Merge branch 'origin/master' into Weblate.

+ some minor point rendering issues fixes

.appveyor.yml

@@ -1,22 +1,33 @@
-version: 7.19.{build}
-configuration: Release
-platform: Any CPU
+version: 7.21.{build}
+
+configuration:
+  - Release
+
+image:
+  - Visual Studio 2017
+
 environment:
   NSISDIR: C:\Program Files (x86)\NSIS
   matrix:
-  - QTDIR: C:\Qt\5.11\msvc2015
-    PLATFORM: x86
+  - QTDIR: C:\Qt\5.13\msvc2017
     NSI: gpxsee.nsi
-    OPENSSLDIR: C:\OpenSSL-Win32\bin
-  - QTDIR: C:\Qt\5.11\msvc2015_64
-    PLATFORM: x86_amd64
+    VCVARS: vcvars32.bat
+    OPENSSLDIR: C:\OpenSSL-v111-Win32\bin
+    LIBCRYPTO: libssl-1_1.dll
+    LIBSSL: libcrypto-1_1.dll
+  - QTDIR: C:\Qt\5.13\msvc2017_64
     NSI: gpxsee64.nsi
-    OPENSSLDIR: C:\OpenSSL-Win64\bin
+    VCVARS: vcvars64.bat
+    OPENSSLDIR: C:\OpenSSL-v111-Win64\bin
+    LIBCRYPTO: libssl-1_1-x64.dll
+    LIBSSL: libcrypto-1_1-x64.dll    
+
 install:
 - cmd: >-
     set PATH=%QTDIR%\bin;%NSISDIR%;%PATH%
 
-    call "C:\Program Files (x86)\Microsoft Visual Studio 14.0\VC\vcvarsall.bat" %PLATFORM%
+    call "C:\Program Files (x86)\Microsoft Visual Studio\2017\Community\VC\Auxiliary\Build\"%VCVARS%
+
 build_script:
 - cmd: >-
     lrelease gpxsee.pro
@@ -44,9 +55,9 @@ build_script:
 
     copy licence.txt installer
 
-    copy %OPENSSLDIR%\libeay32.dll installer
+    copy %OPENSSLDIR%\%LIBCRYPTO% installer
 
-    copy %OPENSSLDIR%\ssleay32.dll installer
+    copy %OPENSSLDIR%\%LIBSSL% installer
 
 
     makensis.exe installer\%NSI%

README.md

@@ -2,7 +2,7 @@
 GPXSee is a Qt-based GPS log file viewer and analyzer that supports all common GPS log file formats.
 
 ## Features
-* Opens GPX, TCX, FIT, KML, NMEA, IGC, CUP, SLF, LOC, GeoJSON, OziExplorer (PLT, RTE, WPT), Garmin GPI&CSV and geotagged JPEG files.
+* Opens GPX, TCX, FIT, KML, NMEA, IGC, CUP, SIGMA SLF, Suunto SML, LOC, GeoJSON, OziExplorer (PLT, RTE, WPT), Garmin GPI&CSV and geotagged JPEG files.
 * User-definable online maps (OpenStreetMap/Google tiles, WMTS, WMS, TMS, QuadTiles).
 * Offline maps (MBTiles, OziExplorer maps, TrekBuddy maps/atlases, Garmin IMG & JNX maps, TwoNav RMaps, GeoTIFF images).
 * Elevation, speed, heart rate, cadence, power, temperature and gear ratio/shifts graphs.

gpxsee.pro

@@ -3,7 +3,7 @@ unix:!macx {
 } else {
     TARGET = GPXSee
 }
-VERSION = 7.19
+VERSION = 7.21
 
 QT += core \
     gui \
@@ -89,6 +89,12 @@ HEADERS += src/common/config.h \
     src/GUI/areaitem.h \
     src/data/link.h \
     src/map/IMG/bitmapline.h \
+    src/map/IMG/bitstream.h \
+    src/map/IMG/deltastream.h \
+    src/map/IMG/gmap.h \
+    src/map/IMG/huffmanstream.h \
+    src/map/IMG/huffmantable.h \
+    src/map/IMG/mapdata.h \
     src/map/IMG/textpathitem.h \
     src/map/IMG/textpointitem.h \
     src/map/projection.h \
@@ -188,7 +194,8 @@ HEADERS += src/common/config.h \
     src/data/csv.h \
     src/data/cupparser.h \
     src/data/gpiparser.h \
-    src/data/address.h
+    src/data/address.h \
+    src/data/smlparser.h
 SOURCES += src/main.cpp \
     src/GUI/popup.cpp \
     src/common/coordinates.cpp \
@@ -242,6 +249,12 @@ SOURCES += src/main.cpp \
     src/GUI/mapview.cpp \
     src/GUI/areaitem.cpp \
     src/map/IMG/bitmapline.cpp \
+    src/map/IMG/bitstream.cpp \
+    src/map/IMG/deltastream.cpp \
+    src/map/IMG/gmap.cpp \
+    src/map/IMG/huffmanstream.cpp \
+    src/map/IMG/huffmantable.cpp \
+    src/map/IMG/mapdata.cpp \
     src/map/IMG/textpathitem.cpp \
     src/map/IMG/textpointitem.cpp \
     src/map/maplist.cpp \
@@ -324,7 +337,8 @@ SOURCES += src/main.cpp \
     src/data/csv.cpp \
     src/data/cupparser.cpp \
     src/GUI/graphicsscene.cpp \
-    src/data/gpiparser.cpp
+    src/data/gpiparser.cpp \
+    src/data/smlparser.cpp
 
 greaterThan(QT_MAJOR_VERSION, 4) {
     HEADERS += src/data/geojsonparser.h
@@ -349,7 +363,8 @@ TRANSLATIONS = lang/gpxsee_en.ts \
     lang/gpxsee_tr.ts \
     lang/gpxsee_es.ts \
     lang/gpxsee_pt_BR.ts \
-    lang/gpxsee_uk.ts
+    lang/gpxsee_uk.ts \
+    lang/gpxsee_hu.ts
 
 macx {
     ICON = icons/gpxsee.icns
@@ -387,7 +402,8 @@ macx {
         icons/formats/slf.icns \
         icons/formats/json.icns \
         icons/formats/cup.icns \
-        icons/formats/gpi.icns
+        icons/formats/gpi.icns \
+        icons/formats/sml.icns
     QMAKE_BUNDLE_DATA += locale maps icons csv
 }
 
@@ -406,7 +422,8 @@ win32 {
         icons/formats/slf.ico \
         icons/formats/json.ico \
         icons/formats/cup.ico \
-        icons/formats/gpi.ico
+        icons/formats/gpi.ico \
+        icons/formats/sml.ico
     DEFINES += _USE_MATH_DEFINES \
         NOGDI
 }

icons/scripts/extensions

@@ -12,3 +12,4 @@ loc:#556677
 slf:#881199
 cup:#20a810
 gpi:#fca314
+sml:#6434eb

lang/gpxsee_cs.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Podporované soubory</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Soubory CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>Soubory CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Soubory FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Soubory GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>Soubory GPI</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Soubory GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Soubory IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>Obrázky JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Soubory KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Soubory LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Soubory NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Soubory OziExploreru</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Soubory SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Soubory TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Soubory SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Všechny soubory</translation>
     </message>
@@ -1131,7 +1136,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Grafy</translation>
     </message>
@@ -1233,14 +1238,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Výška:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Rychlost:</translation>
     </message>
@@ -1296,69 +1301,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimální rychlost:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimální doba trvání:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Vypočítaná ze vzdálenosti/času</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Zaznamenaná zařízením</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Výška</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrování</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Zdroje</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Detekce přestávek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Radius:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Rychlost</translation>
     </message>
@@ -1403,144 +1408,144 @@
         <translation>Vlastní</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Vysoké rozlišení</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Oblast tisku přibližně odpovídá zobrazované oblasti. Přiblížení mapy se nemění.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Přiblížení mapy bude upraveno tak, aby se celý obsah (trasy/body) vešel do oblasti tisku a rozlišení mapy bylo co nejblíže rozlišení tisku.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Název</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Vzdálenost</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Čas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Čistý čas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Počet objektů (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Samostatná stránka s grafy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Režim tisku</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Záhlaví</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Používat OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Povolit HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Mezipaměť obrázků:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Časový limit připojení:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Systém</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Vzhled</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Mapy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Tisk a export</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Nastavení</translation>
     </message>

lang/gpxsee_da.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Understøttede filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Alle filer</translation>
     </message>
@@ -1251,7 +1256,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Grafer</translation>
     </message>
@@ -1267,14 +1272,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Højde:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Hastighed:</translation>
     </message>
@@ -1330,69 +1335,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Mindste hastighed:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minidste varighed:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Beregnet ud fra afstanden/tiden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Indspillet af enhed</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation type="unfinished">Højde</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrering</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation type="unfinished">Pause genkendelse</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Hastighed</translation>
     </message>
@@ -1402,144 +1407,144 @@
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mil</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>sømil</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>IP</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation type="unfinished">WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Højopløsning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation type="unfinished">Det udskrevne område er ca. det samme som visningsområdet. Kortes zoomniveau ændres ikke.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation type="unfinished">Zoom-niveauet vil blive ændret, således at hele indholdet (spor/rutepunkter) passer til udskriftsområdet og kortopløsning er så tæt som muligt på udskriftsopløsningen.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Navn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Dato</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Afstand</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Tid i bevægelse</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation type="unfinished">Elementantal (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separat grafside</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation type="unfinished">Udskrivningstilstand</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation type="unfinished">Toptekst</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Brug OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Aktiver HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation type="unfinished">Billed cachestørrelse:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Timeout for forbindelse:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Udseende</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Kort</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Udskriv &amp; eksport</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Indstillinger</translation>
     </message>

lang/gpxsee_de.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Unterstützte Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>GPI-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG-Bilder</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML-Dateien</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Alle Dateien</translation>
     </message>
@@ -1130,7 +1135,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Graphen</translation>
     </message>
@@ -1232,14 +1237,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Höhe:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Geschwindigkeit:</translation>
     </message>
@@ -1295,69 +1300,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>sek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimale Geschwindigkeit:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimale Dauer:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Berechnet aus Entfernung/Zeit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Aufgezeichnet von Gerät</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS-Daten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM-Daten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Höhe</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Datenfilterung</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Datenquellen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Pausenerkennung</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Radius:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Geschwindigkeit</translation>
     </message>
@@ -1402,144 +1407,144 @@
         <translation>Benutzerdefiniert</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Hohe Auflösung</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Der Druckbereich entspricht ungefähr dem Anzeigebereich. Das Karten-Zoom ändert sich nicht.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Das Karten-Zoom ändert sich so, dass der ganze Inhalt (Strecken/Wegpunkte) in den Druckbereich passen und die Kartenauflösung so nah wie möglich an der Druckauflösung ist.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Name</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Distanz</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Zeit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Bewegungszeit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Elementanzahl (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separate Seite für Graphen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Druckmodus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Kopfzeile</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>OpenGL verwenden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>HTTP/2 verwenden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Bild-Cachegröße:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Verbindungs-Timeout:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Erscheinungsbild</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Karten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Daten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Druck / Export</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Einstellungen</translation>
     </message>

lang/gpxsee_es.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
-        <translation>Formatos soportados</translation>
+        <translation>Formatos admitidos</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Archivos CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
-        <translation type="unfinished"></translation>
+        <translation>Archivos CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Archivos FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Archivos GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
-        <translation type="unfinished"></translation>
+        <translation>Archivos GPI</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Archivos GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Archivos IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
-        <translation>Imagen JPEG</translation>
+        <translation>Imágenes JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Archivos KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Archivos LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Archivos NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Archivos OziExplorer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Archivos SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Archivos SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Archivos TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Todos los archivos</translation>
     </message>
@@ -163,7 +168,7 @@
     <message>
         <location filename="../src/GUI/elevationgraph.cpp" line="144"/>
         <source>ft</source>
-        <translation>pies</translation>
+        <translation>ft</translation>
     </message>
 </context>
 <context>
@@ -176,7 +181,7 @@
     <message>
         <location filename="../src/GUI/elevationgraphitem.cpp" line="33"/>
         <source>ft</source>
-        <translation>′</translation>
+        <translation>ft</translation>
     </message>
     <message>
         <location filename="../src/GUI/elevationgraphitem.cpp" line="36"/>
@@ -229,7 +234,7 @@
     <message>
         <location filename="../src/GUI/exportdialog.cpp" line="66"/>
         <source>in</source>
-        <translation>”</translation>
+        <translation>in</translation>
     </message>
     <message>
         <location filename="../src/GUI/exportdialog.cpp" line="94"/>
@@ -296,7 +301,7 @@
     <message>
         <location filename="../src/GUI/exportdialog.cpp" line="157"/>
         <source>%1 is not writable.</source>
-        <translation>%1 es de sólo lectura.</translation>
+        <translation>%1 es de solo lectura.</translation>
     </message>
 </context>
 <context>
@@ -314,7 +319,7 @@
         <location filename="../src/GUI/format.cpp" line="61"/>
         <location filename="../src/GUI/format.cpp" line="84"/>
         <source>ft</source>
-        <translation>′</translation>
+        <translation>ft</translation>
     </message>
     <message>
         <location filename="../src/GUI/format.cpp" line="57"/>
@@ -398,17 +403,17 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="256"/>
         <source>Load POI file...</source>
-        <translation>Cargar archivo de POI&apos;s...</translation>
+        <translation>Cargar archivo de POI...</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="260"/>
         <source>Close POI files</source>
-        <translation>Cerrar archivo de POI&apos;s</translation>
+        <translation>Cerrar archivos de POI</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="264"/>
         <source>Overlap POIs</source>
-        <translation>Sobrescribir POI&apos;s</translation>
+        <translation>Sobreponer POI</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="269"/>
@@ -418,7 +423,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="274"/>
         <source>Show POIs</source>
-        <translation>Ver POI&apos;s</translation>
+        <translation>Ver POI</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="284"/>
@@ -433,7 +438,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="296"/>
         <source>Clear tile cache</source>
-        <translation>Limpiar cache de teselas</translation>
+        <translation>Limpiar antememoria de teselas</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="301"/>
@@ -450,7 +455,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="322"/>
         <source>Show tracks</source>
-        <translation>Ver tracks</translation>
+        <translation>Ver pistas</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="327"/>
@@ -460,7 +465,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="332"/>
         <source>Show waypoints</source>
-        <translation>Ver waypoints</translation>
+        <translation>Ver puntos de referencia</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="337"/>
@@ -475,12 +480,12 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="347"/>
         <source>Route waypoints</source>
-        <translation>Waypoints de ruta</translation>
+        <translation>Puntos de referencia de ruta</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="352"/>
         <source>km/mi markers</source>
-        <translation type="unfinished"></translation>
+        <translation>Hitos kilométricos o cada milla</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="359"/>
@@ -617,7 +622,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="529"/>
         <source>POI files</source>
-        <translation>Archivos de POI&apos;s</translation>
+        <translation>Archivos de POI</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="540"/>
@@ -722,22 +727,22 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="707"/>
         <source>Zoom in</source>
-        <translation>Zoom +</translation>
+        <translation>Acercar</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="709"/>
         <source>Zoom out</source>
-        <translation>Zoom -</translation>
+        <translation>Alejar</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="711"/>
         <source>Digital zoom</source>
-        <translation>Zoom digital</translation>
+        <translation>Escala digital</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="712"/>
         <source>Zoom</source>
-        <translation>Zoom</translation>
+        <translation>Escala</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="725"/>
@@ -747,7 +752,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="727"/>
         <source>POI directory:</source>
-        <translation>Carpeta de POIs:</translation>
+        <translation>Carpeta de POI:</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="729"/>
@@ -762,7 +767,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="733"/>
         <source>Styles directory:</source>
-        <translation type="unfinished"></translation>
+        <translation>Directorio de estilos:</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="735"/>
@@ -783,17 +788,17 @@
         <location filename="../src/GUI/gui.cpp" line="842"/>
         <location filename="../src/GUI/gui.cpp" line="877"/>
         <source>Line: %1</source>
-        <translation>Linea: %1</translation>
+        <translation>Renglón: %1</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="850"/>
         <source>Open POI file</source>
-        <translation>Cargar archivo de POI&apos;s</translation>
+        <translation>Cargar archivo de POI</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="874"/>
         <source>Error loading POI file:</source>
-        <translation>Error cargando archivo de POI&apos;s:</translation>
+        <translation>Error al cargar el archivo de POI:</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="1028"/>
@@ -811,7 +816,7 @@
         <location filename="../src/GUI/gui.cpp" line="1034"/>
         <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
-        <translation>Waypoints</translation>
+        <translation>Puntos de referencia</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="1037"/>
@@ -846,7 +851,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
-        <translation>Error cargando archivo de mapa:</translation>
+        <translation>Error al cargar el archivo de mapa:</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="1347"/>
@@ -873,7 +878,7 @@
     <message>
         <location filename="../src/GUI/gearratiograph.cpp" line="27"/>
         <source>Most used</source>
-        <translation>Mas usada</translation>
+        <translation>Más usada</translation>
     </message>
     <message>
         <location filename="../src/GUI/gearratiograph.cpp" line="29"/>
@@ -909,7 +914,7 @@
     <message>
         <location filename="../src/GUI/graphview.cpp" line="46"/>
         <source>Data not available</source>
-        <translation>Sin datos</translation>
+        <translation>Sin datos disponibles</translation>
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
@@ -921,7 +926,7 @@
         <location filename="../src/GUI/graphview.cpp" line="110"/>
         <location filename="../src/GUI/graphview.cpp" line="118"/>
         <source>ft</source>
-        <translation>′</translation>
+        <translation>ft</translation>
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="113"/>
@@ -1012,7 +1017,7 @@
     <message>
         <location filename="../src/map/maplist.cpp" line="121"/>
         <source>Supported files</source>
-        <translation>Formatos soportados</translation>
+        <translation>Formatos admitidos</translation>
     </message>
     <message>
         <location filename="../src/map/maplist.cpp" line="126"/>
@@ -1027,7 +1032,7 @@
     <message>
         <location filename="../src/map/maplist.cpp" line="123"/>
         <source>Garmin IMG maps</source>
-        <translation type="unfinished"></translation>
+        <translation>Mapas Garmin IMG</translation>
     </message>
     <message>
         <location filename="../src/map/maplist.cpp" line="125"/>
@@ -1042,7 +1047,7 @@
     <message>
         <location filename="../src/map/maplist.cpp" line="128"/>
         <source>GeoTIFF images</source>
-        <translation>Imagenes GeoTIFF</translation>
+        <translation>Imágenes GeoTIFF</translation>
     </message>
     <message>
         <location filename="../src/map/maplist.cpp" line="129"/>
@@ -1052,7 +1057,7 @@
     <message>
         <location filename="../src/map/maplist.cpp" line="130"/>
         <source>Online map sources</source>
-        <translation>Mapas Online</translation>
+        <translation>Fuentes de mapas en línea</translation>
     </message>
 </context>
 <context>
@@ -1060,12 +1065,12 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
-        <translation>Alta resolución</translation>
+        <translation>Resolución alta</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
-        <translation>Estandar</translation>
+        <translation>Estándar</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
@@ -1100,12 +1105,12 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
-        <translation type="unfinished"></translation>
+        <translation>Proyección:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
-        <translation type="unfinished"></translation>
+        <translation>Mapas vectoriales</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
@@ -1180,12 +1185,12 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
-        <translation>Color de waypoints:</translation>
+        <translation>Color de puntos de referencia:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
-        <translation>Tamaño de wapoints:</translation>
+        <translation>Tamaño de puntos de referencia:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
@@ -1202,27 +1207,27 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
-        <translation>Waypoints</translation>
+        <translation>Puntos de referencia</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
-        <translation>Color de POI&apos;s:</translation>
+        <translation>Color de POI:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
-        <translation>Tamaño de POI&apos;s:</translation>
+        <translation>Tamaño de POI:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
-        <translation>POI&apos;s</translation>
+        <translation>POI</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
-        <translation>Anchura de linea:</translation>
+        <translation>Anchura de línea:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
@@ -1251,7 +1256,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Gráficas</translation>
     </message>
@@ -1267,14 +1272,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Altitud:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Velocidad:</translation>
     </message>
@@ -1311,7 +1316,7 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
         <source>Automatic</source>
-        <translation type="unfinished"></translation>
+        <translation>Automática</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
@@ -1330,216 +1335,216 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Velocidad mínima:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Duración mínima:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Calculado con distancia/tiempo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Grabado por el dispositivo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>Datos GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>Datos del MDT</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Altitud</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrado</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Fuentes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Detectar paradas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Radio:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Velocidad</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
         <source>Custom</source>
-        <translation type="unfinished"></translation>
+        <translation>Personalizada</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
-        <translation>Alta resolución</translation>
+        <translation>Resolución alta</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
-        <translation>El área que se imprime es la que muestra la pantalla. El zoom del mapa no cambiará.</translation>
+        <translation>El área que se imprime es aproximadamente la que muestra la pantalla. La escala del mapa no cambiará.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
-        <translation>El zoom del mapa se cambia para que el area impresa se ajuste a todos los elementos( tracks, waypoints...) y la resolución sea lo mas próxima posible a la de impresión.</translation>
+        <translation>La escala del mapa se cambia para que el área impresa se ajuste a todos los elementos (pistas, puntos de referencia...) y la resolución sea lo mas próxima posible a la de impresión.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nombre</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Fecha</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Distancia</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Hora</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Tiempo en movimiento</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Recuento de elementos (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Pagina de gráficas separada</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Modo de impresión</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Titulo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Usar OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
-        <translation>Habilitar HTTP/2</translation>
+        <translation>Activar HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
-        <translation>Mo</translation>
+        <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
-        <translation>Tamaño del cache de imágenes:</translation>
+        <translation>Tamaño de antememoria de imágenes:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Caducidad de la conexión:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Sistema</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Apariencia</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Mapas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Fecha</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Imprimir y exportar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Opciones</translation>
     </message>
@@ -1586,7 +1591,7 @@
     <message>
         <location filename="../src/GUI/powergraphitem.cpp" line="17"/>
         <source>Maximum</source>
-        <translation>Maxima</translation>
+        <translation>Máxima</translation>
     </message>
     <message>
         <location filename="../src/GUI/powergraphitem.cpp" line="18"/>
@@ -1620,7 +1625,7 @@
     <message>
         <location filename="../src/GUI/routeitem.cpp" line="29"/>
         <source>Links</source>
-        <translation type="unfinished"></translation>
+        <translation>Enlaces</translation>
     </message>
 </context>
 <context>
@@ -1634,7 +1639,7 @@
         <location filename="../src/GUI/scaleitem.cpp" line="109"/>
         <location filename="../src/GUI/scaleitem.cpp" line="112"/>
         <source>ft</source>
-        <translation>′</translation>
+        <translation>ft</translation>
     </message>
     <message>
         <location filename="../src/GUI/scaleitem.cpp" line="111"/>
@@ -1851,7 +1856,7 @@
     <message>
         <location filename="../src/GUI/trackitem.cpp" line="33"/>
         <source>Links</source>
-        <translation type="unfinished"></translation>
+        <translation>Enlaces</translation>
     </message>
 </context>
 <context>
@@ -1884,12 +1889,12 @@
     <message>
         <location filename="../src/GUI/waypointitem.cpp" line="44"/>
         <source>Address</source>
-        <translation type="unfinished"></translation>
+        <translation>Dirección</translation>
     </message>
     <message>
         <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
-        <translation type="unfinished"></translation>
+        <translation>Enlaces</translation>
     </message>
 </context>
 </TS>

lang/gpxsee_fi.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Tuetut tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>GPI-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG-kuvat</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML-tiedostot</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Kaikki tiedostot</translation>
     </message>
@@ -1130,7 +1135,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Kaaviokuvat</translation>
     </message>
@@ -1232,14 +1237,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Korkeus:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Vauhti:</translation>
     </message>
@@ -1295,69 +1300,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimivauhti:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimikesto:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Laskettu etäisyydestä/ajasta</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Tallennettu laitteella</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS-tiedot</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM-tiedot</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Korkeus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Suodatus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Lähteet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Pysähdysten havaitseminen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Säde:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Vauhti</translation>
     </message>
@@ -1402,144 +1407,144 @@
         <translation>Käyttäjän määrittämä</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>mpk</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Korkea resoluutio</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Painettu alue on suunnilleen näyttöalue. Kartan zoomaustaso ei muutu.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Zoomaustasoa muutetaan niin, että koko sisältö (jäljet/reittipisteet) sopii painettuun alueeseen ja kartan resoluutio on mahdollisimman lähellä tulostusresoluutiota.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nimi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Päivämäärä</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Etäisyys</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Aika</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Liikkumisaika</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Kohteiden määrä (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Erillinen sivu kaaviokuvalle</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Tulostustila</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Otsikko</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Käytä OpenGL:ää</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Ota HTTP/2 käyttöön</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>Mt</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Kuvavälimuistin koko:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Yhteyden aikakatkaisu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Järjestelmä</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Ulkoasu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Kartat</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Tiedot</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Tulostus &amp; vienti</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Valinnat</translation>
     </message>

lang/gpxsee_fr.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Formats pris en charge</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Données CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>Données CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Données FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Données GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>Données GPI</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Données GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Données IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>Images JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Données KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Données LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Données NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Données OziExplorer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Données SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Données TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Données SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Tous les fichiers</translation>
     </message>
@@ -1130,7 +1135,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Graphe</translation>
     </message>
@@ -1232,14 +1237,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Altitude :</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Vitesse :</translation>
     </message>
@@ -1295,69 +1300,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Vitesse minimale :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Durée minimale :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Calculée comme distance/temps</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Enregistrée par l&apos;appareil</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>Données GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>Données MNT</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Altitude</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrage</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Sources</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Détection des arrêts</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Rayon :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Vitesse</translation>
     </message>
@@ -1402,144 +1407,144 @@
         <translation>Personnalisé</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Résolution élevée</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>La zone d&apos;impression est presque celle affichée. L&apos;échelle reste la même.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>L&apos;échelle est ajustée pour que tout le contenu (traces et points de jalonnement) rentre dans la zone d&apos;impression tout en gardant proches les résolutions d&apos;impression et de carte.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nom</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Date</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Distance</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Durée</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Durée en déplacement</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Nombre d&apos;éléments (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Sauter une page pour les graphes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Mode d&apos;impression</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Entête</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Utiliser OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Activer l&apos;HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>Mo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Volume du cache à images :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Délai d&apos;attente de connexion :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Système</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Apparence</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Cartes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Données</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Imprimer et exporter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Options</translation>
     </message>

lang/gpxsee_nb.ts

@@ -12,7 +12,7 @@
         <location filename="../src/GUI/cadencegraph.cpp" line="12"/>
         <location filename="../src/GUI/cadencegraph.h" line="16"/>
         <source>Cadence</source>
-        <translation type="unfinished">Stegfrekvens</translation>
+        <translation>Stegfrekvens</translation>
     </message>
     <message>
         <location filename="../src/GUI/cadencegraph.cpp" line="27"/>
@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Støttede filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>GPI-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG-bilder</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML-filer</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Alle filer</translation>
     </message>
@@ -209,7 +214,7 @@
     <message>
         <location filename="../src/GUI/exportdialog.cpp" line="25"/>
         <source>All files</source>
-        <translation type="unfinished">Alle filer</translation>
+        <translation>Alle filer</translation>
     </message>
     <message>
         <location filename="../src/GUI/exportdialog.cpp" line="52"/>
@@ -234,7 +239,7 @@
     <message>
         <location filename="../src/GUI/exportdialog.cpp" line="94"/>
         <source>Page Setup</source>
-        <translation>Sideinnstilling</translation>
+        <translation>Sideoppsett</translation>
     </message>
     <message>
         <location filename="../src/GUI/exportdialog.cpp" line="97"/>
@@ -368,17 +373,17 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="217"/>
         <source>Open...</source>
-        <translation type="unfinished">Åpne…</translation>
+        <translation>Åpne…</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="222"/>
         <source>Print...</source>
-        <translation type="unfinished">Skriv ut…</translation>
+        <translation>Skriv ut…</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="229"/>
         <source>Export to PDF...</source>
-        <translation type="unfinished">Eksporter til PDF…</translation>
+        <translation>Eksporter til PDF…</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="235"/>
@@ -393,12 +398,12 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="248"/>
         <source>Statistics...</source>
-        <translation type="unfinished">Statistikk…</translation>
+        <translation>Statistikk…</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="256"/>
         <source>Load POI file...</source>
-        <translation type="unfinished">Last inn POI-fil…</translation>
+        <translation>Last inn POI-fil…</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="260"/>
@@ -428,7 +433,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="292"/>
         <source>Load map...</source>
-        <translation type="unfinished">Last inn kart…</translation>
+        <translation>Last inn kart…</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="296"/>
@@ -480,7 +485,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="352"/>
         <source>km/mi markers</source>
-        <translation type="unfinished">km/mi-markører</translation>
+        <translation>km/mi-markører</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="359"/>
@@ -515,7 +520,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="393"/>
         <source>Show path markers</source>
-        <translation type="unfinished">Vis veimarkører</translation>
+        <translation>Vis veimarkører</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="400"/>
@@ -552,17 +557,17 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="441"/>
         <source>Decimal degrees (DD)</source>
-        <translation type="unfinished">Desimalgrader (DD)</translation>
+        <translation>Desimalgrader (DD)</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="447"/>
         <source>Degrees and decimal minutes (DMM)</source>
-        <translation type="unfinished">Desimalgrader og desimalminutter (DMM)</translation>
+        <translation>Desimalgrader og desimalminutter (DMM)</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="454"/>
         <source>Degrees, minutes, seconds (DMS)</source>
-        <translation type="unfinished">Grader, minutter, sekunder (DMS)</translation>
+        <translation>Grader, minutter, sekunder (DMS)</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="460"/>
@@ -572,7 +577,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="467"/>
         <source>Options...</source>
-        <translation type="unfinished">Valg…</translation>
+        <translation>Valg…</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="473"/>
@@ -642,7 +647,7 @@
     <message>
         <location filename="../src/GUI/gui.cpp" line="559"/>
         <source>Coordinates format</source>
-        <translation type="unfinished">Koordinatformat</translation>
+        <translation>Koordinatformat</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="569"/>
@@ -856,7 +861,7 @@
     <message numerus="yes">
         <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
-        <translation type="unfinished">
+        <translation>
             <numerusform>%n fil</numerusform>
             <numerusform>%n filer</numerusform>
         </translation>
@@ -969,7 +974,7 @@
     <message>
         <location filename="../src/GUI/heartrategraph.cpp" line="11"/>
         <source>bpm</source>
-        <translation type="unfinished">s/m</translation>
+        <translation>bpm</translation>
     </message>
     <message>
         <location filename="../src/GUI/heartrategraph.cpp" line="12"/>
@@ -1090,12 +1095,12 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
-        <translation type="unfinished">Palettforskyvning:</translation>
+        <translation>Palettforskyvning:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
-        <translation type="unfinished">Sporbredde:</translation>
+        <translation>Sporbredde:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
@@ -1110,7 +1115,7 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
-        <translation type="unfinished">Sporstil:</translation>
+        <translation>Sporstil:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
@@ -1154,12 +1159,12 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
-        <translation type="unfinished">Kantstil for område:</translation>
+        <translation>Kantstil for område:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
-        <translation type="unfinished">Fylldekkevne for område:</translation>
+        <translation>Ugjennomsiktighet for område:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
@@ -1227,7 +1232,7 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
-        <translation type="unfinished">Linjalfarge:</translation>
+        <translation>Farge på skyveregulering:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
@@ -1251,7 +1256,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Diagrammer</translation>
     </message>
@@ -1267,14 +1272,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Høyde:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Hastighet:</translation>
     </message>
@@ -1311,7 +1316,7 @@
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
         <source>Automatic</source>
-        <translation type="unfinished"></translation>
+        <translation>Automatisk</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
@@ -1330,216 +1335,216 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimumshastighet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimumsvarighet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Utregnet fra avstand/tid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Tatt opp av enhet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS-data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM-data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
-        <translation type="unfinished">Høyde</translation>
+        <translation>Høyde</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrering</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Kilder</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Sett oppdagelse på pause</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Radius:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Hastighet</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
         <source>Custom</source>
-        <translation type="unfinished"></translation>
+        <translation>Egendefinert</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Høyoppløsning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Det utskrevne området er omentrent det samme som visningsområdet. Kartforstørrelsesnivået endrer seg ikke.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Forstørrelsesnivået vil endres slik at hele innholdet (spor/veipunkter) passer med utskrevet område, og kartoppløsningen er så lik utskriftsoppløsningen som mulig.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Navn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Dato</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Avstand</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Tid i bevegelse</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Elementantall (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separat diagramside</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Utskriftsmodus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Topptekst</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Bruk OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Skru på HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Bildehurtiglagringstørrelse:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Tilkoblingstidsavbrudd:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Utseende</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Kart</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Utskrift og ekport</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Valg</translation>
     </message>
@@ -1663,17 +1668,17 @@
     <message>
         <location filename="../src/GUI/speedgraph.cpp" line="31"/>
         <source>min/km</source>
-        <translation type="unfinished">min/km</translation>
+        <translation>min/km</translation>
     </message>
     <message>
         <location filename="../src/GUI/speedgraph.cpp" line="32"/>
         <source>min/mi</source>
-        <translation type="unfinished">min/mi</translation>
+        <translation>min/mi</translation>
     </message>
     <message>
         <location filename="../src/GUI/speedgraph.cpp" line="32"/>
         <source>min/nmi</source>
-        <translation type="unfinished">min/nmi</translation>
+        <translation>min/nmi</translation>
     </message>
     <message>
         <location filename="../src/GUI/speedgraph.cpp" line="34"/>
@@ -1736,7 +1741,7 @@
     <message>
         <location filename="../src/GUI/speedgraphitem.cpp" line="28"/>
         <source>min/nmi</source>
-        <translation type="unfinished">min/nmi</translation>
+        <translation>min/nmi</translation>
     </message>
     <message>
         <location filename="../src/GUI/speedgraphitem.cpp" line="31"/>

