Version++

Currently translated at 100.0% (342 of 342 strings)

Translation: GPXSee/Translations
Translate-URL: https://hosted.weblate.org/projects/gpxsee/translations/fr/

.appveyor.yml

@@ -1,4 +1,4 @@
-version: 7.9.{build}
+version: 7.11.{build}
 configuration: Release
 platform: Any CPU
 environment:

gpxsee.pro

@@ -3,7 +3,7 @@ unix:!macx {
 } else {
     TARGET = GPXSee
 }
-VERSION = 7.9
+VERSION = 7.11
 
 QT += core \
     gui \
@@ -180,7 +180,8 @@ HEADERS += src/common/config.h \
     src/map/IMG/netfile.h \
     src/GUI/limitedcombobox.h \
     src/GUI/pathtickitem.h \
-    src/map/IMG/textitem.h
+    src/map/IMG/textitem.h \
+    src/map/IMG/label.h
 SOURCES += src/main.cpp \
     src/common/coordinates.cpp \
     src/common/rectc.cpp \
@@ -318,7 +319,8 @@ greaterThan(QT_MAJOR_VERSION, 4) {
     SOURCES += src/data/geojsonparser.cpp
 }
 
-DEFINES += APP_VERSION=\\\"$$VERSION\\\"
+DEFINES += APP_VERSION=\\\"$$VERSION\\\" \
+    QT_NO_DEPRECATED_WARNINGS
 DEFINES *= QT_USE_QSTRINGBUILDER
 
 RESOURCES += gpxsee.qrc

lang/gpxsee_fr.ts

@@ -1055,7 +1055,7 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="168"/>
         <source>Palette shift:</source>
-        <translation>Décalage de palette :</translation>
+        <translation>Incrément de palette :</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="112"/>

lang/gpxsee_pl.ts

@@ -64,7 +64,7 @@
     <message>
         <location filename="../src/data/data.cpp" line="152"/>
         <source>GeoJSON files</source>
-        <translation type="unfinished"></translation>
+        <translation>Pliki GeoJSON</translation>
     </message>
     <message>
         <location filename="../src/data/data.cpp" line="154"/>
@@ -79,7 +79,7 @@
     <message>
         <location filename="../src/data/data.cpp" line="156"/>
         <source>JPEG images</source>
-        <translation type="unfinished"></translation>
+        <translation>Pliki JPEG</translation>
     </message>
     <message>
         <location filename="../src/data/data.cpp" line="157"/>
@@ -439,7 +439,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="315"/>
         <source>Show cursor coordinates</source>
-        <translation type="unfinished"></translation>
+        <translation>Pokaż współrzędne kursora</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="322"/>
@@ -459,7 +459,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="337"/>
         <source>Show areas</source>
-        <translation type="unfinished"></translation>
+        <translation>Pokaż obszary</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="342"/>
@@ -469,7 +469,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="352"/>
         <source>km/mi markers</source>
-        <translation type="unfinished"></translation>
+        <translation>Znaczniki km/mi</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="359"/>
@@ -489,7 +489,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="393"/>
         <source>Show path markers</source>
-        <translation type="unfinished"></translation>
+        <translation>Pokaż znaczniki ścieżki</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="400"/>
@@ -651,18 +651,18 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="731"/>
         <source>DEM directory:</source>
-        <translation type="unfinished"></translation>
+        <translation>Katalog z danymi DEM:</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="733"/>
         <source>Styles directory:</source>
-        <translation type="unfinished"></translation>
+        <translation>Katalog ze stylami:</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="1037"/>
         <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
-        <translation type="unfinished"></translation>
+        <translation>Obszary</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
@@ -736,7 +736,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="735"/>
         <source>Tile cache directory:</source>
-        <translation type="unfinished"></translation>
+        <translation>Katalog pamięci podręcznej kafelków:</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="1031"/>
@@ -1018,7 +1018,7 @@
     <message>
         <location filename="../src/map/maplist.cpp" line="123"/>
         <source>Garmin IMG maps</source>
-        <translation type="unfinished"></translation>
+        <translation>Mapy Garmin IMG</translation>
     </message>
     <message>
         <location filename="../src/map/maplist.cpp" line="125"/>
@@ -1038,7 +1038,7 @@
     <message>
         <location filename="../src/map/maplist.cpp" line="129"/>
         <source>TwoNav maps</source>
-        <translation type="unfinished"></translation>
+        <translation>Mapy TwoNav</translation>
     </message>
     <message>
         <location filename="../src/map/maplist.cpp" line="130"/>
@@ -1309,18 +1309,18 @@
         <location filename="../src/GUI/optionsdialog.cpp" line="378"/>
         <location filename="../src/GUI/optionsdialog.cpp" line="436"/>
         <source>GPS data</source>
-        <translation type="unfinished"></translation>
+        <translation>Dane GPS</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="379"/>
         <location filename="../src/GUI/optionsdialog.cpp" line="437"/>
         <source>DEM data</source>
-        <translation type="unfinished"></translation>
+        <translation>Dane DEM</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="416"/>
         <source>Elevation</source>
-        <translation type="unfinished">Wysokość</translation>
+        <translation>Wysokość</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="427"/>
@@ -1330,7 +1330,7 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
         <source>Sources</source>
-        <translation type="unfinished"></translation>
+        <translation>Źródła</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
@@ -1340,7 +1340,7 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="462"/>
         <source>Radius:</source>
-        <translation type="unfinished"></translation>
+        <translation>Promień:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
@@ -1350,37 +1350,37 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="72"/>
         <source>Projection:</source>
-        <translation type="unfinished"></translation>
+        <translation>Odwzorowanie:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="94"/>
         <source>Vector maps</source>
-        <translation type="unfinished"></translation>
+        <translation>Mapy wektorowe</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="147"/>
         <source>Area border width:</source>
-        <translation type="unfinished"></translation>
+        <translation>Szerokość granicy obszaru:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="148"/>
         <source>Area border style:</source>
-        <translation type="unfinished"></translation>
+        <translation>Styl obramowania obszaru:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
         <source>Area fill opacity:</source>
-        <translation type="unfinished"></translation>
+        <translation>Nieprzezroczystość wypełnienia obszaru:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
         <source>Fill opacity:</source>
-        <translation type="unfinished"></translation>
+        <translation>Nieprzezroczystość wypełnienia:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
         <source>Areas</source>
-        <translation type="unfinished"></translation>
+        <translation>Obszary</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
@@ -1530,12 +1530,12 @@
     <message>
         <location filename="../src/GUI/areaitem.cpp" line="15"/>
         <source>Name</source>
-        <translation type="unfinished">Nazwa</translation>
+        <translation>Nazwa</translation>
     </message>
     <message>
         <location filename="../src/GUI/areaitem.cpp" line="17"/>
         <source>Description</source>
-        <translation type="unfinished">Opis</translation>
+        <translation>Opis</translation>
     </message>
 </context>
 <context>

pkg/gpxsee.nsi

@@ -7,7 +7,7 @@
 ; The name of the installer
 Name "GPXSee"
 ; Program version
-!define VERSION "7.9"
+!define VERSION "7.11"
 
 ; The file to write
 OutFile "GPXSee-${VERSION}.exe"

pkg/gpxsee64.nsi

@@ -7,7 +7,7 @@
 ; The name of the installer
 Name "GPXSee"
 ; Program version
-!define VERSION "7.9"
+!define VERSION "7.11"
 
 ; The file to write
 OutFile "GPXSee-${VERSION}_x64.exe"

src/GUI/graphview.cpp

@@ -75,8 +75,7 @@ GraphView::~GraphView()
 	delete _grid;
 	delete _message;
 
-	for (int i = 0; i < _graphs.count(); i++)
-		delete _graphs[i];
+	qDeleteAll(_graphs);
 }
 
 void GraphView::createXLabel()
@@ -380,9 +379,7 @@ void GraphView::clear()
 	_slider->clear();
 	_info->clear();
 
-	for (int i = 0; i < _graphs.count(); i++)
-		delete _graphs[i];
-
+	qDeleteAll(_graphs);
 	_graphs.clear();
 	_visible.clear();
 	_palette.reset();

src/GUI/gui.cpp

@@ -885,8 +885,7 @@ void GUI::closePOIFiles()
 {
 	_poiFilesMenu->clear();
 
-	for (int i = 0; i < _poiFilesActions.count(); i++)
-		delete _poiFilesActions[i];
+	qDeleteAll(_poiFilesActions);
 	_poiFilesActions.clear();
 
 	_poi->clear();

src/GUI/pathitem.cpp

@@ -141,6 +141,10 @@ void PathItem::setColor(const QColor &color)
 		return;
 
 	_pen.setColor(color);
+
+	for (int i = 0; i < _ticks.size(); i++)
+		_ticks[i]->setColor(color);
+
 	update();
 }
 
@@ -317,8 +321,7 @@ unsigned PathItem::tickSize() const
 
 void PathItem::updateTicks()
 {
-	for (int i = 0; i < _ticks.size(); i++)
-		delete _ticks[i];
+	qDeleteAll(_ticks);
 	_ticks.clear();
 
 	if (!_showTicks)

src/data/track.cpp

@@ -99,8 +99,11 @@ Track::Track(const TrackData &data) : _data(data), _pause(0)
 			if (sd.at(j).timestamp() >= sd.at(j-1).timestamp())
 				dt = sd.at(j-1).timestamp().msecsTo(
 				  sd.at(j).timestamp()) / 1000.0;
-			else
-				dt = NAN;
+			else {
+				qWarning("%s: %s: time skew detected", qPrintable(_data.name()),
+				  qPrintable(sd.at(j).timestamp().toString(Qt::ISODate)));
+				dt = 0;
+			}
 			seg.time.append(seg.time.last() + dt);
 
 			if (dt < 1e-3) {

src/map/IMG/img.cpp

@@ -5,6 +5,8 @@
 #include "img.h"
 
