Merge branch 'origin/master' into Weblate.

+ some minor point rendering issues fixes

.appveyor.yml

@@ -1,22 +1,33 @@
-version: 7.16.{build}
+version: 7.21.{build}
-configuration: Release
+
-platform: Any CPU
+configuration:
+  - Release
+
+image:
+  - Visual Studio 2017
+
 environment:
   NSISDIR: C:\Program Files (x86)\NSIS
   matrix:
-  - QTDIR: C:\Qt\5.11\msvc2015
+  - QTDIR: C:\Qt\5.13\msvc2017
-    PLATFORM: x86
     NSI: gpxsee.nsi
-    OPENSSLDIR: C:\OpenSSL-Win32\bin
+    VCVARS: vcvars32.bat
-  - QTDIR: C:\Qt\5.11\msvc2015_64
+    OPENSSLDIR: C:\OpenSSL-v111-Win32\bin
-    PLATFORM: x86_amd64
+    LIBCRYPTO: libssl-1_1.dll
+    LIBSSL: libcrypto-1_1.dll
+  - QTDIR: C:\Qt\5.13\msvc2017_64
     NSI: gpxsee64.nsi
-    OPENSSLDIR: C:\OpenSSL-Win64\bin
+    VCVARS: vcvars64.bat
+    OPENSSLDIR: C:\OpenSSL-v111-Win64\bin
+    LIBCRYPTO: libssl-1_1-x64.dll
+    LIBSSL: libcrypto-1_1-x64.dll    
+
 install:
 - cmd: >-
     set PATH=%QTDIR%\bin;%NSISDIR%;%PATH%
 
-    call "C:\Program Files (x86)\Microsoft Visual Studio 14.0\VC\vcvarsall.bat" %PLATFORM%
+    call "C:\Program Files (x86)\Microsoft Visual Studio\2017\Community\VC\Auxiliary\Build\"%VCVARS%
+
 build_script:
 - cmd: >-
     lrelease gpxsee.pro
@@ -44,9 +55,9 @@ build_script:
 
     copy licence.txt installer
 
-    copy %OPENSSLDIR%\libeay32.dll installer
+    copy %OPENSSLDIR%\%LIBCRYPTO% installer
 
-    copy %OPENSSLDIR%\ssleay32.dll installer
+    copy %OPENSSLDIR%\%LIBSSL% installer
 
 
     makensis.exe installer\%NSI%

.travis.yml

@@ -6,6 +6,7 @@ os:
 
 before_install:
   - if [[ "$TRAVIS_OS_NAME" == "linux" ]]; then sudo apt-get -qq update; fi
+  - if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then brew update; fi
 
 install:
   - if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then brew install qt; fi

README.md

@@ -2,7 +2,7 @@
 GPXSee is a Qt-based GPS log file viewer and analyzer that supports all common GPS log file formats.
 
 ## Features
-* Opens GPX, TCX, FIT, KML, NMEA, IGC, CUP, SLF, LOC, GeoJSON, OziExplorer (PLT, RTE, WPT), Garmin CSV and geotagged JPEG files.
+* Opens GPX, TCX, FIT, KML, NMEA, IGC, CUP, SIGMA SLF, Suunto SML, LOC, GeoJSON, OziExplorer (PLT, RTE, WPT), Garmin GPI&CSV and geotagged JPEG files.
 * User-definable online maps (OpenStreetMap/Google tiles, WMTS, WMS, TMS, QuadTiles).
 * Offline maps (MBTiles, OziExplorer maps, TrekBuddy maps/atlases, Garmin IMG & JNX maps, TwoNav RMaps, GeoTIFF images).
 * Elevation, speed, heart rate, cadence, power, temperature and gear ratio/shifts graphs.

gpxsee.pro

@@ -3,7 +3,7 @@ unix:!macx {
 } else {
     TARGET = GPXSee
 }
-VERSION = 7.16
+VERSION = 7.21
 
 QT += core \
     gui \
@@ -21,6 +21,7 @@ INCLUDEPATH += ./src
 HEADERS += src/common/config.h \
     src/GUI/graphicsscene.h \
     src/GUI/popup.h \
+    src/common/garmin.h \
     src/common/staticassert.h \
     src/common/coordinates.h \
     src/common/range.h \
@@ -88,6 +89,12 @@ HEADERS += src/common/config.h \
     src/GUI/areaitem.h \
     src/data/link.h \
     src/map/IMG/bitmapline.h \
+    src/map/IMG/bitstream.h \
+    src/map/IMG/deltastream.h \
+    src/map/IMG/gmap.h \
+    src/map/IMG/huffmanstream.h \
+    src/map/IMG/huffmantable.h \
+    src/map/IMG/mapdata.h \
     src/map/IMG/textpathitem.h \
     src/map/IMG/textpointitem.h \
     src/map/projection.h \
@@ -178,7 +185,6 @@ HEADERS += src/common/config.h \
     src/map/IMG/lblfile.h \
     src/map/IMG/vectortile.h \
     src/map/IMG/subdiv.h \
-    src/map/IMG/units.h \
     src/map/IMG/style.h \
     src/map/IMG/netfile.h \
     src/GUI/limitedcombobox.h \
@@ -187,7 +193,9 @@ HEADERS += src/common/config.h \
     src/map/IMG/label.h \
     src/data/csv.h \
     src/data/cupparser.h \
-    src/data/gpiparser.h
+    src/data/gpiparser.h \
+    src/data/address.h \
+    src/data/smlparser.h
 SOURCES += src/main.cpp \
     src/GUI/popup.cpp \
     src/common/coordinates.cpp \
@@ -241,6 +249,12 @@ SOURCES += src/main.cpp \
     src/GUI/mapview.cpp \
     src/GUI/areaitem.cpp \
     src/map/IMG/bitmapline.cpp \
+    src/map/IMG/bitstream.cpp \
+    src/map/IMG/deltastream.cpp \
+    src/map/IMG/gmap.cpp \
+    src/map/IMG/huffmanstream.cpp \
+    src/map/IMG/huffmantable.cpp \
+    src/map/IMG/mapdata.cpp \
     src/map/IMG/textpathitem.cpp \
     src/map/IMG/textpointitem.cpp \
     src/map/maplist.cpp \
@@ -323,7 +337,8 @@ SOURCES += src/main.cpp \
     src/data/csv.cpp \
     src/data/cupparser.cpp \
     src/GUI/graphicsscene.cpp \
-    src/data/gpiparser.cpp
+    src/data/gpiparser.cpp \
+    src/data/smlparser.cpp
 
 greaterThan(QT_MAJOR_VERSION, 4) {
     HEADERS += src/data/geojsonparser.h
@@ -347,7 +362,9 @@ TRANSLATIONS = lang/gpxsee_en.ts \
     lang/gpxsee_da.ts \
     lang/gpxsee_tr.ts \
     lang/gpxsee_es.ts \
-    lang/gpxsee_pt_BR.ts
+    lang/gpxsee_pt_BR.ts \
+    lang/gpxsee_uk.ts \
+    lang/gpxsee_hu.ts
 
 macx {
     ICON = icons/gpxsee.icns
@@ -365,7 +382,8 @@ macx {
         lang/gpxsee_da.qm \
         lang/gpxsee_tr.qm \
         lang/gpxsee_es.qm \
-        lang/gpxsee_pt_BR.qm
+        lang/gpxsee_pt_BR.qm \
+        lang/gpxsee_uk.qm
     csv.path = Contents/Resources
     csv.files = pkg/csv
     maps.path = Contents/Resources
@@ -384,7 +402,8 @@ macx {
         icons/formats/slf.icns \
         icons/formats/json.icns \
         icons/formats/cup.icns \
-        icons/formats/gpi.icns
+        icons/formats/gpi.icns \
+        icons/formats/sml.icns
     QMAKE_BUNDLE_DATA += locale maps icons csv
 }
 
@@ -403,7 +422,8 @@ win32 {
         icons/formats/slf.ico \
         icons/formats/json.ico \
         icons/formats/cup.ico \
-        icons/formats/gpi.ico
+        icons/formats/gpi.ico \
+        icons/formats/sml.ico
     DEFINES += _USE_MATH_DEFINES \
         NOGDI
 }

icons/scripts/extensions

@@ -12,3 +12,4 @@ loc:#556677
 slf:#881199
 cup:#20a810
 gpi:#fca314
+sml:#6434eb

lang/gpxsee_cs.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Podporované soubory</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Soubory CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>Soubory CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Soubory FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Soubory GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>Soubory GPI</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Soubory GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Soubory IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>Obrázky JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Soubory KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Soubory LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Soubory NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Soubory OziExploreru</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Soubory SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Soubory TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Soubory SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Všechny soubory</translation>
     </message>
@@ -508,8 +518,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Čistý čas</translation>
     </message>
@@ -664,32 +674,32 @@
         <translation>Adresář se styly:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Plochy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Statistika</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Otevřít mapový soubor</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Nejsou načteny žádné soubory</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
@@ -744,18 +754,18 @@
         <translation>Adresář mezipaměti dlaždic:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Trasy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Mapu nelze načíst:</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n soubor</numerusform>
@@ -779,8 +789,8 @@
         <translation>Exportovat do PDF...</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Navigační body</translation>
     </message>
@@ -821,13 +831,13 @@
         <translation>Soubor POI nelze načíst:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Název</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Cesty</translation>
     </message>
@@ -844,16 +854,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Vzdálenost</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Čas</translation>
     </message>
@@ -950,12 +960,12 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Vzdálenost</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Čas</translation>
     </message>
@@ -1054,478 +1064,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Základní barva:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Posun palety:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Šířka cest:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Styl cest:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Cesty</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Šířka tras:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Styl tras:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Trasy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Vyhlazovat hrany</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Šířka čar:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Barva pozadí:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Trasy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Neprůhlednost mapy:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Mapa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Grafy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Vysoké rozlišení</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Standardní</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>Ne-HiDPI mapy jsou načteny jako HiDPI mapy. Mapa je ostrá, ale objekty na mapě jsou malé/těžko čitelné.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>Ne-HiDPI mapy jsou načteny tak jak jsou. Objekty na mapě mají očekávanou velikost, ale mapa je rozmazaná.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>HiDPI režim zobrazení</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Šířka:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Styl:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Barva navigačních bodů:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Velikost navigačních bodů:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Barva:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Velikost:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Navigační body</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>Barva POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>Velikost POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>POI body</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Barva posuvníku:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Body</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Velikost okna klouzavého průměru</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Výška:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Rychlost:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Tep:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Kadence:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Výkon:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Vyhlazování</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Odstarnit odlehlé GPS záznamy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Vyhlazování:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation>Automatická</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mi/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>kn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimální rychlost:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimální doba trvání:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Vypočítaná ze vzdálenosti/času</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Zaznamenaná zařízením</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Výška</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrování</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Zdroje</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Detekce přestávek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Radius:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Rychlost</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Projekce:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Vektorové mapy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Šířka okrajů ploch:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Styl okrajů ploch:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Neprůhlednost výplně ploch:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Neprůhlednost výplně:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Plochy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation>Vlastní</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Vysoké rozlišení</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Oblast tisku přibližně odpovídá zobrazované oblasti. Přiblížení mapy se nemění.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Přiblížení mapy bude upraveno tak, aby se celý obsah (trasy/body) vešel do oblasti tisku a rozlišení mapy bylo co nejblíže rozlišení tisku.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Název</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Vzdálenost</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Čas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Čistý čas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Počet objektů (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Samostatná stránka s grafy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Režim tisku</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Záhlaví</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Používat OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Povolit HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Mezipaměť obrázků:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Časový limit připojení:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Systém</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Vzhled</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Mapy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Tisk a export</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Nastavení</translation>
     </message>
@@ -1868,7 +1888,12 @@
         <translation>Popis</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation>Adresa</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation>Odkazy</translation>
     </message>