lang/gpxsee_pl.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Obsługiwane pliki</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Pliki CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
-        <translation type="unfinished"></translation>
+        <translation>Pliki CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Pliki FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Pliki GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
-        <translation type="unfinished"></translation>
+        <translation>Pliki GPI</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Pliki GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Pliki IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>Pliki JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Pliki KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Pliki LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Pliki NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Pliki OziExplorer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Pliki SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Pliki TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Pliki SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Wszystkie pliki</translation>
     </message>
@@ -1131,7 +1136,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Wykresy</translation>
     </message>
@@ -1233,14 +1238,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Wysokość:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Prędkość:</translation>
     </message>
@@ -1296,69 +1301,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimalna prędkość:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimalny czas trwania:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Obliczona na postawie odległości/czasu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Zapisana przez urządzenie</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>Dane GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>Dane DEM</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Wysokość</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrowanie</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Źródła</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Wykrywanie postoju</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Promień:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Prędkość</translation>
     </message>
@@ -1403,144 +1408,144 @@
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Wysoka rozdzielczość</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Wydrukowany obszar jest w przybliżeniu obszarem wyświetlania. Poziom powiększenia mapy nie zmienia się.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Poziom powiększenia mapy zostanie dostosowany w taki sposób, aby cała zawartość (ścieżki/punkty) wchodziła do drukowanego obszaru, a rozdzielczość mapy była jak najbliższa rozdzielczości wydruku.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nazwa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Dystans</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Czas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Czas ruchu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Liczba elementów (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Oddzielna strona wykresu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Tryb wydruku</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Nagłówek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Używaj OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Włącz HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Rozmiar pamięci podręcznej obrazu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Limit czasu połączenia:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Wygląd</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Mapy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Dane</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Drukowanie i eksport</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Opcje</translation>
     </message>

lang/gpxsee_pt_BR.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Formatos suportados</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Arquivos CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>Arquivos CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Arquivos FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Arquivos GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>Arquivos GPI</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Arquivos GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Arquivos IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>Imagens JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Arquivos KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Arquivos LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Arquivos NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Arquivos OziExplorer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Arquivos SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Arquivos SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Arquivos TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Todos os arquivos</translation>
     </message>
@@ -1251,7 +1256,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Gráficos</translation>
     </message>
@@ -1267,14 +1272,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Altitude:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Velocidade:</translation>
     </message>
@@ -1335,211 +1340,211 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Velocidade Mínima:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Duração mínima:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Calculada a partir da distância/tempo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Gravada através de dispositivo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>Dados de GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>Dados de DEM</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Velocidade</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Altitude</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtragem</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Fontes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Detecção de pausa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Raio:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Alta resolução</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>A área de impressão é aproximadamente a área de tela. O nível de zoom do mapa não é alterado.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>O nível de zoom será alterado de modo que todo o conteúdo (trilhas/waypoints) caiba na área de impressão e a resolução seja tão próxima quanto possível da resolução de impressão.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nome</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Distância</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Tempo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Tempo em movimento</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Número de itens (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separar página de gráficos</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Modo de impressão</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Cabeçalho</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Usar OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Habilitar HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Tamanho do cache de imagens:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Tempo de espera de conexão:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Sistema</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Aparência</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Mapas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Dados</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Imprimir e Exportar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Preferências</translation>
     </message>

lang/gpxsee_ru.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Все поддерживаемые файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>GPI файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG изображения</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML файлы</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Все файлы</translation>
     </message>
@@ -1131,7 +1136,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Графики</translation>
     </message>
@@ -1233,14 +1238,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Высота:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Скорость:</translation>
     </message>
@@ -1296,69 +1301,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>с</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Минимальная скорость:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Минимальная продолжительность:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Вычисленная из расстояния/времени</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Записанная устройством</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS данные</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM данные</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Высота</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Фильтрация</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Источники</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Обнаружение остановок</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Радиус:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Скорость</translation>
     </message>
@@ -1403,144 +1408,144 @@
         <translation>Пользовательскoe</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>мл</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>мор. мл</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>км</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>Точки POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Высокое разрешение</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Печатная область примерно совпадает с областью отображения. Уровень приближения карты не изменяется.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Уровень приближения будет изменен так, чтобы всё содержимое (треки/точки) уместились в печатную область и разрешение карты было бы как можно ближе к разрешению печати.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Имя</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Дата</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Расстояние</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Время</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Время движения</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Количество объектов (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Отдельная страница с графиком</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Режим печати</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Заголовок</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Использовать OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Включить HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>МБ</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Размер кэша изображений:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Таймаут соединения:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Система</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Внешний вид</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Карты</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Данные</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Печать и экспорт</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Параметры</translation>
     </message>

lang/gpxsee_sv.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Filer som stöds</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>GPI-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG-bilder</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML-filer</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Alla filer</translation>
     </message>
@@ -1130,7 +1135,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Diagram</translation>
     </message>
@@ -1232,14 +1237,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Höjd:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Hastighet:</translation>
     </message>
@@ -1295,69 +1300,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>sek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minsta hastighet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Kortast varaktighet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Beräknad från distans/tid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Inspelad av enhet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS-data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM-data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Stigning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrering</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Källor</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Pausa identifiering</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Radie:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Hastighet</translation>
     </message>
@@ -1402,144 +1407,144 @@
         <translation>Anpassat</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Högupplösning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Det utskrivna området är ungefär detsamma som synligt område på skärmen. Kartans zoomnivå ändras inte.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Zoomnivån kommer att ändras så att hela innehållet (spår/vägpunkter) passar utskriftsområdet och kartresolutionen är så nära som möjligt till utskriftsupplösningen.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Namn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Avstånd</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Förflyttningstid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Objektantal (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separat diagramsida</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Utskriftsläge</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Rubrik</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Använd OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Aktivera HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Cashe-storlek för bilder:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Anslutningens tidsgräns:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Utseende</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Kartor</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Utskrift &amp; Export</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Alternativ</translation>
     </message>

lang/gpxsee_tr.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Desteklenen dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP dosyaları</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>GPI dosyaları</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG resimler</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML dosyalar</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Tüm dosyalar</translation>
     </message>
@@ -858,7 +863,6 @@
         <source>%n files</source>
         <translation>
             <numerusform>%n dosya</numerusform>
-            <numerusform>%n dosya</numerusform>
         </translation>
     </message>
 </context>
@@ -1251,7 +1255,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Grafikler</translation>
     </message>
@@ -1267,14 +1271,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Rakım:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Hız:</translation>
     </message>
@@ -1330,69 +1334,69 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Asgari hız:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimum süre:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Mesafe/zamandan hesaplandı</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Cihazdan kaydedilen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS verisi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM verisi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Rakım</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtreleme</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Kaynaklar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Duraklama algılama</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Yarıçap:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Hız</translation>
     </message>
@@ -1402,144 +1406,144 @@
         <translation>Özel</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>Km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Yüksek çözünürlük</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Yazdırılan alan yaklaşık olarak görüntü alanıdır. Harita zum seviyesi değişmez.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Yakınlaştırma seviyesi, tüm içeriğin (izler/yer işaretleri) yazdırılan alana sığması ve harita çözünürlüğünün baskı çözünürlüğüne olabildiğince yakın olacak şekilde değiştirilecektir.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Adı</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Tarih</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Mesafe</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Zaman</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Hareket süresi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Öğe sayısı (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Ayrı grafik sayfası</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Yazdırma modu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Başlık</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>OpenGL Kullan</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>HTTP/2 etkinleştir</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Görüntü önbellek boyutu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Bağlantı zaman aşımı:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Sistem</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Görünüm</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Haritalar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Veri</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Yazdır &amp; Dışa ver</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Seçenekler</translation>
     </message>

lang/gpxsee_uk.ts

@@ -47,82 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Всі підтримувані формати</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="177"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="179"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="186"/>
         <source>GPI files</source>
         <translation>GPI файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG зображення</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="190"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="191"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="192"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML файли</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX файли</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="193"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Всі файли</translation>
     </message>
@@ -1252,7 +1257,7 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Графіки</translation>
     </message>
@@ -1268,14 +1273,14 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="492"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Висота:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="428"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Швидкість:</translation>
     </message>
@@ -1336,211 +1341,211 @@
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="595"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>с</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="389"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Мінімальна швидкість:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="390"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Мінімальна тривалість:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="400"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Обчислено з відстань/час</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Записано пристроєм</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="407"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS дані</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="408"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="466"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM дані</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Швидкість</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="445"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Висота</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Фільтрування</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="457"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Джерела</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="458"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Виявлення пауз</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="477"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>миля</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>мор.миля</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>км</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="491"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Радіус:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="498"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="638"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>Точки POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="505"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG (Візуальний редактор)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="506"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Висока роздільна здатність</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="511"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Область друку є приблизною областю відображення. Рівень масштабування мапи не змінюється.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="513"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Масштаб буде змінено так, щоби весь зміст (треки/маршрутні точки) вмістився на друковану область, а роздільна здатність мапи була якомога наближеною до роздільної здатності друку.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="535"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Ім’я</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="537"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Дата</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="539"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Відстань</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="541"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Час</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Час руху</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Кількість об’єктів (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="560"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Окрема сторінка із графіком</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="570"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Режим друку</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="571"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Заголовок</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="579"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Використовувати OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Дозволити HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>МБ</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="599"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Розмір кешу зображень:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="600"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Час з’єднання вичерпаний:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="616"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Система</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="634"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Зовнішній вигляд</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="636"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Мапи</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Дані</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Друк та експорт</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="668"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Налаштування</translation>
     </message>

pkg/Info.plist

@@ -243,6 +243,22 @@
 			<key>CFBundleTypeRole</key>
 			<string>Viewer</string>
 		</dict>
+		<dict>
+			<key>CFBundleTypeExtensions</key>
+			<array>
+				<string>sml</string>
+			</array>
+			<key>CFBundleTypeMIMETypes</key>
+			<array>
+				<string>application/sml+xml</string>
+			</array>
+			<key>CFBundleTypeIconFile</key>
+			<string>icons/sml.icns</string>
+			<key>CFBundleTypeName</key>
+			<string>Suunto Markup Language</string>
+			<key>CFBundleTypeRole</key>
+			<string>Viewer</string>
+		</dict>
 	</array>
 
 	<key>UTImportedTypeDeclarations</key>
@@ -541,6 +557,27 @@
 				<string>application/vnd.garmin.gpi</string>
 			</dict>
 		</dict>
+		<dict>
+			<key>UTTypeIdentifier</key>
+			<string>com.suunto.sml</string>
+			<key>UTTypeReferenceURL</key>
+			<string>https://www.suunto.com</string>
+			<key>UTTypeDescription</key>
+			<string>Suunto Markup Language</string>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>public.xml</string>
+			</array>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.filename-extension</key>
+				<array>
+					<string>sml</string>
+				</array>
+				<key>public.mime-type</key>
+				<string>application/sml+xml</string>
+			</dict>
+		</dict>
 	</array>
 </dict>
 </plist>

pkg/appdata.xml

@@ -12,17 +12,18 @@
 
 		<p>Features:</p>
 		<ul>
-			<li>Opens GPX, TCX, FIT, KML, IGC, NMEA, SLF, LOC, OziExplorer (PLT,
-				WPT, RTE), GeoJSON, SeeYou CUP, Garmin GPI &amp; CSV and
-				geotagged JPEG files.</li>
+			<li>Opens GPX, TCX, FIT, KML, IGC, NMEA, SIGMA SLF, Suunto SML, LOC,
+				OziExplorer (PLT, WPT, RTE), GeoJSON, SeeYou CUP,
+				Garmin GPI &amp; CSV and geotagged JPEG files.</li>
 			<li>User-definable online maps (OpenStreetMap/Google tiles, WMTS,
-				WMS, TMS).</li>
+				WMS, TMS, QuadTiles).</li>
 			<li>Offline maps (MBTiles, OziExplorer maps, TrekBuddy maps/atlases,
 				TwoNav RMaps, Garmin IMG &amp; JNX, GeoTIFF images).</li>
 			<li>Elevation, speed, heart rate, cadence, power, temperature and
 				gear ratio graphs.</li>
 			<li>Support for multiple tracks in one view.</li>
 			<li>Support for POI files.</li>
+			<li>Support for DEM files (SRTM HGT).</li>
 			<li>Print/export to PDF.</li>
 			<li>Full-screen mode.</li>
 			<li>HiDPI/Retina displays &amp; maps support.</li>
@@ -70,5 +71,6 @@
 		<mimetype>application/geo+json</mimetype>
 		<mimetype>application/vnd.naviter.seeyou.cup</mimetype>
 		<mimetype>application/vnd.garmin.gpi</mimetype>
+		<mimetype>application/sml+xml</mimetype>
 	</mimetypes>
 </component>

pkg/gpxsee.desktop

@@ -4,6 +4,7 @@ Comment=GPS log file viewer and analyzer
 Comment[cz]=Prohlížeč a analyzátor GPS logů
 Comment[fi]=Ohjelma GPS-lokien katseluun ja analysointiin
 Comment[fr]=Visualisation et analyse de fichier GPS
+Comment[nb]=GPS-loggfilleser og analysator
 Comment[pl]=Przeglądarka i analizator plików dziennika GPS
 Comment[ru]=Программа для просмотра и анализа GPS логов
 Comment[sv]=GPS-loggfilsläsare och analysator
@@ -14,4 +15,4 @@ Icon=gpxsee
 Terminal=false
 Type=Application
 Categories=Graphics;Viewer;Education;Geography;Maps;Sports;Qt;
-MimeType=application/gpx+xml;application/tcx+xml;application/vnd.ant.fit;application/vnd.google-earth.kml+xml;application/vnd.fai.igc;application/vnd.nmea.nmea;application/vnd.oziexplorer.plt;application/vnd.oziexplorer.rte;application/vnd.oziexplorer.wpt;application/loc+xml;application/slf+xml;application/geo+json;application/vnd.naviter.seeyou.cup;application/vnd.garmin.gpi;
+MimeType=application/gpx+xml;application/tcx+xml;application/vnd.ant.fit;application/vnd.google-earth.kml+xml;application/vnd.fai.igc;application/vnd.nmea.nmea;application/vnd.oziexplorer.plt;application/vnd.oziexplorer.rte;application/vnd.oziexplorer.wpt;application/loc+xml;application/slf+xml;application/geo+json;application/vnd.naviter.seeyou.cup;application/vnd.garmin.gpi;application/sml+xml;

pkg/gpxsee.nsi

@@ -7,7 +7,7 @@
 ; The name of the installer
 Name "GPXSee"
 ; Program version
-!define VERSION "7.19"
+!define VERSION "7.21"
 
 ; The file to write
 OutFile "GPXSee-${VERSION}.exe"
@@ -106,20 +106,21 @@ Section "GPXSee" SEC_APP
 
   ; Associate file formats
   DetailPrint "Associating file types..."
-  !insertmacro FILE_ASSOCIATION_ADD "gpx" "GPS Exchange Format" 7
-  !insertmacro FILE_ASSOCIATION_ADD "tcx" "Training Center XML" 8
-  !insertmacro FILE_ASSOCIATION_ADD "kml" "Keyhole Markup Language" 9
-  !insertmacro FILE_ASSOCIATION_ADD "fit" "Flexible and Interoperable Data Transfer" 10
-  !insertmacro FILE_ASSOCIATION_ADD "igc" "Flight Recorder Data Format" 11
-  !insertmacro FILE_ASSOCIATION_ADD "nmea" "NMEA 0183 Data" 12
-  !insertmacro FILE_ASSOCIATION_ADD "plt" "OziExplorer Track Point File" 13
-  !insertmacro FILE_ASSOCIATION_ADD "rte" "OziExplorer Route File" 14
+  !insertmacro FILE_ASSOCIATION_ADD "gpx" "GPS Exchange Format" 8
+  !insertmacro FILE_ASSOCIATION_ADD "tcx" "Training Center XML" 9
+  !insertmacro FILE_ASSOCIATION_ADD "kml" "Keyhole Markup Language" 10
+  !insertmacro FILE_ASSOCIATION_ADD "fit" "Flexible and Interoperable Data Transfer" 11
+  !insertmacro FILE_ASSOCIATION_ADD "igc" "Flight Recorder Data Format" 12
+  !insertmacro FILE_ASSOCIATION_ADD "nmea" "NMEA 0183 Data" 13
+  !insertmacro FILE_ASSOCIATION_ADD "plt" "OziExplorer Track Point File" 14
+  !insertmacro FILE_ASSOCIATION_ADD "rte" "OziExplorer Route File" 15
   !insertmacro FILE_ASSOCIATION_ADD "wpt" "OziExplorer Waypoint File" 1
   !insertmacro FILE_ASSOCIATION_ADD "loc" "Geocaching.com Waypoint File" 2
   !insertmacro FILE_ASSOCIATION_ADD "slf" "Sigma Log File" 3
   !insertmacro FILE_ASSOCIATION_ADD "geojson" "GeoJSON" 4
   !insertmacro FILE_ASSOCIATION_ADD "cup" "SeeYou CUP File" 5
   !insertmacro FILE_ASSOCIATION_ADD "gpi" "Garmin POI File" 6
+  !insertmacro FILE_ASSOCIATION_ADD "sml" "Suunto Markup Language" 7
   System::Call 'shell32.dll::SHChangeNotify(i, i, i, i) v (0x08000000, 0, 0, 0)'
 
 SectionEnd
@@ -147,30 +148,17 @@ Section "MSVC runtime" SEC_MSVC
 
   SectionIn RO
 
-  DetailPrint "Checking whether Visual C++ 2015 Redistributable is already installed..."
-  ${If} ${RunningX64}
-    ReadRegDword $R0 HKLM "SOFTWARE\Wow6432Node\Microsoft\VisualStudio\14.0\VC\Runtimes\x86" "Installed"
-  ${Else}
-    ReadRegDword $R0 HKLM "SOFTWARE\Microsoft\VisualStudio\14.0\VC\Runtimes\x86" "Installed"
-  ${EndIf}
-
-  StrCmp $R0 "1" 0 +3
-  DetailPrint "Visual C++ 2015 Redistributable is already installed, skipping install."
-  Goto done
-
-  DetailPrint "Installing Visual C++ 2015 Redistributable..."
   SetOutPath $TEMP
-  File "vcredist_x86.exe"
-  ExecWait '"$TEMP\vcredist_x86.exe" /install /quiet /norestart'
-  SetOutPath $INSTDIR
+  File "vc_redist.x86.exe"
+  ExecWait '"$TEMP\vc_redist.x86.exe" /install /quiet /norestart'
+  SetOutPath $INSTDIR    
 
-  done:
 SectionEnd
 
 Section "OpenSSL" SEC_OPENSSL
 
-  File "libeay32.dll"
-  File "ssleay32.dll"
+  File "libcrypto-1_1.dll"
+  File "libssl-1_1.dll"
 
 SectionEnd
 
@@ -188,6 +176,7 @@ SectionGroup "Localization" SEC_LOCALIZATION
   !insertmacro LOCALIZATION "Finnish" "fi"
   !insertmacro LOCALIZATION "French" "fr"
   !insertmacro LOCALIZATION "German" "de"
+  !insertmacro LOCALIZATION "Hungarian" "hu"
   !insertmacro LOCALIZATION "Norwegian" "nb"
   !insertmacro LOCALIZATION "Polish" "pl"
   !insertmacro LOCALIZATION "Portuguese (Brazil)" "pt_BR"
@@ -232,6 +221,7 @@ Section "Uninstall"
   !insertmacro FILE_ASSOCIATION_REMOVE "geojson"
   !insertmacro FILE_ASSOCIATION_REMOVE "cup"
   !insertmacro FILE_ASSOCIATION_REMOVE "gpi"
+  !insertmacro FILE_ASSOCIATION_REMOVE "sml"
   System::Call 'shell32.dll::SHChangeNotify(i, i, i, i) v (0x08000000, 0, 0, 0)'
 
 SectionEnd
@@ -244,7 +234,7 @@ SectionEnd
 LangString DESC_QT ${LANG_ENGLISH} \
   "QT cross-platform application framework."
 LangString DESC_MSVC ${LANG_ENGLISH} \
-  "Visual C++ 2015 runtime components. If already installed, will be skipped."
+  "Microsoft Visual C++ 2017 runtime. If already installed, will be skipped."
 LangString DESC_OPENSSL ${LANG_ENGLISH} \
   "OpenSSL library. Required for HTTPS to work."
 LangString DESC_ANGLE ${LANG_ENGLISH} \

pkg/gpxsee.xml

@@ -98,4 +98,11 @@
 		<generic-icon name="application/octet-stream"/>
 		<glob pattern="*.gpi"/>
 	</mime-type>
+
+	<mime-type type="application/sml+xml">
+		<comment>Suunto Markup Language</comment>
+		<sub-class-of type="application/xml"/>
+		<generic-icon name="application-xml"/>
+		<glob pattern="*.sml"/>
+	</mime-type>
 </mime-info>

pkg/gpxsee64.nsi

@@ -7,7 +7,7 @@
 ; The name of the installer
 Name "GPXSee"
 ; Program version
-!define VERSION "7.19"
+!define VERSION "7.21"
 
 ; The file to write
 OutFile "GPXSee-${VERSION}_x64.exe"
@@ -113,20 +113,21 @@ Section "GPXSee" SEC_APP
 
   ; Associate file formats
   DetailPrint "Associating file types..."
-  !insertmacro FILE_ASSOCIATION_ADD "gpx" "GPS Exchange Format" 7
-  !insertmacro FILE_ASSOCIATION_ADD "tcx" "Training Center XML" 8
-  !insertmacro FILE_ASSOCIATION_ADD "kml" "Keyhole Markup Language" 9
-  !insertmacro FILE_ASSOCIATION_ADD "fit" "Flexible and Interoperable Data Transfer" 10
-  !insertmacro FILE_ASSOCIATION_ADD "igc" "Flight Recorder Data Format" 11
-  !insertmacro FILE_ASSOCIATION_ADD "nmea" "NMEA 0183 Data" 12
-  !insertmacro FILE_ASSOCIATION_ADD "plt" "OziExplorer Track Point File" 13
-  !insertmacro FILE_ASSOCIATION_ADD "rte" "OziExplorer Route File" 14
+  !insertmacro FILE_ASSOCIATION_ADD "gpx" "GPS Exchange Format" 8
+  !insertmacro FILE_ASSOCIATION_ADD "tcx" "Training Center XML" 9
+  !insertmacro FILE_ASSOCIATION_ADD "kml" "Keyhole Markup Language" 10
+  !insertmacro FILE_ASSOCIATION_ADD "fit" "Flexible and Interoperable Data Transfer" 11
+  !insertmacro FILE_ASSOCIATION_ADD "igc" "Flight Recorder Data Format" 12
+  !insertmacro FILE_ASSOCIATION_ADD "nmea" "NMEA 0183 Data" 13
+  !insertmacro FILE_ASSOCIATION_ADD "plt" "OziExplorer Track Point File" 14
+  !insertmacro FILE_ASSOCIATION_ADD "rte" "OziExplorer Route File" 15
   !insertmacro FILE_ASSOCIATION_ADD "wpt" "OziExplorer Waypoint File" 1
   !insertmacro FILE_ASSOCIATION_ADD "loc" "Geocaching.com Waypoint File" 2
   !insertmacro FILE_ASSOCIATION_ADD "slf" "Sigma Log File" 3
   !insertmacro FILE_ASSOCIATION_ADD "geojson" "GeoJSON" 4
   !insertmacro FILE_ASSOCIATION_ADD "cup" "SeeYou CUP File" 5
   !insertmacro FILE_ASSOCIATION_ADD "gpi" "Garmin POI File" 6
+  !insertmacro FILE_ASSOCIATION_ADD "sml" "Suunto Markup Language" 7
   System::Call 'shell32.dll::SHChangeNotify(i, i, i, i) v (0x08000000, 0, 0, 0)'
 
 SectionEnd
@@ -154,25 +155,17 @@ Section "MSVC runtime" SEC_MSVC
 
   SectionIn RO
 
-  DetailPrint "Checking whether Visual C++ 2015 Redistributable is already installed..."
-  ReadRegDword $R0 HKLM "SOFTWARE\Wow6432Node\Microsoft\VisualStudio\14.0\VC\Runtimes\x64" "Installed"
-  StrCmp $R0 "1" 0 +3
-  DetailPrint "Visual C++ 2015 Redistributable is already installed, skipping install."
-  Goto done
-
-  DetailPrint "Installing Visual C++ 2015 Redistributable..."
   SetOutPath $TEMP
-  File "vcredist_x64.exe"
-  ExecWait '"$TEMP\vcredist_x64.exe" /install /quiet /norestart'
+  File "vc_redist.x64.exe"
+  ExecWait '"$TEMP\vc_redist.x64.exe" /install /quiet /norestart'
   SetOutPath $INSTDIR
 
-  done:
 SectionEnd
 
 Section "OpenSSL" SEC_OPENSSL
 
-  File "libeay32.dll"
-  File "ssleay32.dll"
+  File "libcrypto-1_1-x64.dll"
+  File "libssl-1_1-x64.dll"
 
 SectionEnd
 
@@ -190,6 +183,7 @@ SectionGroup "Localization" SEC_LOCALIZATION
   !insertmacro LOCALIZATION "Finnish" "fi"
   !insertmacro LOCALIZATION "French" "fr"
   !insertmacro LOCALIZATION "German" "de"
+  !insertmacro LOCALIZATION "Hungarian" "hu"
   !insertmacro LOCALIZATION "Norwegian" "nb"
   !insertmacro LOCALIZATION "Polish" "pl"
   !insertmacro LOCALIZATION "Portuguese (Brazil)" "pt_BR"
@@ -235,6 +229,7 @@ Section "Uninstall"
   !insertmacro FILE_ASSOCIATION_REMOVE "geojson"
   !insertmacro FILE_ASSOCIATION_REMOVE "cup"
   !insertmacro FILE_ASSOCIATION_REMOVE "gpi"
+  !insertmacro FILE_ASSOCIATION_REMOVE "sml"
   System::Call 'shell32.dll::SHChangeNotify(i, i, i, i) v (0x08000000, 0, 0, 0)'
 
 SectionEnd
@@ -247,7 +242,7 @@ SectionEnd
 LangString DESC_QT ${LANG_ENGLISH} \
   "QT cross-platform application framework."
 LangString DESC_MSVC ${LANG_ENGLISH} \
-  "Visual C++ 2015 runtime components. If already installed, will be skipped."
+  "Microsoft Visual C++ 2017 runtime. If already installed, will be skipped."
 LangString DESC_OPENSSL ${LANG_ENGLISH} \
   "OpenSSL library. Required for HTTPS to work."
 LangString DESC_ANGLE ${LANG_ENGLISH} \

src/GUI/gui.cpp

@@ -451,11 +451,11 @@ void GUI::createActions()
 	_degreesMinutesAction->setActionGroup(ag);
 	connect(_degreesMinutesAction, SIGNAL(triggered()), this,
 	  SLOT(setDegreesMinutes()));
-	_DMSAction = new QAction(tr("Degrees, minutes, seconds (DMS)"), this);
-	_DMSAction->setMenuRole(QAction::NoRole);
-	_DMSAction->setCheckable(true);
-	_DMSAction->setActionGroup(ag);
-	connect(_DMSAction, SIGNAL(triggered()), this, SLOT(setDMS()));
+	_dmsAction = new QAction(tr("Degrees, minutes, seconds (DMS)"), this);
+	_dmsAction->setMenuRole(QAction::NoRole);
+	_dmsAction->setCheckable(true);
+	_dmsAction->setActionGroup(ag);
+	connect(_dmsAction, SIGNAL(triggered()), this, SLOT(setDMS()));
 	_fullscreenAction = new QAction(QIcon(FULLSCREEN_ICON),
 	  tr("Fullscreen mode"), this);
 	_fullscreenAction->setMenuRole(QAction::NoRole);
@@ -559,7 +559,7 @@ void GUI::createMenus()
 	QMenu *coordinatesMenu = settingsMenu->addMenu(tr("Coordinates format"));
 	coordinatesMenu->addAction(_decimalDegreesAction);
 	coordinatesMenu->addAction(_degreesMinutesAction);
-	coordinatesMenu->addAction(_DMSAction);
+	coordinatesMenu->addAction(_dmsAction);
 	settingsMenu->addSeparator();
 	settingsMenu->addAction(_showToolbarsAction);
 	settingsMenu->addAction(_fullscreenAction);
@@ -1655,7 +1655,7 @@ void GUI::writeSettings()
 	  : _nauticalUnitsAction->isChecked() ? Nautical : Metric;
 	if (units != UNITS_DEFAULT)
 		settings.setValue(UNITS_SETTING, units);
-	CoordinatesFormat format = _DMSAction->isChecked() ? DMS
+	CoordinatesFormat format = _dmsAction->isChecked() ? DMS
 	  : _degreesMinutesAction->isChecked() ? DegreesMinutes : DecimalDegrees;
 	if (format != COORDINATES_DEFAULT)
 		settings.setValue(COORDINATES_SETTING, format);
@@ -1879,7 +1879,7 @@ void GUI::readSettings()
 
 	value = settings.value(COORDINATES_SETTING, COORDINATES_DEFAULT).toInt();
 	if (value == DMS)
-		_DMSAction->trigger();
+		_dmsAction->trigger();
 	else if (value == DegreesMinutes)
 		_degreesMinutesAction->trigger();
 	else

src/GUI/gui.h

@@ -180,7 +180,7 @@ private:
 	QAction *_nauticalUnitsAction;
 	QAction *_decimalDegreesAction;
 	QAction *_degreesMinutesAction;
-	QAction *_DMSAction;
+	QAction *_dmsAction;
 	QAction *_totalTimeAction;
 	QAction *_movingTimeAction;
 	QAction *_nextMapAction;

src/common/coordinates.cpp

@@ -14,7 +14,8 @@ double Coordinates::distanceTo(const Coordinates &c) const
 #ifndef QT_NO_DEBUG
 QDebug operator<<(QDebug dbg, const Coordinates &c)
 {
-	dbg.nospace() << "Coordinates(" << c.lon() << ", " << c.lat() << ")";
+	dbg.nospace() << qSetRealNumberPrecision(10) << "Coordinates(" << c.lat()
+	  << ", " << c.lon() << ")";
 	return dbg.space();
 }
 #endif // QT_NO_DEBUG

src/common/tifffile.h

@@ -9,6 +9,7 @@
 #define TIFF_SHORT     3
 #define TIFF_LONG      4
 #define TIFF_RATIONAL  5
+#define TIFF_SRATIONAL 10
 #define TIFF_DOUBLE    12
 
 class TIFFFile

src/data/data.cpp

@@ -19,6 +19,7 @@
 #include "exifparser.h"
 #include "cupparser.h"
 #include "gpiparser.h"
+#include "smlparser.h"
 #include "dem.h"
 #include "data.h"
 