 
+#define CACHE_SIZE 8388608 /* 8MB */
+
 #define CHECK(condition) \
 	if (!(condition)) { \
 		_errorString = "Invalid/corrupted IMG file"; \
@@ -25,19 +27,8 @@ struct CTX
 	QList<IMG::Point> *points;
 };
 
-#ifndef QT_NO_DEBUG
-static QDebug operator<<(QDebug dbg, const QMap<QString, VectorTile*> &map)
-{
-	dbg.nospace() << "TileMap(";
-	for (QMap<QString, VectorTile*>::const_iterator it = map.constBegin();
-	  it != map.constEnd(); ++it)
-		dbg << "(" << it.key() << ", " << *(*it) << ")";
-	dbg << ")";
-	return dbg.space();
-}
-#endif // QT_NO_DEBUG
-
-IMG::IMG(const QString &fileName) : _file(fileName), _valid(false)
+IMG::IMG(const QString &fileName)
+  : _file(fileName), _typ(0), _style(0), _valid(false)
 {
 	if (!_file.open(QFile::ReadOnly)) {
 		_errorString = _file.errorString();
@@ -62,6 +53,7 @@ IMG::IMG(const QString &fileName) : _file(fileName), _valid(false)
 	QByteArray nba(QByteArray(d1, sizeof(d1)) + QByteArray(d2, sizeof(d2)));
 	_name = QString(nba).trimmed();
 	_blockSize = 1 << (e1 + e2);
+	_blockCache.setMaxCost(CACHE_SIZE / _blockSize);
 
 	// Read the FAT table
 	quint8 flag;
@@ -84,7 +76,7 @@ IMG::IMG(const QString &fileName) : _file(fileName), _valid(false)
 
 
 	QMap<QString, VectorTile*> tileMap;
-	QMap<QString, SubFile*> TYPMap;
+	QString typFile;
 
 	// Read FAT blocks describing the IMG sub-files
 	for (int i = 0; i < cnt; i++) {
@@ -120,20 +112,22 @@ IMG::IMG(const QString &fileName) : _file(fileName), _valid(false)
 				file->addBlock(block);
 			}
 		} else if (tt == SubFile::TYP) {
-			SubFile *typ;
-			QMap<QString, SubFile*>::iterator it = TYPMap.find(fn);
-			if (it == TYPMap.end()) {
-				typ = new SubFile(this, size);
-				TYPMap.insert(fn, typ);
-			} else
-				typ = *it;
+			SubFile *typ = 0;
+			if (typFile.isNull()) {
+				_typ = new SubFile(this, size);
+				typ = _typ;
+				typFile = fn;
+			} else if (fn == typFile)
+				typ = _typ;
 
-			_file.seek(offset + 0x20);
-			for (int i = 0; i < 240; i++) {
-				CHECK(readValue(block));
-				if (block == 0xFFFF)
-					break;
-				typ->addBlock(block);
+			if (typ) {
+				_file.seek(offset + 0x20);
+				for (int i = 0; i < 240; i++) {
+					CHECK(readValue(block));
+					if (block == 0xFFFF)
+						break;
+					typ->addBlock(block);
+				}
 			}
 		}
 
@@ -141,7 +135,6 @@ IMG::IMG(const QString &fileName) : _file(fileName), _valid(false)
 	}
 
 	// Create tile tree
-	QSet<int> bits;
 	for (QMap<QString, VectorTile*>::iterator it = tileMap.begin();
 	  it != tileMap.end(); ++it) {
 		CHECK((*it)->init());
@@ -154,27 +147,6 @@ IMG::IMG(const QString &fileName) : _file(fileName), _valid(false)
 		_tileTree.Insert(min, max, *it);
 
 		_bounds |= (*it)->bounds();
-
-		for (int i = 0; i < (*it)->bits().count(); i++)
-			bits.insert((*it)->bits().at(i));
-	}
-	_bits = bits.toList();
-	qSort(_bits);
-
-	// Read TYP file if any
-	if (!TYPMap.isEmpty()) {
-		if (TYPMap.size() > 1)
-			qWarning("%s: Multiple TYP files, using %s",
-			  qPrintable(_file.fileName()), qPrintable(TYPMap.keys().first()));
-		SubFile *typ = TYPMap.values().first();
-		_style = Style(typ);
-		qDeleteAll(TYPMap);
-	} else {
-		QFile typFile(ProgramPaths::typFile());
-		if (typFile.exists()) {
-			SubFile typ(&typFile);
-			_style = Style(&typ);
-		}
 	}
 
 	_valid = true;
@@ -185,6 +157,37 @@ IMG::~IMG()
 	TileTree::Iterator it;
 	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
 		delete _tileTree.GetAt(it);
+
+	delete _typ;
+	delete _style;
+}
+
+void IMG::load()
+{
+	Q_ASSERT(!_style);
+
+	if (_typ && _typ->isValid())
+		_style = new Style(_typ);
+	else {
+		QFile typFile(ProgramPaths::typFile());
+		if (typFile.exists()) {
+			SubFile typ(&typFile);
+			_style = new Style(&typ);
+		} else
+			_style = new Style();
+	}
+}
+
+void IMG::clear()
+{
+	TileTree::Iterator it;
+	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
+		_tileTree.GetAt(it)->clear();
+
+	delete _style;
+	_style = 0;
+
+	_blockCache.clear();
 }
 
 static bool cb(VectorTile *tile, void *context)
@@ -195,17 +198,9 @@ static bool cb(VectorTile *tile, void *context)
 }
 
 void IMG::objects(const RectC &rect, int bits, QList<Poly> *polygons,
-  QList<Poly> *lines, QList<Point> *points) const
+  QList<Poly> *lines, QList<Point> *points)
 {
-	int mb = _bits.first();
-	for (int i = 0; i < _bits.size(); i++) {
-		if (_bits.at(i) > bits)
-			break;
-		else
-			mb = _bits.at(i);
-	}
-
-	CTX ctx(rect, mb, polygons, lines, points);
+	CTX ctx(rect, bits, polygons, lines, points);
 	double min[2], max[2];
 
 	min[0] = rect.left();

src/map/IMG/img.h

@@ -10,6 +10,7 @@
 #include "common/rectc.h"
 #include "common/range.h"
 #include "style.h"
+#include "label.h"
 
 class VectorTile;
 class SubFile;
@@ -23,7 +24,7 @@ public:
 		   ll2xy() the points in the IMG class as this can not be done in
 		   parallel. */
 		QVector<QPointF> points;
-		QString label;
+		Label label;
 		quint32 type;
 
 		bool operator<(const Poly &other) const
@@ -34,25 +35,29 @@ public:
 		Point() : id(0) {}
 
 		Coordinates coordinates;
-		QString label;
+		Label label;
 		quint32 type;
 		bool poi;
 		quint64 id;
 
 		bool operator<(const Point &other) const
-		  {return id > other.id;}
+		  {return id < other.id;}
 	};
 
 
 	IMG(const QString &fileName);
 	~IMG();
 
+	void load();
+	void clear();
+
+	QString fileName() const {return _file.fileName();}
 	const QString &name() const {return _name;}
 	const RectC &bounds() const {return _bounds;}
-	Range zooms() const {return Range(_bits.first(), _bits.last());}
+
 	void objects(const RectC &rect, int bits, QList<Poly> *polygons,
-	  QList<Poly> *lines, QList<Point> *points) const;
-	const Style &style() const {return _style;}
+	  QList<Poly> *lines, QList<Point> *points);
+	const Style *style() const {return _style;}
 
 	bool isValid() const {return _valid;}
 	const QString &errorString() const {return _errorString;}
@@ -62,23 +67,22 @@ private:
 
 	typedef RTree<VectorTile*, double, 2> TileTree;
 
-	QString fileName() const {return _file.fileName();}
 	int blockSize() const {return _blockSize;}
 	bool readBlock(int blockNum, QByteArray &data);
 	qint64 read(char *data, qint64 maxSize);
 	template<class T> bool readValue(T &val);
+	bool init();
 
 	QFile _file;
 	quint8 _key;
 	int _blockSize;
 	QCache<int, QByteArray> _blockCache;
 