lang/gpxsee_da.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Understøttede filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Alle filer</translation>
     </message>
@@ -484,16 +494,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Afstand</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
@@ -524,8 +534,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Tid i bevægelse</translation>
     </message>
@@ -791,65 +801,65 @@
         <translation>Fejl ved indlæsning af IP-fil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Spor</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Ruter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Rutepunkter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Dato</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Statistikker</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Navn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Åbn kort-fil</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Fejl ved indlæsning af kort:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Ingen filer indlæst</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n fil</numerusform>
@@ -908,7 +918,7 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Afstand</translation>
     </message>
@@ -954,7 +964,7 @@
         <translation>t</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
@@ -1053,478 +1063,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Højopløsning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Standard</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>Ikke HiDPI kort er indlæst som HiDPI kort. Kortet er skarpt, men kortobjekter er små/svære at læse.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>Ikke HiDPI kort er indlæst som de er. Kortobjekter har den forventede størrelse, men kortet er sløret.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>HiDPI skærmtilstand</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Grundfarve:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Paletteskift:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Sporvidde:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Sporstil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Bredde:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Stil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Spor</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Rutebredde:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Rutestil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Ruter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Brug anti-aliasing</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Rutepunktfarve:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Rutepunktstørrelse:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Farve:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Størrelse:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Rutepunkter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>IP farve:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>IP størrelse:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation type="unfinished">Interessepunkter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Linjebredde:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation type="unfinished">Skyderfarve:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Baggrundsfarve:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation type="unfinished">Gennemsigtighed for kort:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Stier</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Punkter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Grafer</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Kort</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation type="unfinished">Glidende gennemsnitlig vinduesstørrelse</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Højde:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Hastighed:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Puls:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Kadence:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Effekt:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Udjævning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Eliminer GPS-ekstremværdier</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Udjævning:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mil/t</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation type="unfinished">knob</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/t</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Mindste hastighed:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minidste varighed:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Beregnet ud fra afstanden/tiden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Indspillet af enhed</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation type="unfinished">Højde</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrering</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation type="unfinished">Pause genkendelse</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation type="unfinished"></translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Hastighed</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mil</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>sømil</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>IP</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation type="unfinished">WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Højopløsning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation type="unfinished">Det udskrevne område er ca. det samme som visningsområdet. Kortes zoomniveau ændres ikke.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation type="unfinished">Zoom-niveauet vil blive ændret, således at hele indholdet (spor/rutepunkter) passer til udskriftsområdet og kortopløsning er så tæt som muligt på udskriftsopløsningen.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Navn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Dato</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Afstand</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Tid i bevægelse</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation type="unfinished">Elementantal (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separat grafside</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation type="unfinished">Udskrivningstilstand</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation type="unfinished">Toptekst</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Brug OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Aktiver HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation type="unfinished">Billed cachestørrelse:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Timeout for forbindelse:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Udseende</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Kort</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Udskriv &amp; eksport</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Indstillinger</translation>
     </message>
@@ -1867,7 +1887,12 @@
         <translation>Beskrivelse</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation type="unfinished"></translation>
     </message>

lang/gpxsee_de.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Unterstützte Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>GPI-Dateien</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG-Bilder</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML-Dateien</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-Dateien</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Alle Dateien</translation>
     </message>
@@ -518,8 +528,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Bewegungszeit</translation>
     </message>
@@ -674,34 +684,34 @@
         <translation>Formatvorlagen-Verzeichnis:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Flächen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Statistiken</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Kartendatei öffnen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Fehler beim Laden der Kartendatei:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Keine Dateien geladen</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n Datei</numerusform>
@@ -709,16 +719,16 @@
         </translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Routen</translation>
     </message>
@@ -738,8 +748,8 @@
         <translation>Als PDF exportieren …</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Wegpunkte</translation>
     </message>
@@ -820,13 +830,13 @@
         <translation>Fehler beim Laden der POI-Datei:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Name</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Strecken</translation>
     </message>
@@ -843,16 +853,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Distanz</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Zeit</translation>
     </message>
@@ -949,12 +959,12 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Distanz</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Zeit</translation>
     </message>
@@ -1053,478 +1063,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Grundfarbe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Palettenverschiebung:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Streckenbreite:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Streckenstil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Strecken</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Routenbreite:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Routenstil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Routen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Anti-Aliasing verwenden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Linienbreite:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Hintergrundfarbe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Pfade</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Kartendeckkraft:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Karte</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Graphen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Hohe Auflösung</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Standardmäßig</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>Nicht-HiDPI-Karten werden als HiDPI-Karten geladen. Die Karte ist scharf, aber die Kartenobjekte sind klein / schwer zu lesen.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>Nicht-HiDPI-Karten werden so geladen, wie sie sind. Kartenobjekte haben die erwartete Größe, aber die Karte ist verschwommen.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>HiDPI-Anzeigemodus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Breite:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Stil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Wegpunkt-Farbe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Wegpunkt-Größe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Farbe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Größe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Wegpunkte</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>POI-Farbe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>POI-Größe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>POIs</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Schieber-Farbe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Punkte</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Fensterbreite des gleitenden Mittelwerts</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Höhe:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Geschwindigkeit:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Herzfrequenz:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Frequenz:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Leistung:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Glätten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>GPS-Ausreißer entfernen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Glätten:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation>Automatisch</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mi/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>kn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>sek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimale Geschwindigkeit:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimale Dauer:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Berechnet aus Entfernung/Zeit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Aufgezeichnet von Gerät</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS-Daten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM-Daten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Höhe</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Datenfilterung</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Datenquellen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Pausenerkennung</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Radius:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Geschwindigkeit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Projektion:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Vektorkarten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Flächen-Randbreite:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Flächen-Randstil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Flächendeckkraft:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Deckkraft:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Flächen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation>Benutzerdefiniert</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Hohe Auflösung</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Der Druckbereich entspricht ungefähr dem Anzeigebereich. Das Karten-Zoom ändert sich nicht.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Das Karten-Zoom ändert sich so, dass der ganze Inhalt (Strecken/Wegpunkte) in den Druckbereich passen und die Kartenauflösung so nah wie möglich an der Druckauflösung ist.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Name</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Distanz</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Zeit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Bewegungszeit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Elementanzahl (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separate Seite für Graphen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Druckmodus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Kopfzeile</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>OpenGL verwenden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>HTTP/2 verwenden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Bild-Cachegröße:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Verbindungs-Timeout:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Erscheinungsbild</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Karten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Daten</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Druck / Export</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Einstellungen</translation>
     </message>
@@ -1867,7 +1887,12 @@
         <translation>Beschreibung</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation>Adresse</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation>Links</translation>
     </message>

lang/gpxsee_fi.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Tuetut tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>GPI-tiedostot</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG-kuvat</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML-tiedostot</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-tiedostot</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Kaikki tiedostot</translation>
     </message>
@@ -508,8 +518,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Liikkumisaika</translation>
     </message>
@@ -664,32 +674,32 @@
         <translation>Tyylitiedostoiden hakemisto:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Alueet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Tilasto</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Avaa karttatiedosto</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Yhtään tiedostoa ei ladattu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Päivämäärä</translation>
     </message>
@@ -744,18 +754,18 @@
         <translation>Välimuistin hakemisto:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Reitit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Virhe ladattaessa karttaa:</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n tiedosto</numerusform>
@@ -778,8 +788,8 @@
         <translation>Vie PDF:ksi...</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Reittipisteet</translation>
     </message>
@@ -820,13 +830,13 @@
         <translation>Virhe ladattaessa POI-tiedostoa:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Nimi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Jäljet</translation>
     </message>
@@ -843,16 +853,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Etäisyys</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Aika</translation>
     </message>
@@ -949,12 +959,12 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Etäisyys</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Aika</translation>
     </message>
@@ -1053,478 +1063,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Pohjaväri:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Paletin muutos:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Jäljen leveys:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Jäljen tyyli:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Jäljet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Reitin leveys:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Reitin tyyli:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Reitit</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Käytä reunanpehmennystä</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Viivan leveys:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Taustan väri:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Jäljet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Kartan läpinäkymättömyys:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Kartat</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Kaaviokuvat</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Korkea resoluutio</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Vakioresoluutio</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>Ei-HiDPI-kartat ladataan HiDPI-karttoina. Kartta on terävä, mutta karttakohteet ovat pieniä/vaikeasti luettavia.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>Ei-HiDPI-kartat ladataan kuten ne ovat. Karttakohteilla on odotettu koko, mutta kartta on epäselvä.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>HiDPI-näyttötila</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Leveys:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Tyyli:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Reittipisteen väri:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Reittipisteen koko:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Väri:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Koko:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Reittipisteet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>POI:n väri:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>POI:n koko:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>POI:t</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Liukusäätimen väri:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Pisteet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Liukuvan keskiarvon ikkunan koko</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Korkeus:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Vauhti:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Sydämen syke:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Kadenssi:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Teho:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Silotus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Poista poikkeavat GPS-havainnot</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Silotus:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation>Automaattinen</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mph</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>kn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/t</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimivauhti:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimikesto:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Laskettu etäisyydestä/ajasta</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Tallennettu laitteella</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS-tiedot</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM-tiedot</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Korkeus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Suodatus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Lähteet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Pysähdysten havaitseminen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Säde:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Vauhti</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Projektio:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Vektorikartat</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Alueen rajan leveys:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Alueen rajan tyyli:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Alueen täytön läpinäkymättömyys:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Täytön läpinäkymättömyys:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Alueet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation>Käyttäjän määrittämä</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>mpk</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Korkea resoluutio</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Painettu alue on suunnilleen näyttöalue. Kartan zoomaustaso ei muutu.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Zoomaustasoa muutetaan niin, että koko sisältö (jäljet/reittipisteet) sopii painettuun alueeseen ja kartan resoluutio on mahdollisimman lähellä tulostusresoluutiota.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nimi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Päivämäärä</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Etäisyys</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Aika</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Liikkumisaika</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Kohteiden määrä (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Erillinen sivu kaaviokuvalle</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Tulostustila</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Otsikko</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Käytä OpenGL:ää</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Ota HTTP/2 käyttöön</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>Mt</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Kuvavälimuistin koko:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Yhteyden aikakatkaisu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Järjestelmä</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Ulkoasu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Kartat</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Tiedot</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Tulostus &amp; vienti</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Valinnat</translation>
     </message>
@@ -1867,7 +1887,12 @@
         <translation>Kuvaus</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation>Osoite</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation>Linkit</translation>
     </message>