@@ -41,6 +42,7 @@ static GeoJSONParser geojson;
 static EXIFParser exif;
 static CUPParser cup;
 static GPIParser gpi;
+static SMLParser sml;
 
 static QHash<QString, Parser*> parsers()
 {
@@ -66,6 +68,7 @@ static QHash<QString, Parser*> parsers()
 	hash.insert("jpg", &exif);
 	hash.insert("cup", &cup);
 	hash.insert("gpi", &gpi);
+	hash.insert("sml", &sml);
 
 	return hash;
 }
@@ -189,6 +192,7 @@ QString Data::formats()
 	  + qApp->translate("Data", "NMEA files") + " (*.nmea);;"
 	  + qApp->translate("Data", "OziExplorer files") + " (*.plt *.rte *.wpt);;"
 	  + qApp->translate("Data", "SLF files") + " (*.slf);;"
+	  + qApp->translate("Data", "SML files") + " (*.sml);;"
 	  + qApp->translate("Data", "TCX files") + " (*.tcx);;"
 	  + qApp->translate("Data", "All files") + " (*)";
 }

src/data/exifparser.cpp

@@ -82,7 +82,10 @@ double EXIFParser::altitude(TIFFFile &file, const IFDEntry &alt,
 
 double EXIFParser::coordinate(TIFFFile &file, const IFDEntry &ll) const
 {
-	if (!(ll.type == TIFF_RATIONAL && ll.count == 3))
+	// Some broken image creators like NOKIA phones use a wrong (SRATIONAL)
+	// data type
+	if (!((ll.type == TIFF_RATIONAL || ll.type == TIFF_SRATIONAL)
+	  && ll.count == 3))
 		return NAN;
 
 	if (!file.seek(ll.offset))

src/data/igcparser.cpp

@@ -96,7 +96,7 @@ static bool readARecord(const char *line, qint64 len)
 	return true;
 }
 
-bool IGCParser::readHRecord(const char *line, int len)
+bool IGCParser::readHRecord(CTX &ctx, const char *line, int len)
 {
 	if (len < 11 || ::strncmp(line, "HFDTE", 5))
 		return true;
@@ -112,9 +112,9 @@ bool IGCParser::readHRecord(const char *line, int len)
 		return false;
 	}
 
-	_date = QDate(y + 2000 <= QDate::currentDate().year() ? 2000 + y : 1900 + y,
-	  m, d);
-	if (!_date.isValid()) {
+	ctx.date = QDate(y + 2000 <= QDate::currentDate().year()
+	  ? 2000 + y : 1900 + y, m, d);
+	if (!ctx.date.isValid()) {
 		_errorString = "Invalid date";
 		return false;
 	}
@@ -122,8 +122,8 @@ bool IGCParser::readHRecord(const char *line, int len)
 	return true;
 }
 
-bool IGCParser::readBRecord(SegmentData &segment, const char *line,
-  int len)
+bool IGCParser::readBRecord(CTX &ctx, const char *line, int len,
+  SegmentData &segment)
 {
 	qreal lat, lon, ele;
 	QTime time;
@@ -152,20 +152,20 @@ bool IGCParser::readBRecord(SegmentData &segment, const char *line,
 		return false;
 	}
 
-	if (time < _time && !segment.isEmpty()
-	  && _date == segment.last().timestamp().date())
-		_date = _date.addDays(1);
-	_time = time;
+	if (time < ctx.time && !segment.isEmpty()
+	  && ctx.date == segment.last().timestamp().date())
+		ctx.date = ctx.date.addDays(1);
+	ctx.time = time;
 
 	Trackpoint t(Coordinates(lon, lat));
-	t.setTimestamp(QDateTime(_date, _time, Qt::UTC));
+	t.setTimestamp(QDateTime(ctx.date, ctx.time, Qt::UTC));
 	t.setElevation(ele);
 	segment.append(t);
 
 	return true;
 }
 
-bool IGCParser::readCRecord(RouteData &route, const char *line, int len)
+bool IGCParser::readCRecord(const char *line, int len, RouteData &route)
 {
 	qreal lat, lon;
 
@@ -202,6 +202,7 @@ bool IGCParser::parse(QFile *file, QList<TrackData> &tracks,
 	qint64 len;
 	char line[76 + 2 + 1 + 1];
 	bool route = false, track = false;
+	CTX ctx;
 
 
 	_errorLine = 1;
@@ -225,28 +226,28 @@ bool IGCParser::parse(QFile *file, QList<TrackData> &tracks,
 			}
 		} else {
 			if (line[0] == 'H') {
-				if (!readHRecord(line, len))
+				if (!readHRecord(ctx, line, len))
 					return false;
 			} else if (line[0] == 'C') {
 				if (route) {
-					if (!readCRecord(routes.last() ,line, len))
+					if (!readCRecord(line, len, routes.last()))
 						return false;
 				} else {
 					route = true;
 					routes.append(RouteData());
 				}
 			} else if (line[0] == 'B') {
-				if (_date.isNull()) {
+				if (ctx.date.isNull()) {
 					_errorString = "Missing date header";
 					return false;
 				}
 				if (!track) {
 					tracks.append(TrackData());
 					tracks.last().append(SegmentData());
-					_time = QTime(0, 0);
+					ctx.time = QTime(0, 0);
 					track = true;
 				}
-				if (!readBRecord(tracks.last().last(), line, len))
+				if (!readBRecord(ctx, line, len, tracks.last().last()))
 					return false;
 			}
 		}

src/data/igcparser.h

@@ -17,15 +17,17 @@ public:
 	int errorLine() const {return _errorLine;}
 
 private:
-	bool readHRecord(const char *line, int len);
-	bool readBRecord(SegmentData &segment, const char *line, int len);
-	bool readCRecord(RouteData &route, const char *line, int len);
+	struct CTX {
+		QDate date;
+		QTime time;
+	};
+
+	bool readHRecord(CTX &ctx, const char *line, int len);
+	bool readBRecord(CTX &ctx, const char *line, int len, SegmentData &segment);
+	bool readCRecord(const char *line, int len, RouteData &route);
 
 	int _errorLine;
 	QString _errorString;
-
-	QDate _date;
-	QTime _time;
 };
 
 #endif // IGCPARSER_H

src/data/link.h

@@ -7,15 +7,15 @@ class Link {
 public:
 	Link() {}
 	Link(const QString &URL, const QString &text = QString())
-		: _URL(URL), _text(text) {}
+		: _url(URL), _text(text) {}
 
-	void setURL(const QString &URL) {_URL = URL;}
+	void setURL(const QString &URL) {_url = URL;}
 	void setText(const QString &text) {_text = text;}
-	const QString &URL() const {return _URL;}
+	const QString &URL() const {return _url;}
 	const QString &text() const {return _text;}
 
 private:
-	QString _URL;
+	QString _url;
 	QString _text;
 };
 

src/data/nmeaparser.cpp

@@ -227,7 +227,8 @@ bool NMEAParser::readEW(const char *data, int len, qreal &lon)
 	return true;
 }
 
-bool NMEAParser::readRMC(SegmentData &segment, const char *line, int len)
+bool NMEAParser::readRMC(CTX &ctx, const char *line, int len,
+  SegmentData &segment)
 {
 	int col = 1;
 	const char *vp = line;
@@ -280,23 +281,24 @@ bool NMEAParser::readRMC(SegmentData &segment, const char *line, int len)
 	}
 
 	if (!date.isNull()) {
-		if (_date.isNull() && !_time.isNull() && !segment.isEmpty())
-			segment.last().setTimestamp(QDateTime(date, _time, Qt::UTC));
-		_date = date;
+		if (ctx.date.isNull() && !ctx.time.isNull() && !segment.isEmpty())
+			segment.last().setTimestamp(QDateTime(date, ctx.time, Qt::UTC));
+		ctx.date = date;
 	}
 
 	Coordinates c(lon, lat);
-	if (valid && !_GGA && c.isValid()) {
+	if (valid && !ctx.GGA && c.isValid()) {
 		Trackpoint t(c);
-		if (!_date.isNull() && !time.isNull())
-			t.setTimestamp(QDateTime(_date, time, Qt::UTC));
+		if (!ctx.date.isNull() && !time.isNull())
+			t.setTimestamp(QDateTime(ctx.date, time, Qt::UTC));
 		segment.append(t);
 	}
 
 	return true;
 }
 
-bool NMEAParser::readGGA(SegmentData &segment, const char *line, int len)
+bool NMEAParser::readGGA(CTX &ctx, const char *line, int len,
+  SegmentData &segment)
 {
 	int col = 1;
 	const char *vp = line;
@@ -306,7 +308,7 @@ bool NMEAParser::readGGA(SegmentData &segment, const char *line, int len)
 		if (*lp == ',' || *lp == '*') {
 			switch (col) {
 				case 1:
-					if (!readTime(vp, lp - vp, _time))
+					if (!readTime(vp, lp - vp, ctx.time))
 						return false;
 					break;
 				case 2:
@@ -360,19 +362,19 @@ bool NMEAParser::readGGA(SegmentData &segment, const char *line, int len)
 	Coordinates c(lon, lat);
 	if (c.isValid()) {
 		Trackpoint t(c);
-		if (!(_time.isNull() || _date.isNull()))
-			t.setTimestamp(QDateTime(_date, _time, Qt::UTC));
+		if (!(ctx.time.isNull() || ctx.date.isNull()))
+			t.setTimestamp(QDateTime(ctx.date, ctx.time, Qt::UTC));
 		if (!std::isnan(ele))
 			t.setElevation(ele - gh);
 		segment.append(t);
 
-		_GGA = true;
+		ctx.GGA = true;
 	}
 
 	return true;
 }
 
-bool NMEAParser::readWPL(QVector<Waypoint> &waypoints, const char *line, int len)
+bool NMEAParser::readWPL(const char *line, int len, QVector<Waypoint> &waypoints)
 {
 	int col = 1;
 	const char *vp = line;
@@ -423,7 +425,7 @@ bool NMEAParser::readWPL(QVector<Waypoint> &waypoints, const char *line, int len
 	return true;
 }
 
-bool NMEAParser::readZDA(const char *line, int len)
+bool NMEAParser::readZDA(CTX &ctx, const char *line, int len)
 {
 	int col = 1;
 	const char *vp = line;
@@ -468,8 +470,8 @@ bool NMEAParser::readZDA(const char *line, int len)
 		return false;
 	}
 
-	_date = QDate(y, m, d);
-	if (!_date.isValid()) {
+	ctx.date = QDate(y, m, d);
+	if (!ctx.date.isValid()) {
 		_errorString = "Invalid date";
 		return false;
 	}
@@ -486,13 +488,11 @@ bool NMEAParser::parse(QFile *file, QList<TrackData> &tracks,
 	qint64 len;
 	char line[80 + 2 + 1 + 1];
 	SegmentData segment;
+	CTX ctx;
 
 
 	_errorLine = 1;
 	_errorString.clear();
-	_date = QDate();
-	_time = QTime();
-	_GGA = false;
 
 	while (!file->atEnd()) {
 		len = file->readLine(line, sizeof(line));
@@ -507,16 +507,16 @@ bool NMEAParser::parse(QFile *file, QList<TrackData> &tracks,
 
 		if (validSentence(line, len)) {
 			if (!memcmp(line + 3, "RMC,", 4)) {
-				if (!readRMC(segment, line + 7, len - 7))
+				if (!readRMC(ctx, line + 7, len - 7, segment))
 					return false;
 			} else if (!memcmp(line + 3, "GGA,", 4)) {
-				if (!readGGA(segment, line + 7, len - 7))
+				if (!readGGA(ctx, line + 7, len - 7, segment))
 					return false;
 			} else if (!memcmp(line + 3, "WPL,", 4)) {
-				if (!readWPL(waypoints, line + 7, len - 7))
+				if (!readWPL(line + 7, len - 7, waypoints))
 					return false;
 			} else if (!memcmp(line + 3, "ZDA,", 4)) {
-				if (!readZDA(line + 7, len - 7))
+				if (!readZDA(ctx, line + 7, len - 7))
 					return false;
 			}
 		}

src/data/nmeaparser.h

@@ -8,7 +8,7 @@
 class NMEAParser : public Parser
 {
 public:
-	NMEAParser() : _errorLine(0), _GGA(false) {}
+	NMEAParser() : _errorLine(0) {}
 
 	bool parse(QFile *file, QList<TrackData> &tracks, QList<RouteData> &routes,
 	  QList<Area> &polygons, QVector<Waypoint> &waypoints);
@@ -16,6 +16,14 @@ public:
 	int errorLine() const {return _errorLine;}
 
 private:
+	struct CTX {
+		CTX() : GGA(false) {}
+
+		QDate date;
+		QTime time;
+		bool GGA;
+	};
+
 	bool readEW(const char *data, int len, qreal &lon);
 	bool readLon(const char *data, int len, qreal &lon);
 	bool readNS(const char *data, int len, qreal &lat);
@@ -25,17 +33,13 @@ private:
 	bool readAltitude(const char *data, int len, qreal &ele);
 	bool readGeoidHeight(const char *data, int len, qreal &gh);
 
-	bool readRMC(SegmentData &segment, const char *line, int len);
-	bool readGGA(SegmentData &segment, const char *line, int len);
-	bool readWPL(QVector<Waypoint> &waypoints, const char *line, int len);
-	bool readZDA(const char *line, int len);
+	bool readRMC(CTX &ctx, const char *line, int len, SegmentData &segment);
+	bool readGGA(CTX &ctx, const char *line, int len, SegmentData &segment);
+	bool readWPL(const char *line, int len, QVector<Waypoint> &waypoints);
+	bool readZDA(CTX &ctx, const char *line, int len);
 
 	int _errorLine;
 	QString _errorString;
-
-	QDate _date;
-	QTime _time;
-	bool _GGA;
 };
 
 #endif // NMEAPARSER_H

src/data/smlparser.cpp

@@ -0,0 +1,163 @@
+#include "smlparser.h"
+
+
+#ifndef QT_NO_DEBUG
+QDebug operator<<(QDebug dbg, const SMLParser::Sensors &sensors)
+{
+	dbg.nospace() << "Sensors(" << sensors.cadence << ", "
+	  << sensors.temperature << ", " << sensors.hr << "," << sensors.power
+	  << ", " << sensors.speed << ")";
+
+	return dbg.space();
+}
+#endif // QT_NO_DEBUG
+
+
+void SMLParser::sample(SegmentData &segment, QMap<QDateTime, Sensors> &map)
+{
+	QDateTime timestamp;
+	Sensors sensors;
+	qreal lat = NAN, lon = NAN, altitude = NAN;
+	bool ok, periodic = false;
+
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("Latitude")) {
+			lat = _reader.readElementText().toDouble(&ok);
+			if (!ok || lat < -90 || lon > 90) {
+				_reader.raiseError("Invalid Latitude");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("Longitude")) {
+			lon = _reader.readElementText().toDouble(&ok);
+			if (!ok || lat < -180 || lon > 180) {
+				_reader.raiseError("Invalid Longitude");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("UTC")) {
+			timestamp = QDateTime::fromString(_reader.readElementText(),
+			  Qt::ISODate);
+			if (!timestamp.isValid()) {
+				_reader.raiseError("Invalid timestamp");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("GPSAltitude")) {
+			altitude = _reader.readElementText().toDouble(&ok);
+			if (!ok) {
+				_reader.raiseError("Invalid GPS altitude");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("SampleType")) {
+			if (_reader.readElementText() == "periodic")
+				periodic = true;
+		} else if (_reader.name() == QLatin1String("Cadence")) {
+			sensors.cadence = _reader.readElementText().toDouble(&ok);
+			if (!ok || sensors.cadence < 0) {
+				_reader.raiseError("Invalid Cadence");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("Temperature")) {
+			sensors.temperature = _reader.readElementText().toDouble(&ok);
+			// Temperature is in Kelvin units
+			if (!ok || sensors.temperature < 0) {
+				_reader.raiseError("Invalid Temperature");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("HR")) {
+			sensors.hr = _reader.readElementText().toDouble(&ok);
+			if (!ok || sensors.hr < 0) {
+				_reader.raiseError("Invalid HR");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("BikePower")) {
+			sensors.power = _reader.readElementText().toDouble(&ok);
+			if (!ok || sensors.power < 0) {
+				_reader.raiseError("Invalid BikePower");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("Speed")) {
+			sensors.speed = _reader.readElementText().toDouble(&ok);
+			if (!ok || sensors.speed < 0) {
+				_reader.raiseError("Invalid Speed");
+				return;
+			}
+		} else
+			_reader.skipCurrentElement();
+	}
+
+	if (periodic && timestamp.isValid())
+		map.insert(timestamp, sensors);
+	else if (!(std::isnan(lon) || std::isnan(lat))) {
+		Trackpoint t(Coordinates(rad2deg(lon), rad2deg(lat)));
+		t.setTimestamp(timestamp);
+		t.setElevation(altitude);
+
+		segment.append(t);
+	}
+}
+
+void SMLParser::samples(SegmentData &segment)
+{
+	QMap<QDateTime, Sensors> sensors;
+	QMap<QDateTime, Sensors>::const_iterator it;
+
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("Sample")) {
+			sample(segment, sensors);
+		} else
+			_reader.skipCurrentElement();
+	}
+
+	for (int i = 0; i < segment.size(); i++) {
+		Trackpoint &t = segment[i];
+		if ((it = sensors.lowerBound(t.timestamp())) != sensors.constEnd()) {
+			t.setCadence(it->cadence * 60);
+			t.setTemperature(it->temperature - 273.15);
+			t.setHeartRate(it->hr * 60);
+			t.setPower(it->power);
+			t.setSpeed(it->speed);
+		}
+	}
+}
+
+void SMLParser::deviceLog(TrackData &track)
+{
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("Samples")) {
+			track.append(SegmentData());
+			samples(track.last());
+		} else
+			_reader.skipCurrentElement();
+	}
+}
+
+void SMLParser::sml(QList<TrackData> &tracks)
+{
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("DeviceLog")) {
+			tracks.append(TrackData());
+			deviceLog(tracks.last());
+		} else
+			_reader.skipCurrentElement();
+	}
+}
+
+bool SMLParser::parse(QFile *file, QList<TrackData> &tracks,
+  QList<RouteData> &routes, QList<Area> &polygons,
+  QVector<Waypoint> &waypoints)
+{
+	Q_UNUSED(routes);
+	Q_UNUSED(polygons);
+	Q_UNUSED(waypoints);
+
+	_reader.clear();
+	_reader.setDevice(file);
+
+	if (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("sml"))
+			sml(tracks);
+		else
+			_reader.raiseError("Not a SML file");
+	}
+
+	return !_reader.error();
+}

src/data/smlparser.h

@@ -0,0 +1,38 @@
+#ifndef SMLPARSER_H
+#define SMLPARSER_H
+
+#include <QXmlStreamReader>
+#include <QMap>
+#include <QDebug>
+#include "parser.h"
+
+class SMLParser : public Parser
+{
+public:
+	bool parse(QFile *file, QList<TrackData> &tracks, QList<RouteData> &routes,
+	  QList<Area> &polygons, QVector<Waypoint> &waypoints);
+	QString errorString() const {return _reader.errorString();}
+	int errorLine() const {return _reader.lineNumber();}
+
+private:
+	struct Sensors
+	{
+		Sensors()
+		  : cadence(NAN), temperature(NAN), hr(NAN), power(NAN), speed(NAN) {}
+
+		qreal cadence, temperature, hr, power, speed;
+	};
+
+	void sml(QList<TrackData> &tracks);
+	void deviceLog(TrackData &track);
+	void samples(SegmentData &segment);
+	void sample(SegmentData &segment, QMap<QDateTime, Sensors> &map);
+
+#ifndef QT_NO_DEBUG
+	friend QDebug operator<<(QDebug dbg, const Sensors &sensors);
+#endif // QT_NO_DEBUG
+
+	QXmlStreamReader _reader;
+};
+
+#endif // SMLPARSER_H

src/map/IMG/bitstream.cpp

@@ -0,0 +1,79 @@
+#include "bitstream.h"
+
+
+bool BitStream1::read(int bits, quint32 &val)
+{
+	val = 0;
+
+	for (int pos = 0; pos < bits; ) {
+		if (!_remaining) {
+			if (!_length || !_file.readUInt8(_hdl, _data))
+				return false;
+			_remaining = 8;
+			_length--;
+		}
+
+		quint32 get = bits - pos;
+		if (get >= _remaining) {
+			val |= _data << pos;
+			pos += _remaining;
+			_remaining = 0;
+		} else {
+			quint32 mask = (1<<get) - 1;
+			val |= (_data & mask)<<pos;
+			_data >>= get;
+			_remaining -= get;
+			break;
+		}
+	}
+
+	return true;
+}
+
+bool BitStream1::flush()
+{
+	if (_length && !_file.seek(_hdl, _hdl.pos() + _length))
+		return false;
+
+	_length = 0;
+	_remaining = 0;
+
+	return true;
+}
+
+
+bool BitStream4::read(int bits, quint32 &val)
+{
+	if (bits <= 32 - (int)(_used + _unused)) {
+		val = bits ? (_data << _used) >> (32 - bits) : 0;
+		_used += bits;
+		return true;
+	}
+
+	quint32 old = (_used < 32) ? (_data << _used) >> (32 - bits) : 0;
+	quint32 bytes = qMin(_length, 4U);
+
+	if (!_file.readVUInt32SW(_hdl, bytes, _data))
+		return false;
+
+	_used -= 32 - bits;
+	_length -= bytes;
+	_unused = (4 - bytes) * 8;
+	_data <<= _unused;
+
+	val = _data >> (32 - _used) | old;
+
+	return true;
+}
+
+bool BitStream4::flush()
+{
+	if (_length && !_file.seek(_hdl, _hdl.pos() + _length))
+		return false;
+
+	_length = 0;
+	_used = 32;
+	_unused = 0;
+
+	return true;
+}

src/map/IMG/bitstream.h

@@ -0,0 +1,39 @@
+#ifndef BITSTREAM_H
+#define BITSTREAM_H
+
+#include "subfile.h"
+
+class BitStream1 {
+public:
+	BitStream1(const SubFile &file, SubFile::Handle &hdl, quint32 length)
+	  : _file(file), _hdl(hdl), _length(length), _remaining(0) {}
+
+	bool read(int bits, quint32 &val);
+	bool flush();
+	quint32 bitsAvailable() const {return _length * 8 + _remaining;}
+
+private:
+	const SubFile &_file;
+	SubFile::Handle &_hdl;
+	quint32 _length, _remaining;
+	quint8 _data;
+};
+
+class BitStream4 {
+public:
+	BitStream4(const SubFile &file, SubFile::Handle &hdl, quint32 length)
+	  : _file(file), _hdl(hdl), _length(length), _used(32), _unused(0),
+	  _data(0) {}
+
+	bool read(int bits, quint32 &val);
+	bool flush();
+	quint32 bitsAvailable() const {return _length * 8 + (32 - _used) - _unused;}
+
+private:
+	const SubFile &_file;
+	SubFile::Handle &_hdl;
+	quint32 _length, _used, _unused;
+	quint32 _data;
+};
+
+#endif // BITSTREAM_H

src/map/IMG/deltastream.cpp

@@ -0,0 +1,86 @@
+#include "deltastream.h"
+
+
+static int bitSize(quint8 baseSize, bool variableSign, bool extraBit)
+{
+	int bits = 2;
+	if (baseSize <= 9)
+		bits += baseSize;
+	else
+		bits += 2 * baseSize - 9;
+
+	if (variableSign)
+		bits++;
+	if (extraBit)
+		bits++;
+
+	return bits;
+}
+
+DeltaStream::DeltaStream(const SubFile &file, SubFile::Handle &hdl,
+  quint32 length, quint8 info, bool extraBit, bool extended)
+  : BitStream1(file, hdl, length), _readBits(0xFFFFFFFF)
+{
+	_extraBit = extraBit ? 1 : 0;
+	if (!(sign(_lonSign) && sign(_latSign)))
+		return;
+	if (extended) {
+		quint32 b;
+		if (!read(1, b))
+			return;
+	}
+	_lonBits = bitSize(info & 0x0F, !_lonSign, extraBit);
+	_latBits = bitSize(info >> 4, !_latSign, false);
+	_readBits = _lonBits + _latBits;
+}
+
+bool DeltaStream::readDelta(int bits, int sign, int extraBit,
+  qint32 &delta)
+{
+	quint32 value;
+
+	if (!read(bits, value))
+		return false;
+
+	value >>= extraBit;
+
+	if (!sign) {
+		qint32 signMask = 1 << (bits - extraBit - 1);
+		if (value & signMask) {
+			qint32 comp = value ^ signMask;
+			if (comp)
+				delta = comp - signMask;
+			else {
+				qint32 other;
+				if (!readDelta(bits - extraBit, sign, false, other))
+					return false;
+				if (other < 0)
+					delta = 1 - signMask + other;
+				else
+					delta = signMask - 1 + other;
+			}
+		} else {
+			delta = value;
+		}
+	} else {
+		delta = value * sign;
+	}
+
+	return true;
+}
+
+bool DeltaStream::sign(int &val)
+{
+	quint32 bit;
+	val = 0;
+
+	if (!read(1, bit))
+		return false;
+	if (bit) {
+		if (!read(1, bit))
+			return false;
+		val = bit ? -1 : 1;
+	}
+
+	return true;
+}

src/map/IMG/deltastream.h

@@ -0,0 +1,28 @@
+#ifndef DELTASTREAM_H
+#define DELTASTREAM_H
+
+#include "bitstream.h"
+
+class DeltaStream : public BitStream1 {
+public:
+	DeltaStream(const SubFile &file, SubFile::Handle &hdl, quint32 length,
+	  quint8 info, bool extraBit, bool extended);
+
+	bool readNext(qint32 &lonDelta, qint32 &latDelta)
+	{
+		return hasNext()
+			? (readDelta(_lonBits, _lonSign, _extraBit, lonDelta)
+			  && readDelta(_latBits, _latSign, false, latDelta)) : false;
+	}
+	bool atEnd() const {return (_readBits != 0xFFFFFFFF && !hasNext());}
+
+private:
+	bool hasNext() const {return bitsAvailable() >= _readBits;}
+	bool sign(int &val);
+	bool readDelta(int bits, int sign, int extraBit, qint32 &delta);
+
+	int _lonSign, _latSign, _extraBit;
+	quint32 _lonBits, _latBits, _readBits;
+};
+
+#endif // DELTASTREAM_H

src/map/IMG/gmap.cpp

@@ -0,0 +1,151 @@
+#include <QXmlStreamReader>
+#include <QDir>
+#include "vectortile.h"
+#include "gmap.h"
+
+
+static SubFile::Type tileType(const QString &suffix)
+{
+	if (!suffix.compare("TRE"))
+		return SubFile::TRE;
+	else if (!suffix.compare("RGN"))
+		return SubFile::RGN;
+	else if (!suffix.compare("LBL"))
+		return SubFile::LBL;
+	else if (!suffix.compare("TYP"))
+		return SubFile::TYP;
+	else if (!suffix.compare("GMP"))
+		return SubFile::GMP;
+	else if (!suffix.compare("NET"))
+		return SubFile::NET;
+	else
+		return SubFile::Unknown;
+}
+
+void GMAP::subProduct(QXmlStreamReader &reader, QString &dataDir,
+  QString &baseMap)
+{
+	while (reader.readNextStartElement()) {
+		if (reader.name() == "Directory")
+			dataDir = reader.readElementText();
+		else if (reader.name() == "BaseMap")
+			baseMap = reader.readElementText();
+		else
+			reader.skipCurrentElement();
+	}
+}
+
+void GMAP::mapProduct(QXmlStreamReader &reader, QString &dataDir,
+  QString &typFile, QString &baseMap)
+{
+	while (reader.readNextStartElement()) {
+		if (reader.name() == "Name")
+			_name = reader.readElementText();
+		else if (reader.name() == "TYP")
+			typFile = reader.readElementText();
+		else if (reader.name() == "SubProduct")
+			subProduct(reader, dataDir, baseMap);
+		else
+			reader.skipCurrentElement();
+	}
+}
+
+bool GMAP::readXML(const QString &path, QString &dataDir, QString &typFile,
+  QString &baseMap)
+{
+	QFile file(path);
+
+	if (!file.open(QFile::ReadOnly | QFile::Text))
+		return false;
+
+	QXmlStreamReader reader(&file);
+	if (reader.readNextStartElement()) {
+		if (reader.name() == "MapProduct")
+			mapProduct(reader, dataDir, typFile, baseMap);
+		else
+			reader.raiseError("Not a GMAP XML file");
+	}
+	if (reader.error()) {
+		_errorString = QString("%1: %2").arg(reader.lineNumber())
+		  .arg(reader.errorString());
+		return false;
+	}
+
+	return true;
+}
+
+bool GMAP::loadTile(const QDir &dir, bool baseMap)
+{
+	VectorTile *tile = new VectorTile();
+
+	QFileInfoList ml = dir.entryInfoList(QDir::Files);
+	for (int i = 0; i < ml.size(); i++) {
+		const QFileInfo &fi = ml.at(i);
+		tile->addFile(fi.absoluteFilePath(), tileType(fi.suffix()));
+	}
+
+	if (!tile->init(baseMap)) {
+		qWarning("%s: Invalid map tile", qPrintable(dir.path()));
+		delete tile;
+		return false;
+	}
+
+	double min[2], max[2];
+	min[0] = tile->bounds().left();
+	min[1] = tile->bounds().bottom();
+	max[0] = tile->bounds().right();
+	max[1] = tile->bounds().top();
+	_tileTree.Insert(min, max, tile);
+
+	_bounds |= tile->bounds();
+
+	return true;
+}
+
+GMAP::GMAP(const QString &fileName) : _fileName(fileName)
+{
+	QString dataDirPath, typFilePath, baseMapPath;
+	if (!readXML(fileName, dataDirPath, typFilePath, baseMapPath))
+		return;
+
+	QDir baseDir(QFileInfo(fileName).absoluteDir());
+	if (!baseDir.exists(dataDirPath)) {
+		_errorString = "Missing/invalid map data directory";
+		return;
+	}
+	QDir dataDir(baseDir.filePath(dataDirPath));
+	QFileInfoList ml = dataDir.entryInfoList(QDir::Dirs | QDir::NoDotAndDotDot);
+
+
+	QFileInfo baseMap(dataDir.filePath(baseMapPath));
+	_baseMap = !baseMapPath.isEmpty() && baseMap.exists();
+
+	for (int i = 0; i < ml.size(); i++) {
+		const QFileInfo &fi = ml.at(i);
+		if (fi.isDir())
+			loadTile(QDir(fi.absoluteFilePath()),
+			  fi.absoluteFilePath() == baseMap.absoluteFilePath());
+	}
+
+	if (baseDir.exists(typFilePath))
+		_typ = new SubFile(baseDir.filePath(typFilePath));
+
+	if (!_tileTree.Count())
+		_errorString = "No usable map tile found";
+	else
+		_valid = true;
+}
+
+bool GMAP::isGMAP(const QString &path)
+{
+	QFile file(path);
+
+	if (!file.open(QFile::ReadOnly | QFile::Text))
+		return false;
+
+	QXmlStreamReader reader(&file);
+	if (reader.readNextStartElement() && reader.name() == "MapProduct")
+		return true;
+
+	return false;
+}