-	TileTree _tileTree;
-
 	QString _name;
 	RectC _bounds;
-	QList<int> _bits;
-	Style _style;
+	TileTree _tileTree;
+	SubFile *_typ;
+	Style *_style;
 
 	bool _valid;
 	QString _errorString;

src/map/IMG/label.h

@@ -0,0 +1,77 @@
+#ifndef LABEL_H
+#define LABEL_H
+
+#include <QString>
+#include <QDebug>
+
+#define FIRST_SHIELD Label::Shield::USInterstate
+#define LAST_SHIELD  Label::Shield::Oval
+
+class Label {
+public:
+	class Shield
+	{
+	public:
+		enum Type {
+			None,
+			USInterstate,
+			USShield,
+			USRound,
+			Hbox,
+			Box,
+			Oval
+		};
+
+		Shield() : _type(None) {}
+		Shield(Type type, const QString &name) : _type(type), _text(name) {}
+
+		Type type() const {return _type;}
+		const QString &text() const {return _text;}
+		bool isValid() const {return _type > None && !_text.isEmpty();}
+
+		bool operator==(const Shield &other) const
+		  {return _type == other._type && _text == other._text;}
+
+	private:
+		Type _type;
+		QString _text;
+	};
+
+	Label() {}
+	Label(const QString &text, const Shield &shield = Shield())
+	  : _text(text), _shield(shield) {}
+
+	const Shield &shield() const {return _shield;}
+	const QString &text() const {return _text;}
+	bool isValid() const {return _shield.isValid() || !_text.isEmpty();}
+
+	void setText(const QString &text) {_text = text;}
+
+private:
+	QString _text;
+	Shield _shield;
+};
+
+inline uint qHash(const Label::Shield &shield)
+{
+	return qHash(shield.text()) ^ shield.type();
+}
+
+#ifndef QT_NO_DEBUG
+inline QDebug operator<<(QDebug dbg, const Label::Shield &shield)
+{
+	dbg.nospace() << "Shield(" << shield.type() << ", " << shield.text() << ")";
+	return dbg.space();
+}
+
+inline QDebug operator<<(QDebug dbg, const Label &label)
+{
+	dbg.nospace() << "Label(";
+	if (label.shield().isValid())
+		dbg << label.shield() << ", ";
+	dbg << label.text() << ")";
+	return dbg.space();
+}
+#endif // QT_NO_DEBUG
+
+#endif // LABEL_H

src/map/IMG/lblfile.cpp

@@ -7,7 +7,7 @@ static quint8 NORMAL_CHARS[] = {
 	' ', 'A', 'B', 'C', 'D', 'E', 'F', 'G',
 	'H', 'I', 'J', 'K', 'L', 'M', 'N', 'O',
 	'P', 'Q', 'R', 'S', 'T', 'U', 'V', 'W',
-	'X', 'Y', 'Z',  '~', '~', '~', '~', '~',
+	'X', 'Y', 'Z',  '~', '~', '~', ' ', ' ',
 	'0', '1', '2', '3', '4', '5', '6', '7',
 	'8', '9', '~', '~', '~', '~', '~', '~'
 };
@@ -48,6 +48,7 @@ static QString capitalize(const QString &str)
 	return ret;
 }
 
+
 bool LBLFile::init()
 {
 	Handle hdl;
@@ -73,45 +74,49 @@ bool LBLFile::init()
 	return true;
 }
 
-QString LBLFile::label6b(Handle &hdl, quint32 offset) const
+Label LBLFile::label6b(Handle &hdl, quint32 offset) const
 {
-	QByteArray result;
+	Label::Shield::Type shieldType = Label::Shield::None;
+	QByteArray label, shieldLabel;
+	QByteArray *bap = &label;
 	Charset curCharSet = Normal;
 	quint8 b1, b2, b3;
 
 	if (!seek(hdl, offset))
-		return QString();
+		return Label();
 
 	while (true) {
 		if (!(readByte(hdl, b1) && readByte(hdl, b2) && readByte(hdl, b3)))
-			return QString();
+			return Label();
 
 		int c[]= {b1>>2, (b1&0x3)<<4|b2>>4, (b2&0xF)<<2|b3>>6, b3&0x3F};
 
 		for (int cpt = 0; cpt < 4; cpt++) {
-			if (c[cpt] > 0x2F)
-				return QString::fromLatin1(result);
+			if (c[cpt] > 0x2f || (curCharSet == Normal && c[cpt] == 0x1d))
+				return Label(capitalize(QString::fromLatin1(label)),
+				  Label::Shield(shieldType, shieldLabel));
 			switch (curCharSet) {
 				case Normal:
 					if (c[cpt] == 0x1c)
 						curCharSet = Symbol;
 					else if (c[cpt] == 0x1b)
 						curCharSet = Special;
-					else if(c[cpt] == 0x1d)
-						result.append('|');
-					else if (c[cpt] == 0x1f)
-						result.append(' ');
-					else if (c[cpt] == 0x1e)
-						result.append(' ');
+					else if (c[cpt] >= 0x2a && c[cpt] <= 0x2f) {
+						shieldType = static_cast<Label::Shield::Type>
+						  (c[cpt] - 0x29);
+						bap = &shieldLabel;
+					} else if (bap == &shieldLabel
+					  && NORMAL_CHARS[c[cpt]] == ' ')
+						bap = &label;
 					else
-						result.append(NORMAL_CHARS[c[cpt]]);
+						bap->append(NORMAL_CHARS[c[cpt]]);
 					break;
 				case Symbol:
-					result.append(SYMBOL_CHARS[c[cpt]]);
+					bap->append(SYMBOL_CHARS[c[cpt]]);
 					curCharSet = Normal;
 					break;
 				case Special:
-					result.append(SPECIAL_CHARS[c[cpt]]);
+					bap->append(SPECIAL_CHARS[c[cpt]]);
 					curCharSet = Normal;
 					break;
 			}
@@ -119,40 +124,51 @@ QString LBLFile::label6b(Handle &hdl, quint32 offset) const
 	}
 }
 
-QString LBLFile::label8b(Handle &hdl, quint32 offset) const
+Label LBLFile::label8b(Handle &hdl, quint32 offset) const
 {
-	QByteArray result;
+	Label::Shield::Type shieldType = Label::Shield::None;
+	QByteArray label, shieldLabel;
+	QByteArray *bap = &label;
 	quint8 c;
 
 	if (!seek(hdl, offset))
-		return QString();
+		return Label();
 
 	while (true) {
 		if (!readByte(hdl, c))
-			return QString();
-		if (!c)
+			return Label();
+		if (!c || c == 0x1d)
 			break;
 
-		if (c >= 0x1B && c <= 0x1F)
-			result.append(' ');
-		else if (c > 0x07)
-			result.append(c);
+		if ((c >= 0x1e && c <= 0x1f)) {
+			if (bap == &shieldLabel)
+				bap = &label;
+			else
+				bap->append(' ');
+		} else if (c <= 0x07) {
+			shieldType = static_cast<Label::Shield::Type>(c);
+			bap = &shieldLabel;
+		} else if (bap == &shieldLabel && QChar(c).isSpace()) {
+			bap = &label;
+		} else
+			bap->append(c);
 	}
 
-	return _codec ? _codec->toUnicode(result) : QString::fromLatin1(result);
+	return Label(capitalize(_codec ? _codec->toUnicode(label)
+	  : QString::fromLatin1(label)), Label::Shield(shieldType, _codec
+	  ? _codec->toUnicode(shieldLabel) : QString::fromLatin1(shieldLabel)));
 }
 
-QString LBLFile::label(Handle &hdl, quint32 offset, bool poi)
+Label LBLFile::label(Handle &hdl, quint32 offset, bool poi)
 {
-	if (!_init) {
-		if (!(_init = init()))
-			return QString();
-	}
+	if (!_size && !init())
+		return QString();
 
 	quint32 labelOffset;
 	if (poi) {
 		quint32 poiOffset;
-		if (!(seek(hdl, _poiOffset + offset) && readUInt24(hdl, poiOffset)))
+		if (!(seek(hdl, _poiOffset + offset) && readUInt24(hdl, poiOffset)
+		  && (poiOffset & 0x3FFFFF)))
 			return QString();
 		labelOffset = _offset + (poiOffset & 0x3FFFFF) * _multiplier;
 	} else
@@ -163,11 +179,11 @@ QString LBLFile::label(Handle &hdl, quint32 offset, bool poi)
 
 	switch (_encoding) {
 		case 6:
-			return capitalize(label6b(hdl, labelOffset));
+			return label6b(hdl, labelOffset);
 		case 9:
 		case 10:
-			return capitalize(label8b(hdl, labelOffset));
+			return label8b(hdl, labelOffset);
 		default:
-			return QString();
+			return Label();
 	}
 }

src/map/IMG/lblfile.h

@@ -2,21 +2,24 @@
 #define LBLFILE_H
 
 #include "subfile.h"
+#include "label.h"
 
 class QTextCodec;
 
 class LBLFile : public SubFile
 {
 public:
-	LBLFile(IMG *img, quint32 size) : SubFile(img, size), _init(false) {}
+	LBLFile(IMG *img, quint32 size)
+	  : SubFile(img, size), _offset(0), _size(0), _poiOffset(0), _poiSize(0),
+	  _multiplier(0), _encoding(0), _codec(0) {}
 
-	QString label(Handle &hdl, quint32 offset, bool poi = false);
+	Label label(Handle &hdl, quint32 offset, bool poi = false);
 
 private:
 	bool init();
 
-	QString label6b(Handle &hdl, quint32 offset) const;
-	QString label8b(Handle &hdl, quint32 offset) const;
+	Label label6b(Handle &hdl, quint32 offset) const;
+	Label label8b(Handle &hdl, quint32 offset) const;
 
 	quint32 _offset;
 	quint32 _size;
@@ -25,8 +28,6 @@ private:
 	quint8 _multiplier;
 	quint8 _encoding;
 	QTextCodec *_codec;
-
-	bool _init;
 };
 
 #endif // LBLFILE_H

src/map/IMG/rgnfile.cpp

@@ -205,7 +205,8 @@ bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 		if (lbl && (labelPtr & 0x3FFFFF)) {
 			if (labelPtr & 0x800000) {
 				quint32 lblOff;
-				if (net && net->lblOffset(netHdl, labelPtr & 0x3FFFFF, lblOff))
+				if (net && net->lblOffset(netHdl, labelPtr & 0x3FFFFF, lblOff)
+				  && lblOff)
 					poly.label = lbl->label(lblHdl, lblOff);
 			} else
 				poly.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF);
@@ -289,7 +290,7 @@ bool RGNFile::extPolyObjects(const RectC &rect, Handle &hdl,
 		if (subtype & 0x20) {
 			if (!readUInt24(hdl, labelPtr))
 				return false;
-			if (lbl)
+			if (lbl && (labelPtr & 0x3FFFFF))
 				poly.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF);
 		}
 