lang/gpxsee_fr.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Formats pris en charge</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Données CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>Données CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Données FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Données GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>Données GPI</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Données GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Données IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>Images JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Données KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Données LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Données NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Données OziExplorer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Données SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Données TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Données SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Tous les fichiers</translation>
     </message>
@@ -518,8 +528,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Durée en déplacement</translation>
     </message>
@@ -674,34 +684,34 @@
         <translation>Dossier de styles :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Zones</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Statistiques</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Ouvrir un fichier de carte</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Erreur lors du chargement de la carte :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Aucun fichier chargé</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n fichier</numerusform>
@@ -709,16 +719,16 @@
         </translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Date</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Routes</translation>
     </message>
@@ -738,8 +748,8 @@
         <translation>Exporter au format PDF...</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Points de jalonnement</translation>
     </message>
@@ -820,13 +830,13 @@
         <translation>Erreur lors du chargement du fichier POI :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Nom</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Traces</translation>
     </message>
@@ -843,16 +853,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Distance</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Temps</translation>
     </message>
@@ -949,12 +959,12 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Distance</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Temps</translation>
     </message>
@@ -1053,478 +1063,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Couleur de base :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Incrément de palette :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Épaisseur des traces :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Style des traces :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Traces</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Épaisseur des routes :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Style des routes :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Routes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Utiliser l&apos;anticrénelage</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Épaisseur de ligne :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Couleur d&apos;arrière plan :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Chemins</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Opacité de la carte :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Carte</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Graphe</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Résolution élevée</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Standard</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
-        <translation>Les cartes qui n&apos;ont pas de résolution élevée sont chargées comme une carte à résolution élevée. La carte est nette mais ses symboles sont petits ou difficiles à lire.</translation>
+        <translation>Les cartes qui n&apos;ont pas de résolution élevée sont chargées comme une carte à résolution élevée. La carte est nette mais ses symboles sont petits et moins lisible.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
-        <translation>Les cartes qui n&apos;ont pas de résolution élevée sont chargées telles quelles. Les symboles de la carte ont leurs tailles attendues mais la carte est floue.</translation>
+        <translation>Les cartes qui n&apos;ont pas de résolution élevée sont chargées telles quelles. Les symboles de la carte ont une taille adaptée mais la carte est floue.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>Affichage à haute résolution</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Épaisseur :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Style :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Couleur des points de jalonnement :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Tailles des points de jalonnement :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Couleur :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Taille :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Points de jalonnement</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>Couleur des POI :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>Taille des POI :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Couleur du curseur :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Points</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Largeur de fenêtre de la moyenne glissante</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Altitude :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Vitesse :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Fréquence cardiaque :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Cadence :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Puissance :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Lissage</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Supprimer les données GPS aberrantes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Lissage :</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation>Automatique</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mi/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>nd</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Vitesse minimale :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Durée minimale :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Calculée comme distance/temps</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Enregistrée par l&apos;appareil</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>Données GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>Données MNT</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Altitude</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrage</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Sources</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Détection des arrêts</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Rayon :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Vitesse</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Projection :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Cartes vectorielles</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Épaisseur de bord de zone :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Style de bord de zone :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Opacité du remplissage des zones :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Opacité de remplissage :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Zones</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation>Personnalisé</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Résolution élevée</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>La zone d&apos;impression est presque celle affichée. L&apos;échelle reste la même.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>L&apos;échelle est ajustée pour que tout le contenu (traces et points de jalonnement) rentre dans la zone d&apos;impression tout en gardant proches les résolutions d&apos;impression et de carte.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nom</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Date</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Distance</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Durée</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Durée en déplacement</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Nombre d&apos;éléments (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Sauter une page pour les graphes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Mode d&apos;impression</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Entête</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Utiliser OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Activer l&apos;HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>Mo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Volume du cache à images :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Délai d&apos;attente de connexion :</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Système</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Apparence</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Cartes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Données</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Imprimer et exporter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Options</translation>
     </message>
@@ -1605,7 +1625,7 @@
     <message>
         <location filename="../src/GUI/routeitem.cpp" line="29"/>
         <source>Links</source>
-        <translation type="unfinished"></translation>
+        <translation>Liens</translation>
     </message>
 </context>
 <context>
@@ -1836,7 +1856,7 @@
     <message>
         <location filename="../src/GUI/trackitem.cpp" line="33"/>
         <source>Links</source>
-        <translation type="unfinished"></translation>
+        <translation>Liens</translation>
     </message>
 </context>
 <context>
@@ -1867,9 +1887,14 @@
         <translation>Description</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation>Adresse</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
-        <translation type="unfinished"></translation>
+        <translation>Liens</translation>
     </message>
 </context>
 </TS>

lang/gpxsee_pl.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Obsługiwane pliki</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Pliki CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
-        <translation type="unfinished"></translation>
+        <translation>Pliki CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Pliki FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Pliki GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>Pliki GPI</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Pliki GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Pliki IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>Pliki JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Pliki KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Pliki LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Pliki NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Pliki OziExplorer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Pliki SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Pliki TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Pliki SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Wszystkie pliki</translation>
     </message>
@@ -508,8 +518,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Czas ruchu</translation>
     </message>
@@ -664,32 +674,32 @@
         <translation>Katalog ze stylami:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Obszary</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Statystyka</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Otwórz plik mapy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Nie załadowano żadnych plików</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Data</translation>
     </message>
@@ -744,18 +754,18 @@
         <translation>Katalog pamięci podręcznej kafelków:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Trasy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Wystąpił błąd podczas ładowania mapy:</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n plik</numerusform>
@@ -779,8 +789,8 @@
         <translation>Eksportuj do PDF...</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Punkty nawigacyjne</translation>
     </message>
@@ -821,13 +831,13 @@
         <translation>Błąd podczas ładowania pliku POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Nazwa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Ślady</translation>
     </message>
@@ -844,16 +854,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Dystans</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Czas</translation>
     </message>
@@ -950,12 +960,12 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Dystans</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Czas</translation>
     </message>
@@ -1054,478 +1064,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Kolor podstawowy:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Przesunięcie palety:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Szerokość śladu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Styl śladu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Ślady</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Szerokość trasy:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Styl trasy:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Trasy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Użyj wygładzania</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Szerokość lini:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Kolor tła:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Ścieżki</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Nieprzezroczystość mapy:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Mapa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Wykresy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Wysoka rozdzielczość</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Standardowy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>Mapy inne niż HiDPI są ładowane jako mapy HiDPI. Mapa jest ostra, ale obiekty mapy są małe / trudne do odczytania.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>Mapy inne niż HiDPI są ładowane w takiej postaci, w jakiej są. Obiekty mapy mają oczekiwany rozmiar, ale mapa jest rozmyta / nieostra.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>Tryb wyświetlania HiDPI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Szerokość:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Styl:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Kolor punktów nawigacyjnych:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Rozmiar punktów nawigacyjnych:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Kolor:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Rozmiar:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Punkty nawigacyjne</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>Kolor POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>Rozmiar POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>Punkty POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Kolor suwaka:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Punkty</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Rozmiar okna średniej ruchomej</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Wysokość:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Prędkość:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Tętno:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Kadencja:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Moc:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Wygładzanie</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Wyeliminuj odstające dane GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Wygładzanie:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mi/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>kn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minimalna prędkość:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimalny czas trwania:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Obliczona na postawie odległości/czasu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Zapisana przez urządzenie</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>Dane GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>Dane DEM</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Wysokość</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrowanie</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Źródła</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Wykrywanie postoju</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Promień:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Prędkość</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Odwzorowanie:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Mapy wektorowe</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Szerokość granicy obszaru:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Styl obramowania obszaru:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Nieprzezroczystość wypełnienia obszaru:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Nieprzezroczystość wypełnienia:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Obszary</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Wysoka rozdzielczość</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Wydrukowany obszar jest w przybliżeniu obszarem wyświetlania. Poziom powiększenia mapy nie zmienia się.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Poziom powiększenia mapy zostanie dostosowany w taki sposób, aby cała zawartość (ścieżki/punkty) wchodziła do drukowanego obszaru, a rozdzielczość mapy była jak najbliższa rozdzielczości wydruku.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nazwa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Dystans</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Czas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Czas ruchu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Liczba elementów (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Oddzielna strona wykresu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Tryb wydruku</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Nagłówek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Używaj OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Włącz HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Rozmiar pamięci podręcznej obrazu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Limit czasu połączenia:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Wygląd</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Mapy</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Dane</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Drukowanie i eksport</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Opcje</translation>
     </message>
@@ -1868,7 +1888,12 @@
         <translation>Opis</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation type="unfinished"></translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation type="unfinished"></translation>
     </message>