src/map/IMG/gmap.h

@@ -0,0 +1,30 @@
+#ifndef GMAP_H
+#define GMAP_H
+
+#include "mapdata.h"
+
+class QXmlStreamReader;
+class QDir;
+
+class GMAP : public MapData
+{
+public:
+	GMAP(const QString &fileName);
+
+	QString fileName() const {return _fileName;}
+
+	static bool isGMAP(const QString &path);
+
+private:
+	bool readXML(const QString &path, QString &dataDir, QString &typFile,
+	  QString &baseMap);
+	void mapProduct(QXmlStreamReader &reader, QString &dataDir,
+	  QString &typFile, QString &baseMap);
+	void subProduct(QXmlStreamReader &reader, QString &dataDir,
+	  QString &baseMap);
+	bool loadTile(const QDir &dir, bool baseMap);
+
+	QString _fileName;
+};
+
+#endif // GMAP_H

src/map/IMG/huffmanstream.cpp

@@ -0,0 +1,74 @@
+#include "huffmanstream.h"
+
+
+HuffmanStream::HuffmanStream(const SubFile &file, SubFile::Handle &hdl,
+  quint32 length, const HuffmanTable &table, bool line)
+  : BitStream4(file, hdl, length), _table(table), _symbolDataSize(0),
+  _symbolData(0)
+{
+	if (line) {
+		if (!(sign(_lonSign) && sign(_latSign)))
+			return;
+	} else {
+		_lonSign = 0;
+		_latSign = 0;
+	}
+
+	quint32 eb;
+	if (!read(1, eb))
+		return;
+	if (eb) {
+		qWarning("Extended polygon/lines not supported");
+		flush();
+	}
+}
+
+bool HuffmanStream::sign(int &val)
+{
+	quint32 bit;
+	val = 0;
+
+	if (!read(1, bit))
+		return false;
+	if (bit) {
+		if (!read(1, bit))
+			return false;
+		val = bit ? -1 : 1;
+	}
+
+	return true;
+}
+
+bool HuffmanStream::readDelta(int sign, qint32 &symbol)
+{
+	quint8 size;
+	quint32 next;
+	quint8 nextSize = qMin((quint32)(32 - _symbolDataSize), bitsAvailable());
+
+	if (!read(nextSize, next))
+		return false;
+
+	_symbolData = (_symbolData << nextSize) | next;
+	_symbolDataSize += nextSize;
+
+	symbol = _table.symbol(_symbolData << (32 - _symbolDataSize), size);
+
+	if (size <= _symbolDataSize)
+		_symbolDataSize -= size;
+	else
+		return false;
+
+	if (symbol && !sign) {
+		if (!_symbolDataSize)
+			return false;
+		else {
+			sign = ((1U << (_symbolDataSize - 1)) & _symbolData) ? -1 : 1;
+			_symbolDataSize--;
+		}
+	}
+	symbol = sign * symbol;
+
+	return true;
+}
+
+

src/map/IMG/huffmanstream.h

@@ -0,0 +1,35 @@
+#ifndef HUFFMANSTREAM_H
+#define HUFFMANSTREAM_H
+
+#include "bitstream.h"
+#include "huffmantable.h"
+
+class HuffmanStream : public BitStream4 {
+public:
+	HuffmanStream(const SubFile &file, SubFile::Handle &hdl, quint32 length,
+	  const HuffmanTable &table, bool line);
+
+	bool readNext(qint32 &lonDelta, qint32 &latDelta)
+	{
+		if (!(readDelta(_lonSign, lonDelta) && readDelta(_latSign, latDelta)))
+			return false;
+
+		return (lonDelta || latDelta);
+	}
+
+	bool readOffset(qint32 &lonDelta, qint32 &latDelta)
+	  {return (readDelta(1, lonDelta) && readDelta(1, latDelta));}
+	bool atEnd() const
+	  {return _symbolDataSize + bitsAvailable() < _table.maxSymbolSize();}
+
+private:
+	bool sign(int &val);
+	bool readDelta(int sign, qint32 &delta);
+
+	const HuffmanTable &_table;
+	quint32 _symbolDataSize;
+	quint32 _symbolData;
+	int _lonSign, _latSign;
+};
+
+#endif // HUFFMANSTREAM_H

src/map/IMG/huffmantable.cpp

@@ -0,0 +1,139 @@
+#include "huffmantable.h"
+
+
+static quint8 vs(const quint8 b0)
+{
+	static const quint8 sizes[] = {4, 1, 2, 1, 3, 1, 2, 1};
+	return sizes[b0 & 0x07];
+}
+
+static inline quint8 bs(const quint8 val)
+{
+	return (val + 7) >> 3;
+}
+
+static inline quint32 readVUint32(const quint8 *buffer, quint32 bytes)
+{
+	quint32 val = 0;
+
+	for (quint32 i = bytes; i; i--)
+		val |= ((quint32)*(buffer + i)) << ((i-1) * 8);
+
+	return val;
+}
+
+bool HuffmanTable::load(const SubFile &file, SubFile::Handle &hdl,
+  quint32 offset, quint32 size, quint32 id)
+{
+	if (!getBuffer(file, hdl, offset, size, id))
+		return false;
+
+	_s0 = (quint8)_buffer.at(0) & 0x0F;
+	_s1e = (quint8)_buffer.at(0) & 0x10 ? 1 : 8;
+	_s2 = (quint8)_buffer.at(1);
+	_s3 = bs(_s2);
+	_s1d = (quint8)_buffer.at(2);
+	_s1f = (quint8)_buffer.at(3);
+	_s20 = bs(_s1f);
+	_s1 = _s20 + 1;
+	_s22 = vs(_buffer.at(4));
+	_s1c = _s3 + 1 + _s22;
+	_s14 = (quint8*)(_buffer.data()) + 4 + _s22;
+	_s10 = _s14 + _s1c * _s1d;
+	_s18 = _s10 + (_s1 << _s0);
+
+	return true;
+}
+
+bool HuffmanTable::getBuffer(const SubFile &file, SubFile::Handle &hdl,
+  quint32 offset, quint32 size, quint8 id)
+{
+	quint32 recordSize, recordOffset = offset;
+
+	for (int i = 0; i <= id; i++) {
+		if (!file.seek(hdl, recordOffset))
+			return false;
+		if (!file.readVUInt32(hdl, recordSize))
+			return false;
+		recordOffset = hdl.pos() + recordSize;
+		if (recordOffset > offset + size)
+			return false;
+	};
+
+	_buffer.resize(recordSize);
+	for (int i = 0; i < _buffer.size(); i++)
+		if (!file.readUInt8(hdl, *((quint8*)(_buffer.data() + i))))
+			return false;
+
+	return true;
+}
+
+quint32 HuffmanTable::symbol(quint32 data, quint8 &size) const
+{
+	quint32 ss, sym;
+	quint8 *tp;
+
+
+	if (_s0 == 0) {
+		sym = _s1d - 1;
+		ss = 0;
+	} else {
+		quint32 offset = _s1 * (data >> (0x20U - _s0));
+		tp = _s10 + offset;
+
+		if ((*tp & 1) != 0) {
+			sym = readVUint32(tp, _s20);
+			size = *tp >> 1;
+			return sym;
+		}
+
+		ss = *tp >> 1;
+		sym = tp[1];
+	}
+
+	tp = ss * _s1c + _s14;
+	data = data >> (0x20U - _s2);
+
+	quint8 *prev = tp;
+	while (ss < sym) {
+		quint32 cnt = (ss + 1 + sym) >> 1;
+		tp = _s14 + (cnt * _s1c);
+		quint32 nd = readVUint32(tp - 1, _s3);
+
+		if (data <= nd) {
+			if (data == nd)
+				ss = cnt;
+			else
+				tp = prev;
+
+			sym = cnt - (data < nd);
+			cnt = ss;
+		}
+		ss = cnt;
+		prev = tp;
+	}
+
+	sym = readVUint32(tp - 1, _s3);
+	tp = tp + _s3;
+	ss = readVUint32(tp, _s22);
+	size = *tp;
+	sym = (data - sym) >> (_s2 - *tp);
+
+	if (_s1e == 8)
+		sym = readVUint32(tp, _s20);
+	else {
+		sym = (sym + ss) * _s1f;
+		ss = sym >> 3;
+		sym = sym & 7;
+		quint32 shift = 8 - sym;
+		sym = *(_s18 + ss) >> sym;
+
+		if (shift < _s1f) {
+			tp = _s18 + ss;
+			ss = readVUint32(tp, ((_s1f + 7) - shift) >> 3);
+			sym = (ss << shift) | sym;
+		}
+	}
+
+	return sym;
+}

src/map/IMG/huffmantable.h

@@ -0,0 +1,27 @@
+#ifndef HUFFMANTABLE_H
+#define HUFFMANTABLE_H
+
+#include "subfile.h"
+
+class HuffmanTable {
+public:
+	HuffmanTable() : _s2(0) {}
+
+	bool load(const SubFile &file, SubFile::Handle &hdl, quint32 offset,
+	  quint32 size, quint32 id);
+	bool isNull() const {return _s2 == 0;}
+	quint8 maxSymbolSize() const {return _s2;}
+	quint32 symbol(quint32 data, quint8 &size) const;
+
+private:
+	bool getBuffer(const SubFile &file, SubFile::Handle &hdl, quint32 offset,
+	  quint32 size, quint8 id);
+
+	QByteArray _buffer;
+	quint8 _s0, _s1, _s2, _s3;
+	quint8 *_s10, *_s14, *_s18;
+	quint8 _s1c, _s1d, _s1e, _s1f, _s20;
+	quint16 _s22;
+};
+
+#endif // HUFFMANTABLE_H

src/map/IMG/img.cpp

@@ -1,35 +1,41 @@
-#include <QSet>
+#include <QMap>
 #include <QtEndian>
-#include "common/programpaths.h"
 #include "vectortile.h"
 #include "img.h"
 
 
-#define CACHE_SIZE 8388608 /* 8MB */
+typedef QMap<QByteArray, VectorTile*> TileMap;
 
+static SubFile::Type tileType(const char str[3])
+{
+	if (!memcmp(str, "TRE", 3))
+		return SubFile::TRE;
+	else if (!memcmp(str, "RGN", 3))
+		return SubFile::RGN;
+	else if (!memcmp(str, "LBL", 3))
+		return SubFile::LBL;
+	else if (!memcmp(str, "TYP", 3))
+		return SubFile::TYP;
+	else if (!memcmp(str, "GMP", 3))
+		return SubFile::GMP;
+	else if (!memcmp(str, "NET", 3))
+		return SubFile::NET;
+	else
+		return SubFile::Unknown;
+}
+
+IMG::IMG(const QString &fileName) : _file(fileName)
+{
 #define CHECK(condition) \
 	if (!(condition)) { \
 		_errorString = "Unsupported or invalid IMG file"; \
+		qDeleteAll(tileMap); \
 		return; \
 	}
 
-struct CTX
-{
-	CTX(const RectC &rect, int bits, QList<IMG::Poly> *polygons,
-	  QList<IMG::Poly> *lines, QList<IMG::Point> *points)
-	  : rect(rect), bits(bits), polygons(polygons), lines(lines),
-	  points(points) {}
+	TileMap tileMap;
+	QByteArray typFile;
 
-	const RectC &rect;
-	int bits;
-	QList<IMG::Poly> *polygons;
-	QList<IMG::Poly> *lines;
-	QList<IMG::Point> *points;
-};
-
-IMG::IMG(const QString &fileName)
-  : _file(fileName), _typ(0), _style(0), _valid(false)
-{
 	if (!_file.open(QFile::ReadOnly)) {
 		_errorString = _file.errorString();
 		return;
@@ -54,7 +60,6 @@ IMG::IMG(const QString &fileName)
 	QByteArray nba(QByteArray(d1, sizeof(d1)) + QByteArray(d2, sizeof(d2)));
 	_name = QString::fromLatin1(nba.constData(), nba.size()-1).trimmed();
 	_blockSize = 1 << (e1 + e2);
-	_blockCache.setMaxCost(CACHE_SIZE / _blockSize);
 
 	// Read the FAT table
 	quint8 flag;
@@ -75,22 +80,18 @@ IMG::IMG(const QString &fileName)
 	offset += 512;
 	int cnt = (size - offset) / 512;
 
-
-	QMap<QString, VectorTile*> tileMap;
-	QString typFile;
-
 	// Read FAT blocks describing the IMG sub-files
 	for (int i = 0; i < cnt; i++) {
 		quint16 block;
 		CHECK(_file.seek(offset) && readValue(flag) && read(name, sizeof(name))
 		  && read(type, sizeof(type)) && readValue(size) && readValue(part));
-		SubFile::Type tt = SubFile::type(type);
+		SubFile::Type tt = tileType(type);
 
-		QString fn(QByteArray(name, sizeof(name)));
-		if (SubFile::isTileFile(tt)) {
+		QByteArray fn(name, sizeof(name));
+		if (VectorTile::isTileFile(tt)) {
 			VectorTile *tile;
-			QMap<QString, VectorTile*>::iterator it = tileMap.find(fn);
-			if (it == tileMap.end()) {
+			TileMap::const_iterator it = tileMap.find(fn);
+			if (it == tileMap.constEnd()) {
 				tile = new VectorTile();
 				tileMap.insert(fn, tile);
 			} else
@@ -131,80 +132,31 @@ IMG::IMG(const QString &fileName)
 	}
 
 	// Create tile tree
-	for (QMap<QString, VectorTile*>::iterator it = tileMap.begin();
-	  it != tileMap.end(); ++it) {
-		CHECK((*it)->init());
+	for (TileMap::const_iterator it = tileMap.constBegin();
+	  it != tileMap.constEnd(); ++it) {
+		VectorTile *tile = it.value();
+
+		if (!tile->init(false)) {
+			qWarning("%s: %s: Invalid map tile", qPrintable(_file.fileName()),
+			  qPrintable(it.key()));
+			delete tile;
+			continue;
+		}
 
 		double min[2], max[2];
-		min[0] = (*it)->bounds().left();
-		min[1] = (*it)->bounds().bottom();
-		max[0] = (*it)->bounds().right();
-		max[1] = (*it)->bounds().top();
-		_tileTree.Insert(min, max, *it);
+		min[0] = tile->bounds().left();
+		min[1] = tile->bounds().bottom();
+		max[0] = tile->bounds().right();
+		max[1] = tile->bounds().top();
+		_tileTree.Insert(min, max, tile);
 
-		_bounds |= (*it)->bounds();
+		_bounds |= tile->bounds();
 	}
 
-	_valid = true;
-}
-
-IMG::~IMG()
-{
-	TileTree::Iterator it;
-	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
-		delete _tileTree.GetAt(it);
-
-	delete _typ;
-	delete _style;
-}
-
-void IMG::load()
-{
-	Q_ASSERT(!_style);
-
-	if (_typ)
-		_style = new Style(_typ);
-	else {
-		QFile typFile(ProgramPaths::typFile());
-		if (typFile.exists()) {
-			SubFile typ(&typFile);
-			_style = new Style(&typ);
-		} else
-			_style = new Style();
-	}
-}
-
-void IMG::clear()
-{
-	TileTree::Iterator it;
-	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
-		_tileTree.GetAt(it)->clear();
-
-	delete _style;
-	_style = 0;
-
-	_blockCache.clear();
-}
-
-static bool cb(VectorTile *tile, void *context)
-{
-	CTX *ctx = (CTX*)context;
-	tile->objects(ctx->rect, ctx->bits, ctx->polygons, ctx->lines, ctx->points);
-	return true;
-}
-
-void IMG::objects(const RectC &rect, int bits, QList<Poly> *polygons,
-  QList<Poly> *lines, QList<Point> *points)
-{
-	CTX ctx(rect, bits, polygons, lines, points);
-	double min[2], max[2];
-
-	min[0] = rect.left();
-	min[1] = rect.bottom();
-	max[0] = rect.right();
-	max[1] = rect.top();
-
-	_tileTree.Search(min, max, cb, &ctx);
+	if (!_tileTree.Count())
+		_errorString = "No usable map tile found";
+	else
+		_valid = true;
 }
 
 qint64 IMG::read(char *data, qint64 maxSize)
@@ -228,33 +180,12 @@ template<class T> bool IMG::readValue(T &val)
 	return true;
 }
 
-bool IMG::readBlock(int blockNum, QByteArray &data)
+bool IMG::readBlock(int blockNum, char *data)
 {
-	QByteArray *block = _blockCache[blockNum];
-	if (!block) {
-		if (!_file.seek((qint64)blockNum * (qint64)_blockSize))
-			return false;
-		data.resize(_blockSize);
-		if (read(data.data(), _blockSize) < _blockSize)
-			return false;
-		_blockCache.insert(blockNum, new QByteArray(data));
-	} else
-		data = *block;
+	if (!_file.seek((qint64)blockNum * (qint64)_blockSize))
+		return false;
+	if (read(data, _blockSize) < _blockSize)
+		return false;
 
 	return true;
 }
-
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const IMG::Point &point)
-{
-	dbg.nospace() << "Point(" << hex << point.type << ", " << point.label
-	  << ", " << point.poi << ")";
-	return dbg.space();
-}
-
-QDebug operator<<(QDebug dbg, const IMG::Poly &poly)
-{
-	dbg.nospace() << "Poly(" << hex << poly.type << ", " << poly.label << ")";
-	return dbg.space();
-}
-#endif // QT_NO_DEBUG

src/map/IMG/img.h

@@ -1,96 +1,27 @@
 #ifndef IMG_H
 #define IMG_H
 
-#include <QRect>
 #include <QFile>
-#include <QByteArray>
-#include <QCache>
-#include <QDebug>
-#include "common/rtree.h"
-#include "common/rectc.h"
-#include "common/range.h"
-#include "style.h"
-#include "label.h"
+#include "mapdata.h"
 
-class VectorTile;
-class SubFile;
-
-class IMG
+class IMG : public MapData
 {
 public:
-	struct Poly {
-		/* QPointF insted of Coordinates for performance reasons (no need to
-		   duplicate all the vectors for drawing). Note, that we do not want to
-		   ll2xy() the points in the IMG class as this can not be done in
-		   parallel. */
-		QVector<QPointF> points;
-		Label label;
-		quint32 type;
-
-		bool operator<(const Poly &other) const
-		  {return type > other.type;}
-	};
-
-	struct Point {
-		Point() : id(0) {}
-
-		Coordinates coordinates;
-		Label label;
-		quint32 type;
-		bool poi;
-		quint64 id;
-
-		bool operator<(const Point &other) const
-		  {return id < other.id;}
-	};
-
-
 	IMG(const QString &fileName);
-	~IMG();
-
-	void load();
-	void clear();
 
 	QString fileName() const {return _file.fileName();}
-	const QString &name() const {return _name;}
-	const RectC &bounds() const {return _bounds;}
-
-	void objects(const RectC &rect, int bits, QList<Poly> *polygons,
-	  QList<Poly> *lines, QList<Point> *points);
-	const Style *style() const {return _style;}
-
-	bool isValid() const {return _valid;}
-	const QString &errorString() const {return _errorString;}
 
 private:
 	friend class SubFile;
 
-	typedef RTree<VectorTile*, double, 2> TileTree;
-
 	int blockSize() const {return _blockSize;}
-	bool readBlock(int blockNum, QByteArray &data);
+	bool readBlock(int blockNum, char *data);
 	qint64 read(char *data, qint64 maxSize);
 	template<class T> bool readValue(T &val);
-	bool init();
 
 	QFile _file;
 	quint8 _key;
 	int _blockSize;
-	QCache<int, QByteArray> _blockCache;
-
-	QString _name;
-	RectC _bounds;
-	TileTree _tileTree;
-	SubFile *_typ;
-	Style *_style;
-
-	bool _valid;
-	QString _errorString;
 };
 
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const IMG::Point &point);
-QDebug operator<<(QDebug dbg, const IMG::Poly &poly);
-#endif // QT_NO_DEBUG
-
 #endif // IMG_H

src/map/IMG/lblfile.cpp

@@ -56,10 +56,10 @@ bool LBLFile::init(Handle &hdl)
 	quint8 multiplier, poiMultiplier;
 
 	if (!(seek(hdl, _gmpOffset + 0x15) && readUInt32(hdl, _offset)
-	  && readUInt32(hdl, _size) && readByte(hdl, multiplier)
-	  && readByte(hdl, _encoding) && seek(hdl, _gmpOffset + 0x57)
+	  && readUInt32(hdl, _size) && readUInt8(hdl, multiplier)
+	  && readUInt8(hdl, _encoding) && seek(hdl, _gmpOffset + 0x57)
 	  && readUInt32(hdl, _poiOffset) && readUInt32(hdl, _poiSize)
-	  && readByte(hdl, poiMultiplier) && seek(hdl, _gmpOffset + 0xAA)
+	  && readUInt8(hdl, poiMultiplier) && seek(hdl, _gmpOffset + 0xAA)
 	  && readUInt16(hdl, codepage)))
 		return false;
 
@@ -89,7 +89,7 @@ Label LBLFile::label6b(Handle &hdl, quint32 offset) const
 		return Label();
 
 	while (true) {
-		if (!(readByte(hdl, b1) && readByte(hdl, b2) && readByte(hdl, b3)))
+		if (!(readUInt8(hdl, b1) && readUInt8(hdl, b2) && readUInt8(hdl, b3)))
 			return Label();
 
 		int c[]= {b1>>2, (b1&0x3)<<4|b2>>4, (b2&0xF)<<2|b3>>6, b3&0x3F};
@@ -138,7 +138,7 @@ Label LBLFile::label8b(Handle &hdl, quint32 offset) const
 		return Label();
 
 	while (true) {
-		if (!readByte(hdl, c))
+		if (!readUInt8(hdl, c))
 			return Label();
 		if (!c || c == 0x1d)
 			break;

src/map/IMG/lblfile.h

@@ -12,6 +12,9 @@ public:
 	LBLFile(IMG *img)
 	  : SubFile(img), _codec(0), _offset(0), _size(0), _poiOffset(0),
 	  _poiSize(0), _poiMultiplier(0), _multiplier(0), _encoding(0) {}
+	LBLFile(const QString &path)
+	  : SubFile(path), _codec(0), _offset(0), _size(0), _poiOffset(0),
+	  _poiSize(0), _poiMultiplier(0), _multiplier(0), _encoding(0) {}
 	LBLFile(SubFile *gmp, quint32 offset) : SubFile(gmp, offset),
 	  _codec(0), _offset(0), _size(0), _poiOffset(0), _poiSize(0),
 	  _poiMultiplier(0), _multiplier(0), _encoding(0) {}

src/map/IMG/mapdata.cpp

@@ -0,0 +1,123 @@
+#include "common/programpaths.h"
+#include "vectortile.h"
+#include "style.h"
+#include "mapdata.h"
+
+
+#define CACHED_SUBDIVS_COUNT 2048 // ~32MB for both caches together
+
+struct PolyCTX
+{
+	PolyCTX(const RectC &rect, int bits, bool baseMap,
+	  QList<MapData::Poly> *polygons, QList<MapData::Poly> *lines,
+	  QCache<const SubDiv*, MapData::Polys> *polyCache)
+	  : rect(rect), bits(bits), baseMap(baseMap), polygons(polygons),
+	  lines(lines), polyCache(polyCache) {}
+
+	const RectC &rect;
+	int bits;
+	bool baseMap;
+	QList<MapData::Poly> *polygons;
+	QList<MapData::Poly> *lines;
+	QCache<const SubDiv*, MapData::Polys> *polyCache;
+};
+
+struct PointCTX
+{
+	PointCTX(const RectC &rect, int bits, bool baseMap,
+	  QList<MapData::Point> *points,
+	  QCache<const SubDiv*, QList<MapData::Point> > *pointCache)
+	  : rect(rect), bits(bits), baseMap(baseMap), points(points),
+	  pointCache(pointCache) {}
+
+	const RectC &rect;
+	int bits;
+	bool baseMap;
+	QList<MapData::Point> *points;
+	QCache<const SubDiv*, QList<MapData::Point> > *pointCache;
+};
+
+inline bool polyCb(VectorTile *tile, void *context)
+{
+	PolyCTX *ctx = (PolyCTX*)context;
+	tile->polys(ctx->rect, ctx->bits, ctx->baseMap, ctx->polygons, ctx->lines,
+	  ctx->polyCache);
+	return true;
+}
+
+inline bool pointCb(VectorTile *tile, void *context)
+{
+	PointCTX *ctx = (PointCTX*)context;
+	tile->points(ctx->rect, ctx->bits, ctx->baseMap, ctx->points,
+	  ctx->pointCache);
+	return true;
+}
+
+
+MapData::MapData() : _typ(0), _style(0), _baseMap(false), _valid(false)
+{
+	_polyCache.setMaxCost(CACHED_SUBDIVS_COUNT);
+	_pointCache.setMaxCost(CACHED_SUBDIVS_COUNT);
+}
+
+MapData::~MapData()
+{
+	TileTree::Iterator it;
+	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
+		delete _tileTree.GetAt(it);
+
+	delete _typ;
+	delete _style;
+}
+
+void MapData::polys(const RectC &rect, int bits, QList<Poly> *polygons,
+  QList<Poly> *lines)
+{
+	PolyCTX ctx(rect, bits, _baseMap, polygons, lines, &_polyCache);
+	double min[2], max[2];
+
+	min[0] = rect.left();
+	min[1] = rect.bottom();
+	max[0] = rect.right();
+	max[1] = rect.top();
+
+	_tileTree.Search(min, max, polyCb, &ctx);
+}
+
+void MapData::points(const RectC &rect, int bits, QList<Point> *points)
+{
+	PointCTX ctx(rect, bits, _baseMap, points, &_pointCache);
+	double min[2], max[2];
+
+	min[0] = rect.left();
+	min[1] = rect.bottom();
+	max[0] = rect.right();
+	max[1] = rect.top();
+
+	_tileTree.Search(min, max, pointCb, &ctx);
+}
+
+void MapData::load()
+{
+	Q_ASSERT(!_style);
+
+	if (_typ)
+		_style = new Style(_typ);
+	else {
+		SubFile typ(ProgramPaths::typFile());
+		_style = new Style(&typ);
+	}
+}
+
+void MapData::clear()
+{
+	TileTree::Iterator it;
+	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
+		_tileTree.GetAt(it)->clear();
+
+	delete _style;
+	_style = 0;
+
+	_polyCache.clear();
+	_pointCache.clear();
+}

src/map/IMG/mapdata.h

@@ -0,0 +1,107 @@
+#ifndef MAPDATA_H
+#define MAPDATA_H
+
+#include <QList>
+#include <QPointF>
+#include <QCache>
+#include <QDebug>
+#include "common/rectc.h"
+#include "common/rtree.h"
+#include "label.h"
+
+class Style;
+class SubDiv;
+class SubFile;
+class VectorTile;
+
+class MapData
+{
+public:
+	struct Poly {
+		/* QPointF insted of Coordinates for performance reasons (no need to
+		   duplicate all the vectors for drawing). Note, that we do not want to
+		   ll2xy() the points in the IMG class as this can not be done in
+		   parallel. */
+		QVector<QPointF> points;
+		Label label;
+		quint32 type;
+		RectC boundingRect;
+
+		bool operator<(const Poly &other) const
+		  {return type > other.type;}
+	};
+
+	struct Point {
+		Point() : id(0) {}
+
+		Coordinates coordinates;
+		Label label;
+		quint32 type;
+		bool poi;
+		quint64 id;
+
+		bool operator<(const Point &other) const
+		  {return id < other.id;}
+	};
+
+	struct Polys {
+		Polys() {}
+		Polys(const QList<Poly> &polygons, const QList<Poly> &lines)
+			: polygons(polygons), lines(lines) {}
+
+		QList<Poly> polygons;
+		QList<Poly> lines;
+	};
+
+	MapData();
+	virtual ~MapData();
+
+	const QString &name() const {return _name;}
+	const RectC &bounds() const {return _bounds;}
+	const Style *style() const {return _style;}
+	void polys(const RectC &rect, int bits, QList<Poly> *polygons,
+	  QList<Poly> *lines);
+	void points(const RectC &rect, int bits, QList<Point> *points);
+
+	void load();
+	void clear();
+
+	virtual QString fileName() const = 0;
+
+	bool isValid() const {return _valid;}
+	QString errorString() const {return _errorString;}
+
+protected:
+	typedef RTree<VectorTile*, double, 2> TileTree;
+
+	QString _name;
+	RectC _bounds;
+	SubFile *_typ;
+	Style *_style;
+	TileTree _tileTree;
+	bool _baseMap;
+
+	bool _valid;
+	QString _errorString;
+
+private:
+	QCache<const SubDiv*, Polys> _polyCache;
+	QCache<const SubDiv*, QList<Point> > _pointCache;
+};
+
+#ifndef QT_NO_DEBUG
+inline QDebug operator<<(QDebug dbg, const MapData::Point &point)
+{
+	dbg.nospace() << "Point(" << hex << point.type << ", " << point.label
+	  << ", " << point.poi << ")";
+	return dbg.space();
+}
+
+inline QDebug operator<<(QDebug dbg, const MapData::Poly &poly)
+{
+	dbg.nospace() << "Poly(" << hex << poly.type << ", " << poly.label << ")";
+	return dbg.space();
+}
+#endif // QT_NO_DEBUG
+
+#endif // MAPDATA_H

src/map/IMG/netfile.cpp

@@ -3,9 +3,11 @@
 bool NETFile::init(Handle &hdl)
 {
 	quint8 multiplier;
+	quint16 hdrLen;
 
-	if (!(seek(hdl, _gmpOffset + 0x15) && readUInt32(hdl, _offset)
-	  && readUInt32(hdl, _size) && readByte(hdl, multiplier)))
+	if (!(seek(hdl, _gmpOffset) && readUInt16(hdl, hdrLen)
+	  && seek(hdl, _gmpOffset + 0x15) && readUInt32(hdl, _offset)
+	  && readUInt32(hdl, _size) && readUInt8(hdl, multiplier)))
 		return false;
 
 	_multiplier = 1<<multiplier;

src/map/IMG/netfile.h

@@ -6,17 +6,19 @@
 class NETFile : public SubFile
 {
 public:
-	NETFile(IMG *img) : SubFile(img), _offset(0), _size(0), _multiplier(0) {}
-	NETFile(SubFile *gmp, quint32 offset) : SubFile(gmp, offset),
-	  _offset(0), _size(0), _multiplier(0) {}
+	NETFile(IMG *img)
+	  : SubFile(img), _offset(0), _size(0), _multiplier(0) {}
+	NETFile(const QString &path)
+	  : SubFile(path), _offset(0), _size(0), _multiplier(0) {}
+	NETFile(SubFile *gmp, quint32 offset)
+	  : SubFile(gmp, offset), _offset(0), _size(0), _multiplier(0) {}
 
 	bool lblOffset(Handle &hdl, quint32 netOffset, quint32 &lblOffset);
 
 private:
 	bool init(Handle &hdl);
 
-	quint32 _offset;
-	quint32 _size;
+	quint32 _offset, _size;
 	quint8 _multiplier;
 };
 

src/map/IMG/rgnfile.cpp

@@ -1,123 +1,81 @@
+#include <cstring>
 #include "common/rectc.h"
 #include "common/garmin.h"
+#include "deltastream.h"
+#include "huffmanstream.h"
 #include "lblfile.h"
 #include "netfile.h"
 #include "rgnfile.h"
 
 
-static int bitSize(quint8 baseSize, bool variableSign, bool extraBit)
+bool RGNFile::skipClassFields(Handle &hdl) const
 {
-	int bits = 2;
-	if (baseSize <= 9)
-		bits += baseSize;
-	else
-		bits += 2 * baseSize - 9;
+	quint8 flags;
+	quint32 rs;
 
-	if (variableSign)
-		bits++;
-	if (extraBit)
-		bits++;
+	if (!readUInt8(hdl, flags))
+		return false;
 
-	return bits;
-}
-
-bool RGNFile::BitStream::read(int bits, quint32 &val)
-{
-	val = 0;
-
-	for (int pos = 0; pos < bits; ) {
-		if (!_remaining) {
-			if (!_length || !_file.readByte(_hdl, _data))
-				return false;
-			_remaining = 8;
-			_length--;
-		}
-
-		quint32 get = bits - pos;
-		if (get >= _remaining) {
-			val |= _data << pos;
-			pos += _remaining;
-			_remaining = 0;
-		} else {
-			quint32 mask = (1<<get) - 1;
-			val |= (_data & mask)<<pos;
-			_data >>= get;
-			_remaining -= get;
+	switch (flags >> 5) {
+		case 4:
+			rs = 1;
+			break;
+		case 5:
+			rs = 2;
+			break;
+		case 6:
+			rs = 3;
+			break;
+		case 7:
+			if (!readVUInt32(hdl, rs))
+				return false;
+			break;
+		default:
+			rs = 0;
 			break;
-		}
 	}
 