@@ -403,10 +404,8 @@ void RGNFile::objects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
 {
 	Handle rgnHdl, lblHdl, netHdl;
 
-	if (!_init) {
-		if (!(_init = init()))
-			return;
-	}
+	if (!_size && !init())
+		return;
 
 	QVector<RGNFile::Segment> seg(segments(rgnHdl, subdiv));
 	for (int i = 0; i < seg.size(); i++) {
@@ -437,10 +436,8 @@ void RGNFile::extObjects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
 {
 	Handle rgnHdl, lblHdl;
 
-	if (!_init) {
-		if (!(_init = init()))
-			return;
-	}
+	if (!_size && !init())
+		return;
 
 	if (polygons && subdiv->polygonsOffset() != subdiv->polygonsEnd()) {
 		quint32 start = _polygonsOffset + subdiv->polygonsOffset();
@@ -462,7 +459,7 @@ void RGNFile::extObjects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
 		quint32 start = _pointsOffset + subdiv->pointsOffset();
 		quint32 end = subdiv->pointsEnd()
 		  ? _pointsOffset + subdiv->pointsEnd()
-		  : _pointsOffset + _linesSize;
+		  : _pointsOffset + _pointsSize;
 		extPointObjects(rect, rgnHdl, subdiv, Segment(start, end,
 		  Segment::Point), lbl, lblHdl, points);
 	}

src/map/IMG/rgnfile.h

@@ -11,7 +11,10 @@ class NETFile;
 class RGNFile : public SubFile
 {
 public:
-	RGNFile(IMG *img, quint32 size) : SubFile(img, size), _init(false) {}
+	RGNFile(IMG *img, quint32 size)
+	  : SubFile(img, size), _offset(0), _size(0), _polygonsOffset(0),
+	  _polygonsSize(), _linesOffset(), _linesSize(), _pointsOffset(),
+	  _pointsSize() {}
 
 	void objects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
 	  NETFile *net, QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
@@ -96,8 +99,6 @@ private:
 	quint32 _linesSize;
 	quint32 _pointsOffset;
 	quint32 _pointsSize;
-
-	bool _init;
 };
 
 #ifndef QT_NO_DEBUG

src/map/IMG/style.cpp

@@ -148,8 +148,14 @@ void Style::defaultLineStyle()
 	_lines[TYPE(0x29)].setTextFontSize(Style::None);
 }
 
-void Style::defaultPOIStyle()
+void Style::defaultPointStyle()
 {
+	// Cities
+	_points[TYPE(0x01)].setTextFontSize(Style::Large);
+	_points[TYPE(0x02)].setTextFontSize(Style::Large);
+	_points[TYPE(0x03)].setTextFontSize(Style::Large);
+
+	// POI
 	_points[0x2a00] = Point(QImage(":/restaurant-11.png"));
 	_points[0x2a01] = Point(QImage(":/restaurant-11.png"));
 	_points[0x2a02] = Point(QImage(":/restaurant-noodle-11.png"));
@@ -380,6 +386,9 @@ bool Style::itemInfo(SubFile *file, SubFile::Handle &hdl,
 bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
   const Section &section)
 {
+	if (!section.arrayItemSize)
+		return section.arraySize ? false : true;
+
 	for (quint32 i = 0; i < section.arraySize / section.arrayItemSize; i++) {
 		if (!file->seek(hdl, section.arrayOffset + i * section.arrayItemSize))
 			return false;
@@ -493,6 +502,9 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
   const Section &section)
 {
+	if (!section.arrayItemSize)
+		return section.arraySize ? false : true;
+
 	for (quint32 i = 0; i < section.arraySize / section.arrayItemSize; i++) {
 		if (!file->seek(hdl, section.arrayOffset + i * section.arrayItemSize))
 			return false;
@@ -774,6 +786,9 @@ static bool readColorTable(SubFile *file, SubFile::Handle &hdl, QImage& img,
 bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
   const Section &section)
 {
+	if (!section.arrayItemSize)
+		return section.arraySize ? false : true;
+
 	for (quint32 i = 0; i < section.arraySize / section.arrayItemSize; i++) {
 		if (!file->seek(hdl, section.arrayOffset + i * section.arrayItemSize))
 			return false;
@@ -849,6 +864,9 @@ bool Style::parseDrawOrder(SubFile *file, SubFile::Handle &hdl,
 {
 	QList<quint32> drawOrder;
 
+	if (!order.arrayItemSize)
+		return order.arraySize ? false : true;
+
 	if (!file->seek(hdl, order.arrayOffset))
 		return false;
 
@@ -922,7 +940,7 @@ Style::Style(SubFile *typ)
 {
 	defaultLineStyle();
 	defaultPolygonStyle();
-	defaultPOIStyle();
+	defaultPointStyle();
 
 	if (typ && typ->isValid())
 		parseTYPFile(typ);
@@ -965,7 +983,12 @@ bool Style::isSpot(quint32 type)
 
 bool Style::isSummit(quint32 type)
 {
-	return  (type == 0x6616);
+	return (type == 0x6616);
+}
+
+bool Style::isMajorRoad(quint32 type)
+{
+	return (type <= TYPE(0x04));
 }
 
 Style::POIClass Style::poiClass(quint32 type)

src/map/IMG/style.h

@@ -106,6 +106,7 @@ public:
 	static bool isContourLine(quint32 type);
 	static bool isSpot(quint32 type);
 	static bool isSummit(quint32 type);
+	static bool isMajorRoad(quint32 type);
 	static POIClass poiClass(quint32 type);
 
 private:
@@ -137,7 +138,7 @@ private:
 	  const Section &section, ItemInfo &info);
 	void defaultPolygonStyle();
 	void defaultLineStyle();
-	void defaultPOIStyle();
+	void defaultPointStyle();
 
 	QMap<quint32, Line> _lines;
 	QMap<quint32, Polygon> _polygons;

src/map/IMG/textpointitem.cpp

@@ -7,29 +7,48 @@
 
 #define FLAGS (Qt::AlignCenter | Qt::TextWordWrap | Qt::TextDontClip)
 #define MAX_TEXT_WIDTH 8
+#define MIN_BOX_WIDTH 2
+
+
+static void expand(QRect &rect, int width)
+{
+	rect.adjust(-(width/2 - rect.width()/2), 0, width/2 - rect.width()/2, 0);
+}
 
 TextPointItem::TextPointItem(const QPoint &point, const QString *text,
-  const QFont *font, const QImage *img, const QColor *color)
-  : _text(text), _font(font), _img(img), _color(color)
+  const QFont *font, const QImage *img, const QColor *color,
+  const QColor *bgColor) : _text(font ? text : 0), _font(font), _img(img),
+  _color(color), _bgColor(bgColor)
 {
+	if (_text) {
+		QFontMetrics fm(*_font);
+		int limit = _font->pixelSize() * MAX_TEXT_WIDTH;
+		_textRect = fm.boundingRect(QRect(0, 0, limit, 0), FLAGS, *_text);
+		_textRect.adjust(0, 0, 1, 1);
+
+		if (_bgColor && _textRect.width() < _font->pixelSize() * MIN_BOX_WIDTH)
+			expand(_textRect, _font->pixelSize() * MIN_BOX_WIDTH);
+	}
+
+	setPos(point);
+}
+
+void TextPointItem::setPos(const QPoint &point)
+{
+	QPainterPath shape;
 	QRect iconRect;
 
-	if (text) {
-		QFontMetrics fm(*font);
-		int limit = font->pixelSize() * MAX_TEXT_WIDTH;
-		_textRect = fm.boundingRect(QRect(0, 0, limit, 0), FLAGS, *text);
-		_textRect.adjust(0, 0, 1, 1);
-	}
-	if (img) {
-		iconRect = QRect(QPoint(point.x() - img->width()/2, point.y()
-		  - img->height()/2), img->size());
-		_textRect.moveTopLeft(QPoint(point.x() + img->width(), point.y()
+	if (_img) {
+		iconRect = QRect(QPoint(point.x() - _img->width()/2, point.y()
+		  - _img->height()/2), _img->size());
+		_textRect.moveTopLeft(QPoint(point.x() + _img->width(), point.y()
 		  - _textRect.height()/2));
 	} else
 		_textRect.moveCenter(point);
 