lang/gpxsee_pt_BR.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Formatos suportados</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>Arquivos CSV</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>Arquivos CUP</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>Arquivos FIT</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>Arquivos GeoJSON</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>Arquivos GPI</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>Arquivos GPX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>Arquivos IGC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>Imagens JPEG</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>Arquivos KML</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>Arquivos LOC</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>Arquivos NMEA</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>Arquivos OziExplorer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>Arquivos SLF</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>Arquivos SML</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>Arquivos TCX</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Todos os arquivos</translation>
     </message>
@@ -484,16 +494,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Distância</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Tempo</translation>
     </message>
@@ -524,8 +534,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Tempo em movimento</translation>
     </message>
@@ -791,65 +801,65 @@
         <translation>Erro ao carregar arquivo POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Trilhas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Rotas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Waypoints</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Áreas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Estatísticas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Nome</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Abrir arquivo de mapa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Erro ao carregar o mapa:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Nenhum arquivo carregado</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n arquivo</numerusform>
@@ -908,7 +918,7 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Distância</translation>
     </message>
@@ -954,7 +964,7 @@
         <translation>h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Tempo</translation>
     </message>
@@ -1053,478 +1063,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Alta resolução</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Padrão</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>Mapas que não são HiDPI são carregados como se o fossem. O Mapa é nítido, mas os objetos são pequenos/difíceis de ler.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>Mapas que não são HiDPI são carregados do modo que são. Objetos de mapa têm o tamanho esperado, mas o mapa é desfocado.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Projeção:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Mapas vetoriais</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>Modo de exibição HiDPI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Largura da trilha:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Estilo da trilha:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Largura:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Estilo:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Trilhas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Largura da rota:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Estilo da rota:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Rotas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Largura de borda de área:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Estilo de borda de área:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Opacidade de preenchimento de área:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Opacidade de preenchimento:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Áreas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Cor de base:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Deslocamento de paleta:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Usar anti-aliasing</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Cor de waypoint:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Tamanho de waypoint:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Cor:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Tamanho:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Waypoints</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>Cor do POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>Tamanho do POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>POIs</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Largura de linha:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Cor do cursor:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Cor de fundo:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Opacidade do mapa:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Caminhos</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Pontos</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Gráficos</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Mapa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Tamanho de janela da média móvel</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Altitude:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Velocidade:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Frequência cardiaca:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Cadência:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Potência:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Suavizar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Eliminar valores atípicos do GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Suavizar:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation>Automática</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation>Personalizada</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mi/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>kn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Velocidade Mínima:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Duração mínima:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Calculada a partir da distância/tempo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Gravada através de dispositivo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>Dados de GPS</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>Dados de DEM</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Velocidade</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Altitude</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtragem</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Fontes</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Detecção de pausa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Raio:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Alta resolução</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>A área de impressão é aproximadamente a área de tela. O nível de zoom do mapa não é alterado.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>O nível de zoom será alterado de modo que todo o conteúdo (trilhas/waypoints) caiba na área de impressão e a resolução seja tão próxima quanto possível da resolução de impressão.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Nome</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Distância</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Tempo</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Tempo em movimento</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Número de itens (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separar página de gráficos</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Modo de impressão</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Cabeçalho</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Usar OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Habilitar HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Tamanho do cache de imagens:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Tempo de espera de conexão:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Sistema</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Aparência</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Mapas</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Dados</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Imprimir e Exportar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Preferências</translation>
     </message>
@@ -1867,7 +1887,12 @@
         <translation>Descrição</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation>Endereço</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation>Links</translation>
     </message>

lang/gpxsee_ru.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Все поддерживаемые файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>GPI файлы</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG изображения</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML файлы</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF файлы</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Все файлы</translation>
     </message>
@@ -508,8 +518,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Время движения</translation>
     </message>
@@ -664,32 +674,32 @@
         <translation>Каталог со стилями:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Области</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Статистика</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Открыть файл карты</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Нет загруженных файлов</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Дата</translation>
     </message>
@@ -744,18 +754,18 @@
         <translation>Каталог кеша тайлов:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Маршруты</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Ошибка загрузки карты:</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n файл</numerusform>
@@ -779,8 +789,8 @@
         <translation>Экспорт в PDF…</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Точки</translation>
     </message>
@@ -821,13 +831,13 @@
         <translation>Ошибка загрузки файла с точками POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Имя</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Треки</translation>
     </message>
@@ -844,16 +854,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Расстояние</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Время</translation>
     </message>
@@ -950,12 +960,12 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Расстояние</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Время</translation>
     </message>
@@ -1054,478 +1064,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Основной цвет:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Смещение палитры:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Толщина трека:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Стиль трека:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Треки</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Толщина маршрута:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Стиль маршрута:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Маршруты</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Применять сглаживание</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Толщина линии:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Цвет фона:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Треки</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Прозрачность карты:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Карты</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Графики</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Высокое разрешение</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Стандартный</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>Не-HiDPI карты загружаются как HiDPI карты. Карта резкая, но объекты карты маленькие/трудночитаемые.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>Не-HiDPI карты загружаются так, как есть. Объекты карты имеют ожидаемый размер, но карта размытая.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>HiDPI режим отображения</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Толщина:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Стиль:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Цвет точки:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Размер точки:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Цвет:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Размер:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Точки</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>Цвет точки POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>Размер точки POI:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>Точки POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Цвет ползунка:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Точки</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Ширины окна усреднения</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Высота:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Скорость:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Пульс:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Каденс:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Мощность:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Сглаживание</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Устранять GPS выбросы</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Сглаживание:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation>Автоматическое</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>мл/ч</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>уз</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>км/ч</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>с</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Минимальная скорость:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Минимальная продолжительность:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Вычисленная из расстояния/времени</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Записанная устройством</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS данные</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM данные</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Высота</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Фильтрация</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Источники</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Обнаружение остановок</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Радиус:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Скорость</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Проекция:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Векторные карты</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Толщина границы области:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Стиль границы области:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Непрозрачность заливки области:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Непрозрачность заливки:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Области</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation>Пользовательскoe</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>мл</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>мор. мл</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>км</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>Точки POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Высокое разрешение</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Печатная область примерно совпадает с областью отображения. Уровень приближения карты не изменяется.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Уровень приближения будет изменен так, чтобы всё содержимое (треки/точки) уместились в печатную область и разрешение карты было бы как можно ближе к разрешению печати.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Имя</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Дата</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Расстояние</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Время</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Время движения</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Количество объектов (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Отдельная страница с графиком</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Режим печати</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Заголовок</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Использовать OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Включить HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>МБ</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Размер кэша изображений:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Таймаут соединения:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Система</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Внешний вид</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Карты</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Данные</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Печать и экспорт</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Параметры</translation>
     </message>
@@ -1868,7 +1888,12 @@
         <translation>Описание</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation>Адрес</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation>Ссылки</translation>
     </message>

lang/gpxsee_sv.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Filer som stöds</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>GPI-filer</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG-bilder</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML-filer</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF-filer</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Alla filer</translation>
     </message>
@@ -518,8 +528,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Förflyttningstid</translation>
     </message>
@@ -674,34 +684,34 @@
         <translation>Mapp för stilar:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Områden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>Statistik</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Öppna kartfil</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Fel vid inläsning av karta:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Inga filer inlästa</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n fil</numerusform>
@@ -709,16 +719,16 @@
         </translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Rutter</translation>
     </message>
@@ -738,8 +748,8 @@
         <translation>Exportera till PDF...</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Vägpunkter</translation>
     </message>
@@ -820,13 +830,13 @@
         <translation>Fel vid inläsning av POI-fil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Namn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>Spår</translation>
     </message>
@@ -843,16 +853,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Avstånd</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
@@ -949,12 +959,12 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Avstånd</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
@@ -1053,478 +1063,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Basfärg:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Palettskiftning:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>Spårtjocklek:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>Spårstil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>Spår</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Ruttjocklek:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Ruttstil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Rutter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Använd kantutjämning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Linjetjocklek:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Bakgrundsfärg:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Sökvägar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Kartopacitet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Karta</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Diagram</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Högupplösning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Standard</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>Icke högupplösta kartor läses in som högupplösta. Kartan är skarp men kartobjekt är små/svåra att läsa.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>Icke högupplösta kartor läses in som de är. Kartobjekt har förväntad storlek men kartan är oskarp.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>Högupplöst visningsläge</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Bredd:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Stil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Navigeringspunktsfärg:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Navigeringspunktsstorlek:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Färg:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Storlek:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Navigeringspunkter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>POI-färg:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>POI-storlek:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>POI:er</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Skjutreglagefärg:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Punkter</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Flyttar vanlig fönsterstorlek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Höjd:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Hastighet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Hjärtfrekvens:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Stegfrekvens:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Kraft:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Utjämning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Eliminera GPS-extremvärden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Utjämning:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation>Automatiskt</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mi/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>knop</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>sek</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Minsta hastighet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Kortast varaktighet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Beräknad från distans/tid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Inspelad av enhet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS-data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM-data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Stigning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtrering</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Källor</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Pausa identifiering</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Radie:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Hastighet</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Projektion:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Vektor-kartor</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Kantbredd för områden:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Kantstil för områden:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Ifyllnadsopacitet för områden:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Ifyllnadsopacitet:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Områden</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation>Anpassat</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Högupplösning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Det utskrivna området är ungefär detsamma som synligt område på skärmen. Kartans zoomnivå ändras inte.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Zoomnivån kommer att ändras så att hela innehållet (spår/vägpunkter) passar utskriftsområdet och kartresolutionen är så nära som möjligt till utskriftsupplösningen.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Namn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Datum</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Avstånd</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Tid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Förflyttningstid</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Objektantal (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Separat diagramsida</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Utskriftsläge</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Rubrik</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>Använd OpenGL</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>Aktivera HTTP/2</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Cashe-storlek för bilder:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Anslutningens tidsgräns:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>System</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Utseende</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Kartor</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Data</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Utskrift &amp; Export</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Alternativ</translation>
     </message>
@@ -1867,7 +1887,12 @@
         <translation>Beskrivning</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation>Adress</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation>Länkar</translation>
     </message>