-	return true;
+	return seek(hdl, hdl.pos() + rs);
 }
 
-RGNFile::DeltaStream::DeltaStream(const SubFile &file, Handle &hdl,
-  quint32 length, quint8 info, bool extraBit, bool extended)
-  : BitStream(file, hdl, length), _readBits(0xFFFFFFFF)
+bool RGNFile::skipLclFields(Handle &hdl, const quint32 flags[3],
+  SegmentType type) const
 {
-	_extraBit = extraBit ? 1 : 0;
-	if (!(sign(_lonSign) && sign(_latSign)))
-		return;
-	if (extended) {
-		quint32 b;
-		if (!read(1, b))
-			return;
-	}
-	_lonBits = bitSize(info & 0x0F, !_lonSign, extraBit);
-	_latBits = bitSize(info >> 4, !_latSign, false);
-	_readBits = _lonBits + _latBits;
-}
+	quint32 bitfield = 0xFFFFFFFF;
 
-bool RGNFile::DeltaStream::readDelta(int bits, int sign, int extraBit,
-  qint32 &delta)
-{
-	quint32 value;
-
-	if (!read(bits, value))
-		return false;
-
-	value >>= extraBit;
-
-	if (!sign) {
-		qint32 signMask = 1 << (bits - extraBit - 1);
-		if (value & signMask) {
-			qint32 comp = value ^ signMask;
-			if (comp)
-				delta = comp - signMask;
-			else {
-				qint32 other;
-				if (!readDelta(bits - extraBit, sign, false, other))
-					return false;
-				if (other < 0)
-					delta = 1 - signMask + other;
-				else
-					delta = signMask - 1 + other;
-			}
-		} else {
-			delta = value;
-		}
-	} else {
-		delta = value * sign;
-	}
-
-	return true;
-}
-
-bool RGNFile::DeltaStream::sign(int &val)
-{
-	quint32 bit;
-	val = 0;
-
-	if (!read(1, bit))
-		return false;
-	if (bit) {
-		if (!read(1, bit))
+	if (flags[0] & 0x20000000)
+		if (!readVBitfield32(hdl, bitfield))
 			return false;
-		val = bit ? -1 : 1;
+
+	for (int i = 0; i < 29; i++) {
+		if ((flags[0] >> i) & 1) {
+			if (bitfield & 1) {
+				quint32 m = flags[(i >> 4) + 1] >> ((i * 2) & 0x1e) & 3;
+				switch (i) {
+					case 5:
+						if (m == 1 && type == Point) {
+							quint16 u16;
+							if (!readUInt16(hdl, u16))
+								return false;
+						}
+						break;
+					default:
+						break;
+				}
+			}
+			bitfield >>= 1;
+		}
 	}
 
 	return true;
 }
 
+void RGNFile::clearFlags()
+{
+	memset(_polygonsFlags, 0, sizeof(_polygonsFlags));
+	memset(_linesFlags, 0, sizeof(_linesFlags));
+	memset(_pointsFlags, 0, sizeof(_pointsFlags));
+}
 
 bool RGNFile::init(Handle &hdl)
 {
@@ -128,25 +86,29 @@ bool RGNFile::init(Handle &hdl)
 	  && readUInt32(hdl, _size)))
 		return false;
 
-	if (hdrLen >= 0x5D) {
+	if (hdrLen >= 0x68) {
 		if (!(readUInt32(hdl, _polygonsOffset) && readUInt32(hdl, _polygonsSize)
-		  && seek(hdl, _gmpOffset + 0x39) && readUInt32(hdl, _linesOffset)
-		  && readUInt32(hdl, _linesSize) && seek(hdl, _gmpOffset + 0x55)
-		  && readUInt32(hdl, _pointsOffset) && readUInt32(hdl, _pointsSize)))
+		  && seek(hdl, _gmpOffset + 0x2D) && readUInt32(hdl, _polygonsFlags[0])
+		  && readUInt32(hdl, _polygonsFlags[1]) && readUInt32(hdl, _polygonsFlags[2])
+		  && readUInt32(hdl, _linesOffset) && readUInt32(hdl, _linesSize)
+		  && seek(hdl, _gmpOffset + 0x49) && readUInt32(hdl, _linesFlags[0])
+		  && readUInt32(hdl, _linesFlags[1]) && readUInt32(hdl, _linesFlags[2])
+		  && readUInt32(hdl, _pointsOffset) && readUInt32(hdl, _pointsSize)
+		  && seek(hdl, _gmpOffset + 0x65) && readUInt32(hdl, _pointsFlags[0])
+		  && readUInt32(hdl, _pointsFlags[1]) && readUInt32(hdl, _pointsFlags[2])))
 			return false;
 	}
 
 	if (hdrLen >= 0x7D) {
-		quint32 dictOffset, dictSize;
+		quint32 dictOffset, dictSize, info;
 		if (!(seek(hdl, _gmpOffset + 0x71) && readUInt32(hdl, dictOffset)
-		  && readUInt32(hdl, dictSize)))
+		  && readUInt32(hdl, dictSize) && readUInt32(hdl, info)))
 			return false;
 
-		// NT maps
-		if (dictSize || dictOffset) {
-			qWarning("NT compression not supported");
-			return false;
-		}
+		if (dictSize && dictOffset && (info & 0x1E))
+			if (!_huffmanTable.load(*this, hdl, dictOffset, dictSize,
+			  ((info >> 1) & 0xF) - 1))
+				return false;
 	}
 
 	_init = true;
@@ -154,14 +116,16 @@ bool RGNFile::init(Handle &hdl)
 	return true;
 }
 
-bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-  const Segment &segment, LBLFile *lbl, Handle &lblHdl, NETFile *net,
+bool RGNFile::polyObjects(Handle &hdl, const SubDiv *subdiv,
+  SegmentType segmentType, LBLFile *lbl, Handle &lblHdl, NETFile *net,
   Handle &netHdl, QList<IMG::Poly> *polys) const
 {
-	if (segment.start() == segment.end())
-		return true;
+	const SubDiv::Segment &segment = (segmentType == Line)
+	 ? subdiv->lines() : subdiv->polygons();
 
-	if (!seek(hdl, segment.start()))
+	if (!segment.isValid())
+		return true;
+	if (!seek(hdl, segment.offset()))
 		return false;
 
 	quint32 labelPtr;
@@ -169,31 +133,31 @@ bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 	qint16 lon, lat;
 	quint16 len;
 
-	while (hdl.pos < (int)segment.end()) {
+	while (hdl.pos() < (int)segment.end()) {
 		IMG::Poly poly;
 
-		if (!(readByte(hdl, type) && readUInt24(hdl, labelPtr)
+		if (!(readUInt8(hdl, type) && readUInt24(hdl, labelPtr)
 		  && readInt16(hdl, lon) && readInt16(hdl, lat)))
 			return false;
 		if (type & 0x80) {
 			if (!readUInt16(hdl, len))
 				return false;
 		} else {
-			if (!readByte(hdl, len8))
+			if (!readUInt8(hdl, len8))
 				return false;
 			len = len8;
 		}
-		if (!readByte(hdl, bitstreamInfo))
+		if (!readUInt8(hdl, bitstreamInfo))
 			return false;
 
-		poly.type = (segment.type() == Segment::Polygon)
+		poly.type = (segmentType == Polygon)
 		  ? ((quint32)(type & 0x7F)) << 8 : ((quint32)(type & 0x3F)) << 8;
 
 
 		QPoint pos(subdiv->lon() + ((qint32)lon<<(24-subdiv->bits())),
 		  subdiv->lat() + ((qint32)lat<<(24-subdiv->bits())));
 		Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
-		RectC br(c, c);
+		poly.boundingRect = RectC(c, c);
 		poly.points.append(QPointF(c.lon(), c.lat()));
 
 		qint32 lonDelta, latDelta;
@@ -205,14 +169,11 @@ bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 
 			Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
 			poly.points.append(QPointF(c.lon(), c.lat()));
-			br = br.united(c);
+			poly.boundingRect = poly.boundingRect.united(c);
 		}
 		if (!(stream.atEnd() && stream.flush()))
 			return false;
 
-		if (!rect.intersects(br))
-			continue;
-
 		if (lbl && (labelPtr & 0x3FFFFF)) {
 			if (labelPtr & 0x800000) {
 				quint32 lblOff;
@@ -229,60 +190,96 @@ bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 	return true;
 }
 
-bool RGNFile::extPolyObjects(const RectC &rect, Handle &hdl,
-  const SubDiv *subdiv, const Segment &segment, LBLFile *lbl, Handle &lblHdl,
+bool RGNFile::extPolyObjects(Handle &hdl, const SubDiv *subdiv, quint32 shift,
+  SegmentType segmentType, LBLFile *lbl, Handle &lblHdl,
   QList<IMG::Poly> *polys) const
 {
-	quint32 len, labelPtr = 0;
-	quint8 type, subtype, bitstreamInfo;
+	quint32 labelPtr, len;
+	quint8 type, subtype;
 	qint16 lon, lat;
+	const SubDiv::Segment &segment = (segmentType == Line)
+	 ? subdiv->extLines() : subdiv->extPolygons();
 
 
-	if (!seek(hdl, segment.start()))
+	if (!segment.isValid())
+		return true;
+	if (!seek(hdl, segment.offset()))
 		return false;
 
-	while (hdl.pos < (int)segment.end()) {
+	while (hdl.pos() < (int)segment.end()) {
 		IMG::Poly poly;
+		QPoint pos;
 
-		if (!(readByte(hdl, type) && readByte(hdl, subtype)
+		if (!(readUInt8(hdl, type) && readUInt8(hdl, subtype)
 		  && readInt16(hdl, lon) && readInt16(hdl, lat)
-		  && readVUInt32(hdl, len) && readByte(hdl, bitstreamInfo)))
+		  && readVUInt32(hdl, len)))
 			return false;
 
-		if (subtype & 0x80) {
-			qWarning("Polygons/lines with extra bytes not supported");
-			return false;
-		}
+		poly.type = 0x10000 | (quint16(type)<<8) | (subtype & 0x1F);
+		labelPtr = 0;
 
-		poly.type = 0x10000 + (quint16(type) << 8) + (subtype & 0x1F);
+		if (!_huffmanTable.isNull()) {
+			pos = QPoint((subdiv->lon()<<8) + ((qint32)lon<<(32-subdiv->bits())),
+			  (subdiv->lat()<<8) + ((qint32)lat<<(32-subdiv->bits())));
 
-		QPoint pos(subdiv->lon() + ((qint32)lon<<(24-subdiv->bits())),
-		  subdiv->lat() + ((qint32)lat<<(24-subdiv->bits())));
-		Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
-		RectC br(c, c);
-		poly.points.append(QPointF(c.lon(), c.lat()));
+			qint32 lonDelta, latDelta;
+			HuffmanStream stream(*this, hdl, len, _huffmanTable,
+			  segmentType == Line);
 
-		qint32 lonDelta, latDelta;
-		DeltaStream stream(*this, hdl, len - 1, bitstreamInfo, false, true);
-		while (stream.readNext(lonDelta, latDelta)) {
-			pos.rx() += lonDelta<<(24-subdiv->bits());
-			pos.ry() += latDelta<<(24-subdiv->bits());
-
-			Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
+			if (shift) {
+				if (!stream.readOffset(lonDelta, latDelta))
+					return false;
+				pos = QPoint(pos.x() | lonDelta<<(32-subdiv->bits()-shift),
+				  pos.y() | latDelta<<(32-subdiv->bits()-shift));
+			}
+			Coordinates c(toWGS32(pos.x()), toWGS32(pos.y()));
+			poly.boundingRect = RectC(c, c);
 			poly.points.append(QPointF(c.lon(), c.lat()));
-			br = br.united(c);
-		}
-		if (!(stream.atEnd() && stream.flush()))
-			return false;
 
-		if ((subtype & 0x20)) {
-			if (!readUInt24(hdl, labelPtr))
+			while (stream.readNext(lonDelta, latDelta)) {
+				pos.rx() += lonDelta<<(32-subdiv->bits()-shift);
+				pos.ry() += latDelta<<(32-subdiv->bits()-shift);
+
+				Coordinates c(toWGS32(pos.x()), toWGS32(pos.y()));
+				poly.points.append(QPointF(c.lon(), c.lat()));
+				poly.boundingRect = poly.boundingRect.united(c);
+			}
+
+			if (!(stream.atEnd() && stream.flush()))
 				return false;
-		} else
-			labelPtr = 0;
+		} else {
+			pos = QPoint(subdiv->lon() + ((qint32)lon<<(24-subdiv->bits())),
+			  subdiv->lat() + ((qint32)lat<<(24-subdiv->bits())));
+			Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
+			poly.boundingRect = RectC(c, c);
+			poly.points.append(QPointF(c.lon(), c.lat()));
 
-		if (!rect.intersects(br))
-			continue;
+			quint8 bitstreamInfo;
+			if (!readUInt8(hdl, bitstreamInfo))
+				return false;
+
+			qint32 lonDelta, latDelta;
+			DeltaStream stream(*this, hdl, len - 1, bitstreamInfo, false, true);
+
+			while (stream.readNext(lonDelta, latDelta)) {
+				pos.rx() += lonDelta<<(24-subdiv->bits());
+				pos.ry() += latDelta<<(24-subdiv->bits());
+
+				Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
+				poly.points.append(QPointF(c.lon(), c.lat()));
+				poly.boundingRect = poly.boundingRect.united(c);
+			}
+			if (!(stream.atEnd() && stream.flush()))
+				return false;
+		}
+
+		if (subtype & 0x20 && !readUInt24(hdl, labelPtr))
+			return false;
+		if (subtype & 0x80 && !skipClassFields(hdl))
+			return false;
+		if (subtype & 0x40 && !skipLclFields(hdl, segmentType == Line
+		  ? _linesFlags : _polygonsFlags, segmentType))
+			return false;
 
 		if (lbl && (labelPtr & 0x3FFFFF))
 			poly.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF);
@@ -293,45 +290,47 @@ bool RGNFile::extPolyObjects(const RectC &rect, Handle &hdl,
 	return true;
 }
 
-bool RGNFile::pointObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-  const Segment &segment, LBLFile *lbl, Handle &lblHdl,
+bool RGNFile::pointObjects(Handle &hdl, const SubDiv *subdiv,
+  SegmentType segmentType, LBLFile *lbl, Handle &lblHdl,
   QList<IMG::Point> *points) const
 {
 	quint8 type, subtype;
 	qint16 lon, lat;
 	quint32 labelPtr;
+	const SubDiv::Segment &segment = (segmentType == IndexedPoint)
+	 ? subdiv->idxPoints() : subdiv->points();
 
-	if (!seek(hdl, segment.start()))
+	if (!segment.isValid())
+		return true;
+	if (!seek(hdl, segment.offset()))
 		return false;
 
-	while (hdl.pos < (int)segment.end()) {
+	while (hdl.pos() < (int)segment.end()) {
 		IMG::Point point;
 
-		if (!(readByte(hdl, type) && readUInt24(hdl, labelPtr)
+		if (!(readUInt8(hdl, type) && readUInt24(hdl, labelPtr)
 		  && readInt16(hdl, lon) && readInt16(hdl, lat)))
 			return false;
 		if (labelPtr & 0x800000) {
-			if (!readByte(hdl, subtype))
+			if (!readUInt8(hdl, subtype))
 				return false;
 		} else
 			subtype = 0;
 
 		point.type = (quint16)type<<8 | subtype;
 
-		qint16 lonOffset = lon<<(24-subdiv->bits());
-		qint16 latOffset = lat<<(24-subdiv->bits());
+		qint32 lonOffset = lon<<(24-subdiv->bits());
+		qint32 latOffset = lat<<(24-subdiv->bits());
 		point.coordinates = Coordinates(toWGS24(subdiv->lon() + lonOffset),
 		  toWGS24(subdiv->lat() + latOffset));
 
-		if (!rect.contains(point.coordinates))
-			continue;
-
+		uint hash = qHash(QPair<uint,uint>(qHash(QPair<qint32, qint32>
+		  (subdiv->lon() + lonOffset, subdiv->lat() + latOffset)),
+		  labelPtr & 0x3FFFFF));
+		point.id = ((quint64)point.type)<<32 | hash;
 		point.poi = labelPtr & 0x400000;
-		if (lbl && (labelPtr & 0x3FFFFF)) {
+		if (lbl && (labelPtr & 0x3FFFFF))
 			point.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF, point.poi);
-			point.id = ((quint64)point.type)<<40 | ((quint64)lbl->offset())<<24
-			  | (labelPtr & 0x3FFFFF);
-		}
 
 		points->append(point);
 	}
@@ -339,167 +338,134 @@ bool RGNFile::pointObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 	return true;
 }
 
-bool RGNFile::extPointObjects(const RectC &rect, Handle &hdl,
-  const SubDiv *subdiv, const Segment &segment, LBLFile *lbl, Handle &lblHdl,
-  QList<IMG::Point> *points) const
+bool RGNFile::extPointObjects(Handle &hdl, const SubDiv *subdiv, LBLFile *lbl,
+  Handle &lblHdl, QList<IMG::Point> *points) const
 {
 	quint8 type, subtype;
 	qint16 lon, lat;
 	quint32 labelPtr;
+	const SubDiv::Segment &segment = subdiv->extPoints();
 
-	if (!seek(hdl, segment.start()))
+
+	if (!segment.isValid())
+		return true;
+	if (!seek(hdl, segment.offset()))
 		return false;
 
-	while (hdl.pos < (int)segment.end()) {
+	while (hdl.pos() < (int)segment.end()) {
 		IMG::Point point;
 
-		if (!(readByte(hdl, type) && readByte(hdl, subtype)
+		if (!(readUInt8(hdl, type) && readUInt8(hdl, subtype)
 		  && readInt16(hdl, lon) && readInt16(hdl, lat)))
 			return false;
 
-		if (subtype & 0x80) {
-			qWarning("Points with extra bytes not supported");
-			return false;
-		}
-
 		point.type = 0x10000 | (((quint32)type)<<8) | (subtype & 0x1F);
 
-		qint16 lonOffset = lon<<(24-subdiv->bits());
-		qint16 latOffset = lat<<(24-subdiv->bits());
+		qint32 lonOffset = lon<<(24-subdiv->bits());
+		qint32 latOffset = lat<<(24-subdiv->bits());
 		point.coordinates = Coordinates(toWGS24(subdiv->lon() + lonOffset),
 		  toWGS24(subdiv->lat() + latOffset));
+		labelPtr = 0;
 
-		if (subtype & 0x20) {
-			if (!readUInt24(hdl, labelPtr))
-				return false;
-			point.poi = labelPtr & 0x400000;
-			if (lbl && (labelPtr & 0x3FFFFF)) {
-				point.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF, point.poi);
-				point.id = ((quint64)point.type)<<40
-				  | ((quint64)lbl->offset())<<24 | (labelPtr & 0x3FFFFF);
-			}
-		}
+		if (subtype & 0x20 && !readUInt24(hdl, labelPtr))
+			return false;
+		if (subtype & 0x80 && !skipClassFields(hdl))
+			return false;
+		if (subtype & 0x40 && !skipLclFields(hdl, _pointsFlags, Point))
+			return false;
 
-		if (rect.contains(point.coordinates))
-			points->append(point);
+		// Discard NT points breaking style draw order logic (and causing huge
+		// performance drawback)
+		if (point.type == 0x11400)
+			continue;
+
+		uint hash = qHash(QPair<uint,uint>(qHash(QPair<qint32, qint32>
+		  (subdiv->lon() + lonOffset, subdiv->lat() + latOffset)),
+		  labelPtr & 0x3FFFFF));
+		point.id = ((quint64)point.type)<<32 | hash;
+		point.poi = labelPtr & 0x400000;
+		if (lbl && (labelPtr & 0x3FFFFF))
+			point.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF, point.poi);
+
+		points->append(point);
 	}
 
 	return true;
 }
 
-
-void RGNFile::objects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
-  NETFile *net, QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
-  QList<IMG::Point> *points)
+QMap<RGNFile::SegmentType, SubDiv::Segment> RGNFile::segments(Handle &hdl,
+  SubDiv *subdiv) const
 {
-	Handle rgnHdl, lblHdl, netHdl;
+	QMap<SegmentType, SubDiv::Segment> ret;
 
-	if (!_init && !init(rgnHdl))
-		return;
-
-	QVector<RGNFile::Segment> seg(segments(rgnHdl, subdiv));
-	for (int i = 0; i < seg.size(); i++) {
-		switch (seg.at(i).type()) {
-			case Segment::Point:
-			case Segment::IndexedPoint:
-				if (points)
-					pointObjects(rect, rgnHdl, subdiv, seg.at(i), lbl, lblHdl,
-					  points);
-				break;
-			case Segment::Line:
-				if (lines)
-					polyObjects(rect, rgnHdl, subdiv, seg.at(i), lbl, lblHdl,
-					  net, netHdl, lines);
-				break;
-			case Segment::Polygon:
-				if (polygons)
-					polyObjects(rect, rgnHdl, subdiv, seg.at(i), lbl, lblHdl,
-					  net, netHdl, polygons);
-				break;
-		}
-	}
-}
-
-void RGNFile::extObjects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
-  QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
-  QList<IMG::Point> *points)
-{
-	Handle rgnHdl, lblHdl;
-
-	if (!_init && !init(rgnHdl))
-		return;
-
-	if (polygons && subdiv->polygonsOffset() != subdiv->polygonsEnd()) {
-		quint32 start = _polygonsOffset + subdiv->polygonsOffset();
-		quint32 end = subdiv->polygonsEnd()
-		  ? _polygonsOffset + subdiv->polygonsEnd()
-		  : _polygonsOffset + _polygonsSize;
-		extPolyObjects(rect, rgnHdl, subdiv, Segment(start, end,
-		  Segment::Polygon), lbl, lblHdl, polygons);
-	}
-	if (lines && subdiv->linesOffset() != subdiv->linesEnd()) {
-		quint32 start = _linesOffset + subdiv->linesOffset();
-		quint32 end = subdiv->linesEnd()
-		  ? _linesOffset + subdiv->linesEnd()
-		  : _linesOffset + _linesSize;
-		extPolyObjects(rect, rgnHdl, subdiv, Segment(start, end, Segment::Line),
-		  lbl, lblHdl, lines);
-	}
-	if (points && subdiv->pointsOffset() != subdiv->pointsEnd()) {
-		quint32 start = _pointsOffset + subdiv->pointsOffset();
-		quint32 end = subdiv->pointsEnd()
-		  ? _pointsOffset + subdiv->pointsEnd()
-		  : _pointsOffset + _pointsSize;
-		extPointObjects(rect, rgnHdl, subdiv, Segment(start, end,
-		  Segment::Point), lbl, lblHdl, points);
-	}
-}
-
-QVector<RGNFile::Segment> RGNFile::segments(Handle &hdl, const SubDiv *subdiv)
-  const
-{
-	if (subdiv->offset() == subdiv->end() || !(subdiv->objects() & 0xF0))
-		return QVector<Segment>();
+	if (subdiv->offset() == subdiv->end() || !(subdiv->objects() & 0x1F))
+		return ret;
 
 	quint32 offset = _offset + subdiv->offset();
 
 	int no = 0;
-	for (quint8 mask = 0x10; mask; mask <<= 1)
+	for (quint8 mask = 0x1; mask <= 0x10; mask <<= 1)
 		if (subdiv->objects() & mask)
 			no++;
 
 	if (!seek(hdl, offset))
-		return QVector<Segment>();
+		return ret;
 
-	QVector<Segment> ret;
 	quint32 start = offset + 2 * (no - 1);
-	quint16 po;
-	int cnt = 0;
+	quint32 ls = 0;
+	SegmentType lt = (SegmentType)0;
 
-	for (quint8 mask = 0x10; mask; mask <<= 1) {
+	for (quint16 mask = 0x1; mask <= 0x10; mask <<= 1) {
 		if (subdiv->objects() & mask) {
-			if (cnt) {
-				if (!readUInt16(hdl, po))
-					return QVector<Segment>();
+			if (ls) {
+				quint16 po;
+				if (!readUInt16(hdl, po) || !po)
+					return QMap<RGNFile::SegmentType, SubDiv::Segment>();
 				start = offset + po;
+				ret.insert(lt, SubDiv::Segment(ls, start));
 			}
-			if (!ret.isEmpty())
-				ret.last().setEnd(start);
-			ret.append(Segment(start, (Segment::Type)mask));
-			cnt++;
+
+			lt = (SegmentType)mask;
+			ls = start;
 		}
 	}
 
-	ret.last().setEnd(subdiv->end() ? _offset + subdiv->end() : _offset + _size);
+	ret.insert(lt, SubDiv::Segment(ls, subdiv->end()
+	  ? _offset + subdiv->end() : _offset + _size));
 
 	return ret;
 }
 
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const RGNFile::Segment &segment)
+bool RGNFile::subdivInit(Handle &hdl, SubDiv *subdiv) const
 {
-	dbg.nospace() << "Segment(" << segment.start() << ", " << segment.end()
-	  << ", " << segment.type() << ")";
-	return dbg.space();
+	QMap<RGNFile::SegmentType, SubDiv::Segment> seg(segments(hdl, subdiv));
+	SubDiv::Segment extPoints, extLines, extPolygons;
+
+	if (subdiv->extPointsOffset() != subdiv->extPointsEnd()) {
+		quint32 start = _pointsOffset + subdiv->extPointsOffset();
+		quint32 end = subdiv->extPointsEnd()
+		  ? _pointsOffset + subdiv->extPointsEnd()
+		  : _pointsOffset + _pointsSize;
+		extPoints = SubDiv::Segment(start, end);
+	}
+	if (subdiv->extPolygonsOffset() != subdiv->extPolygonsEnd()) {
+		quint32 start = _polygonsOffset + subdiv->extPolygonsOffset();
+		quint32 end = subdiv->extPolygonsEnd()
+		  ? _polygonsOffset + subdiv->extPolygonsEnd()
+		  : _polygonsOffset + _polygonsSize;
+		extPolygons = SubDiv::Segment(start, end);
+	}
+	if (subdiv->extLinesOffset() != subdiv->extLinesEnd()) {
+		quint32 start = _linesOffset + subdiv->extLinesOffset();
+		quint32 end = subdiv->extLinesEnd()
+		  ? _linesOffset + subdiv->extLinesEnd()
+		  : _linesOffset + _linesSize;
+		extLines = SubDiv::Segment(start, end);
+	}
+
+	subdiv->init(seg.value(Point), seg.value(IndexedPoint), seg.value(Line),
+	  seg.value(Polygon), seg.value(RoadReference), extPoints, extLines,
+	  extPolygons);
+
+	return true;
 }
-#endif // QT_NO_DEBUG

src/map/IMG/rgnfile.h

@@ -4,6 +4,7 @@
 #include "img.h"
 #include "subfile.h"
 #include "subdiv.h"
+#include "huffmantable.h"
 
 class LBLFile;
 class NETFile;
@@ -11,121 +12,67 @@ class NETFile;
 class RGNFile : public SubFile
 {
 public:
+	enum SegmentType {
+		Point = 0x1,
+		IndexedPoint = 0x2,
+		Line = 0x4,
+		Polygon = 0x8,
+		RoadReference = 0x10
+	};
+
 	RGNFile(IMG *img)
 	  : SubFile(img), _offset(0), _size(0), _polygonsOffset(0),
 	  _polygonsSize(0), _linesOffset(0), _linesSize(0), _pointsOffset(0),
-	  _pointsSize(0), _init(false) {}
+	  _pointsSize(0), _init(false) {clearFlags();}
+	RGNFile(const QString &path)
+	  : SubFile(path), _offset(0), _size(0), _polygonsOffset(0),
+	  _polygonsSize(0), _linesOffset(0), _linesSize(0), _pointsOffset(0),
+	  _pointsSize(0), _init(false) {clearFlags();}
 	RGNFile(SubFile *gmp, quint32 offset) : SubFile(gmp, offset), _offset(0),
 	  _size(0), _polygonsOffset(0), _polygonsSize(0), _linesOffset(0),
-	  _linesSize(0), _pointsOffset(0), _pointsSize(0), _init(false) {}
-
-	void objects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
-	  NETFile *net, QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
-	  QList<IMG::Point> *points);
-	void extObjects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
-	  QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
-	  QList<IMG::Point> *points);
-
-private:
-	class Segment {
-	public:
-		enum Type {
-			Point = 0x10,
-			IndexedPoint = 0x20,
-			Line = 0x40,
-			Polygon = 0x80
-		};
-
-		Segment() : _start(0), _end(0), _type(Point) {}
-		Segment(quint32 start, Type type)
-		  : _start(start), _end(0), _type(type) {}
-		Segment(quint32 start, quint32 end, Type type)
-		  : _start(start), _end(end), _type(type) {}
-
-		void setEnd(quint32 end) {_end = end;}
-
-		quint32 start() const {return _start;}
-		quint32 end() const {return _end;}
-		Type type() const {return _type;}
-
-	private:
-		quint32 _start;
-		quint32 _end;
-		Type _type;
-	};
-
-	class BitStream {
-	public:
-		BitStream(const SubFile &file, Handle &hdl, quint32 length)
-		  : _file(file), _hdl(hdl), _length(length), _remaining(0) {}
-
-		bool read(int bits, quint32 &val);
-		bool flush() {return _file.seek(_hdl, _hdl.pos + _length);}
-		quint32 bitsAvailable() const {return _length * 8 + _remaining;}
-
-	private:
-		const SubFile &_file;
-		Handle &_hdl;
-		quint32 _length, _remaining;
-		quint8 _data;
-	};
-
-	class DeltaStream : public BitStream {
-	public:
-		DeltaStream(const SubFile &file, Handle &hdl, quint32 length,
-		  quint8 info, bool extraBit, bool extended);
-
-		bool readNext(qint32 &lonDelta, qint32 &latDelta)
-		{
-			return hasNext()
-			  ? (readDelta(_lonBits, _lonSign, _extraBit, lonDelta)
-				  && readDelta(_latBits, _latSign, false, latDelta))
-			  : false;
-		}
-		bool atEnd() const {return (_readBits != 0xFFFFFFFF && !hasNext());}
-
-	private:
-		bool hasNext() const {return bitsAvailable() >= _readBits;}
-		bool sign(int &val);
-		bool readDelta(int bits, int sign, int extraBit, qint32 &delta);
-
-		int _lonSign, _latSign, _extraBit;
-		quint32 _lonBits, _latBits, _readBits;
-	};
+	  _linesSize(0), _pointsOffset(0), _pointsSize(0), _init(false)
+	  {clearFlags();}
 
+	bool initialized() const {return _init;}
 	bool init(Handle &hdl);
 
-	QVector<Segment> segments(Handle &hdl, const SubDiv *subdiv) const;
-	bool polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-	  const Segment &segment, LBLFile *lbl, Handle &lblHdl, NETFile *net,
-	  Handle &netHdl, QList<IMG::Poly> *polys) const;
-	bool pointObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-	  const Segment &segment, LBLFile *lbl, Handle &lblHdl,
-	  QList<IMG::Point> *points) const;
-	bool extPolyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-	  const Segment &segment, LBLFile *lbl, Handle &lblHdl,
+	bool polyObjects(Handle &hdl, const SubDiv *subdiv, SegmentType segmentType,
+	  LBLFile *lbl, Handle &lblHdl, NETFile *net, Handle &netHdl,
 	  QList<IMG::Poly> *polys) const;
-	bool extPointObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-	  const Segment &segment, LBLFile *lbl, Handle &lblHdl,
-	  QList<IMG::Point> *points) const;
+	bool pointObjects(Handle &hdl, const SubDiv *subdiv, SegmentType segmentType,
+	  LBLFile *lbl, Handle &lblHdl, QList<IMG::Point> *points) const;
+	bool extPolyObjects(Handle &hdl, const SubDiv *subdiv, quint32 shift,
+	  SegmentType segmentType, LBLFile *lbl, Handle &lblHdl,
+	  QList<IMG::Poly> *polys) const;
+	bool extPointObjects(Handle &hdl, const SubDiv *subdiv, LBLFile *lbl,
+	  Handle &lblHdl, QList<IMG::Point> *points) const;
 