 	_rect = _textRect | iconRect;
-	_shape.addRect(_rect);
+	shape.addRect(_rect);
+	_shape = shape;
 }
 
 void TextPointItem::paint(QPainter *painter) const
@@ -39,34 +58,44 @@ void TextPointItem::paint(QPainter *painter) const
 		  - _img->height()/2), *_img);
 
 	if (_text) {
-		QImage img(_textRect.size(), QImage::Format_ARGB32_Premultiplied);
-		img.fill(Qt::transparent);
-		QPainter ip(&img);
-		ip.setPen(Qt::white);
-		ip.setFont(*_font);
-		ip.drawText(img.rect(), FLAGS, *_text);
-
-		painter->drawImage(_textRect.x() - 1, _textRect.y() - 1, img);
-		painter->drawImage(_textRect.x() + 1, _textRect.y() + 1, img);
-		painter->drawImage(_textRect.x() - 1, _textRect.y() + 1, img);
-		painter->drawImage(_textRect.x(), _textRect.y() - 1, img);
-		painter->drawImage(_textRect.x(), _textRect.y() + 1, img);
-		painter->drawImage(_textRect.x() - 1, _textRect.y(), img);
-		painter->drawImage(_textRect.x() + 1, _textRect.y(), img);
-
-		if (_color) {
-			painter->setFont(*_font);
+		if (_bgColor) {
 			painter->setPen(*_color);
+			painter->setBrush(*_bgColor);
+			painter->drawRect(_textRect);
+			painter->setBrush(Qt::NoBrush);
+			painter->setFont(*_font);
 			painter->drawText(_textRect, FLAGS, *_text);
 		} else {
+			QImage img(_textRect.size(), QImage::Format_ARGB32_Premultiplied);
+			img.fill(Qt::transparent);
+			QPainter ip(&img);
+			ip.setPen(Qt::white);
+			ip.setFont(*_font);
+			ip.drawText(img.rect(), FLAGS, *_text);
+
+			painter->drawImage(_textRect.x() - 1, _textRect.y() - 1, img);
+			painter->drawImage(_textRect.x() + 1, _textRect.y() + 1, img);
+			painter->drawImage(_textRect.x() - 1, _textRect.y() + 1, img);
+			painter->drawImage(_textRect.x() + 1, _textRect.y() - 1, img);
+			painter->drawImage(_textRect.x(), _textRect.y() - 1, img);
+			painter->drawImage(_textRect.x(), _textRect.y() + 1, img);
+			painter->drawImage(_textRect.x() - 1, _textRect.y(), img);
+			painter->drawImage(_textRect.x() + 1, _textRect.y(), img);
+
+			if (_color) {
+				painter->setFont(*_font);
+				painter->setPen(*_color);
+				painter->drawText(_textRect, FLAGS, *_text);
+			} else {
 #if QT_VERSION >= QT_VERSION_CHECK(5, 4, 0)
-			img.invertPixels();
-			painter->drawImage(_textRect, img);
+				img.invertPixels();
+				painter->drawImage(_textRect, img);
 #else // QT >= 5.4
-			QImage iimg(img.convertToFormat(QImage::Format_ARGB32));
-			iimg.invertPixels();
-			painter->drawImage(_textRect, iimg);
+				QImage iimg(img.convertToFormat(QImage::Format_ARGB32));
+				iimg.invertPixels();
+				painter->drawImage(_textRect, iimg);
 #endif // QT >= 5.4
+			}
 		}
 	}
 

src/map/IMG/textpointitem.h

@@ -16,7 +16,7 @@ class TextPointItem : public TextItem
 public:
 	TextPointItem() : _text(0), _font(0), _img(0) {}
 	TextPointItem(const QPoint &point, const QString *text, const QFont *font,
-	  const QImage *img, const QColor *color);
+	  const QImage *img, const QColor *color, const QColor *bgColor = 0);
 
 	bool isValid() const {return !_rect.isEmpty();}
 
@@ -24,11 +24,13 @@ public:
 	QPainterPath shape() const {return _shape;}
 	void paint(QPainter *painter) const;
 
+	void setPos(const QPoint &point);
+
 private:
 	const QString *_text;
 	const QFont *_font;
 	const QImage *_img;
-	const QColor *_color;
+	const QColor *_color, *_bgColor;
 	QRect _rect, _textRect;
 	QPainterPath _shape;
 };

src/map/IMG/trefile.cpp

@@ -3,22 +3,6 @@
 #include "trefile.h"
 
 
-struct MapLevel {
-	quint8 level;
-	quint8 bits;
-	quint16 subdivs;
-};
-
-#ifndef QT_NO_DEBUG
-static QDebug operator<<(QDebug dbg, const MapLevel &ml)
-{
-	bool inherited = ml.level & 0x80 ? true : false;
-	dbg.nospace() << "MapLevel(" << (ml.level & 0x7F) << ", " << inherited
-	  << ", " << ml.bits << ", " << ml.subdivs << ")";
-	return dbg.space();
-}
-#endif // QT_NO_DEBUG
-
 static void unlock(quint8 *dst, const quint8 *src, quint32 size, quint32 key)
 {
 	static const unsigned char shuf[] = {
@@ -50,18 +34,7 @@ static void unlock(quint8 *dst, const quint8 *src, quint32 size, quint32 key)
 
 TREFile::~TREFile()
 {
-	SubDivTree::Iterator jt;
-
-	for (QMap<int, SubDivTree*>::iterator it = _subdivs.begin();
-	  it != _subdivs.end(); ++it) {
-		SubDivTree *tree = *it;
-		for (tree->GetFirst(jt); !tree->IsNull(jt); tree->GetNext(jt))
-			delete tree->GetAt(jt);
-	}
-
-	for (QMap<int, SubDivTree*>::iterator it = _subdivs.begin();
-	  it != _subdivs.end(); ++it)
-		delete *it;
+	clear();
 }
 
 bool TREFile::init()
@@ -70,7 +43,7 @@ bool TREFile::init()
 	quint8 locked;
 	quint16 hdrLen;
 
-	if (!(isValid() && seek(hdl, 0) && readUInt16(hdl, hdrLen)
+	if (!(seek(hdl, 0) && readUInt16(hdl, hdrLen)
 	  && seek(hdl, 0x0D) && readByte(hdl, locked)))
 		return false;
 
@@ -82,16 +55,18 @@ bool TREFile::init()
 	_bounds = RectC(Coordinates(toWGS84(west), toWGS84(north)),
 	  Coordinates(toWGS84(east), toWGS84(south)));
 
-	quint32 levelsOffset, levelsSize, subdivOffset, subdivSize;
-	if (!(readUInt32(hdl, levelsOffset) && readUInt32(hdl, levelsSize)
-	  && readUInt32(hdl, subdivOffset) && readUInt32(hdl, subdivSize)))
+	// Levels & subdivs info
+	quint32 levelsOffset, levelsSize, subdivSize;
+	if (!(seek(hdl, 0x21) && readUInt32(hdl, levelsOffset)
+	  && readUInt32(hdl, levelsSize) && readUInt32(hdl, _subdivOffset)
+	  && readUInt32(hdl, subdivSize)))
 		return false;
 
-	quint32 extOffset, extSize = 0;
-	quint16 extItemSize = 0;
+	// TRE7 info
 	if (hdrLen > 0x9A) {
-		if (!(seek(hdl, 0x7C) && readUInt32(hdl, extOffset)
-		  && readUInt32(hdl, extSize) && readUInt16(hdl, extItemSize)))
+		if (!(seek(hdl, 0x7C) && readUInt32(hdl, _extended.offset)
+		  && readUInt32(hdl, _extended.size)
+		  && readUInt16(hdl, _extended.itemSize)))
 			return false;
 	}
 
@@ -112,94 +87,166 @@ bool TREFile::init()
 	}
 
 	quint32 levelsCount = levelsSize / 4;
-	QVector<MapLevel> ml(levelsCount);
-	QMap<int, int> level2bits;
+	_levels = QVector<MapLevel>(levelsCount);
 
 	for (quint32 i = 0; i < levelsCount; i++) {
 		quint8 *zoom = levels + (i * 4);
-		ml[i].level = *zoom;
-		ml[i].bits = *(zoom + 1);
-		ml[i].subdivs = *(zoom + 2) | (quint16)(*(zoom + 3)) << 8;
-		if ((ml[i].level & 0xF) > 15 || ml[i].bits > 24)
+		_levels[i].level = *zoom;
+		_levels[i].bits = *(zoom + 1);
+		_levels[i].subdivs = *(zoom + 2) | (quint16)(*(zoom + 3)) << 8;
+		if (_levels[i].bits > 24 || !_levels[i].subdivs)
 			return false;
-
-		level2bits.insert(ml[i].level & 0xF, ml[i].bits);
 	}
 
-	// Subdivisions
-	if (!seek(hdl, subdivOffset))
-		return false;
-	SubDiv *s = 0;
-	QList<SubDiv*> sl;
-
-	for (int i = 0; i < ml.size(); i++) {
-		if (!(ml.at(i).level & 0x80))
-			_subdivs.insert(ml.at(i).bits, new SubDivTree());
-
-		for (int j = 0; j < ml.at(i).subdivs; j++) {
-			quint32 offset;
-			qint32 lon, lat;
-			quint8 objects;
-			quint16 width, height, nextLevel;
-
-			if (!(readUInt24(hdl, offset) && readByte(hdl, objects)
-			  && readInt24(hdl, lon) && readInt24(hdl, lat)
-			  && readUInt16(hdl, width) && readUInt16(hdl, height)))
-				return false;
-			if (i != (int)levelsCount - 1)
-				if (!readUInt16(hdl, nextLevel))
-					return false;
-
-			if (s)
-				s->setEnd(offset);
-
-			if (ml.at(i).level & 0x80) {
-				sl.append(0);
-				s = 0;
-				continue;
-			}
-
-			width &= 0x7FFF;
-			width <<= (24 - ml.at(i).bits);
-			height <<= (24 - ml.at(i).bits);
-
-			s = new SubDiv(offset, lon, lat, ml.at(i).bits, objects);
-			sl.append(s);
-
-			double min[2], max[2];
-			RectC bounds(Coordinates(toWGS84(lon - width),
-			  toWGS84(lat + height + 1)), Coordinates(toWGS84(lon + width + 1),
-			  toWGS84(lat - height)));
-
-			min[0] = bounds.left();
-			min[1] = bounds.bottom();
-			max[0] = bounds.right();
-			max[1] = bounds.top();
-			_subdivs[ml.at(i).bits]->Insert(min, max, s);
+	// Get first non-inherited level
+	_firstLevel = -1;
+	for (int i = 0; i < _levels.size(); i++) {
+		if (!(_levels.at(i).level & 0x80)) {
+			_firstLevel = i;
+			break;
 		}
 	}
 