lang/gpxsee_tr.ts

@@ -47,77 +47,87 @@
 <context>
     <name>Data</name>
     <message>
-        <location filename="../src/data/data.cpp" line="173"/>
+        <location filename="../src/data/data.cpp" line="179"/>
         <source>Supported files</source>
         <translation>Desteklenen dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="174"/>
+        <location filename="../src/data/data.cpp" line="180"/>
         <source>CSV files</source>
         <translation>CSV dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="175"/>
+        <location filename="../src/data/data.cpp" line="181"/>
         <source>CUP files</source>
         <translation>CUP dosyaları</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="176"/>
+        <location filename="../src/data/data.cpp" line="182"/>
         <source>FIT files</source>
         <translation>FIT dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="178"/>
+        <location filename="../src/data/data.cpp" line="184"/>
         <source>GeoJSON files</source>
         <translation>GeoJSON dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="180"/>
+        <location filename="../src/data/data.cpp" line="186"/>
+        <source>GPI files</source>
+        <translation>GPI dosyaları</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="187"/>
         <source>GPX files</source>
         <translation>GPX dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="181"/>
+        <location filename="../src/data/data.cpp" line="188"/>
         <source>IGC files</source>
         <translation>IGC dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="182"/>
+        <location filename="../src/data/data.cpp" line="189"/>
         <source>JPEG images</source>
         <translation>JPEG resimler</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="183"/>
+        <location filename="../src/data/data.cpp" line="190"/>
         <source>KML files</source>
         <translation>KML dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="184"/>
+        <location filename="../src/data/data.cpp" line="191"/>
         <source>LOC files</source>
         <translation>LOC dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="185"/>
+        <location filename="../src/data/data.cpp" line="192"/>
         <source>NMEA files</source>
         <translation>NMEA dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="186"/>
+        <location filename="../src/data/data.cpp" line="193"/>
         <source>OziExplorer files</source>
         <translation>OziExplorer dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="187"/>
+        <location filename="../src/data/data.cpp" line="194"/>
         <source>SLF files</source>
         <translation>SLF dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="188"/>
+        <location filename="../src/data/data.cpp" line="195"/>
+        <source>SML files</source>
+        <translation>SML dosyalar</translation>
+    </message>
+    <message>
+        <location filename="../src/data/data.cpp" line="196"/>
         <source>TCX files</source>
         <translation>TCX dosyalar</translation>
     </message>
     <message>
-        <location filename="../src/data/data.cpp" line="189"/>
+        <location filename="../src/data/data.cpp" line="197"/>
         <source>All files</source>
         <translation>Tüm dosyalar</translation>
     </message>
@@ -484,16 +494,16 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="369"/>
-        <location filename="../src/GUI/gui.cpp" line="1053"/>
+        <location filename="../src/GUI/gui.cpp" line="1054"/>
-        <location filename="../src/GUI/gui.cpp" line="1120"/>
+        <location filename="../src/GUI/gui.cpp" line="1121"/>
         <source>Distance</source>
         <translation>Mesafe</translation>
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="376"/>
         <location filename="../src/GUI/gui.cpp" line="552"/>
-        <location filename="../src/GUI/gui.cpp" line="1056"/>
+        <location filename="../src/GUI/gui.cpp" line="1057"/>
-        <location filename="../src/GUI/gui.cpp" line="1122"/>
+        <location filename="../src/GUI/gui.cpp" line="1123"/>
         <source>Time</source>
         <translation>Zaman</translation>
     </message>
@@ -524,8 +534,8 @@
     </message>
     <message>
         <location filename="../src/GUI/gui.cpp" line="413"/>
-        <location filename="../src/GUI/gui.cpp" line="1058"/>
+        <location filename="../src/GUI/gui.cpp" line="1059"/>
-        <location filename="../src/GUI/gui.cpp" line="1124"/>
+        <location filename="../src/GUI/gui.cpp" line="1125"/>
         <source>Moving time</source>
         <translation>Hareket süresi</translation>
     </message>
@@ -791,69 +801,68 @@
         <translation>POI dosyası yükleme hatası:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1027"/>
+        <location filename="../src/GUI/gui.cpp" line="1028"/>
-        <location filename="../src/GUI/gui.cpp" line="1098"/>
+        <location filename="../src/GUI/gui.cpp" line="1099"/>
         <source>Tracks</source>
         <translation>İzler</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1030"/>
+        <location filename="../src/GUI/gui.cpp" line="1031"/>
-        <location filename="../src/GUI/gui.cpp" line="1100"/>
+        <location filename="../src/GUI/gui.cpp" line="1101"/>
         <source>Routes</source>
         <translation>Rotalar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1033"/>
+        <location filename="../src/GUI/gui.cpp" line="1034"/>
-        <location filename="../src/GUI/gui.cpp" line="1102"/>
+        <location filename="../src/GUI/gui.cpp" line="1103"/>
         <source>Waypoints</source>
         <translation>Yer işaretleri</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1036"/>
+        <location filename="../src/GUI/gui.cpp" line="1037"/>
-        <location filename="../src/GUI/gui.cpp" line="1104"/>
+        <location filename="../src/GUI/gui.cpp" line="1105"/>
         <source>Areas</source>
         <translation>Alanlar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1042"/>
+        <location filename="../src/GUI/gui.cpp" line="1043"/>
-        <location filename="../src/GUI/gui.cpp" line="1046"/>
+        <location filename="../src/GUI/gui.cpp" line="1047"/>
-        <location filename="../src/GUI/gui.cpp" line="1110"/>
+        <location filename="../src/GUI/gui.cpp" line="1111"/>
-        <location filename="../src/GUI/gui.cpp" line="1113"/>
+        <location filename="../src/GUI/gui.cpp" line="1114"/>
         <source>Date</source>
         <translation>Tarih</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1079"/>
         <location filename="../src/GUI/gui.cpp" line="1080"/>
+        <location filename="../src/GUI/gui.cpp" line="1081"/>
         <source>Statistics</source>
         <translation>İstatistikler</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1094"/>
+        <location filename="../src/GUI/gui.cpp" line="1095"/>
         <source>Name</source>
         <translation>Adı</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1312"/>
+        <location filename="../src/GUI/gui.cpp" line="1313"/>
         <source>Open map file</source>
         <translation>Harita dosyası aç</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1335"/>
+        <location filename="../src/GUI/gui.cpp" line="1336"/>
         <source>Error loading map:</source>
         <translation>Harita yüklenirken hata oluştu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/gui.cpp" line="1346"/>
+        <location filename="../src/GUI/gui.cpp" line="1347"/>
         <source>No files loaded</source>
         <translation>Hiç dosya yüklenmedi</translation>
     </message>
     <message numerus="yes">
-        <location filename="../src/GUI/gui.cpp" line="1350"/>
+        <location filename="../src/GUI/gui.cpp" line="1351"/>
         <source>%n files</source>
         <translation>
             <numerusform>%n dosya</numerusform>
-            <numerusform>%n dosya</numerusform>
         </translation>
     </message>
 </context>
@@ -908,7 +917,7 @@
     </message>
     <message>
         <location filename="../src/GUI/graphview.cpp" line="66"/>
-        <location filename="../src/GUI/graphview.cpp" line="173"/>
+        <location filename="../src/GUI/graphview.cpp" line="177"/>
         <source>Distance</source>
         <translation>Mesafe</translation>
     </message>
@@ -954,7 +963,7 @@
         <translation>sa</translation>
     </message>
     <message>
-        <location filename="../src/GUI/graphview.cpp" line="175"/>
+        <location filename="../src/GUI/graphview.cpp" line="179"/>
         <source>Time</source>
         <translation>Zaman</translation>
     </message>
@@ -1053,478 +1062,488 @@
 <context>
     <name>OptionsDialog</name>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="55"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
         <source>High-resolution</source>
         <translation>Yüksek çözünürlük</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="56"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="62"/>
         <source>Standard</source>
         <translation>Standart</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="61"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="67"/>
         <source>Non-HiDPI maps are loaded as HiDPI maps. The map is sharp but map objects are small/hard to read.</source>
         <translation>HiDPI olmayan haritalar, HiDPI haritaları olarak yüklenir. Harita keskin ama harita nesneleri küçük/okunması zor.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="63"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="69"/>
         <source>Non-HiDPI maps are loaded such as they are. Map objects have the expected size but the map is blurry.</source>
         <translation>HiDPI olmayan haritalar, oldukları gibi yüklenir. Harita nesneleri beklenen boyuta sahip ancak harita bulanıktır.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="98"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="104"/>
         <source>HiDPI display mode</source>
         <translation>HiDPI gösterim modu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="169"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="175"/>
         <source>Base color:</source>
         <translation>Temel renk:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="170"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="176"/>
         <source>Palette shift:</source>
         <translation>Palet değişimi:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="114"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="120"/>
         <source>Track width:</source>
         <translation>İz genişliği:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="74"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="80"/>
         <source>Projection:</source>
         <translation>Projeksiyon:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="96"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="102"/>
         <source>Vector maps</source>
         <translation>Vektör haritaları</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="115"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="121"/>
         <source>Track style:</source>
         <translation>İz stili:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="117"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="123"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="134"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="140"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="153"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="159"/>
         <source>Width:</source>
         <translation>Genişlik:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="118"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="124"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="135"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="141"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="154"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="160"/>
         <source>Style:</source>
         <translation>Stil:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="119"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="125"/>
         <source>Tracks</source>
         <translation>İzler</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="131"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="137"/>
         <source>Route width:</source>
         <translation>Rota genişliği:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="132"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="138"/>
         <source>Route style:</source>
         <translation>Rota stili:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="136"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="142"/>
         <source>Routes</source>
         <translation>Rotalar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="149"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
         <source>Area border width:</source>
         <translation>Alan sınır genişliği:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="150"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
         <source>Area border style:</source>
         <translation>Alan sınır stili:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="151"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="157"/>
         <source>Area fill opacity:</source>
         <translation>Alan dolgusu opaklığı:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="155"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="161"/>
         <source>Fill opacity:</source>
         <translation>Opaklığı doldur:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="156"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="162"/>
         <source>Areas</source>
         <translation>Alanlar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="172"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="178"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="255"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="261"/>
         <source>Use anti-aliasing</source>
         <translation>Kenar yumuşatma kullan</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="205"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="211"/>
         <source>Waypoint color:</source>
         <translation>Yer işareti rengi:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="206"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="212"/>
         <source>Waypoint size:</source>
         <translation>Yer işareti boyutu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="208"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="214"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="224"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="230"/>
         <source>Color:</source>
         <translation>Renk:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="209"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="215"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="225"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="231"/>
         <source>Size:</source>
         <translation>Boyut:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="210"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="216"/>
         <source>Waypoints</source>
         <translation>Yer işaretleri</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="221"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="227"/>
         <source>POI color:</source>
         <translation>POI renk:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="222"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="228"/>
         <source>POI size:</source>
         <translation>POI boyutu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="226"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="232"/>
         <source>POIs</source>
         <translation>POI&apos;ler</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="252"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="258"/>
         <source>Line width:</source>
         <translation>Hat genişliği:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="253"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="259"/>
         <source>Slider color:</source>
         <translation>Kaydırıcı rengi:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="276"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="282"/>
         <source>Background color:</source>
         <translation>Arka plan rengi:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="277"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="283"/>
         <source>Map opacity:</source>
         <translation>Harita opaklığı:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="287"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="293"/>
         <source>Paths</source>
         <translation>Klasör konumları</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="288"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="294"/>
         <source>Points</source>
         <translation>Noktalar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="289"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="295"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="545"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="575"/>
         <source>Graphs</source>
         <translation>Grafikler</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="290"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="296"/>
         <source>Map</source>
         <translation>Harita</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="297"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="303"/>
         <source>Moving average window size</source>
         <translation>Ortalama pencere boyutuna taşıma</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="316"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="402"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="432"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="465"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="495"/>
         <source>Elevation:</source>
         <translation>Rakım:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="317"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="323"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="401"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
         <source>Speed:</source>
         <translation>Hız:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="318"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="324"/>
         <source>Heart rate:</source>
         <translation>Nabız:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="319"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="325"/>
         <source>Cadence:</source>
         <translation>Kadans:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="320"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
         <source>Power:</source>
         <translation>Güç:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="322"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="328"/>
         <source>Smoothing</source>
         <translation>Yumuşatma</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="326"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="332"/>
         <source>Eliminate GPS outliers</source>
         <translation>Aykırı GPS ele</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="335"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="341"/>
         <source>Smoothing:</source>
         <translation>Yumuşatma:</translation>
     </message>
     <message>
         <location filename="../src/GUI/optionsdialog.cpp" line="352"/>
+        <source>Automatic</source>
+        <translation>Otomatik</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
         <source>mi/h</source>
         <translation>mi/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="355"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="369"/>
         <source>kn</source>
         <translation>kn</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="358"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="372"/>
         <source>km/h</source>
         <translation>km/h</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="362"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="376"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="568"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="598"/>
         <source>s</source>
         <translation>s</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="366"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="392"/>
         <source>Minimal speed:</source>
         <translation>Asgari hız:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="367"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="393"/>
         <source>Minimal duration:</source>
         <translation>Minimum süre:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="373"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="403"/>
         <source>Computed from distance/time</source>
         <translation>Mesafe/zamandan hesaplandı</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="374"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="404"/>
         <source>Recorded by device</source>
         <translation>Cihazdan kaydedilen</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="380"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="410"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="438"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="468"/>
         <source>GPS data</source>
         <translation>GPS verisi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="381"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="411"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="439"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="469"/>
         <source>DEM data</source>
         <translation>DEM verisi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="418"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="448"/>
         <source>Elevation</source>
         <translation>Rakım</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="429"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="459"/>
         <source>Filtering</source>
         <translation>Filtreleme</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="430"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="460"/>
         <source>Sources</source>
         <translation>Kaynaklar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="431"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="461"/>
         <source>Pause detection</source>
         <translation>Duraklama algılama</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="464"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="494"/>
         <source>Radius:</source>
         <translation>Yarıçap:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="412"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="442"/>
         <source>Speed</source>
         <translation>Hız</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="450"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="353"/>
+        <source>Custom</source>
+        <translation>Özel</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/optionsdialog.cpp" line="480"/>
         <source>mi</source>
         <translation>mi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="453"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="483"/>
         <source>nmi</source>
         <translation>nmi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="456"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
         <source>km</source>
         <translation>Km</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="471"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="501"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="611"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
         <source>POI</source>
         <translation>POI</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="478"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
         <source>WYSIWYG</source>
         <translation>WYSIWYG</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="479"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="509"/>
         <source>High-Resolution</source>
         <translation>Yüksek çözünürlük</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="484"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
         <source>The printed area is approximately the display area. The map zoom level does not change.</source>
         <translation>Yazdırılan alan yaklaşık olarak görüntü alanıdır. Harita zum seviyesi değişmez.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="486"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
         <source>The zoom level will be changed so that the whole content (tracks/waypoints) fits to the printed area and the map resolution is as close as possible to the print resolution.</source>
         <translation>Yakınlaştırma seviyesi, tüm içeriğin (izler/yer işaretleri) yazdırılan alana sığması ve harita çözünürlüğünün baskı çözünürlüğüne olabildiğince yakın olacak şekilde değiştirilecektir.</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="508"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="538"/>
         <source>Name</source>
         <translation>Adı</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="510"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="540"/>
         <source>Date</source>
         <translation>Tarih</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="512"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="542"/>
         <source>Distance</source>
         <translation>Mesafe</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="514"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
         <source>Time</source>
         <translation>Zaman</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="516"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="546"/>
         <source>Moving time</source>
         <translation>Hareket süresi</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="518"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="548"/>
         <source>Item count (&gt;1)</source>
         <translation>Öğe sayısı (&gt;1)</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="533"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="563"/>
         <source>Separate graph page</source>
         <translation>Ayrı grafik sayfası</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="543"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
         <source>Print mode</source>
         <translation>Yazdırma modu</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="544"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="574"/>
         <source>Header</source>
         <translation>Başlık</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="552"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="582"/>
         <source>Use OpenGL</source>
         <translation>OpenGL Kullan</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="555"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="585"/>
         <source>Enable HTTP/2</source>
         <translation>HTTP/2 etkinleştir</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="562"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="592"/>
         <source>MB</source>
         <translation>MB</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="572"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="602"/>
         <source>Image cache size:</source>
         <translation>Görüntü önbellek boyutu:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="573"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="603"/>
         <source>Connection timeout:</source>
         <translation>Bağlantı zaman aşımı:</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="589"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="619"/>
-        <location filename="../src/GUI/optionsdialog.cpp" line="614"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="644"/>
         <source>System</source>
         <translation>Sistem</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="607"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="637"/>
         <source>Appearance</source>
         <translation>Görünüm</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="609"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="639"/>
         <source>Maps</source>
         <translation>Haritalar</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="610"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="640"/>
         <source>Data</source>
         <translation>Veri</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="612"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="642"/>
         <source>Print &amp; Export</source>
         <translation>Yazdır &amp; Dışa ver</translation>
     </message>
     <message>
-        <location filename="../src/GUI/optionsdialog.cpp" line="641"/>
+        <location filename="../src/GUI/optionsdialog.cpp" line="671"/>
         <source>Options</source>
         <translation>Seçenekler</translation>
     </message>
@@ -1867,7 +1886,12 @@
         <translation>Açıklama</translation>
     </message>
     <message>
-        <location filename="../src/GUI/waypointitem.cpp" line="42"/>
+        <location filename="../src/GUI/waypointitem.cpp" line="44"/>
+        <source>Address</source>
+        <translation>Adres</translation>
+    </message>
+    <message>
+        <location filename="../src/GUI/waypointitem.cpp" line="55"/>
         <source>Links</source>
         <translation>Bağlantılar</translation>
     </message>