-	friend QDebug operator<<(QDebug dbg, const RGNFile::Segment &segment);
+	bool subdivInit(Handle &hdl, SubDiv *subdiv) const;
+
+private:
+	QMap<SegmentType, SubDiv::Segment> segments(Handle &hdl, SubDiv *subdiv)
+	  const;
+	void clearFlags();
+	bool skipClassFields(Handle &hdl) const;
+	bool skipLclFields(Handle &hdl, const quint32 flags[3], SegmentType type)
+	  const;
 
 	quint32 _offset;
 	quint32 _size;
 
 	quint32 _polygonsOffset;
 	quint32 _polygonsSize;
+	quint32 _polygonsFlags[3];
 	quint32 _linesOffset;
 	quint32 _linesSize;
+	quint32 _linesFlags[3];
 	quint32 _pointsOffset;
 	quint32 _pointsSize;
+	quint32 _pointsFlags[3];
+
+	HuffmanTable _huffmanTable;
 
 	bool _init;
 };
 
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const RGNFile::Segment &segment);
-#endif // QT_NO_DEBUG
-
 #endif // RGNFILE_H

src/map/IMG/style.cpp

@@ -1,72 +1,69 @@
 #include <QImage>
 #include "style.h"
 
-#define TYPE(t) ((t)<<8)
 
 void Style::defaultPolygonStyle()
 {
-	_polygons[TYPE(0x01)] = Style::Polygon(QBrush("#dfd3b5"));
-	_polygons[TYPE(0x02)] = Style::Polygon(QBrush("#dfd3b5"));
-	_polygons[TYPE(0x03)] = Style::Polygon(QBrush("#dfd3b5"));
-	_polygons[TYPE(0x04)] = Style::Polygon(QBrush("#ff4040", Qt::BDiagPattern));
-	_polygons[TYPE(0x05)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x06)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x07)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x08)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x09)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x0a)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x0b)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x0c)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x0d)] = Style::Polygon(QBrush("#f8e3be"));
-	_polygons[TYPE(0x0e)] = Style::Polygon(QBrush("#ffffff"));
-	_polygons[TYPE(0x0f)] = Style::Polygon(QBrush("#e6e2d9"));
-	_polygons[TYPE(0x10)] = Style::Polygon(QBrush("#e6e2d9"));
-	_polygons[TYPE(0x11)] = Style::Polygon(QBrush("#e6e2d9"));
-	_polygons[TYPE(0x12)] = Style::Polygon(QBrush("#e6e2d9"));
-	_polygons[TYPE(0x13)] = Style::Polygon(QBrush("#dbd0b6"),
+	_polygons[TYPE(0x01)] = Polygon(QBrush("#dfd3b5"));
+	_polygons[TYPE(0x02)] = Polygon(QBrush("#dfd3b5"));
+	_polygons[TYPE(0x03)] = Polygon(QBrush("#dfd3b5"));
+	_polygons[TYPE(0x04)] = Polygon(QBrush("#ff4040", Qt::BDiagPattern));
+	_polygons[TYPE(0x05)] = Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x06)] = Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x07)] = Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x08)] = Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x09)] = Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x0a)] = Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x0b)] = Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x0c)] = Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x0d)] = Polygon(QBrush("#f8e3be"));
+	_polygons[TYPE(0x0e)] = Polygon(QBrush("#ffffff"));
+	_polygons[TYPE(0x0f)] = Polygon(QBrush("#e6e2d9"));
+	_polygons[TYPE(0x10)] = Polygon(QBrush("#e6e2d9"));
+	_polygons[TYPE(0x11)] = Polygon(QBrush("#e6e2d9"));
+	_polygons[TYPE(0x12)] = Polygon(QBrush("#e6e2d9"));
+	_polygons[TYPE(0x13)] = Polygon(QBrush("#dbd0b6"),
 	  QPen(QColor("#cdccc4"), 1));
-	_polygons[TYPE(0x14)] = Style::Polygon(QBrush(QColor("#9ac269"),
+	_polygons[TYPE(0x14)] = Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x15)] = Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x16)] = Polygon(QBrush(QColor("#9ac269"),
 	  Qt::BDiagPattern));
-	_polygons[TYPE(0x15)] = Style::Polygon(QBrush(QColor("#9ac269"),
-	  Qt::BDiagPattern));
-	_polygons[TYPE(0x16)] = Style::Polygon(QBrush(QColor("#9ac269"),
-	  Qt::BDiagPattern));
-	_polygons[TYPE(0x17)] = Style::Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x18)] = Style::Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x19)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x1a)] = Style::Polygon(QBrush("#000000", Qt::Dense6Pattern),
+	_polygons[TYPE(0x17)] = Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x18)] = Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x19)] = Polygon(QBrush("#e3edc6"), QPen("#c9d3a5"));
+	_polygons[TYPE(0x1a)] = Polygon(QBrush("#000000", Qt::Dense6Pattern),
 	  QPen(QColor("#cdccc4"), 1));
-	_polygons[TYPE(0x1e)] = Style::Polygon(QBrush(QColor("#9ac269"),
+	_polygons[TYPE(0x1e)] = Polygon(QBrush(QColor("#9ac269"),
 	  Qt::BDiagPattern));
-	_polygons[TYPE(0x1f)] = Style::Polygon(QBrush(QColor("#9ac269"),
+	_polygons[TYPE(0x1f)] = Polygon(QBrush(QColor("#9ac269"),
 	  Qt::BDiagPattern));
-	_polygons[TYPE(0x28)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x29)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x32)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3b)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3c)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3d)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3e)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3f)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x40)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x41)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x42)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x43)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x44)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x45)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x46)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x47)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x48)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x49)] = Style::Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x4b)] = Style::Polygon(QBrush("#f1f0e5"), QPen("#f1f0e5"));
-	_polygons[TYPE(0x4a)] = Style::Polygon(QBrush("#f1f0e5"), QPen("#f1f0e5"));
-	_polygons[TYPE(0x4c)] = Style::Polygon(QBrush("#9fc4e1", Qt::Dense6Pattern));
-	_polygons[TYPE(0x4d)] = Style::Polygon(QBrush("#ddf1fd"));
-	_polygons[TYPE(0x4e)] = Style::Polygon(QBrush("#e3edc1"));
-	_polygons[TYPE(0x4f)] = Style::Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x50)] = Style::Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x51)] = Style::Polygon(QBrush("#9fc4e1", Qt::Dense4Pattern));
-	_polygons[TYPE(0x52)] = Style::Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x28)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x29)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x32)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3b)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3c)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3d)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3e)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3f)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x40)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x41)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x42)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x43)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x44)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x45)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x46)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x47)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x48)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x49)] = Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x4b)] = Polygon(QBrush("#f1f0e5"), QPen("#f1f0e5"));
+	_polygons[TYPE(0x4a)] = Polygon(QBrush("#f1f0e5"), QPen("#f1f0e5"));
+	_polygons[TYPE(0x4c)] = Polygon(QBrush("#9fc4e1", Qt::Dense6Pattern));
+	_polygons[TYPE(0x4d)] = Polygon(QBrush("#ddf1fd"));
+	_polygons[TYPE(0x4e)] = Polygon(QBrush("#e3edc1"));
+	_polygons[TYPE(0x4f)] = Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x50)] = Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x51)] = Polygon(QBrush("#9fc4e1", Qt::Dense4Pattern));
+	_polygons[TYPE(0x52)] = Polygon(QBrush("#d4ebb8"));
 
 	_drawOrder << TYPE(0x4b) << TYPE(0x4a) << TYPE(0x01) << TYPE(0x02)
 	  << TYPE(0x03) << TYPE(0x17) << TYPE(0x18) << TYPE(0x19) << TYPE(0x1a)
@@ -89,71 +86,69 @@ void Style::defaultLineStyle()
 	QPen rr(QColor("#717171"), 3, Qt::CustomDashLine);
 	rr.setDashPattern(pattern);
 
-	_lines[TYPE(0x01)] = Style::Line(QPen(QColor("#9bd772"), 2, Qt::SolidLine),
+	_lines[TYPE(0x01)] = Line(QPen(QColor("#9bd772"), 2, Qt::SolidLine),
 	  QPen(QColor("#72a35a"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x02)] = Style::Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
+	_lines[TYPE(0x02)] = Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
 	  QPen(QColor("#e8a541"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x03)] = Style::Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
+	_lines[TYPE(0x03)] = Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
 	  QPen(QColor("#e8a541"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x04)] = Style::Line(QPen(QColor("#faef75"), 3, Qt::SolidLine),
+	_lines[TYPE(0x04)] = Line(QPen(QColor("#faef75"), 3, Qt::SolidLine),
 	  QPen(QColor("#dbd27b"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x05)] = Style::Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
+	_lines[TYPE(0x05)] = Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x06)] = Style::Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
+	_lines[TYPE(0x06)] = Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x07)] = Style::Line(QPen(QColor("#ffffff"), 2, Qt::SolidLine),
+	_lines[TYPE(0x07)] = Line(QPen(QColor("#ffffff"), 2, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 4, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x08)] = Style::Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
+	_lines[TYPE(0x08)] = Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
 	  QPen(QColor("#e8a541"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x09)] = Style::Line(QPen(QColor("#9bd772"), 2, Qt::SolidLine),
+	_lines[TYPE(0x09)] = Line(QPen(QColor("#9bd772"), 2, Qt::SolidLine),
 	  QPen(QColor("#72a35a"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x0a)] = Style::Line(QPen(QColor("#aba083"), 1, Qt::DashLine));
-	_lines[TYPE(0x0b)] = Style::Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
+	_lines[TYPE(0x0a)] = Line(QPen(QColor("#aba083"), 1, Qt::DashLine));
+	_lines[TYPE(0x0b)] = Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
 	  QPen(QColor("#e8a541"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x0c)] = Style::Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
+	_lines[TYPE(0x0c)] = Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x14)] = Style::Line(rr, QPen(Qt::white, 3, Qt::SolidLine,
+	_lines[TYPE(0x14)] = Line(rr, QPen(Qt::white, 3, Qt::SolidLine,
 	  Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x16)] = Style::Line(QPen(QColor("#aba083"), 1, Qt::DotLine));
-	_lines[TYPE(0x18)] = Style::Line(QPen(QColor("#9fc4e1"), 2, Qt::SolidLine));
+	_lines[TYPE(0x16)] = Line(QPen(QColor("#aba083"), 1, Qt::DotLine));
+	_lines[TYPE(0x18)] = Line(QPen(QColor("#9fc4e1"), 2, Qt::SolidLine));
 	_lines[TYPE(0x18)].setTextColor(QColor("#9fc4e1"));
-	//_lines[TYPE(0x1a)] = Style::Line(QPen(QColor("#7697b7"), 1, Qt::DashLine));
-	_lines[TYPE(0x1b)] = Style::Line(QPen(QColor("#7697b7"), 1, Qt::DashLine));
-	_lines[TYPE(0x1e)] = Style::Line(QPen(QColor("#505145"), 2, Qt::DashDotLine));
-	_lines[TYPE(0x1f)] = Style::Line(QPen(QColor("#9fc4e1"), 3, Qt::SolidLine));
+	//_lines[TYPE(0x1a)] = Line(QPen(QColor("#7697b7"), 1, Qt::DashLine));
+	_lines[TYPE(0x1b)] = Line(QPen(QColor("#7697b7"), 1, Qt::DashLine));
+	_lines[TYPE(0x1e)] = Line(QPen(QColor("#505145"), 2, Qt::DashDotLine));
+	_lines[TYPE(0x1f)] = Line(QPen(QColor("#9fc4e1"), 3, Qt::SolidLine));
 	_lines[TYPE(0x1f)].setTextColor(QColor("#9fc4e1"));
-	_lines[TYPE(0x20)] = Style::Line(QPen(QColor("#cacfc0"), 1, Qt::SolidLine));
-	_lines[TYPE(0x20)].setTextColor(QColor("#62695a"));
-	_lines[TYPE(0x20)].setTextFontSize(Style::Small);
-	_lines[TYPE(0x21)] = Style::Line(QPen(QColor("#cacfc0"), 1.5, Qt::SolidLine));
-	_lines[TYPE(0x21)].setTextColor(QColor("#62695a"));
-	_lines[TYPE(0x21)].setTextFontSize(Style::Small);
-	_lines[TYPE(0x22)] = Style::Line(QPen(QColor("#cacfc0"), 2, Qt::SolidLine));
-	_lines[TYPE(0x22)].setTextColor(QColor("#62695a"));
-	_lines[TYPE(0x22)].setTextFontSize(Style::Small);
-	_lines[TYPE(0x23)] = Style::Line(QPen(QColor("#55aaff"), 1, Qt::SolidLine));
-	_lines[TYPE(0x23)].setTextColor(QColor("#55aaff"));
-	_lines[TYPE(0x23)].setTextFontSize(Style::Small);
-	_lines[TYPE(0x24)] = Style::Line(QPen(QColor("#55aaff"), 1.5, Qt::SolidLine));
-	_lines[TYPE(0x24)].setTextColor(QColor("#55aaff"));
-	_lines[TYPE(0x24)].setTextFontSize(Style::Small);
-	_lines[TYPE(0x25)] = Style::Line(QPen(QColor("#55aaff"), 2, Qt::SolidLine));
-	_lines[TYPE(0x25)].setTextColor(QColor("#55aaff"));
-	_lines[TYPE(0x25)].setTextFontSize(Style::Small);
-	_lines[TYPE(0x26)] = Style::Line(QPen(QColor("#9fc4e1"), 2, Qt::DotLine));
-	_lines[TYPE(0x27)] = Style::Line(QPen(QColor("#ffffff"), 4, Qt::SolidLine),
+	_lines[TYPE(0x20)] = Line(QPen(QColor("#cfcfcf"), 1, Qt::SolidLine));
+	_lines[TYPE(0x20)].setTextFontSize(None);
+	_lines[TYPE(0x21)] = Line(QPen(QColor("#bfbfbf"), 1, Qt::SolidLine));
+	_lines[TYPE(0x21)].setTextColor(QColor("#666666"));
+	_lines[TYPE(0x21)].setTextFontSize(Small);
+	_lines[TYPE(0x22)] = Line(QPen(QColor("#afafaf"), 1, Qt::SolidLine));
+	_lines[TYPE(0x22)].setTextColor(QColor("#666666"));
+	_lines[TYPE(0x22)].setTextFontSize(Small);
+	_lines[TYPE(0x23)] = Line(QPen(QColor("#55aaff"), 1, Qt::SolidLine));
+	_lines[TYPE(0x23)].setTextFontSize(None);
+	_lines[TYPE(0x24)] = Line(QPen(QColor("#659aef"), 1, Qt::SolidLine));
+	_lines[TYPE(0x24)].setTextColor(QColor("#558adf"));
+	_lines[TYPE(0x24)].setTextFontSize(Small);
+	_lines[TYPE(0x25)] = Line(QPen(QColor("#558adf"), 1, Qt::SolidLine));
+	_lines[TYPE(0x25)].setTextColor(QColor("#558adf"));
+	_lines[TYPE(0x25)].setTextFontSize(Small);
+	_lines[TYPE(0x26)] = Line(QPen(QColor("#9fc4e1"), 2, Qt::DotLine));
+	_lines[TYPE(0x27)] = Line(QPen(QColor("#ffffff"), 4, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	//_lines[TYPE(0x28)] = Style::Line(QPen(QColor("#5a5a5a"), 1, Qt::SolidLine));
-	_lines[TYPE(0x29)] = Style::Line(QPen(QColor("#5a5a5a"), 1, Qt::SolidLine));
-	_lines[TYPE(0x29)].setTextFontSize(Style::None);
+	//_lines[TYPE(0x28)] = Line(QPen(QColor("#5a5a5a"), 1, Qt::SolidLine));
+	_lines[TYPE(0x29)] = Line(QPen(QColor("#5a5a5a"), 1, Qt::SolidLine));
+	_lines[TYPE(0x29)].setTextFontSize(None);
 }
 
 void Style::defaultPointStyle()
 {
 	// Cities
-	_points[TYPE(0x01)].setTextFontSize(Style::Large);
-	_points[TYPE(0x02)].setTextFontSize(Style::Large);
-	_points[TYPE(0x03)].setTextFontSize(Style::Large);
+	_points[TYPE(0x01)].setTextFontSize(Large);
+	_points[TYPE(0x02)].setTextFontSize(Large);
+	_points[TYPE(0x03)].setTextFontSize(Large);
 
 	// POI
 	_points[0x2a00] = Point(QImage(":/restaurant-11.png"));
@@ -294,7 +289,7 @@ static bool readBitmap(SubFile *file, SubFile::Handle &hdl, QImage &img,
 	for (int y = 0; y < img.height(); y++) {
 		for (int x = 0; x < img.width(); x += 8/bpp) {
 			quint8 color;
-			if (!file->readByte(hdl, color))
+			if (!file->readUInt8(hdl, color))
 				return false;
 
 			for (int i = 0; i < 8/bpp && x + i < img.width(); i++) {
@@ -319,8 +314,8 @@ static bool readColor(SubFile *file, SubFile::Handle &hdl, QColor &color)
 {
 	quint8 b, g, r;
 
-	if (!(file->readByte(hdl, b) && file->readByte(hdl, g)
-	  && file->readByte(hdl, r)))
+	if (!(file->readUInt8(hdl, b) && file->readUInt8(hdl, g)
+	  && file->readUInt8(hdl, r)))
 		return false;
 
 	color = qRgb(r, g, b);
@@ -333,20 +328,20 @@ static bool skipLocalization(SubFile *file, SubFile::Handle &hdl)
 	quint8 t8;
 	quint16 len;
 
-	if (!file->readByte(hdl, t8))
+	if (!file->readUInt8(hdl, t8))
 		return false;
 	len = t8;
 
 	if (len & 0x01)
 		len = len >> 1;
 	else {
-		if (!file->readByte(hdl, t8))
+		if (!file->readUInt8(hdl, t8))
 			return false;
 		len = (((quint16)t8) << 8) | len;
 		len = len >> 2;
 	}
 
-	if (!file->seek(hdl, hdl.pos + len))
+	if (!file->seek(hdl, hdl.pos() + len))
 		return false;
 
 	return true;
@@ -361,7 +356,7 @@ bool Style::itemInfo(SubFile *file, SubFile::Handle &hdl,
 
 	if (section.arrayItemSize == 5) {
 		if (!(file->readUInt16(hdl, t16_1) && file->readUInt16(hdl, t16_2)
-		  && file->readByte(hdl, t8)))
+		  && file->readUInt8(hdl, t8)))
 			return false;
 		info.offset = t16_2 | (t8<<16);
 	} else if (section.arrayItemSize == 4) {
@@ -369,7 +364,7 @@ bool Style::itemInfo(SubFile *file, SubFile::Handle &hdl,
 			return false;
 		info.offset = t16_2;
 	} else if (section.arrayItemSize == 3) {
-		if (!(file->readUInt16(hdl, t16_1) && file->readByte(hdl, t8)))
+		if (!(file->readUInt16(hdl, t16_1) && file->readUInt8(hdl, t8)))
 			return false;
 		info.offset = t8;
 	} else
@@ -400,7 +395,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 
 		quint8 t8, flags;
 		if (!(file->seek(hdl, section.offset + info.offset)
-		  && file->readByte(hdl, t8)))
+		  && file->readUInt8(hdl, t8)))
 			return false;
 		flags = t8 & 0x0F;
 
@@ -412,14 +407,14 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!(readColor(file, hdl, c1) && readColor(file, hdl, c2)
 				  && readColor(file, hdl, c3) && readColor(file, hdl, c4)))
 					return false;
-				_polygons[type] = Style::Polygon(QBrush(c1), QPen(c3, 2));
+				_polygons[type] = Polygon(QBrush(c1), QPen(c3, 2));
 				break;
 
 			case 0x06:
 			case 0x07:
 				if (!readColor(file, hdl, c1))
 					return false;
-				_polygons[type] = Style::Polygon(QBrush(c1));
+				_polygons[type] = Polygon(QBrush(c1));
 				break;
 
 			case 0x08:
@@ -432,7 +427,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			case 0x09:
@@ -446,7 +441,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			case 0x0B:
@@ -462,7 +457,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			case 0x0E:
@@ -475,7 +470,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			case 0x0F:
@@ -488,7 +483,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			default:
@@ -516,7 +511,7 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 
 		quint8 t8_1, t8_2, flags, rows;
 		if (!(file->seek(hdl, section.offset + info.offset)
-		  && file->readByte(hdl, t8_1) && file->readByte(hdl, t8_2)))
+		  && file->readUInt8(hdl, t8_1) && file->readUInt8(hdl, t8_2)))
 			return false;
 		flags = t8_1 & 0x07;
 		rows = t8_1 >> 3;
@@ -539,16 +534,16 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!(file->readByte(hdl, w1) && file->readByte(hdl, w2)))
+					if (!(file->readUInt8(hdl, w1) && file->readUInt8(hdl, w2)))
 						return false;
 
 					_lines[type] = (w2 > w1)
-					  ? Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  ? Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin), QPen(c2, w2, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin))
-					  : Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  : Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin));
 				}
 				break;
@@ -566,16 +561,16 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!(file->readByte(hdl, w1) && file->readByte(hdl, w2)))
+					if (!(file->readUInt8(hdl, w1) && file->readUInt8(hdl, w2)))
 						return false;
 
 					_lines[type] = (w2 > w1)
-					  ? Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  ? Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin), QPen(c2, w2, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin))
-					  : Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  : Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin));
 				}
 				break;
@@ -593,12 +588,12 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!(file->readByte(hdl, w1) && file->readByte(hdl, w2)))
+					if (!(file->readUInt8(hdl, w1) && file->readUInt8(hdl, w2)))
 						return false;
 
-					_lines[type] = Style::Line(QPen(c1, w1, Qt::SolidLine,
+					_lines[type] = Line(QPen(c1, w1, Qt::SolidLine,
 					  Qt::RoundCap, Qt::RoundJoin));
 				}
 				break;
@@ -616,16 +611,16 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!(file->readByte(hdl, w1) && file->readByte(hdl, w2)))
+					if (!(file->readUInt8(hdl, w1) && file->readUInt8(hdl, w2)))
 						return false;
 
 					_lines[type] = (w2 > w1)
-					  ? Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  ? Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin), QPen(c2, w2, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin))
-					  : Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  : Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin));
 				}
 				break;
@@ -642,12 +637,12 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!file->readByte(hdl, w1))
+					if (!file->readUInt8(hdl, w1))
 						return false;
 
-					_lines[type] = Style::Line(QPen(c1, w1, Qt::SolidLine,
+					_lines[type] = Line(QPen(c1, w1, Qt::SolidLine,
 					  Qt::RoundCap, Qt::RoundJoin));
 				}
 				break;
@@ -664,12 +659,12 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!file->readByte(hdl, w1))
+					if (!file->readUInt8(hdl, w1))
 						return false;
 
-					_lines[type] = Style::Line(QPen(c1, w1, Qt::SolidLine,
+					_lines[type] = Line(QPen(c1, w1, Qt::SolidLine,
 					  Qt::RoundCap, Qt::RoundJoin));
 				}
 				break;
@@ -689,7 +684,7 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 
 		if (textColor) {
 			quint8 labelFlags;
-			if (!file->readByte(hdl, labelFlags))
+			if (!file->readUInt8(hdl, labelFlags))
 				return false;
 			if (labelFlags & 0x08) {
 				if (!readColor(file, hdl, c1))
@@ -751,7 +746,7 @@ static bool readColorTable(SubFile *file, SubFile::Handle &hdl, QImage& img,
 
 		for (int i = 0; i < colors; i++) {
 			while (bits < 28) {
-				if (!file->readByte(hdl, byte))
+				if (!file->readUInt8(hdl, byte))
 					return false;
 
 				mask = 0x000000FF << bits;
@@ -801,9 +796,9 @@ bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
 
 		quint8 t8_1, width, height, numColors, imgType;
 		if (!(file->seek(hdl, section.offset + info.offset)
-		  && file->readByte(hdl, t8_1) && file->readByte(hdl, width)
-		  && file->readByte(hdl, height) && file->readByte(hdl, numColors)
-		  && file->readByte(hdl, imgType)))
+		  && file->readUInt8(hdl, t8_1) && file->readUInt8(hdl, width)
+		  && file->readUInt8(hdl, height) && file->readUInt8(hdl, numColors)
+		  && file->readUInt8(hdl, imgType)))
 			return false;
 
 		bool localization = t8_1 & 0x04;
@@ -820,8 +815,8 @@ bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
 		_points[type] = Point(img);
 
 		if (t8_1 == 0x03) {
-			if (!(file->readByte(hdl, numColors)
-			  && file->readByte(hdl, imgType)))
+			if (!(file->readUInt8(hdl, numColors)
+			  && file->readUInt8(hdl, imgType)))
 				return false;
 			if ((bpp = colors2bpp(numColors, imgType)) < 0)
 				continue;
@@ -830,8 +825,8 @@ bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
 			if (!readBitmap(file, hdl, img, bpp))
 				return false;
 		} else if (t8_1 == 0x02) {
-			if (!(file->readByte(hdl, numColors)
-			  && file->readByte(hdl, imgType)))
+			if (!(file->readUInt8(hdl, numColors)
+			  && file->readUInt8(hdl, imgType)))
 				return false;
 			if ((bpp = colors2bpp(numColors, imgType)) < 0)
 				continue;
@@ -845,7 +840,7 @@ bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
 		if (textColor) {
 			quint8 labelFlags;
 			QColor color;
-			if (!file->readByte(hdl, labelFlags))
+			if (!file->readUInt8(hdl, labelFlags))
 				return false;
 			if (labelFlags & 0x08) {
 				if (!readColor(file, hdl, color))
@@ -874,7 +869,7 @@ bool Style::parseDrawOrder(SubFile *file, SubFile::Handle &hdl,
 		quint8 type;
 		quint32 subtype;
 
-		if (!(file->readByte(hdl, type) && file->readUInt32(hdl, subtype)))
+		if (!(file->readUInt8(hdl, type) && file->readUInt32(hdl, subtype)))
 			return false;
 
 		if (!subtype)
@@ -895,7 +890,7 @@ bool Style::parseDrawOrder(SubFile *file, SubFile::Handle &hdl,
 
 bool Style::parseTYPFile(SubFile *file)
 {
-	SubFile::Handle hdl;
+	SubFile::Handle hdl(file);
 	Section points, lines, polygons, order;
 	quint16 tmp16, codepage;
 
@@ -970,27 +965,6 @@ const Style::Point &Style::point(quint32 type) const
 	return (it == _points.constEnd()) ? null : *it;
 }
 
-bool Style::isContourLine(quint32 type)
-{
-	return (type == TYPE(0x20) || type == TYPE(0x21) || type == TYPE(0x22)
-	  || type == TYPE(0x23) || type == TYPE(0x24) || type == TYPE(0x25));
-}
-
-bool Style::isSpot(quint32 type)
-{
-	return (type == TYPE(0x62) || type == TYPE(0x63));
-}
-
-bool Style::isSummit(quint32 type)
-{
-	return (type == 0x6616);
-}
-
-bool Style::isMajorRoad(quint32 type)
-{
-	return (type <= TYPE(0x04));
-}
-
 Style::POIClass Style::poiClass(quint32 type)
 {
 	if ((type >= 0x2a00 && type < 0x2b00) || type == 0x2c0a || type == 0x2d02)
@@ -1041,4 +1015,11 @@ QDebug operator<<(QDebug dbg, const Style::Line &line)
 	  << penColor(line.background()) << ", " << !line.img().isNull() << ")";
 	return dbg.space();
 }
+
+QDebug operator<<(QDebug dbg, const Style::Point &point)
+{
+	dbg.nospace() << "Point(" << point.textFontSize() << ", "
+	  << point.textColor() << ", " << !point.img().isNull() << ")";
+	return dbg.space();
+}
 #endif // QT_NO_DEBUG

src/map/IMG/style.h

@@ -6,6 +6,7 @@
 #include <QDebug>
 #include "subfile.h"
 
+#define TYPE(t) ((t)<<8)
 
 class Style
 {
@@ -47,6 +48,7 @@ public:
 	private:
 		QBrush _brush;
 		QPen _pen;
+		QColor _textColor;
 	};
 
 	class Line {
@@ -80,6 +82,8 @@ public:
 	class Point {
 	public:
 		Point() : _textFontSize(NotSet) {}
+		Point(FontSize fontSize, const QColor &textColor = QColor())
+		  : _textColor(textColor), _textFontSize(fontSize) {}
 		Point(const QImage &img) : _textFontSize(NotSet), _img(img) {}
 
 		void setTextColor(const QColor &color) {_textColor = color;}
@@ -103,10 +107,22 @@ public:
 	const Point &point(quint32 type) const;
 	const QList<quint32> &drawOrder() const {return _drawOrder;}
 
-	static bool isContourLine(quint32 type);
-	static bool isSpot(quint32 type);
-	static bool isSummit(quint32 type);
-	static bool isMajorRoad(quint32 type);
+	static bool isContourLine(quint32 type)
+	  {return ((type >= TYPE(0x20) && type <= TYPE(0x25))
+	  || (type & 0xffff00) == TYPE(0x109));}
+	static bool isWaterArea(quint32 type)
+	  {return (type >= TYPE(0x3c) && type <= TYPE(0x44));}
+	static bool isMilitaryArea(quint32 type)
+	  {return (type == TYPE(0x04));}
+	static bool isNatureReserve(quint32 type)
+	  {return (type == TYPE(0x16));}
+	static bool isSpot(quint32 type)
+	  {return (type == TYPE(0x62) || type == TYPE(0x63));}
+	static bool isSummit(quint32 type)
+	  {return (type == 0x6616);}
+	static bool isMajorRoad(quint32 type)
+	  {return (type <= TYPE(0x04));}
+
 	static POIClass poiClass(quint32 type);
 
 private:
@@ -149,6 +165,7 @@ private:
 #ifndef QT_NO_DEBUG
 QDebug operator<<(QDebug dbg, const Style::Polygon &polygon);
 QDebug operator<<(QDebug dbg, const Style::Line &line);
+QDebug operator<<(QDebug dbg, const Style::Point &point);
 #endif // QT_NO_DEBUG
 
 #endif // STYLE_H

src/map/IMG/subdiv.h

@@ -7,55 +7,147 @@
 
 class SubDiv {
 public:
-	SubDiv(quint32 offset, qint32 lon, qint32 lat, int bits, quint8 objects)
-	  : _offset(offset), _end(0), _lon(lon), _lat(lat), _bits(bits),
-	  _objects(objects), _polygonsOffset(0), _polygonsEnd(0), _linesOffset(0),
-	  _linesEnd(0), _pointsOffset(0), _pointsEnd(0) {}
-	void setEnd(quint32 end) {_end = end;}
+	class Segment {
+	public:
+		Segment() : _offset(0), _end(0) {}
+		Segment(quint32 ofset, quint32 end) : _offset(ofset), _end(end) {}
+
+		bool isValid() const {return (_end > _offset);}
+
+		quint32 offset() const {return _offset;}
+		quint32 end() const {return _end;}
+
+	private:
+		quint32 _offset, _end;
+	};
+
+	SubDiv(quint32 offset, qint32 lon, qint32 lat, int bits, quint8 objects)
+	  : _lon(lon), _lat(lat), _bits(bits), _init(false)
+	{
+		_tre.objects = objects;
+		_tre.offset = offset;
+		_tre.end = 0;
+
+		_tre.extPolygonsOffset = 0;
+		_tre.extPolygonsEnd = 0;
+		_tre.extLinesOffset = 0;
+		_tre.extLinesEnd = 0;
+		_tre.extPointsOffset = 0;
+		_tre.extPointsEnd = 0;
+	}
+	void setEnd(quint32 end) {_tre.end = end;}
+	void setExtOffsets(quint32 polygon, quint32 line, quint32 point)
+	{
+		_tre.extPolygonsOffset = polygon;
+		_tre.extLinesOffset = line;
+		_tre.extPointsOffset = point;
+	}
+	void setExtEnds(quint32 polygon, quint32 line, quint32 point)
+	{
+		_tre.extPolygonsEnd = polygon;
+		_tre.extLinesEnd = line;
+		_tre.extPointsEnd = point;
+	}
+
+	void init(const Segment &points, const Segment &idxPoints,
+	  const Segment &lines, const Segment &polygons,
+	  const Segment &roadReferences, const Segment &extPoints,
+	  const Segment &extLines, const Segment &extPolygons)
+	{
+		_rgn.pointsOffset = points.offset();
+		_rgn.pointsEnd = points.end();
+		_rgn.idxPointsOffset = idxPoints.offset();
+		_rgn.idxPointsEnd = idxPoints.end();
+		_rgn.linesOffset = lines.offset();
+		_rgn.linesEnd = lines.end();
+		_rgn.polygonsOffset = polygons.offset();
+		_rgn.polygonsEnd = polygons.end();
+		_rgn.roadReferencesOffset = roadReferences.offset();
+		_rgn.roadReferencesEnd = roadReferences.end();
+		_rgn.extPointsOffset = extPoints.offset();
+		_rgn.extPointsEnd = extPoints.end();
+		_rgn.extLinesOffset = extLines.offset();
+		_rgn.extLinesEnd = extLines.end();
+		_rgn.extPolygonsOffset = extPolygons.offset();
+		_rgn.extPolygonsEnd = extPolygons.end();
+
+		_init = true;
+	}
+	bool initialized() const {return _init;}
 