-	// objects with extended types (TRE7)
-	if (extSize && extItemSize >= 12
-	  && (sl.size() - (int)(extSize/extItemSize) + 1 >= 0)) {
-		quint32 polygons, lines, points;
-		if (!seek(hdl, extOffset))
-			return false;
+	return (_firstLevel >= 0);
+}
 
-		for (int i = sl.size() - (extSize/extItemSize) + 1; i < sl.size(); i++) {
+bool TREFile::load(int idx)
+{
+	Handle hdl;
+	QList<SubDiv*> sl;
+	SubDiv *s = 0;
+	SubDivTree *tree = new SubDivTree();
+
+
+	_subdivs.insert(_levels.at(idx).bits, tree);
+
+	quint32 skip = 0;
+	for (int i = 0; i < idx; i++)
+		skip += _levels.at(i).subdivs;
+
+	if (!seek(hdl, _subdivOffset + skip * 16))
+		return false;
+
+	for (int j = 0; j < _levels.at(idx).subdivs; j++) {
+		quint32 offset;
+		qint32 lon, lat;
+		quint8 objects;
+		quint16 width, height, nextLevel;
+
+		if (!(readUInt24(hdl, offset) && readByte(hdl, objects)
+		  && readInt24(hdl, lon) && readInt24(hdl, lat)
+		  && readUInt16(hdl, width) && readUInt16(hdl, height)))
+			goto error;
+		if (idx != _levels.size() - 1)
+			if (!readUInt16(hdl, nextLevel))
+				goto error;
+
+		if (s)
+			s->setEnd(offset);
+
+		width &= 0x7FFF;
+		width <<= (24 - _levels.at(idx).bits);
+		height <<= (24 - _levels.at(idx).bits);
+
+		s = new SubDiv(offset, lon, lat, _levels.at(idx).bits, objects);
+		sl.append(s);
+
+		double min[2], max[2];
+		RectC bounds(Coordinates(toWGS84(lon - width),
+		  toWGS84(lat + height + 1)), Coordinates(toWGS84(lon + width + 1),
+		  toWGS84(lat - height)));
+
+		min[0] = bounds.left();
+		min[1] = bounds.bottom();
+		max[0] = bounds.right();
+		max[1] = bounds.top();
+
+		tree->Insert(min, max, s);
+	}
+
+	if (idx != _levels.size() - 1) {
+		quint32 offset;
+		if (!readUInt24(hdl, offset))
+			goto error;
+		s->setEnd(offset);
+	}
+
+
+	// Objects with extended types (TRE7)
+	if (_extended.size && _extended.itemSize >= 12) {
+		/* Some maps skip entries for the inherited levels, some don't. Our
+		   decision is based on the difference between the extended subdivs
+		   count and the total subdivs count. */
+		quint32 totalSubdivs = 0;
+		for (int i = 0; i < _levels.size(); i++)
+			totalSubdivs += _levels.at(i).subdivs;
+		quint32 extendedSubdivs = _extended.size / _extended.itemSize;
+		quint32 diff = totalSubdivs - extendedSubdivs + 1;
+
+		quint32 polygons, lines, points;
+		if (!seek(hdl, _extended.offset + (skip - diff) * _extended.itemSize))
+			goto error;
+
+		for (int i = 0; i < sl.size(); i++) {
 			if (!(readUInt32(hdl, polygons) && readUInt32(hdl, lines)
 			  && readUInt32(hdl, points)))
-				return false;
-			if (!seek(hdl, hdl.pos + extItemSize - 12))
-				return false;
-			if (i && sl.at(i-1))
+				goto error;
+
+			sl.at(i)->setExtOffsets(polygons, lines, points);
+			if (i)
 				sl.at(i-1)->setExtEnds(polygons, lines, points);
-			if (sl.at(i))
-				sl.at(i)->setExtOffsets(polygons, lines, points);
+
+			if (!seek(hdl, hdl.pos + _extended.itemSize - 12))
+				goto error;
+		}
+
+		if (idx != _levels.size() - 1) {
+			if (!(readUInt32(hdl, polygons) && readUInt32(hdl, lines)
+			  && readUInt32(hdl, points)))
+				goto error;
+			sl.last()->setExtEnds(polygons, lines, points);
 		}
 	}
 
 	return true;
+
+error:
+	qDeleteAll(sl);
+	tree->RemoveAll();
+
+	return false;
+}
+
+void TREFile::clear()
+{
+	SubDivTree::Iterator jt;
+
+	for (QMap<int, SubDivTree*>::iterator it = _subdivs.begin();
+	  it != _subdivs.end(); ++it) {
+		SubDivTree *tree = *it;
+		for (tree->GetFirst(jt); !tree->IsNull(jt); tree->GetNext(jt))
+			delete tree->GetAt(jt);
+	}
+
+	qDeleteAll(_subdivs);
+
+	_subdivs.clear();
+}
+
+int TREFile::level(int bits)
+{
+	int idx = _firstLevel;
+
+	for (int i = idx + 1; i < _levels.size(); i++) {
+		if (_levels.at(i).bits > bits)
+			break;
+		idx++;
+	}
+
+	if (!_subdivs.contains(_levels.at(idx).bits) && !load(idx))
+		return -1;
+
+	return _levels.at(idx).bits;
 }
 
 static bool cb(SubDiv *subdiv, void *context)
@@ -209,9 +256,10 @@ static bool cb(SubDiv *subdiv, void *context)
 	return true;
 }
 
-QList<SubDiv*> TREFile::subdivs(const RectC &rect, int bits) const
+QList<SubDiv*> TREFile::subdivs(const RectC &rect, int bits)
 {
 	QList<SubDiv*> list;
+	SubDivTree *tree = _subdivs.value(level(bits));
 	double min[2], max[2];
 
 	min[0] = rect.left();
@@ -219,7 +267,17 @@ QList<SubDiv*> TREFile::subdivs(const RectC &rect, int bits) const
 	max[0] = rect.right();
 	max[1] = rect.top();
 
-	_subdivs.value(bits)->Search(min, max, cb, &list);
+	if (tree)
+		tree->Search(min, max, cb, &list);
 
 	return list;
 }
+
+#ifndef QT_NO_DEBUG
+QDebug operator<<(QDebug dbg, const TREFile::MapLevel &level)
+{
+	dbg.nospace() << "MapLevel(" << level.level << ", " << level.bits << ", "
+	  << level.subdivs << ")";
+	return dbg.space();
+}
+#endif // QT_NO_DEBUG

src/map/IMG/trefile.h

@@ -17,21 +17,45 @@ public:
 	~TREFile();
 
 	bool init();
+	void clear();
 
 	const RectC &bounds() const {return _bounds;}
-	const QList<int> bits() const {return _subdivs.keys();}
-
-	QList<SubDiv*> subdivs(const RectC &rect, int bits) const;
+	QList<SubDiv*> subdivs(const RectC &rect, int bits);
 
 private:
+	struct MapLevel {
+		quint8 level;
+		quint8 bits;
+		quint16 subdivs;
+	};
+	struct Extended {
+		quint32 offset;
+		quint32 size;
+		quint16 itemSize;
+
+		Extended() : offset(0), size(0), itemSize(0) {}
+	};
 	typedef RTree<SubDiv*, double, 2> SubDivTree;
 
+	bool load(int idx);
+	int level(int bits);
 	bool parsePoly(Handle hdl, quint32 pos, const QMap<int, int> &level2bits,
 	  QMap<quint32, int> &map);
 	bool parsePoints(Handle hdl, quint32 pos, const QMap<int, int> &level2bits);
 
+	friend QDebug operator<<(QDebug dbg, const MapLevel &level);
+
 	RectC _bounds;
+	QVector<MapLevel> _levels;
+	quint32 _subdivOffset;
+	Extended _extended;
+	int _firstLevel;
+
 	QMap<int, SubDivTree*> _subdivs;
 };
 
+#ifndef QT_NO_DEBUG
+QDebug operator<<(QDebug dbg, const TREFile::MapLevel &level);
+#endif // QT_NO_DEBUG
+
 #endif // TREFILE_H

src/map/IMG/vectortile.cpp

@@ -38,7 +38,8 @@ SubFile *VectorTile::addFile(IMG *img, SubFile::Type type, quint32 size)
 
 bool VectorTile::init()
 {
-	if (!(_tre && _tre->init() && _rgn && _rgn->isValid()))
+	if (!(_tre && _tre->isValid() && _tre->init() && _rgn
+	  && _rgn->isValid()))
 		return false;
 	if (_lbl && !_lbl->isValid())
 		return false;

src/map/IMG/vectortile.h

@@ -14,9 +14,9 @@ public:
 	~VectorTile() {delete _tre; delete _rgn; delete _lbl; delete _net;}
 
 	bool init();
+	void clear() {_tre->clear();}
 
 	const RectC &bounds() const {return _tre->bounds();}
-	const QList<int> bits() const {return _tre->bits();}
 
 	SubFile *file(SubFile::Type type);
 	SubFile *addFile(IMG *img, SubFile::Type type, quint32 size);

src/map/imgmap.cpp

@@ -19,12 +19,8 @@
 #define TILE_SIZE   256
 #define TEXT_EXTENT 256
 
-#define LARGE_FONT_SIZE   14
-#define NORMAL_FONT_SIZE  12
-#define SMALL_FONT_SIZE   10
-#define POI_FONT_SIZE      9
-
-#define LINE_TEXT_MIN_ZOOM   22
+#define AREA(rect) \
+	(rect.size().width() * rect.size().height())
 
 class RasterTile
 {
@@ -41,13 +37,14 @@ public:
 	QList<IMG::Poly> &lines() {return _lines;}
 	QList<IMG::Point> &points() {return _points;}
 