pkg/Info.plist

@@ -243,6 +243,22 @@
 			<key>CFBundleTypeRole</key>
 			<string>Viewer</string>
 		</dict>
+		<dict>
+			<key>CFBundleTypeExtensions</key>
+			<array>
+				<string>sml</string>
+			</array>
+			<key>CFBundleTypeMIMETypes</key>
+			<array>
+				<string>application/sml+xml</string>
+			</array>
+			<key>CFBundleTypeIconFile</key>
+			<string>icons/sml.icns</string>
+			<key>CFBundleTypeName</key>
+			<string>Suunto Markup Language</string>
+			<key>CFBundleTypeRole</key>
+			<string>Viewer</string>
+		</dict>
 	</array>
 
 	<key>UTImportedTypeDeclarations</key>
@@ -538,7 +554,28 @@
 					<string>gpi</string>
 				</array>
 				<key>public.mime-type</key>
-				<string>application/vnd.garmin.cup</string>
+				<string>application/vnd.garmin.gpi</string>
+			</dict>
+		</dict>
+		<dict>
+			<key>UTTypeIdentifier</key>
+			<string>com.suunto.sml</string>
+			<key>UTTypeReferenceURL</key>
+			<string>https://www.suunto.com</string>
+			<key>UTTypeDescription</key>
+			<string>Suunto Markup Language</string>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>public.xml</string>
+			</array>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.filename-extension</key>
+				<array>
+					<string>sml</string>
+				</array>
+				<key>public.mime-type</key>
+				<string>application/sml+xml</string>
 			</dict>
 		</dict>
 	</array>