-	quint32 offset() const {return _offset;}
-	quint32 end() const {return _end;}
 	qint32 lon() const {return _lon;}
 	qint32 lat() const {return _lat;}
 	quint8 bits() const {return _bits;}
-	quint8 objects() const {return _objects;}
 
-	// Extended types objects (TRE7)
-	void setExtOffsets(quint32 polygon, quint32 line, quint32 point)
-	  {_polygonsOffset = polygon; _linesOffset = line; _pointsOffset = point;}
-	void setExtEnds(quint32 polygon, quint32 line, quint32 point)
-	  {_polygonsEnd = polygon; _linesEnd = line; _pointsEnd = point;}
+	// Valid only after initialization
+	Segment points() const
+	  {return Segment(_rgn.pointsOffset, _rgn.pointsEnd);}
+	Segment idxPoints() const
+	  {return Segment(_rgn.idxPointsOffset, _rgn.idxPointsEnd);}
+	Segment lines() const
+	  {return Segment(_rgn.linesOffset, _rgn.linesEnd);}
+	Segment polygons() const
+	  {return Segment(_rgn.polygonsOffset, _rgn.polygonsEnd);}
+	Segment extPoints() const
+	  {return Segment(_rgn.extPointsOffset, _rgn.extPointsEnd);}
+	Segment extLines() const
+	  {return Segment(_rgn.extLinesOffset, _rgn.extLinesEnd);}
+	Segment extPolygons() const
+	  {return Segment(_rgn.extPolygonsOffset, _rgn.extPolygonsEnd);}
 
-	quint32 polygonsOffset() const {return _polygonsOffset;}
-	quint32 polygonsEnd() const {return _polygonsEnd;}
-	quint32 linesOffset() const {return _linesOffset;}
-	quint32 linesEnd() const {return _linesEnd;}
-	quint32 pointsOffset() const {return _pointsOffset;}
-	quint32 pointsEnd() const {return _pointsEnd;}
+	// Valid only until initialization
+	quint8 objects() const {return _tre.objects;}
+	quint32 offset() const {return _tre.offset;}
+	quint32 end() const {return _tre.end;}
+	quint32 extPolygonsOffset() const {return _tre.extPolygonsOffset;}
+	quint32 extPolygonsEnd() const {return _tre.extPolygonsEnd;}
+	quint32 extLinesOffset() const {return _tre.extLinesOffset;}
+	quint32 extLinesEnd() const {return _tre.extLinesEnd;}
+	quint32 extPointsOffset() const {return _tre.extPointsOffset;}
+	quint32 extPointsEnd() const {return _tre.extPointsEnd;}
 
 private:
-	quint32 _offset;
-	quint32 _end;
+	struct TRE
+	{
+		quint8 objects;
+		quint32 offset;
+		quint32 end;
+
+		quint32 extPolygonsOffset;
+		quint32 extPolygonsEnd;
+		quint32 extLinesOffset;
+		quint32 extLinesEnd;
+		quint32 extPointsOffset;
+		quint32 extPointsEnd;
+	};
+
+	struct RGN
+	{
+		quint32 pointsOffset;
+		quint32 pointsEnd;
+		quint32 idxPointsOffset;
+		quint32 idxPointsEnd;
+		quint32 linesOffset;
+		quint32 linesEnd;
+		quint32 polygonsOffset;
+		quint32 polygonsEnd;
+		quint32 roadReferencesOffset;
+		quint32 roadReferencesEnd;
+		quint32 extPointsOffset;
+		quint32 extPointsEnd;
+		quint32 extLinesOffset;
+		quint32 extLinesEnd;
+		quint32 extPolygonsOffset;
+		quint32 extPolygonsEnd;
+	};
+
 	qint32 _lon, _lat;
 	quint8 _bits;
-	quint8 _objects;
-
-	quint32 _polygonsOffset;
-	quint32 _polygonsEnd;
-	quint32 _linesOffset;
-	quint32 _linesEnd;
-	quint32 _pointsOffset;
-	quint32 _pointsEnd;
+	bool _init;
+	union {
+		TRE _tre;
+		RGN _rgn;
+	};
 };
 
-#ifndef QT_NO_DEBUG
-inline QDebug operator<<(QDebug dbg, const SubDiv &subdiv)
-{
-	Coordinates c(toWGS24(subdiv.lon()), toWGS24(subdiv.lat()));
-	dbg.nospace() << "SubDiv(" << c << ", " << subdiv.offset()
-	  << ", " << subdiv.end() << ", " << subdiv.objects() << ")";
-	return dbg.space();
-}
-#endif // QT_NO_DEBUG
-
 #endif // SUBDIV_H

src/map/IMG/subfile.cpp

@@ -2,70 +2,43 @@
 #include "img.h"
 #include "subfile.h"
 
-SubFile::Type SubFile::type(const char str[3])
-{
-	if (!memcmp(str, "TRE", 3))
-		return TRE;
-	else if (!memcmp(str, "RGN", 3))
-		return RGN;
-	else if (!memcmp(str, "LBL", 3))
-		return LBL;
-	else if (!memcmp(str, "TYP", 3))
-		return TYP;
-	else if (!memcmp(str, "GMP", 3))
-		return GMP;
-	else if (!memcmp(str, "NET", 3))
-		return NET;
-	else
-		return Unknown;
-}
-
-SubFile::SubFile(QFile *file) :_gmpOffset(0), _img(0), _file(file), _blocks(0)
-{
-	if (!_file->open(QIODevice::ReadOnly))
-		qWarning("Error opening %s: %s", qPrintable(_file->fileName()),
-		  qPrintable(_file->errorString()));
-}
 
 bool SubFile::seek(Handle &handle, quint32 pos) const
 {
-	Q_ASSERT(_img || _file);
+	if (handle._file) {
+		int blockNum = pos / BLOCK_SIZE;
 
-	if (_file)
-		return _file->seek(pos);
-	else {
+		if (handle._blockNum != blockNum) {
+			if (!handle._file->seek((qint64)blockNum * BLOCK_SIZE))
+				return false;
+			if (handle._file->read(handle._data.data(), BLOCK_SIZE) < 0)
+				return false;
+			handle._blockNum = blockNum;
+		}
+
+		handle._blockPos = pos % BLOCK_SIZE;
+		handle._pos = pos;
+
+		return true;
+	} else {
 		quint32 blockSize = _img->blockSize();
 		int blockNum = pos / blockSize;
 
-		if (handle.blockNum != blockNum) {
+		if (handle._blockNum != blockNum) {
 			if (blockNum >= _blocks->size())
 				return false;
-			if (!_img->readBlock(_blocks->at(blockNum), handle.data))
+			if (!_img->readBlock(_blocks->at(blockNum), handle._data.data()))
 				return false;
-			handle.blockNum = blockNum;
+			handle._blockNum = blockNum;
 		}
 
-		handle.blockPos = pos % blockSize;
-		handle.pos = pos;
+		handle._blockPos = pos % blockSize;
+		handle._pos = pos;
 
 		return true;
 	}
 }
 
-bool SubFile::readByte(Handle &handle, quint8 &val) const
-{
-	Q_ASSERT(_img || _file);
-
-	if (_file)
-		return _file->getChar((char*)&val);
-	else {
-		val = handle.data.at(handle.blockPos++);
-		handle.pos++;
-		return (handle.blockPos >= _img->blockSize())
-		  ? seek(handle, handle.pos) : true;
-	}
-}
-
 bool SubFile::readVUInt32(Handle &hdl, quint32 &val) const
 {
 	quint8 bytes, shift, b;
@@ -97,24 +70,31 @@ bool SubFile::readVUInt32(Handle &hdl, quint32 &val) const
 	return true;
 }
 
-QString SubFile::fileName() const
+bool SubFile::readVBitfield32(Handle &hdl, quint32 &bitfield) const
 {
-	return _file ? _file->fileName() : _img->fileName();
-}
+	quint8 bits;
 
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const SubFile &file)
-{
-	bool continuous = true;
-	for (int i = 1; i < file._blocks->size(); i++) {
-		if (file._blocks->at(i) != file._blocks->at(i-1) + 1) {
-			continuous = false;
-			break;
+	if (!readUInt8(hdl, bits))
+		return false;
+
+	if (!(bits & 1)) {
+		seek(hdl, hdl._pos - 1);
+		if (!((bits>>1) & 1)) {
+			if (!((bits>>2) & 1)) {
+				if (!readUInt32(hdl, bitfield))
+					return false;
+			} else {
+				if (!readUInt24(hdl, bitfield))
+					return false;
+			}
+			bitfield >>= 3;
+		} else {
+			if (!readUInt16(hdl, bitfield))
+				return false;
+			bitfield >>= 2;
 		}
-	}
+	} else
+		bitfield = bits>>1;
 
-	dbg.nospace() << "SubFile(" << file._blocks->size() << ", "
-	  << continuous << ")";
-	return dbg.space();
+	return true;
 }
-#endif // QT_NO_DEBUG

src/map/IMG/subfile.h

@@ -3,37 +3,74 @@
 
 #include <QVector>
 #include <QDebug>
+#include <QFile>
+#include "img.h"
 
-class IMG;
-class QFile;
+
+#define BLOCK_SIZE 4096
 
 class SubFile
 {
 public:
 	enum Type {Unknown, TRE, RGN, LBL, NET, TYP, GMP};
 
-	struct Handle
+	class Handle
 	{
-		Handle() : blockNum(-1), blockPos(-1), pos(-1) {}
+	public:
+		Handle(const SubFile *subFile)
+		  : _file(0), _blockNum(-1), _blockPos(-1), _pos(-1)
+		{
+			if (subFile && subFile->_path) {
+				_file = new QFile(*(subFile->_path));
+				_file->open(QIODevice::ReadOnly);
+				_data.resize(BLOCK_SIZE);
+			} else if (subFile)
+				_data.resize(subFile->_img->blockSize());
+		}
+		~Handle() {delete _file;}
 
-		QByteArray data;
-		int blockNum;
-		int blockPos;
-		int pos;
+		int pos() const {return _pos;}
+
+	private:
+		friend class SubFile;
+
+		QFile *_file;
+		QByteArray _data;
+		int _blockNum;
+		int _blockPos;
+		int _pos;
 	};
 
-	SubFile(IMG *img) : _gmpOffset(0), _img(img), _file(0),
-	  _blocks(&_blockData) {}
+	SubFile(IMG *img)
+	  : _gmpOffset(0), _img(img), _blocks(new QVector<quint16>()), _path(0) {}
 	SubFile(SubFile *gmp, quint32 offset) : _gmpOffset(offset), _img(gmp->_img),
-	  _file(0), _blocks(&(gmp->_blockData)) {}
-	SubFile(QFile *file);
+	  _blocks(gmp->_blocks), _path(gmp->_path) {}
+	SubFile(const QString &path)
+	  : _gmpOffset(0), _img(0), _blocks(0), _path(new QString(path)) {}
+	~SubFile()
+	{
+		if (!_gmpOffset) {
+			delete _blocks;
+			delete _path;
+		}
+	}
 
 	void addBlock(quint16 block) {_blocks->append(block);}
 
 	bool seek(Handle &handle, quint32 pos) const;
-	bool readByte(Handle &handle, quint8 &val) const;
 
-	bool readUInt16(Handle &handle, quint16 &val) const
+	template<typename T>
+	bool readUInt8(Handle &handle, T &val) const
+	{
+		quint8 b;
+		if (!readByte(handle, b))
+			return false;
+		val = b;
+		return true;
+	}
+
+	template<typename T>
+	bool readUInt16(Handle &handle, T &val) const
 	{
 		quint8 b0, b1;
 		if (!(readByte(handle, b0) && readByte(handle, b1)))
@@ -81,32 +118,41 @@ public:
 		return true;
 	}
 
-	bool readVUInt32(Handle &hdl, quint32 &val) const;
-
-	quint16 offset() const {return _blocks->first();}
-	QString fileName() const;
-
-	static Type type(const char str[3]);
-	static bool isTileFile(Type type)
+	bool readVUInt32SW(Handle &hdl, quint32 bytes, quint32 &val) const
 	{
-		return (type == TRE || type == LBL || type == RGN || type == NET
-		  || type == GMP);
+		quint8 b;
+
+		val = 0;
+		for (quint32 i = bytes; i; i--) {
+			if (!readByte(hdl, b))
+				return false;
+			val |= ((quint32)b) << ((i-1) * 8);
+		}
+
+		return true;
 	}
 
-	friend QDebug operator<<(QDebug dbg, const SubFile &file);
+	bool readVUInt32(Handle &hdl, quint32 &val) const;
+	bool readVBitfield32(Handle &hdl, quint32 &bitfield) const;
+
+	QString fileName() const {return _path ? *_path : _img->fileName();}
 
 protected:
 	quint32 _gmpOffset;
 
 private:
+	bool readByte(Handle &handle, quint8 &val) const
+	{
+		int blockSize = _img ? _img->blockSize() : BLOCK_SIZE;
+		val = handle._data.at(handle._blockPos++);
+		handle._pos++;
+		return (handle._blockPos >= blockSize)
+		  ? seek(handle, handle._pos) : true;
+	}
+
 	IMG *_img;
-	QFile *_file;
 	QVector<quint16> *_blocks;
-	QVector<quint16> _blockData;
+	QString *_path;
 };
 
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const SubFile &file);
-#endif // QT_NO_DEBUG
-
 #endif // SUBFILE_H

src/map/IMG/trefile.cpp

@@ -37,14 +37,14 @@ TREFile::~TREFile()
 	clear();
 }
 
-bool TREFile::init()
+bool TREFile::init(bool baseMap)
 {
-	Handle hdl;
+	Handle hdl(this);
 	quint8 locked;
 	quint16 hdrLen;
 
 	if (!(seek(hdl, _gmpOffset) && readUInt16(hdl, hdrLen)
-	  && seek(hdl, _gmpOffset + 0x0D) && readByte(hdl, locked)))
+	  && seek(hdl, _gmpOffset + 0x0D) && readUInt8(hdl, locked)))
 		return false;
 
 	// Tile bounds
@@ -62,12 +62,15 @@ bool TREFile::init()
 	  && readUInt32(hdl, subdivSize)))
 		return false;
 
-	// TRE7 info
 	if (hdrLen > 0x9A) {
+		// TRE7 info
 		if (!(seek(hdl, _gmpOffset + 0x7C) && readUInt32(hdl, _extended.offset)
 		  && readUInt32(hdl, _extended.size)
 		  && readUInt16(hdl, _extended.itemSize)))
 			return false;
+		// flags
+		if (!(seek(hdl, _gmpOffset + 0x86) && readUInt32(hdl, _flags)))
+			return false;
 	}
 
 	// Tile levels
@@ -75,7 +78,7 @@ bool TREFile::init()
 		return false;
 	quint8 levels[64];
 	for (quint32 i = 0; i < levelsSize; i++)
-		if (!readByte(hdl, levels[i]))
+		if (!readUInt8(hdl, levels[i]))
 			return false;
 	if (locked) {
 		quint32 key;
@@ -105,12 +108,14 @@ bool TREFile::init()
 		}
 	}
 
+	_isBaseMap = baseMap;
+
 	return (_firstLevel >= 0);
 }
 
 bool TREFile::load(int idx)
 {
-	Handle hdl;
+	Handle hdl(this);
 	QList<SubDiv*> sl;
 	SubDiv *s = 0;
 	SubDivTree *tree = new SubDivTree();
@@ -126,15 +131,16 @@ bool TREFile::load(int idx)
 		return false;
 
 	for (int j = 0; j < _levels.at(idx).subdivs; j++) {
-		quint32 offset;
+		quint32 oo;
 		qint32 lon, lat;
-		quint8 objects;
 		quint16 width, height, nextLevel;
 
-		if (!(readUInt24(hdl, offset) && readByte(hdl, objects)
-		  && readInt24(hdl, lon) && readInt24(hdl, lat)
+		if (!(readUInt32(hdl, oo) && readInt24(hdl, lon) && readInt24(hdl, lat)
 		  && readUInt16(hdl, width) && readUInt16(hdl, height)))
 			goto error;
+		quint32 offset = oo & 0xfffffff;
+		quint8 objects = (((qint16)height < 0) << 4) | (oo >> 0x1c);
+
 		if (idx != _levels.size() - 1)
 			if (!readUInt16(hdl, nextLevel))
 				goto error;
@@ -146,6 +152,7 @@ bool TREFile::load(int idx)
 		width <<= (24 - _levels.at(idx).bits);
 		height <<= (24 - _levels.at(idx).bits);
 
+
 		s = new SubDiv(offset, lon, lat, _levels.at(idx).bits, objects);
 		sl.append(s);
 
@@ -194,7 +201,7 @@ bool TREFile::load(int idx)
 			if (i)
 				sl.at(i-1)->setExtEnds(polygons, lines, points);
 
-			if (!seek(hdl, hdl.pos + _extended.itemSize - 12))
+			if (!seek(hdl, hdl.pos() + _extended.itemSize - 12))
 				goto error;
 		}
 
@@ -231,10 +238,17 @@ void TREFile::clear()
 	_subdivs.clear();
 }
 
-int TREFile::level(int bits)
+int TREFile::level(int bits, bool baseMap)
 {
 	int idx = _firstLevel;
 
+	if (baseMap) {
+		if (!_isBaseMap && _levels.at(idx).bits > bits)
+			return -1;
+		if (_isBaseMap && bits > _levels.last().bits)
+			return -1;
+	}
+
 	for (int i = idx + 1; i < _levels.size(); i++) {
 		if (_levels.at(i).bits > bits)
 			break;
@@ -254,10 +268,10 @@ static bool cb(SubDiv *subdiv, void *context)
 	return true;
 }
 
-QList<SubDiv*> TREFile::subdivs(const RectC &rect, int bits)
+QList<SubDiv*> TREFile::subdivs(const RectC &rect, int bits, bool baseMap)
 {
 	QList<SubDiv*> list;
-	SubDivTree *tree = _subdivs.value(level(bits));
+	SubDivTree *tree = _subdivs.value(level(bits, baseMap));
 	double min[2], max[2];
 
 	min[0] = rect.left();

src/map/IMG/trefile.h

@@ -14,14 +14,17 @@ class TREFile : public SubFile
 {
 public:
 	TREFile(IMG *img) : SubFile(img) {}
+	TREFile(const QString &path) : SubFile(path) {}
 	TREFile(SubFile *gmp, quint32 offset) : SubFile(gmp, offset) {}
 	~TREFile();
 
-	bool init();
+	bool init(bool baseMap);
 	void clear();
 
 	const RectC &bounds() const {return _bounds;}
-	QList<SubDiv*> subdivs(const RectC &rect, int bits);
+	QList<SubDiv*> subdivs(const RectC &rect, int bits, bool baseMap);
+	quint32 shift(quint8 bits) const
+	  {return (bits == _levels.last().bits) ? (_flags >> 0xb) & 7 : 0;}
 
 private:
 	struct MapLevel {
@@ -39,7 +42,7 @@ private:
 	typedef RTree<SubDiv*, double, 2> SubDivTree;
 
 	bool load(int idx);
-	int level(int bits);
+	int level(int bits, bool baseMap);
 	bool parsePoly(Handle hdl, quint32 pos, const QMap<int, int> &level2bits,
 	  QMap<quint32, int> &map);
 	bool parsePoints(Handle hdl, quint32 pos, const QMap<int, int> &level2bits);
@@ -51,6 +54,8 @@ private:
 	quint32 _subdivOffset;
 	Extended _extended;
 	int _firstLevel;
+	quint32 _flags;
+	bool _isBaseMap;
 
 	QMap<int, SubDivTree*> _subdivs;
 };

src/map/IMG/vectortile.cpp

@@ -1,5 +1,23 @@
 #include "vectortile.h"
 
+
+static void copyPolys(const RectC &rect, QList<IMG::Poly> *src,
+  QList<IMG::Poly> *dst)
+{
+	for (int i = 0; i < src->size(); i++)
+		if (rect.intersects(src->at(i).boundingRect))
+			dst->append(src->at(i));
+}
+
+static void copyPoints(const RectC &rect, QList<IMG::Point> *src,
+  QList<IMG::Point> *dst)
+{
+	for (int j = 0; j < src->size(); j++)
+		if (rect.contains(src->at(j).coordinates))
+			dst->append(src->at(j));
+}
+
+
 SubFile *VectorTile::file(SubFile::Type type)
 {
 	switch (type) {
@@ -41,12 +59,35 @@ SubFile *VectorTile::addFile(IMG *img, SubFile::Type type)
 	}
 }
 
-bool VectorTile::init()
+SubFile *VectorTile::addFile(const QString &path, SubFile::Type type)
+{
+	switch (type) {
+		case SubFile::TRE:
+			_tre = new TREFile(path);
+			return _tre;
+		case SubFile::RGN:
+			_rgn = new RGNFile(path);
+			return _rgn;
+		case SubFile::LBL:
+			_lbl = new LBLFile(path);
+			return _lbl;
+		case SubFile::NET:
+			_net = new NETFile(path);
+			return _net;
+		case SubFile::GMP:
+			_gmp = new SubFile(path);
+			return _gmp;
+		default:
+			return 0;
+	}
+}
+
+bool VectorTile::init(bool baseMap)
 {
 	if (_gmp && !initGMP())
 		return false;
 
-	if (!(_tre && _tre->init() && _rgn))
+	if (!(_tre && _tre->init(baseMap) && _rgn))
 		return false;
 
 	return true;
@@ -54,7 +95,7 @@ bool VectorTile::init()
 
 bool VectorTile::initGMP()
 {
-	SubFile::Handle hdl;
+	SubFile::Handle hdl(_gmp);
 	quint32 tre, rgn, lbl, net;
 
 	if (!(_gmp->seek(hdl, 0x19) && _gmp->readUInt32(hdl, tre)
@@ -62,39 +103,91 @@ bool VectorTile::initGMP()
 	  && _gmp->readUInt32(hdl, net)))
 		return false;
 
-	_tre = new TREFile(_gmp, tre);
-	_rgn = new RGNFile(_gmp, rgn);
-	_lbl = new LBLFile(_gmp, lbl);
-	_net = new NETFile(_gmp, net);
+	_tre = tre ? new TREFile(_gmp, tre) : 0;
+	_rgn = rgn ? new RGNFile(_gmp, rgn) : 0;
+	_lbl = lbl ? new LBLFile(_gmp, lbl) : 0;
+	_net = net ? new NETFile(_gmp, net) : 0;
 
 	return true;
 }
 
-void VectorTile::objects(const RectC &rect, int bits,
+void VectorTile::polys(const RectC &rect, int bits, bool baseMap,
   QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
-  QList<IMG::Point> *points) const
+  QCache<const SubDiv *, IMG::Polys> *polyCache) const
 {
-	QList<SubDiv*> subdivs = _tre->subdivs(rect, bits);
+	SubFile::Handle rgnHdl(_rgn), lblHdl(_lbl), netHdl(_net);
+
+	if (!_rgn->initialized() && !_rgn->init(rgnHdl))
+		return;
+
+	QList<SubDiv*> subdivs = _tre->subdivs(rect, bits, baseMap);
 	for (int i = 0; i < subdivs.size(); i++) {
-		_rgn->objects(rect, subdivs.at(i), _lbl, _net, polygons, lines, points);
-		_rgn->extObjects(rect, subdivs.at(i), _lbl, polygons, lines,
-		  points);
+		SubDiv *subdiv = subdivs.at(i);
+
+		IMG::Polys *polys = polyCache->object(subdiv);
+		if (!polys) {
+			quint32 shift = _tre->shift(subdiv->bits());
+			QList<IMG::Poly> p, l;
+
+			if (!subdiv->initialized() && !_rgn->subdivInit(rgnHdl, subdiv))
+				continue;
+
+			_rgn->polyObjects(rgnHdl, subdiv, RGNFile::Polygon, _lbl, lblHdl,
+			  _net, netHdl, &p);
+			_rgn->polyObjects(rgnHdl, subdiv, RGNFile::Line, _lbl, lblHdl,
+			  _net, netHdl, &l);
+			_rgn->extPolyObjects(rgnHdl, subdiv, shift, RGNFile::Polygon, _lbl,
+			  lblHdl, &p);
+			_rgn->extPolyObjects(rgnHdl, subdiv, shift, RGNFile::Line, _lbl,
+			  lblHdl, &l);
+
+			copyPolys(rect, &p, polygons);
+			copyPolys(rect, &l, lines);
+			polyCache->insert(subdiv, new IMG::Polys(p, l));
+		} else {
+			copyPolys(rect, &(polys->polygons), polygons);
+			copyPolys(rect, &(polys->lines), lines);
+		}
+	}
+}
+
+void VectorTile::points(const RectC &rect, int bits, bool baseMap,
+  QList<IMG::Point> *points, QCache<const SubDiv *,
+  QList<IMG::Point> > *pointCache) const
+{
+	SubFile::Handle rgnHdl(_rgn), lblHdl(_lbl);
+
+	if (!_rgn->initialized() && !_rgn->init(rgnHdl))
+		return;
+
+	QList<SubDiv*> subdivs = _tre->subdivs(rect, bits, baseMap);
+	for (int i = 0; i < subdivs.size(); i++) {
+		SubDiv *subdiv = subdivs.at(i);
+
+		QList<IMG::Point> *pl = pointCache->object(subdiv);
+		if (!pl) {
+			QList<IMG::Point> p;
+
+			if (!subdiv->initialized() && !_rgn->subdivInit(rgnHdl, subdiv))
+				continue;
+
+			_rgn->pointObjects(rgnHdl, subdiv, RGNFile::Point, _lbl, lblHdl,
+			  &p);
+			_rgn->pointObjects(rgnHdl, subdiv, RGNFile::IndexedPoint, _lbl,
+			  lblHdl, &p);
+			_rgn->extPointObjects(rgnHdl, subdiv, _lbl, lblHdl, &p);
+
+			copyPoints(rect, &p, points);
+			pointCache->insert(subdiv, new QList<IMG::Point>(p));
+		} else
+			copyPoints(rect, pl, points);
 	}
 }
 
 #ifndef QT_NO_DEBUG
 QDebug operator<<(QDebug dbg, const VectorTile &tile)
 {
-	dbg.nospace() << "VectorTile(";
-	if (tile._tre)
-		dbg << "TRE: " << *(tile._tre);
-	if (tile._rgn)
-		dbg << ", RGN: " << *(tile._rgn);
-	if (tile._lbl)
-		dbg << ", LBL: " << *(tile._lbl);
-	if (tile._net)
-		dbg << ", NET: " << *(tile._net);
-	dbg << ")";
+	dbg.nospace() << "VectorTile(" << tile.bounds() <<")";
 
 	return dbg.space();
 }

src/map/IMG/vectortile.h

@@ -1,7 +1,6 @@
 #ifndef VECTORTILE_H
 #define VECTORTILE_H
 
-#include "img.h"
 #include "trefile.h"
 #include "trefile.h"
 #include "rgnfile.h"
@@ -12,20 +11,32 @@ class VectorTile {
 public:
 	VectorTile() : _tre(0), _rgn(0), _lbl(0), _net(0), _gmp(0) {}
 	~VectorTile()
-	  {delete _tre; delete _rgn; delete _lbl; delete _net; delete _gmp;}
+	{
+		delete _tre; delete _rgn; delete _lbl; delete _net; delete _gmp;
+	}
 
-	bool init();
+	bool init(bool baseMap);
 	void clear() {_tre->clear();}
 
 	const RectC &bounds() const {return _tre->bounds();}
 
 	SubFile *file(SubFile::Type type);
 	SubFile *addFile(IMG *img, SubFile::Type type);
+	SubFile *addFile(const QString &path, SubFile::Type type);
 
-	void objects(const RectC &rect, int bits, QList<IMG::Poly> *polygons,
-	  QList<IMG::Poly> *lines, QList<IMG::Point> *points) const;
+	void polys(const RectC &rect, int bits, bool baseMap,
+	  QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
+	  QCache<const SubDiv *, IMG::Polys> *polyCache) const;
+	void points(const RectC &rect, int bits, bool baseMap,
+	  QList<IMG::Point> *points, QCache<const SubDiv*,
+	  QList<IMG::Point> > *pointCache) const;
 
-	friend QDebug operator<<(QDebug dbg, const VectorTile &tile);
+	static bool isTileFile(SubFile::Type type)
+	{
+		return (type == SubFile::TRE || type == SubFile::LBL
+		  || type == SubFile::RGN || type == SubFile::NET
+		  || type == SubFile::GMP);
+	}
 
 private:
 	bool initGMP();

src/map/albersequal.cpp

@@ -104,10 +104,10 @@ AlbersEqual::AlbersEqual(const Ellipsoid *ellipsoid, double standardParallel1,
 	} else
 		_n = sin_lat1;
 
-	_C = sqr_m1 + _n * q1;
+	_c = sqr_m1 + _n * q1;
 	_a_over_n = ellipsoid->radius() / _n;
 	nq0 = _n * q0;
-	_rho0 = (_C < nq0) ? 0 : _a_over_n * sqrt(_C - nq0);
+	_rho0 = (_c < nq0) ? 0 : _a_over_n * sqrt(_c - nq0);
 }
 
 PointD AlbersEqual::ll2xy(const Coordinates &c) const
@@ -131,7 +131,7 @@ PointD AlbersEqual::ll2xy(const Coordinates &c) const
 	e_sin = _e * sin_lat;
 	q = ALBERS_Q(sin_lat, ONE_MINUS_SQR(e_sin), e_sin);
 	nq = _n * q;
-	rho = (_C < nq) ? 0 : _a_over_n * sqrt(_C - nq);
+	rho = (_c < nq) ? 0 : _a_over_n * sqrt(_c - nq);
 	theta = _n * dlam;
 
 	return PointD(rho * sin(theta) + _falseEasting,
@@ -168,7 +168,7 @@ Coordinates AlbersEqual::xy2ll(const PointD &p) const
 	if (rho != 0.0)
 		theta = atan2(dx, rho0_minus_dy);
 	rho_n = rho * _n;
-	q = (_C - (rho_n * rho_n) / _a2) / _n;
+	q = (_c - (rho_n * rho_n) / _a2) / _n;
 	qc = 1 - ((_one_minus_es) / (_two_e)) * log((1.0 - _e) / (1.0 + _e));
 	if (fabs(fabs(qc) - fabs(q)) > 1.0e-6) {
 		q_over_2 = q / 2.0;

src/map/albersequal.h

@@ -25,7 +25,7 @@ private:
 
 	double _a2;
 	double _rho0;
-	double _C;
+	double _c;
 	double _n;
 	double _e;
 	double _es;

src/map/imgmap.cpp

@@ -1,5 +1,6 @@
 #include <QFile>
 #include <QPainter>
+#include <QFont>
 #include <QPixmapCache>
 #if QT_VERSION < QT_VERSION_CHECK(5, 0, 0)
 #include <QtCore>
@@ -8,9 +9,13 @@
 #endif // QT_VERSION < 5
 #include "common/rectc.h"
 #include "common/wgs84.h"
+#include "common/range.h"
 #include "IMG/textpathitem.h"
 #include "IMG/textpointitem.h"
 #include "IMG/bitmapline.h"
+#include "IMG/style.h"
+#include "IMG/img.h"
+#include "IMG/gmap.h"
 #include "pcs.h"
 #include "rectd.h"
 #include "imgmap.h"
@@ -33,18 +38,19 @@ public:
 	const QString &key() const {return _key;}
 	const QPoint &xy() const {return _xy;}
 	QImage &img() {return _img;}
-	QList<IMG::Poly> &polygons() {return _polygons;}
-	QList<IMG::Poly> &lines() {return _lines;}
-	QList<IMG::Point> &points() {return _points;}
+	QList<MapData::Poly> &polygons() {return _polygons;}
+	QList<MapData::Poly> &lines() {return _lines;}
+	QList<MapData::Point> &points() {return _points;}
 
 	void render()
 	{
 		QList<TextItem*> textItems;
 