-	void load()
+	void render()
 	{
 		QList<TextItem*> textItems;
 
 		_map->processPolygons(_polygons);
 		_map->processPoints(_points, textItems);
-		_map->processLines(_lines, _xy, textItems);
+		_map->processLines(_lines, QRect(_xy, QSize(TILE_SIZE, TILE_SIZE)),
+		  textItems);
 
 		_img.fill(Qt::transparent);
 
@@ -59,6 +56,8 @@ public:
 		_map->drawPolygons(&painter, _polygons);
 		_map->drawLines(&painter, _lines);
 		_map->drawTextItems(&painter, textItems);
+		//painter.setPen(Qt::red);
+		//painter.drawRect(QRect(_xy, QSize(TILE_SIZE, TILE_SIZE)));
 
 		qDeleteAll(textItems);
 	}
@@ -74,12 +73,18 @@ private:
 };
 
 
-static void convertUnits(QString &str)
+static Range zooms(12, 28);
+
+static QColor shieldColor(Qt::white);
+static QColor shieldBgColor1("#dd3e3e");
+static QColor shieldBgColor2("#379947");
+static QColor shieldBgColor3("#4a7fc1");
+
+static QString convertUnits(const QString &str)
 {
 	bool ok;
 	int number = str.toInt(&ok);
-	if (ok)
-		str = QString::number(qRound(number * 0.3048));
+	return ok ? QString::number(qRound(number * 0.3048)) : str;
 }
 
 static int minPOIZoom(Style::POIClass cl)
@@ -103,28 +108,107 @@ static int minPOIZoom(Style::POIClass cl)
 	}
 }
 
+static QFont pixelSizeFont(int pixelSize)
+{
+	QFont f;
+	f.setPixelSize(pixelSize);
+	return f;
+}
+
+static QFont *font(Style::FontSize size, Style::FontSize defaultSize
+  = Style::Normal)
+{
+	/* The fonts must be initialized on first usage (after the QGuiApplication
+	   instance is created) */
+	static QFont large = pixelSizeFont(16);
+	static QFont normal = pixelSizeFont(14);
+	static QFont small = pixelSizeFont(12);
+
+	switch (size) {
+		case Style::None:
+			return 0;
+		case Style::Large:
+			return &large;
+		case Style::Normal:
+			return &normal;
+		case Style::Small:
+			return &small;
+		default:
+			return font(defaultSize);
+	}
+}
+
+static QFont *poiFont(Style::FontSize size = Style::Normal)
+{
+	static QFont poi = pixelSizeFont(10);
+
+	switch (size) {
+		case Style::None:
+			return 0;
+		default:
+			return &poi;
+	}
+}
+
+static const QColor *shieldBgColor(Label::Shield::Type type)
+{
+	switch (type) {
+		case Label::Shield::USInterstate:
+		case Label::Shield::Hbox:
+			return &shieldBgColor1;
+		case Label::Shield::USShield:
+		case Label::Shield::Box:
+			return &shieldBgColor2;
+		case Label::Shield::USRound:
+		case Label::Shield::Oval:
+			return &shieldBgColor3;
+		default:
+			return 0;
+	}
+}
+
+static int minShieldZoom(Label::Shield::Type type)
+{
+	switch (type) {
+		case Label::Shield::USInterstate:
+		case Label::Shield::Hbox:
+			return 18;
+		case Label::Shield::USShield:
+		case Label::Shield::Box:
+			return 19;
+		case Label::Shield::USRound:
+		case Label::Shield::Oval:
+			return 20;
+		default:
+			return 0;
+	}
+}
+
+
 IMGMap::IMGMap(const QString &fileName, QObject *parent)
-  : Map(parent), _fileName(fileName), _img(fileName),
-  _projection(PCS::pcs(3857)), _valid(false)
+  : Map(parent), _img(fileName), _projection(PCS::pcs(3857)), _valid(false)
 {
 	if (!_img.isValid()) {
 		_errorString = _img.errorString();
 		return;
 	}
 
-	_zooms = Range(_img.zooms().min() - 1, 28);
-	_zoom = _zooms.min();
-
+	_zoom = zooms.min();
 	updateTransform();
 
-	_largeFont.setPixelSize(LARGE_FONT_SIZE);
-	_normalFont.setPixelSize(NORMAL_FONT_SIZE);
-	_smallFont.setPixelSize(SMALL_FONT_SIZE);
-	_poiFont.setPixelSize(POI_FONT_SIZE);
-
 	_valid = true;
 }
 
+void IMGMap::load()
+{
+	_img.load();
+}
+
+void IMGMap::unload()
+{
+	_img.clear();
+}
+
 QRectF IMGMap::bounds()
 {
 	RectD prect(_img.bounds(), _projection);
@@ -137,8 +221,8 @@ int IMGMap::zoomFit(const QSize &size, const RectC &rect)
 	if (rect.isValid()) {
 		RectD pr(rect, _projection, 10);
 
-		_zoom = _zooms.min();
-		for (int i = _zooms.min() + 1; i <= _zooms.max(); i++) {
+		_zoom = zooms.min();
+		for (int i = zooms.min() + 1; i <= zooms.max(); i++) {
 			Transform t(transform(i));
 			QRectF r(t.proj2img(pr.topLeft()), t.proj2img(pr.bottomRight()));
 			if (size.width() < r.width() || size.height() < r.height())
@@ -146,7 +230,7 @@ int IMGMap::zoomFit(const QSize &size, const RectC &rect)
 			_zoom = i;
 		}
 	} else
-		_zoom = _zooms.max();
+		_zoom = zooms.max();
 
 	updateTransform();
 
@@ -155,14 +239,14 @@ int IMGMap::zoomFit(const QSize &size, const RectC &rect)
 
 int IMGMap::zoomIn()
 {
-	_zoom = qMin(_zoom + 1, _zooms.max());
+	_zoom = qMin(_zoom + 1, zooms.max());
 	updateTransform();
 	return _zoom;
 }
 
 int IMGMap::zoomOut()
 {
-	_zoom = qMax(_zoom - 1, _zooms.min());
+	_zoom = qMax(_zoom - 1, zooms.min());
 	updateTransform();
 	return _zoom;
 }
@@ -199,12 +283,12 @@ Coordinates IMGMap::xy2ll(const QPointF &p)
 
 void IMGMap::drawPolygons(QPainter *painter, const QList<IMG::Poly> &polygons)
 {
-	for (int n = 0; n < _img.style().drawOrder().size(); n++) {
+	for (int n = 0; n < _img.style()->drawOrder().size(); n++) {
 		for (int i = 0; i < polygons.size(); i++) {
 			const IMG::Poly &poly = polygons.at(i);
-			if (poly.type != _img.style().drawOrder().at(n))
+			if (poly.type != _img.style()->drawOrder().at(n))
 				continue;
-			const Style::Polygon &style = _img.style().polygon(poly.type);
+			const Style::Polygon &style = _img.style()->polygon(poly.type);
 
 			painter->setPen(style.pen());
 			painter->setBrush(style.brush());
@@ -219,7 +303,7 @@ void IMGMap::drawLines(QPainter *painter, const QList<IMG::Poly> &lines)
 
 	for (int i = 0; i < lines.size(); i++) {
 		const IMG::Poly &poly = lines.at(i);
-		const Style::Line &style = _img.style().line(poly.type);
+		const Style::Line &style = _img.style()->line(poly.type);
 
 		if (style.background() == Qt::NoPen)
 			continue;
@@ -230,7 +314,7 @@ void IMGMap::drawLines(QPainter *painter, const QList<IMG::Poly> &lines)
 
 	for (int i = 0; i < lines.size(); i++) {
 		const IMG::Poly &poly = lines.at(i);
-		const Style::Line &style = _img.style().line(poly.type);
+		const Style::Line &style = _img.style()->line(poly.type);
 
 		if (!style.img().isNull())
 			BitmapLine::draw(painter, poly.points, style.img());
@@ -259,7 +343,7 @@ void IMGMap::processPolygons(QList<IMG::Poly> &polygons)
 	}
 }
 
-void IMGMap::processLines(QList<IMG::Poly> &lines, const QPoint &tile,
+void IMGMap::processLines(QList<IMG::Poly> &lines, const QRect &tileRect,
   QList<TextItem*> &textItems)
 {
 	qStableSort(lines);
@@ -272,37 +356,33 @@ void IMGMap::processLines(QList<IMG::Poly> &lines, const QPoint &tile,
 		}
 	}
 
-	if (_zoom < LINE_TEXT_MIN_ZOOM)
-		return;
+	if (_zoom >= 22)
+		processStreetNames(lines, tileRect, textItems);
+	processShields(lines, tileRect, textItems);
+}
 
+void IMGMap::processStreetNames(QList<IMG::Poly> &lines, const QRect &tileRect,
+  QList<TextItem*> &textItems)
+{
 	for (int i = 0; i < lines.size(); i++) {
 		IMG::Poly &poly = lines[i];
-		const Style::Line &style = _img.style().line(poly.type);
+		const Style::Line &style = _img.style()->line(poly.type);
 
 		if (style.img().isNull() && style.foreground() == Qt::NoPen)
 			continue;
-		if (poly.label.isEmpty() || style.textFontSize() == Style::None)
+		if (poly.label.text().isEmpty()
+		  || style.textFontSize() == Style::None)
 			continue;
 
 		if (Style::isContourLine(poly.type))
-			convertUnits(poly.label);
+			poly.label.setText(convertUnits(poly.label.text()));
 