pkg/appdata.xml

@@ -12,17 +12,18 @@
 
 		<p>Features:</p>
 		<ul>
-			<li>Opens GPX, TCX, FIT, KML, IGC, NMEA, SLF, LOC, OziExplorer (PLT,
+			<li>Opens GPX, TCX, FIT, KML, IGC, NMEA, SIGMA SLF, Suunto SML, LOC,
-				WPT, RTE), GeoJSON, SeeYou CUP, Garmin CSV and geotagged
+				OziExplorer (PLT, WPT, RTE), GeoJSON, SeeYou CUP,
-				JPEG files.</li>
+				Garmin GPI &amp; CSV and geotagged JPEG files.</li>
 			<li>User-definable online maps (OpenStreetMap/Google tiles, WMTS,
-				WMS, TMS).</li>
+				WMS, TMS, QuadTiles).</li>
 			<li>Offline maps (MBTiles, OziExplorer maps, TrekBuddy maps/atlases,
 				TwoNav RMaps, Garmin IMG &amp; JNX, GeoTIFF images).</li>
-			<li>Elevation, speed, heart rate, cadence, power and temperature
+			<li>Elevation, speed, heart rate, cadence, power, temperature and
-				graphs.</li>
+				gear ratio graphs.</li>
 			<li>Support for multiple tracks in one view.</li>
 			<li>Support for POI files.</li>
+			<li>Support for DEM files (SRTM HGT).</li>
 			<li>Print/export to PDF.</li>
 			<li>Full-screen mode.</li>
 			<li>HiDPI/Retina displays &amp; maps support.</li>
@@ -69,5 +70,7 @@
 		<mimetype>application/slf+xml</mimetype>
 		<mimetype>application/geo+json</mimetype>
 		<mimetype>application/vnd.naviter.seeyou.cup</mimetype>
+		<mimetype>application/vnd.garmin.gpi</mimetype>
+		<mimetype>application/sml+xml</mimetype>
 	</mimetypes>
 </component>

pkg/gpxsee.desktop

@@ -3,12 +3,16 @@ Name=GPXSee
 Comment=GPS log file viewer and analyzer
 Comment[cz]=Prohlížeč a analyzátor GPS logů
 Comment[fi]=Ohjelma GPS-lokien katseluun ja analysointiin
+Comment[fr]=Visualisation et analyse de fichier GPS
+Comment[nb]=GPS-loggfilleser og analysator
 Comment[pl]=Przeglądarka i analizator plików dziennika GPS
 Comment[ru]=Программа для просмотра и анализа GPS логов
 Comment[sv]=GPS-loggfilsläsare och analysator
+Comment[tr]=GPS günlük dosyası görüntüleyici ve analizcisi
+Comment[uk]=Переглядач та аналізатор GPS логів
 Exec=gpxsee %F
 Icon=gpxsee
 Terminal=false
 Type=Application
 Categories=Graphics;Viewer;Education;Geography;Maps;Sports;Qt;
-MimeType=application/gpx+xml;application/tcx+xml;application/vnd.ant.fit;application/vnd.google-earth.kml+xml;application/vnd.fai.igc;application/vnd.nmea.nmea;application/vnd.oziexplorer.plt;application/vnd.oziexplorer.rte;application/vnd.oziexplorer.wpt;application/loc+xml;application/slf+xml;application/geo+json;application/vnd.naviter.seeyou.cup;
+MimeType=application/gpx+xml;application/tcx+xml;application/vnd.ant.fit;application/vnd.google-earth.kml+xml;application/vnd.fai.igc;application/vnd.nmea.nmea;application/vnd.oziexplorer.plt;application/vnd.oziexplorer.rte;application/vnd.oziexplorer.wpt;application/loc+xml;application/slf+xml;application/geo+json;application/vnd.naviter.seeyou.cup;application/vnd.garmin.gpi;application/sml+xml;

pkg/gpxsee.nsi

@@ -7,7 +7,7 @@
 ; The name of the installer
 Name "GPXSee"
 ; Program version
-!define VERSION "7.16"
+!define VERSION "7.21"
 
 ; The file to write
 OutFile "GPXSee-${VERSION}.exe"
@@ -106,20 +106,21 @@ Section "GPXSee" SEC_APP
 
   ; Associate file formats
   DetailPrint "Associating file types..."
-  !insertmacro FILE_ASSOCIATION_ADD "gpx" "GPS Exchange Format" 7
+  !insertmacro FILE_ASSOCIATION_ADD "gpx" "GPS Exchange Format" 8
-  !insertmacro FILE_ASSOCIATION_ADD "tcx" "Training Center XML" 8
+  !insertmacro FILE_ASSOCIATION_ADD "tcx" "Training Center XML" 9
-  !insertmacro FILE_ASSOCIATION_ADD "kml" "Keyhole Markup Language" 9
+  !insertmacro FILE_ASSOCIATION_ADD "kml" "Keyhole Markup Language" 10
-  !insertmacro FILE_ASSOCIATION_ADD "fit" "Flexible and Interoperable Data Transfer" 10
+  !insertmacro FILE_ASSOCIATION_ADD "fit" "Flexible and Interoperable Data Transfer" 11
-  !insertmacro FILE_ASSOCIATION_ADD "igc" "Flight Recorder Data Format" 11
+  !insertmacro FILE_ASSOCIATION_ADD "igc" "Flight Recorder Data Format" 12
-  !insertmacro FILE_ASSOCIATION_ADD "nmea" "NMEA 0183 Data" 12
+  !insertmacro FILE_ASSOCIATION_ADD "nmea" "NMEA 0183 Data" 13
-  !insertmacro FILE_ASSOCIATION_ADD "plt" "OziExplorer Track Point File" 13
+  !insertmacro FILE_ASSOCIATION_ADD "plt" "OziExplorer Track Point File" 14
-  !insertmacro FILE_ASSOCIATION_ADD "rte" "OziExplorer Route File" 14
+  !insertmacro FILE_ASSOCIATION_ADD "rte" "OziExplorer Route File" 15
   !insertmacro FILE_ASSOCIATION_ADD "wpt" "OziExplorer Waypoint File" 1
   !insertmacro FILE_ASSOCIATION_ADD "loc" "Geocaching.com Waypoint File" 2
   !insertmacro FILE_ASSOCIATION_ADD "slf" "Sigma Log File" 3
   !insertmacro FILE_ASSOCIATION_ADD "geojson" "GeoJSON" 4
   !insertmacro FILE_ASSOCIATION_ADD "cup" "SeeYou CUP File" 5
   !insertmacro FILE_ASSOCIATION_ADD "gpi" "Garmin POI File" 6
+  !insertmacro FILE_ASSOCIATION_ADD "sml" "Suunto Markup Language" 7
   System::Call 'shell32.dll::SHChangeNotify(i, i, i, i) v (0x08000000, 0, 0, 0)'
 
 SectionEnd
@@ -147,30 +148,17 @@ Section "MSVC runtime" SEC_MSVC
 
   SectionIn RO
 
-  DetailPrint "Checking whether Visual C++ 2015 Redistributable is already installed..."
-  ${If} ${RunningX64}
-    ReadRegDword $R0 HKLM "SOFTWARE\Wow6432Node\Microsoft\VisualStudio\14.0\VC\Runtimes\x86" "Installed"
-  ${Else}
-    ReadRegDword $R0 HKLM "SOFTWARE\Microsoft\VisualStudio\14.0\VC\Runtimes\x86" "Installed"
-  ${EndIf}
-
-  StrCmp $R0 "1" 0 +3
-  DetailPrint "Visual C++ 2015 Redistributable is already installed, skipping install."
-  Goto done
-
-  DetailPrint "Installing Visual C++ 2015 Redistributable..."
   SetOutPath $TEMP
-  File "vcredist_x86.exe"
+  File "vc_redist.x86.exe"
-  ExecWait '"$TEMP\vcredist_x86.exe" /install /quiet /norestart'
+  ExecWait '"$TEMP\vc_redist.x86.exe" /install /quiet /norestart'
   SetOutPath $INSTDIR    
 
-  done:
 SectionEnd
 
 Section "OpenSSL" SEC_OPENSSL
 
-  File "libeay32.dll"
+  File "libcrypto-1_1.dll"
-  File "ssleay32.dll"
+  File "libssl-1_1.dll"
 
 SectionEnd
 
@@ -188,6 +176,7 @@ SectionGroup "Localization" SEC_LOCALIZATION
   !insertmacro LOCALIZATION "Finnish" "fi"
   !insertmacro LOCALIZATION "French" "fr"
   !insertmacro LOCALIZATION "German" "de"
+  !insertmacro LOCALIZATION "Hungarian" "hu"
   !insertmacro LOCALIZATION "Norwegian" "nb"
   !insertmacro LOCALIZATION "Polish" "pl"
   !insertmacro LOCALIZATION "Portuguese (Brazil)" "pt_BR"
@@ -195,6 +184,7 @@ SectionGroup "Localization" SEC_LOCALIZATION
   !insertmacro LOCALIZATION "Spanish" "es"
   !insertmacro LOCALIZATION "Swedish" "sv"
   !insertmacro LOCALIZATION "Turkish" "tr"
+  !insertmacro LOCALIZATION "Ukrainian" "uk"
 SectionGroupEnd
 
 ;--------------------------------
@@ -231,6 +221,7 @@ Section "Uninstall"
   !insertmacro FILE_ASSOCIATION_REMOVE "geojson"
   !insertmacro FILE_ASSOCIATION_REMOVE "cup"
   !insertmacro FILE_ASSOCIATION_REMOVE "gpi"
+  !insertmacro FILE_ASSOCIATION_REMOVE "sml"
   System::Call 'shell32.dll::SHChangeNotify(i, i, i, i) v (0x08000000, 0, 0, 0)'
 
 SectionEnd
@@ -243,7 +234,7 @@ SectionEnd
 LangString DESC_QT ${LANG_ENGLISH} \
   "QT cross-platform application framework."
 LangString DESC_MSVC ${LANG_ENGLISH} \
-  "Visual C++ 2015 runtime components. If already installed, will be skipped."
+  "Microsoft Visual C++ 2017 runtime. If already installed, will be skipped."
 LangString DESC_OPENSSL ${LANG_ENGLISH} \
   "OpenSSL library. Required for HTTPS to work."
 LangString DESC_ANGLE ${LANG_ENGLISH} \

pkg/gpxsee.xml

@@ -91,4 +91,18 @@
 		<generic-icon name="text-plain"/>
 		<glob pattern="*.cup"/>
 	</mime-type>
+
+	<mime-type type="application/vnd.garmin.gpi">
+		<comment>Garmin POI File</comment>
+		<sub-class-of type="application/octet-stream"/>
+		<generic-icon name="application/octet-stream"/>
+		<glob pattern="*.gpi"/>
+	</mime-type>
+
+	<mime-type type="application/sml+xml">
+		<comment>Suunto Markup Language</comment>
+		<sub-class-of type="application/xml"/>
+		<generic-icon name="application-xml"/>
+		<glob pattern="*.sml"/>
+	</mime-type>
 </mime-info>

pkg/gpxsee64.nsi

@@ -7,7 +7,7 @@
 ; The name of the installer
 Name "GPXSee"
 ; Program version
-!define VERSION "7.16"
+!define VERSION "7.21"
 