-		_map->processPolygons(_polygons);
+		QRect tileRect(_xy, QSize(TILE_SIZE, TILE_SIZE));
+
 		_map->processPoints(_points, textItems);
-		_map->processLines(_lines, QRect(_xy, QSize(TILE_SIZE, TILE_SIZE)),
-		  textItems);
+		_map->processPolygons(_polygons, textItems);
+		_map->processLines(_lines, tileRect, textItems);
 
 		_img.fill(Qt::transparent);
 
@@ -67,9 +73,9 @@ private:
 	QPoint _xy;
 	QString _key;
 	QImage _img;
-	QList<IMG::Poly> _polygons;
-	QList<IMG::Poly> _lines;
-	QList<IMG::Point> _points;
+	QList<MapData::Poly> _polygons;
+	QList<MapData::Poly> _lines;
+	QList<MapData::Point> _points;
 };
 
 
@@ -172,7 +178,7 @@ static int minShieldZoom(Label::Shield::Type type)
 	switch (type) {
 		case Label::Shield::USInterstate:
 		case Label::Shield::Hbox:
-			return 18;
+			return 17;
 		case Label::Shield::USShield:
 		case Label::Shield::Box:
 			return 19;
@@ -184,12 +190,56 @@ static int minShieldZoom(Label::Shield::Type type)
 	}
 }
 
+static qreal area(const QVector<QPointF> &polygon)
+{
+	qreal area = 0;
+
+	for (int i = 0; i < polygon.size(); i++) {
+		int j = (i + 1) % polygon.size();
+		area += polygon.at(i).x() * polygon.at(j).y();
+		area -= polygon.at(i).y() * polygon.at(j).x();
+	}
+	area /= 2.0;
+
+   return area;
+}
+
+static QPointF centroid(const QVector<QPointF> &polygon)
+{
+	qreal cx = 0, cy = 0;
+	qreal factor = 1.0 / (6.0 * area(polygon));
+
+	for (int i = 0; i < polygon.size(); i++) {
+		int j = (i + 1) % polygon.size();
+		qreal f = (polygon.at(i).x() * polygon.at(j).y() - polygon.at(j).x()
+		  * polygon.at(i).y());
+		cx += (polygon.at(i).x() + polygon.at(j).x()) * f;
+		cy += (polygon.at(i).y() + polygon.at(j).y()) * f;
+	}
+
+	return QPointF(cx * factor, cy * factor);
+}
+
+static bool rectNearPolygon(const QPolygonF &polygon, const QRectF &rect)
+{
+	return (polygon.boundingRect().contains(rect)
+	  && (polygon.containsPoint(rect.topLeft(), Qt::OddEvenFill)
+	  || polygon.containsPoint(rect.topRight(), Qt::OddEvenFill)
+	  || polygon.containsPoint(rect.bottomLeft(), Qt::OddEvenFill)
+	  || polygon.containsPoint(rect.bottomRight(), Qt::OddEvenFill)));
+}
+
 
 IMGMap::IMGMap(const QString &fileName, QObject *parent)
-  : Map(parent), _img(fileName), _projection(PCS::pcs(3857)), _valid(false)
+  : Map(parent), _projection(PCS::pcs(3857)), _valid(false)
 {
-	if (!_img.isValid()) {
-		_errorString = _img.errorString();
+	if (GMAP::isGMAP(fileName))
+		_data = new GMAP(fileName);
+	else
+		_data = new IMG(fileName);
+
+	if (!_data->isValid()) {
+		_errorString = _data->errorString();
 		return;
 	}
 
@@ -201,17 +251,17 @@ IMGMap::IMGMap(const QString &fileName, QObject *parent)
 
 void IMGMap::load()
 {
-	_img.load();
+	_data->load();
 }
 
 void IMGMap::unload()
 {
-	_img.clear();
+	_data->clear();
 }
 
 QRectF IMGMap::bounds()
 {
-	RectD prect(_img.bounds(), _projection);
+	RectD prect(_data->bounds(), _projection);
 	return QRectF(_transform.proj2img(prect.topLeft()),
 	  _transform.proj2img(prect.bottomRight()));
 }
@@ -261,7 +311,7 @@ Transform IMGMap::transform(int zoom) const
 {
 	double scale = _projection.isGeographic()
 	  ? 360.0 / (1<<zoom) : (2.0 * M_PI * WGS84_RADIUS) / (1<<zoom);
-	PointD topLeft(_projection.ll2xy(_img.bounds().topLeft()));
+	PointD topLeft(_projection.ll2xy(_data->bounds().topLeft()));
 	return Transform(ReferencePoint(PointD(0, 0), topLeft),
 	  PointD(scale, scale));
 }
@@ -281,15 +331,14 @@ Coordinates IMGMap::xy2ll(const QPointF &p)
 	return _projection.xy2ll(_transform.img2proj(p));
 }
 
-
-void IMGMap::drawPolygons(QPainter *painter, const QList<IMG::Poly> &polygons)
+void IMGMap::drawPolygons(QPainter *painter, const QList<MapData::Poly> &polygons)
 {
-	for (int n = 0; n < _img.style()->drawOrder().size(); n++) {
+	for (int n = 0; n < _data->style()->drawOrder().size(); n++) {
 		for (int i = 0; i < polygons.size(); i++) {
-			const IMG::Poly &poly = polygons.at(i);
-			if (poly.type != _img.style()->drawOrder().at(n))
+			const MapData::Poly &poly = polygons.at(i);
+			if (poly.type != _data->style()->drawOrder().at(n))
 				continue;
-			const Style::Polygon &style = _img.style()->polygon(poly.type);
+			const Style::Polygon &style = _data->style()->polygon(poly.type);
 
 			painter->setPen(style.pen());
 			painter->setBrush(style.brush());
@@ -298,13 +347,13 @@ void IMGMap::drawPolygons(QPainter *painter, const QList<IMG::Poly> &polygons)
 	}
 }
 
-void IMGMap::drawLines(QPainter *painter, const QList<IMG::Poly> &lines)
+void IMGMap::drawLines(QPainter *painter, const QList<MapData::Poly> &lines)
 {
 	painter->setBrush(Qt::NoBrush);
 
 	for (int i = 0; i < lines.size(); i++) {
-		const IMG::Poly &poly = lines.at(i);
-		const Style::Line &style = _img.style()->line(poly.type);
+		const MapData::Poly &poly = lines.at(i);
+		const Style::Line &style = _data->style()->line(poly.type);
 
 		if (style.background() == Qt::NoPen)
 			continue;
@@ -314,8 +363,8 @@ void IMGMap::drawLines(QPainter *painter, const QList<IMG::Poly> &lines)
 	}
 
 	for (int i = 0; i < lines.size(); i++) {
-		const IMG::Poly &poly = lines.at(i);
-		const Style::Line &style = _img.style()->line(poly.type);
+		const MapData::Poly &poly = lines.at(i);
+		const Style::Line &style = _data->style()->line(poly.type);
 
 		if (!style.img().isNull())
 			BitmapLine::draw(painter, poly.points, style.img());
@@ -332,25 +381,42 @@ void IMGMap::drawTextItems(QPainter *painter, const QList<TextItem*> &textItems)
 		textItems.at(i)->paint(painter);
 }
 
-
-void IMGMap::processPolygons(QList<IMG::Poly> &polygons)
+void IMGMap::processPolygons(QList<MapData::Poly> &polygons,
+  QList<TextItem*> &textItems)
 {
 	for (int i = 0; i < polygons.size(); i++) {
-		IMG::Poly &poly = polygons[i];
+		MapData::Poly &poly = polygons[i];
 		for (int j = 0; j < poly.points.size(); j++) {
 			QPointF &p = poly.points[j];
 			p = ll2xy(Coordinates(p.x(), p.y()));
 		}
+
+		if (poly.label.text().isEmpty())
+			continue;
+
+		if (_zoom <= 23 && (Style::isWaterArea(poly.type)
+		  || Style::isMilitaryArea(poly.type)
+		  || Style::isNatureReserve(poly.type))) {
+			const Style::Polygon &style = _data->style()->polygon(poly.type);
+			TextPointItem *item = new TextPointItem(
+			  centroid(poly.points).toPoint(), &poly.label.text(),
+			  poiFont(), 0, &style.brush().color());
+			if (item->isValid() && !item->collides(textItems)
+			  && rectNearPolygon(poly.points, item->boundingRect()))
+				textItems.append(item);
+			else
+				delete item;
+		}
 	}
 }
 
-void IMGMap::processLines(QList<IMG::Poly> &lines, const QRect &tileRect,
+void IMGMap::processLines(QList<MapData::Poly> &lines, const QRect &tileRect,
   QList<TextItem*> &textItems)
 {
 	qStableSort(lines);
 
 	for (int i = 0; i < lines.size(); i++) {
-		IMG::Poly &poly = lines[i];
+		MapData::Poly &poly = lines[i];
 		for (int j = 0; j < poly.points.size(); j++) {
 			QPointF &p = poly.points[j];
 			p = ll2xy(Coordinates(p.x(), p.y()));
@@ -362,12 +428,12 @@ void IMGMap::processLines(QList<IMG::Poly> &lines, const QRect &tileRect,
 	processShields(lines, tileRect, textItems);
 }
 
-void IMGMap::processStreetNames(QList<IMG::Poly> &lines, const QRect &tileRect,
-  QList<TextItem*> &textItems)
+void IMGMap::processStreetNames(QList<MapData::Poly> &lines,
+  const QRect &tileRect, QList<TextItem*> &textItems)
 {
 	for (int i = 0; i < lines.size(); i++) {
-		IMG::Poly &poly = lines[i];
-		const Style::Line &style = _img.style()->line(poly.type);
+		MapData::Poly &poly = lines[i];
+		const Style::Line &style = _data->style()->line(poly.type);
 
 		if (style.img().isNull() && style.foreground() == Qt::NoPen)
 			continue;
@@ -391,7 +457,7 @@ void IMGMap::processStreetNames(QList<IMG::Poly> &lines, const QRect &tileRect,
 	}
 }
 
-void IMGMap::processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
+void IMGMap::processShields(QList<MapData::Poly> &lines, const QRect &tileRect,
   QList<TextItem*> &textItems)
 {
 	for (int type = FIRST_SHIELD; type <= LAST_SHIELD; type++) {
@@ -402,7 +468,7 @@ void IMGMap::processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
 		QHash<Label::Shield, const Label::Shield*> sp;
 
 		for (int i = 0; i < lines.size(); i++) {
-			const IMG::Poly &poly = lines.at(i);
+			const MapData::Poly &poly = lines.at(i);
 			const Label::Shield &shield = poly.label.shield();
 			if (!shield.isValid() || shield.type() != type
 			  || !Style::isMajorRoad(poly.type))
@@ -455,14 +521,14 @@ void IMGMap::processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
 	}
 }
 
-void IMGMap::processPoints(QList<IMG::Point> &points,
+void IMGMap::processPoints(QList<MapData::Point> &points,
   QList<TextItem*> &textItems)
 {
 	qSort(points);
 
 	for (int i = 0; i < points.size(); i++) {
-		IMG::Point &point = points[i];
-		const Style::Point &style = _img.style()->point(point.type);
+		MapData::Point &point = points[i];
+		const Style::Point &style = _data->style()->point(point.type);
 
 		if (point.poi && _zoom < minPOIZoom(Style::poiClass(point.type)))
 			continue;
@@ -516,7 +582,7 @@ void IMGMap::draw(QPainter *painter, const QRectF &rect, Flags flags)
 		for (int j = 0; j < height; j++) {
 			QPixmap pm;
 			QPoint ttl(tl.x() + i * TILE_SIZE, tl.y() + j * TILE_SIZE);
-			QString key = _img.fileName() + "-" + QString::number(_zoom) + "_"
+			QString key = _data->fileName() + "-" + QString::number(_zoom) + "_"
 			  + QString::number(ttl.x()) + "_" + QString::number(ttl.y());
 			if (QPixmapCache::find(key, pm))
 				painter->drawPixmap(ttl, pm);
@@ -526,13 +592,14 @@ void IMGMap::draw(QPainter *painter, const QRectF &rect, Flags flags)
 
 				RectD polyRect(_transform.img2proj(ttl), _transform.img2proj(
 				  QPointF(ttl.x() + TILE_SIZE, ttl.y() + TILE_SIZE)));
-				_img.objects(polyRect.toRectC(_projection, 4), _zoom,
-				  &(tile.polygons()), &(tile.lines()), 0);
+				_data->polys(polyRect.toRectC(_projection, 4), _zoom,
+				  &(tile.polygons()), &(tile.lines()));
+
 				RectD pointRect(_transform.img2proj(QPointF(ttl.x() - TEXT_EXTENT,
 				  ttl.y() - TEXT_EXTENT)), _transform.img2proj(QPointF(ttl.x()
 				  + TILE_SIZE + TEXT_EXTENT, ttl.y() + TILE_SIZE + TEXT_EXTENT)));
-				_img.objects(pointRect.toRectC(_projection, 4), _zoom,
-				  0, 0, &(tile.points()));
+				_data->points(pointRect.toRectC(_projection, 4), _zoom,
+				  &(tile.points()));
 			}
 		}
 	}

src/map/imgmap.h

@@ -1,12 +1,10 @@
 #ifndef IMGMAP_H
 #define IMGMAP_H
 
-#include <QFont>
 #include "map.h"
 #include "projection.h"
 #include "transform.h"
-#include "common/range.h"
-#include "IMG/img.h"
+#include "IMG/mapdata.h"
 
 class TextItem;
 
@@ -16,8 +14,9 @@ class IMGMap : public Map
 
 public:
 	IMGMap(const QString &fileName, QObject *parent = 0);
+	~IMGMap() {delete _data;}
 
-	QString name() const {return _img.name();}
+	QString name() const {return _data->name();}
 
 	QRectF bounds();
 
@@ -45,20 +44,21 @@ private:
 
 	Transform transform(int zoom) const;
 	void updateTransform();
-	void drawPolygons(QPainter *painter, const QList<IMG::Poly> &polygons);
-	void drawLines(QPainter *painter, const QList<IMG::Poly> &lines);
+	void drawPolygons(QPainter *painter, const QList<MapData::Poly> &polygons);
+	void drawLines(QPainter *painter, const QList<MapData::Poly> &lines);
 	void drawTextItems(QPainter *painter, const QList<TextItem*> &textItems);
 
-	void processPolygons(QList<IMG::Poly> &polygons);
-	void processLines(QList<IMG::Poly> &lines, const QRect &tileRect,
+	void processPolygons(QList<MapData::Poly> &polygons,
+	  QList<TextItem *> &textItems);
+	void processLines(QList<MapData::Poly> &lines, const QRect &tileRect,
 	  QList<TextItem*> &textItems);
-	void processPoints(QList<IMG::Point> &points, QList<TextItem*> &textItems);
-	void processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
+	void processPoints(QList<MapData::Point> &points, QList<TextItem*> &textItems);
+	void processShields(QList<MapData::Poly> &lines, const QRect &tileRect,
 	  QList<TextItem*> &textItems);
-	void processStreetNames(QList<IMG::Poly> &lines, const QRect &tileRect,
+	void processStreetNames(QList<MapData::Poly> &lines, const QRect &tileRect,
 	  QList<TextItem*> &textItems);
 
-	IMG _img;
+	MapData *_data;
 	int _zoom;
 	Projection _projection;
 	Transform _transform;

src/map/krovak.cpp

@@ -15,16 +15,16 @@ Krovak::Krovak(const Ellipsoid *ellipsoid, double standardParallel,
 
 	_phiP = deg2rad(standardParallel);
 	_e = sqrt(ellipsoid->es());
-	_A = ellipsoid->radius() * sqrt(1.0 - ellipsoid->es())
+	_a = ellipsoid->radius() * sqrt(1.0 - ellipsoid->es())
 	  / (1.0 - ellipsoid->es() * sinPhiC2);
-	_B = sqrt(1.0 + (ellipsoid->es() * cosPhiC4 / (1.0 - ellipsoid->es())));
-	double gamma0 = asin(sinPhiC / _B);
+	_b = sqrt(1.0 + (ellipsoid->es() * cosPhiC4 / (1.0 - ellipsoid->es())));
+	double gamma0 = asin(sinPhiC / _b);
 	_t0 = tan(M_PI_4 + gamma0 / 2.0) * pow((1.0 + _e * sinPhiC) /
-	  (1.0 - _e * sinPhiC), _e*_B / 2.0) / pow(tan(M_PI_4 + phiC/2.0), _B);
+	  (1.0 - _e * sinPhiC), _e*_b / 2.0) / pow(tan(M_PI_4 + phiC/2.0), _b);
 	_n = sin(_phiP);
-	_r0 = scale * _A / tan(_phiP);
-	_FE = falseEasting;
-	_FN = falseNorthing;
+	_r0 = scale * _a / tan(_phiP);
+	_fe = falseEasting;
+	_fn = falseNorthing;
 	_cosAlphaC = cos(alphaC);
 	_sinAlphaC = sin(alphaC);
 	_lambda0 = deg2rad(longitudeOrigin);
@@ -35,23 +35,23 @@ PointD Krovak::ll2xy(const Coordinates &c) const
 	double phi = deg2rad(c.lat());
 	double lambda = deg2rad(c.lon());
 	double eSinPhi = _e * sin(phi);
-	double U = 2.0 * (atan(_t0 * pow(tan(phi/2.0 + M_PI_4), _B)
-	  / pow((1.0 + eSinPhi) / (1.0 - eSinPhi), _e * _B/2.0)) - M_PI_4);
+	double U = 2.0 * (atan(_t0 * pow(tan(phi/2.0 + M_PI_4), _b)
+	  / pow((1.0 + eSinPhi) / (1.0 - eSinPhi), _e * _b/2.0)) - M_PI_4);
 	double cosU = cos(U);
-	double V = _B * (_lambda0 - lambda);
+	double V = _b * (_lambda0 - lambda);
 	double T = asin(_cosAlphaC * sin(U) + _sinAlphaC * cosU * cos(V));
 	double D = asin(cosU * sin(V) / cos(T));
 	double theta = _n * D;
 	double r = _r0 * pow(tan(M_PI_4 + _phiP/2.0), _n)
 	  / pow(tan(T/2.0 + M_PI_4), _n);
 
-	return PointD(r * sin(theta) + _FE, r * cos(theta) + _FN);
+	return PointD(r * sin(theta) + _fe, r * cos(theta) + _fn);
 }
 
 Coordinates Krovak::xy2ll(const PointD &p) const
 {
-	double Xp = p.y() - _FN;
-	double Yp = p.x() - _FE;
+	double Xp = p.y() - _fn;
+	double Yp = p.x() - _fe;
 	double Xp2 = Xp * Xp;
 	double Yp2 = Yp * Yp;
 	double r = sqrt(Xp2 + Yp2);
@@ -63,8 +63,8 @@ Coordinates Krovak::xy2ll(const PointD &p) const
 	double V = asin(cos(T) * sin(D) / cos(U));
 	double phi = U;
 	for (int i = 0; i < 3; i++)
-		phi = 2.0 * (atan(pow(_t0, -1.0/_B) * pow(tan(U/2.0 + M_PI_4), 1.0/_B)
+		phi = 2.0 * (atan(pow(_t0, -1.0/_b) * pow(tan(U/2.0 + M_PI_4), 1.0/_b)
 		  * pow((1.0 + _e * sin(phi))/(1.0 - _e * sin(phi)), _e/2.0)) - M_PI_4);
 
-	return Coordinates(rad2deg(_lambda0 - V/_B), rad2deg(phi));
+	return Coordinates(rad2deg(_lambda0 - V/_b), rad2deg(phi));
 }

src/map/krovak.h

@@ -18,8 +18,8 @@ public:
 	virtual Coordinates xy2ll(const PointD &p) const;
 
 private:
-	double _e, _A, _B, _t0, _n, _r0, _phiP;
-	double _cosAlphaC, _sinAlphaC, _lambda0, _FE, _FN;
+	double _e, _a, _b, _t0, _n, _r0, _phiP;
+	double _cosAlphaC, _sinAlphaC, _lambda0, _fe, _fn;
 };
 
 class KrovakNE : public CT

src/map/lambertazimuthal.cpp

@@ -11,8 +11,8 @@ LambertAzimuthal::LambertAzimuthal(const Ellipsoid *ellipsoid,
 {
 	double lat0 = deg2rad(latitudeOrigin);
 
-	_falseEasting = falseEasting;
-	_falseNorthing = falseNorthing;
+	_fe = falseEasting;
+	_fn = falseNorthing;
 	_lon0 = deg2rad(longitudeOrigin);
 
 	_a = ellipsoid->radius();
@@ -25,8 +25,8 @@ LambertAzimuthal::LambertAzimuthal(const Ellipsoid *ellipsoid,
 	_qP = (1.0 - _es) * ((1.0 / (1.0 - _es)) - ((1.0/(2.0*_e))
 	  * log((1.0 - _e) / (1.0 + _e))));
 	_beta0 = asin(q0 / _qP);
-	_Rq = _a * sqrt(_qP / 2.0);
-	_D = _a * (cos(lat0) / sqrt(1.0 - _es * sin2(lat0))) / (_Rq * cos(_beta0));
+	_rq = _a * sqrt(_qP / 2.0);
+	_d = _a * (cos(lat0) / sqrt(1.0 - _es * sin2(lat0))) / (_rq * cos(_beta0));
 }
 
 PointD LambertAzimuthal::ll2xy(const Coordinates &c) const
@@ -38,11 +38,11 @@ PointD LambertAzimuthal::ll2xy(const Coordinates &c) const
 	  - ((1.0/(2.0*_e)) * log((1.0 - _e * sin(lat)) / (1.0 + _e
 	  * sin(lat)))));
 	double beta = asin(q / _qP);
-	double B = _Rq * sqrt(2.0 / (1.0 + sin(_beta0) * sin(beta) + (cos(_beta0)
+	double B = _rq * sqrt(2.0 / (1.0 + sin(_beta0) * sin(beta) + (cos(_beta0)
 	  * cos(beta) * cos(lon - _lon0))));
 
-	double x = _falseEasting + ((B * _D) * (cos(beta) * sin(lon - _lon0)));
-	double y = _falseNorthing + (B / _D) * ((cos(_beta0) * sin(beta))
+	double x = _fe + ((B * _d) * (cos(beta) * sin(lon - _lon0)));
+	double y = _fn + (B / _d) * ((cos(_beta0) * sin(beta))
 	  - (sin(_beta0) * cos(beta) * cos(lon - _lon0)));
 
 	return PointD(x, y);
@@ -53,14 +53,14 @@ Coordinates LambertAzimuthal::xy2ll(const PointD &p) const
 	double es4 = _es * _es;
 	double es6 = _es * es4;
 
-	double rho = sqrt(sqr((p.x() - _falseEasting) / _D) + sqr(_D * (p.y()
-	  - _falseNorthing)));
-	double C = 2.0 * asin(rho / (2.0*_Rq));
-	double betaS = asin((cos(C) * sin(_beta0)) + ((_D * (p.y() -_falseNorthing)
+	double rho = sqrt(sqr((p.x() - _fe) / _d) + sqr(_d * (p.y()
+	  - _fn)));
+	double C = 2.0 * asin(rho / (2.0*_rq));
+	double betaS = asin((cos(C) * sin(_beta0)) + ((_d * (p.y() -_fn)
 	  * sin(C) * cos(_beta0)) / rho));
 
-	double lon = _lon0 + atan((p.x() - _falseEasting) * sin(C) / (_D * rho
-	  * cos(_beta0) * cos(C) - sqr(_D) * (p.y() - _falseNorthing) * sin(_beta0)
+	double lon = _lon0 + atan((p.x() - _fe) * sin(C) / (_d * rho
+	  * cos(_beta0) * cos(C) - sqr(_d) * (p.y() - _fn) * sin(_beta0)
 	  * sin(C)));
 	double lat = betaS + ((_es/3.0 + 31.0*es4/180.0 + 517.0*es6/5040.0)
 	  * sin(2.0*betaS)) + ((23.0*es4/360.0 + 251.0*es6/3780.0) * sin(4.0*betaS))

src/map/lambertazimuthal.h

@@ -18,9 +18,8 @@ public:
 
 private:
 	double _lon0;
-	double _falseNorthing;
-	double _falseEasting;
-	double _a, _e, _es, _qP, _beta0, _Rq, _D;
+	double _fn, _fe;
+	double _a, _e, _es, _qP, _beta0, _rq, _d;
 };
 
 #endif // LAMBERTAZIMUTHAL_H

src/map/maplist.cpp

@@ -8,20 +8,27 @@
 #include "mbtilesmap.h"
 #include "rmap.h"
 #include "imgmap.h"
+#include "IMG/gmap.h"
 #include "maplist.h"
 
 
-bool MapList::loadMap(Map* map, const QString &path, bool dir)
+bool MapList::loadMap(Map *map, const QString &path, bool dir)
 {
-	if (map->isValid()) {
+	if (map && map->isValid()) {
 		_maps.append(map);
 		return true;
-	} else {
+	} else if (map) {
 		if (dir)
 			_errorString += path + ": " + map->errorString() + "\n";
 		else
 			_errorString = map->errorString();
 		return false;
+	} else {
+		if (dir)
+			_errorString += path + ": " + "Unknown map format\n";
+		else
+			_errorString = "Unknown map format";
+		return false;
 	}
 }
 
@@ -41,18 +48,22 @@ Map *MapList::loadSource(const QString &path, bool dir)
 	return map;
 }
 
-bool MapList::loadFile(const QString &path, bool *atlas, bool dir)
+bool MapList::loadFile(const QString &path, bool *terminate, bool dir)
 {
 	QFileInfo fi(path);
 	QString suffix = fi.suffix().toLower();
-	Map *map;
+	Map *map = 0;
 
 	if (Atlas::isAtlas(path)) {
-		*atlas = true;
+		*terminate = true;
 		map = new Atlas(path, this);
 	} else if (suffix == "xml") {
-		if (!(map = loadSource(path, dir)))
+		if (MapSource::isMap(path) && !(map = loadSource(path, dir)))
 			return false;
+		else if (GMAP::isGMAP(path)) {
+			*terminate = true;
+			map = new IMGMap(path);
+		}
 	} else if (suffix == "jnx")
 		map = new JNXMap(path, this);
 	else if (suffix == "tif" || suffix == "tiff")
@@ -85,15 +96,15 @@ bool MapList::loadDirR(const QString &path)
 	for (int i = 0; i < ml.size(); i++) {
 		const QFileInfo &fi = ml.at(i);
 		QString suffix = fi.suffix().toLower();
-		bool atlas = false;
+		bool terminate = false;
 
 		if (fi.isDir() && fi.fileName() != "set") {
 			if (!loadDirR(fi.absoluteFilePath()))
 				ret = false;
 		} else if (filter().contains("*." + suffix)) {
-			if (!loadFile(fi.absoluteFilePath(), &atlas, true))
+			if (!loadFile(fi.absoluteFilePath(), &terminate, true))
 				ret = false;
-			if (atlas)
+			if (terminate)
 				break;
 		}
 	}
@@ -120,7 +131,7 @@ QString MapList::formats()
 	return
 	  tr("Supported files")
 	  + " (*.img *.jnx *.map *.mbtiles *.rmap *.rtmap *.tar *.tba *.tif *.tiff *.xml);;"
-	  + tr("Garmin IMG maps") + " (*.img);;"
+	  + tr("Garmin IMG maps") + " (*.img *.xml);;"
 	  + tr("Garmin JNX maps") + " (*.jnx);;"
 	  + tr("OziExplorer maps") + " (*.map);;"
 	  + tr("MBTiles maps") + " (*.mbtiles);;"

src/map/maplist.h

@@ -23,7 +23,7 @@ public:
 	static QStringList filter();
 
 private:
-	bool loadFile(const QString &path, bool *atlas, bool dir);
+	bool loadFile(const QString &path, bool *terminate, bool dir);
 	bool loadDirR(const QString &path);
 	Map *loadSource(const QString &path, bool dir);
 	bool loadMap(Map *map, const QString &path, bool dir);

src/map/mapsource.cpp

@@ -222,6 +222,20 @@ void MapSource::map(QXmlStreamReader &reader, Config &config)
 	}
 }
 
+bool MapSource::isMap(const QString &path)
+{
+	QFile file(path);
+
+	if (!file.open(QFile::ReadOnly | QFile::Text))
+		return false;
+
+	QXmlStreamReader reader(&file);
+	if (reader.readNextStartElement() && reader.name() == "map")
+		return true;
+
+	return false;
+}
+
 Map *MapSource::loadMap(const QString &path, QString &errorString)
 {
 	Config config;

src/map/mapsource.h

@@ -15,6 +15,7 @@ class MapSource
 {
 public:
 	static Map *loadMap(const QString &path, QString &errorString);
+	static bool isMap(const QString &path);
 
 private:
 	enum Type {

src/map/obliquestereographic.cpp

@@ -8,7 +8,7 @@
 ObliqueStereographic::ObliqueStereographic(const Ellipsoid *ellipsoid,
   double latitudeOrigin, double longitudeOrigin, double scale,
   double falseEasting, double falseNorthing)
-  : _FE(falseEasting), _FN(falseNorthing)
+  : _fe(falseEasting), _fn(falseNorthing)
 {
 	double lat0 = deg2rad(latitudeOrigin);
 	double sinPhi0 = sin(lat0);
@@ -48,17 +48,17 @@ PointD ObliqueStereographic::ll2xy(const Coordinates &c) const
 	double B = (1.0 + sin(chi) * _sinChi0 + cos(chi) * _cosChi0
 	  * cos(lambda - _lambda0));
 
-	return PointD(_FE + _twoRk0 * cos(chi) * sin(lambda - _lambda0) / B,
-	  _FN + _twoRk0 * (sin(chi) * _cosChi0 - cos(chi) * _sinChi0
+	return PointD(_fe + _twoRk0 * cos(chi) * sin(lambda - _lambda0) / B,
+	  _fn + _twoRk0 * (sin(chi) * _cosChi0 - cos(chi) * _sinChi0
 	  * cos(lambda - _lambda0)) / B);
 }
 
 Coordinates ObliqueStereographic::xy2ll(const PointD &p) const
 {
-	double i = atan((p.x() - _FE) / (_h + (p.y() - _FN)));
-	double j = atan((p.x() - _FE) / (_g - (p.y() - _FN))) - i;
+	double i = atan((p.x() - _fe) / (_h + (p.y() - _fn)));
+	double j = atan((p.x() - _fe) / (_g - (p.y() - _fn))) - i;
 
-	double chi = _chi0 + 2.0 * atan(((p.y() - _FN) - (p.x() - _FE) * tan(j/2.0))
+	double chi = _chi0 + 2.0 * atan(((p.y() - _fn) - (p.x() - _fe) * tan(j/2.0))
 	  / _twoRk0);
 	double lambda = j + 2.0 * i + _lambda0;
 

src/map/obliquestereographic.h

@@ -22,7 +22,7 @@ private:
 	double _lambda0;
 	double _n;
 	double _c;
-	double _FE, _FN;
+	double _fe, _fn;
 	double _twoRk0,	_g, _h;
 };