-		const QFont *font;
-		switch (style.textFontSize()) {
-			case Style::Large:
-				font = &_largeFont;
-				break;
-			case Style::Small:
-				font = &_smallFont;
-				break;
-			default:
-				font = &_normalFont;
-		}
+		const QFont *fnt = font(style.textFontSize(), Style::Small);
 		const QColor *color = style.textColor().isValid()
 		  ? &style.textColor() : 0;
 
-		TextPathItem *item = new TextPathItem(poly.points, &poly.label,
-		  QRect(tile, QSize(TILE_SIZE, TILE_SIZE)), font, color);
+		TextPathItem *item = new TextPathItem(poly.points,
+		  &poly.label.text(), tileRect, fnt, color);
 		if (item->isValid() && !item->collides(textItems))
 			textItems.append(item);
 		else
@@ -310,6 +390,70 @@ void IMGMap::processLines(QList<IMG::Poly> &lines, const QPoint &tile,
 	}
 }
 
+void IMGMap::processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
+  QList<TextItem*> &textItems)
+{
+	for (int type = FIRST_SHIELD; type <= LAST_SHIELD; type++) {
+		if (minShieldZoom(static_cast<Label::Shield::Type>(type)) > _zoom)
+			continue;
+
+		QHash<Label::Shield, QPolygonF> shields;
+		QHash<Label::Shield, const Label::Shield*> sp;
+
+		for (int i = 0; i < lines.size(); i++) {
+			const IMG::Poly &poly = lines.at(i);
+			const Label::Shield &shield = poly.label.shield();
+			if (!shield.isValid() || shield.type() != type
+			  || !Style::isMajorRoad(poly.type))
+				continue;
+
+			QPolygonF &p = shields[shield];
+			for (int j = 0; j < poly.points.size(); j++)
+				p.append(poly.points.at(j));
+
+			sp.insert(shield, &shield);
+		}
+
+		for (QHash<Label::Shield, QPolygonF>::const_iterator it
+		  = shields.constBegin(); it != shields.constEnd(); ++it) {
+			const QPolygonF &p = it.value();
+			QRectF rect(p.boundingRect() & tileRect);
+			if (qSqrt(AREA(rect)) < 32)
+				continue;
+
+			QMap<qreal, int> map;
+			QPointF center = rect.center();
+			for (int j = 0; j < p.size(); j++) {
+				QLineF l(p.at(j), center);
+				map.insert(l.length(), j);
+			}
+
+			QMap<qreal, int>::const_iterator jt = map.constBegin();
+
+			TextPointItem *item = new TextPointItem(
+			  p.at(jt.value()).toPoint(), &(sp.value(it.key())->text()),
+			  poiFont(), 0, &shieldColor, shieldBgColor(it.key().type()));
+
+			bool valid = false;
+			while (true) {
+				if (!item->collides(textItems)
+				  && tileRect.contains(item->boundingRect().toRect())) {
+					valid = true;
+					break;
+				}
+				if (++jt == map.constEnd())
+					break;
+				item->setPos(p.at(jt.value()).toPoint());
+			}
+
+			if (valid)
+				textItems.append(item);
+			else
+				delete item;
+		}
+	}
+}
+
 void IMGMap::processPoints(QList<IMG::Point> &points,
   QList<TextItem*> &textItems)
 {
@@ -317,51 +461,32 @@ void IMGMap::processPoints(QList<IMG::Point> &points,
 
 	for (int i = 0; i < points.size(); i++) {
 		IMG::Point &point = points[i];
-
-		const Style::Point &style = _img.style().point(point.type);
+		const Style::Point &style = _img.style()->point(point.type);
 
 		if (point.poi && _zoom < minPOIZoom(Style::poiClass(point.type)))
 			continue;
 
-		const QString *label = point.label.isEmpty() ? 0 : &(point.label);
+		const QString *label = point.label.text().isEmpty()
+		  ? 0 : &(point.label.text());
 		const QImage *img = style.img().isNull() ? 0 : &style.img();
-		const QFont *font = 0;
-		if (point.poi) {
-			if (style.textFontSize() == Style::None)
-				label = 0;
-			else
-				font = &_poiFont;
-		} else {
-			switch (style.textFontSize()) {
-				case Style::None:
-					label = 0;
-					break;
-				case Style::Normal:
-					font = &_normalFont;
-					break;
-				case Style::Small:
-					font = &_smallFont;
-					break;
-				default:
-					font = &_largeFont;
-			}
-		}
+		const QFont *fnt = point.poi
+		  ? poiFont(style.textFontSize()) : font(style.textFontSize());
 		const QColor *color = style.textColor().isValid()
 		  ? &style.textColor() : 0;
 
-		if (!label && !img)
+		if ((!label || !fnt) && !img)
 			continue;
 
 		if (Style::isSpot(point.type))
-			convertUnits(point.label);
-		if (Style::isSummit(point.type) && !point.label.isEmpty()) {
-			QStringList list = point.label.split(" ");
-			convertUnits(list.last());
+			point.label.setText(convertUnits(point.label.text()));
+		if (Style::isSummit(point.type) && !point.label.text().isEmpty()) {
+			QStringList list = point.label.text().split(" ");
+			list.last() = convertUnits(list.last());
 			point.label = list.join(" ");
 		}
 
 		TextPointItem *item = new TextPointItem(
-		  ll2xy(point.coordinates).toPoint(), label, font, img, color);
+		  ll2xy(point.coordinates).toPoint(), label, fnt, img, color);
 		if (item->isValid() && !item->collides(textItems))
 			textItems.append(item);
 		else
@@ -371,7 +496,7 @@ void IMGMap::processPoints(QList<IMG::Point> &points,
 
 static void render(RasterTile &tile)
 {
-	tile.load();
+	tile.render();
 }
 
 void IMGMap::draw(QPainter *painter, const QRectF &rect, Flags flags)
@@ -390,7 +515,7 @@ void IMGMap::draw(QPainter *painter, const QRectF &rect, Flags flags)
 		for (int j = 0; j < height; j++) {
 			QPixmap pm;
 			QPoint ttl(tl.x() + i * TILE_SIZE, tl.y() + j * TILE_SIZE);
-			QString key = _fileName + "-" + QString::number(_zoom) + "_"
+			QString key = _img.fileName() + "-" + QString::number(_zoom) + "_"
 			  + QString::number(ttl.x()) + "_" + QString::number(ttl.y());
 			if (QPixmapCache::find(key, pm))
 				painter->drawPixmap(ttl, pm);

src/map/imgmap.h

@@ -34,6 +34,9 @@ public:
 
 	void setProjection(const Projection &projection);
 
+	void load();
+	void unload();
+
 	bool isValid() const {return _valid;}
 	QString errorString() const {return _errorString;}
 
@@ -47,19 +50,19 @@ private:
 	void drawTextItems(QPainter *painter, const QList<TextItem*> &textItems);
 
 	void processPolygons(QList<IMG::Poly> &polygons);
-	void processLines(QList<IMG::Poly> &lines, const QPoint &tile,
+	void processLines(QList<IMG::Poly> &lines, const QRect &tileRect,
 	  QList<TextItem*> &textItems);
 	void processPoints(QList<IMG::Point> &points, QList<TextItem*> &textItems);
+	void processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
+	  QList<TextItem*> &textItems);
+	void processStreetNames(QList<IMG::Poly> &lines, const QRect &tileRect,
+	  QList<TextItem*> &textItems);
 
-	QString _fileName;
 	IMG _img;
 	int _zoom;
-	Range _zooms;
 	Projection _projection;
 	Transform _transform;
 
-	QFont _largeFont, _normalFont, _smallFont, _poiFont;
-
 	bool _valid;
 	QString _errorString;
 };

src/map/matrix.cpp

@@ -37,21 +37,23 @@ Matrix::Matrix(const Matrix& M)
 
 Matrix &Matrix::operator=(const Matrix &M)
 {
-	if (_h != M._h || _w != M._w) {
-		if (!isNull())
-			delete[] _m;
+	if (this != &M) {
+		if (_h != M._h || _w != M._w) {
+			if (!isNull())
+				delete[] _m;
 
-		_h = M._h; _w = M._w;
-		if (isNull())
-			_m = 0;
-		else
-			_m = new double[_h * _w];
+			_h = M._h; _w = M._w;
+			if (isNull())
+				_m = 0;
+			else
+				_m = new double[_h * _w];
+		}
+
+		for (size_t i = 0; i < _h; i++)
+			for (size_t j = 0; j < _w; j++)
+				m(i,j) = M.m(i,j);
 	}
 
-	for (size_t i = 0; i < _h; i++)
-		for (size_t j = 0; j < _w; j++)
-			m(i,j) = M.m(i,j);
-
 	return *this;
 }
 

src/map/projection.cpp

@@ -128,13 +128,15 @@ Projection::~Projection()
 
 Projection &Projection::operator=(const Projection &p)
 {
-	delete _ct;
+	if (this != &p) {
+		delete _ct;
 
-	_gcs = p._gcs;
-	_units = p._units;
-	_ct = p._ct ? p._ct->clone() : 0;
-	_geographic = p._geographic;
-	_cs = p._cs;
+		_gcs = p._gcs;
+		_units = p._units;
+		_ct = p._ct ? p._ct->clone() : 0;
+		_geographic = p._geographic;
+		_cs = p._cs;
+	}
 
 	return *this;
 }