 ; The file to write
 OutFile "GPXSee-${VERSION}_x64.exe"
@@ -113,20 +113,21 @@ Section "GPXSee" SEC_APP
 
   ; Associate file formats
   DetailPrint "Associating file types..."
-  !insertmacro FILE_ASSOCIATION_ADD "gpx" "GPS Exchange Format" 7
+  !insertmacro FILE_ASSOCIATION_ADD "gpx" "GPS Exchange Format" 8
-  !insertmacro FILE_ASSOCIATION_ADD "tcx" "Training Center XML" 8
+  !insertmacro FILE_ASSOCIATION_ADD "tcx" "Training Center XML" 9
-  !insertmacro FILE_ASSOCIATION_ADD "kml" "Keyhole Markup Language" 9
+  !insertmacro FILE_ASSOCIATION_ADD "kml" "Keyhole Markup Language" 10
-  !insertmacro FILE_ASSOCIATION_ADD "fit" "Flexible and Interoperable Data Transfer" 10
+  !insertmacro FILE_ASSOCIATION_ADD "fit" "Flexible and Interoperable Data Transfer" 11
-  !insertmacro FILE_ASSOCIATION_ADD "igc" "Flight Recorder Data Format" 11
+  !insertmacro FILE_ASSOCIATION_ADD "igc" "Flight Recorder Data Format" 12
-  !insertmacro FILE_ASSOCIATION_ADD "nmea" "NMEA 0183 Data" 12
+  !insertmacro FILE_ASSOCIATION_ADD "nmea" "NMEA 0183 Data" 13
-  !insertmacro FILE_ASSOCIATION_ADD "plt" "OziExplorer Track Point File" 13
+  !insertmacro FILE_ASSOCIATION_ADD "plt" "OziExplorer Track Point File" 14
-  !insertmacro FILE_ASSOCIATION_ADD "rte" "OziExplorer Route File" 14
+  !insertmacro FILE_ASSOCIATION_ADD "rte" "OziExplorer Route File" 15
   !insertmacro FILE_ASSOCIATION_ADD "wpt" "OziExplorer Waypoint File" 1
   !insertmacro FILE_ASSOCIATION_ADD "loc" "Geocaching.com Waypoint File" 2
   !insertmacro FILE_ASSOCIATION_ADD "slf" "Sigma Log File" 3
   !insertmacro FILE_ASSOCIATION_ADD "geojson" "GeoJSON" 4
   !insertmacro FILE_ASSOCIATION_ADD "cup" "SeeYou CUP File" 5
   !insertmacro FILE_ASSOCIATION_ADD "gpi" "Garmin POI File" 6
+  !insertmacro FILE_ASSOCIATION_ADD "sml" "Suunto Markup Language" 7
   System::Call 'shell32.dll::SHChangeNotify(i, i, i, i) v (0x08000000, 0, 0, 0)'
 
 SectionEnd
@@ -154,25 +155,17 @@ Section "MSVC runtime" SEC_MSVC
 
   SectionIn RO
 
-  DetailPrint "Checking whether Visual C++ 2015 Redistributable is already installed..."
-  ReadRegDword $R0 HKLM "SOFTWARE\Wow6432Node\Microsoft\VisualStudio\14.0\VC\Runtimes\x64" "Installed"
-  StrCmp $R0 "1" 0 +3
-  DetailPrint "Visual C++ 2015 Redistributable is already installed, skipping install."
-  Goto done
-
-  DetailPrint "Installing Visual C++ 2015 Redistributable..."
   SetOutPath $TEMP
-  File "vcredist_x64.exe"
+  File "vc_redist.x64.exe"
-  ExecWait '"$TEMP\vcredist_x64.exe" /install /quiet /norestart'
+  ExecWait '"$TEMP\vc_redist.x64.exe" /install /quiet /norestart'
   SetOutPath $INSTDIR
 
-  done:
 SectionEnd
 
 Section "OpenSSL" SEC_OPENSSL
 
-  File "libeay32.dll"
+  File "libcrypto-1_1-x64.dll"
-  File "ssleay32.dll"
+  File "libssl-1_1-x64.dll"
 
 SectionEnd
 
@@ -190,6 +183,7 @@ SectionGroup "Localization" SEC_LOCALIZATION
   !insertmacro LOCALIZATION "Finnish" "fi"
   !insertmacro LOCALIZATION "French" "fr"
   !insertmacro LOCALIZATION "German" "de"
+  !insertmacro LOCALIZATION "Hungarian" "hu"
   !insertmacro LOCALIZATION "Norwegian" "nb"
   !insertmacro LOCALIZATION "Polish" "pl"
   !insertmacro LOCALIZATION "Portuguese (Brazil)" "pt_BR"
@@ -197,6 +191,7 @@ SectionGroup "Localization" SEC_LOCALIZATION
   !insertmacro LOCALIZATION "Spanish" "es"
   !insertmacro LOCALIZATION "Swedish" "sv"
   !insertmacro LOCALIZATION "Turkish" "tr"
+  !insertmacro LOCALIZATION "Ukrainian" "uk"
 SectionGroupEnd
 
 ;--------------------------------
@@ -234,6 +229,7 @@ Section "Uninstall"
   !insertmacro FILE_ASSOCIATION_REMOVE "geojson"
   !insertmacro FILE_ASSOCIATION_REMOVE "cup"
   !insertmacro FILE_ASSOCIATION_REMOVE "gpi"
+  !insertmacro FILE_ASSOCIATION_REMOVE "sml"
   System::Call 'shell32.dll::SHChangeNotify(i, i, i, i) v (0x08000000, 0, 0, 0)'
 
 SectionEnd
@@ -246,7 +242,7 @@ SectionEnd
 LangString DESC_QT ${LANG_ENGLISH} \
   "QT cross-platform application framework."
 LangString DESC_MSVC ${LANG_ENGLISH} \
-  "Visual C++ 2015 runtime components. If already installed, will be skipped."
+  "Microsoft Visual C++ 2017 runtime. If already installed, will be skipped."
 LangString DESC_OPENSSL ${LANG_ENGLISH} \
   "OpenSSL library. Required for HTTPS to work."
 LangString DESC_ANGLE ${LANG_ENGLISH} \

pkg/maps/4UMaps.xml

@@ -1,7 +1,7 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <map xmlns="http://www.gpxsee.org/map/1.3">
 	<name>4UMaps</name>
-	<url>https://4umaps.com/$z/$x/$y.png</url>
+	<url>https://tileserver.4umaps.com/$z/$x/$y.png</url>
 	<zoom min="2" max="15"/>
 	<bounds bottom="-65"/>
 	<copyright>Map data: © OpenStreetMap contributors (ODbL) | Rendering: © 4UMaps.eu</copyright>

pkg/maps/OpenStreetMap.xml

@@ -1,6 +1,6 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <map xmlns="http://www.gpxsee.org/map/1.3">
 	<name>Open Street Map</name>
-	<url>http://tile.openstreetmap.org/$z/$x/$y.png</url>
+	<url>https://tile.openstreetmap.org/$z/$x/$y.png</url>
 	<copyright>Map data: © OpenStreetMap contributors (ODbL) | Rendering: © OpenStreetMap (CC-BY-SA)</copyright>
 </map>

src/GUI/areaitem.cpp

@@ -8,7 +8,7 @@
 #include "areaitem.h"
 
 
-ToolTip AreaItem::toolTip() const
+QString AreaItem::info() const
 {
 	ToolTip tt;
 
@@ -18,11 +18,11 @@ ToolTip AreaItem::toolTip() const
 		tt.insert(qApp->translate("PolygonItem", "Description"),
 		  _area.description());
 
-	return tt;
+	return tt.toString();
 }
 
-AreaItem::AreaItem(const Area &area, Map *map, QGraphicsItem *parent)
+AreaItem::AreaItem(const Area &area, Map *map, GraphicsItem *parent)
-  : QGraphicsItem(parent), _area(area)
+  : GraphicsItem(parent), _area(area)
 {
 	_map = map;
 	_digitalZoom = 0;
@@ -173,6 +173,6 @@ void AreaItem::hoverLeaveEvent(QGraphicsSceneHoverEvent *event)
 
 void AreaItem::mousePressEvent(QGraphicsSceneMouseEvent *event)
 {
-	Popup::show(event->screenPos(), toolTip().toString(), event->widget());
+	Popup::show(event->screenPos(), info(), event->widget());
 	QGraphicsItem::mousePressEvent(event);
 }

src/GUI/areaitem.h

@@ -1,16 +1,16 @@
 #ifndef AREAITEM_H
 #define AREAITEM_H
 
-#include <QGraphicsItem>
 #include "data/area.h"
+#include "graphicsscene.h"
 #include "tooltip.h"
 
 class Map;
 
-class AreaItem : public QGraphicsItem
+class AreaItem : public GraphicsItem
 {
 public:
-	AreaItem(const Area &area, Map *map, QGraphicsItem *parent = 0);
+	AreaItem(const Area &area, Map *map, GraphicsItem *parent = 0);
 
 	QPainterPath shape() const {return _painterPath;}
 	QRectF boundingRect() const {return _painterPath.boundingRect();}
@@ -27,6 +27,8 @@ public:
 	void setStyle(Qt::PenStyle style);
 	void setDigitalZoom(int zoom);
 
+	virtual QString info() const;
+
 protected:
 	void hoverEnterEvent(QGraphicsSceneHoverEvent *event);
 	void hoverLeaveEvent(QGraphicsSceneHoverEvent *event);

src/GUI/graphicsscene.cpp

@@ -46,3 +46,9 @@ void GraphicsScene::helpEvent(QGraphicsSceneHelpEvent *event)
 
 	/* No need to process QGraphicsScene::helpEvent() */
 }
+
+void GraphicsScene::clear()
+{
+	Popup::clear();
+	QGraphicsScene::clear();
+}

src/GUI/graphicsscene.h

@@ -18,6 +18,9 @@ class GraphicsScene : public QGraphicsScene
 public:
 	GraphicsScene(QObject *parent = 0) : QGraphicsScene(parent) {}
 
+public slots:
+	void clear();
+
 protected:
 	void helpEvent(QGraphicsSceneHelpEvent *event);
 

src/GUI/gui.cpp

@@ -451,11 +451,11 @@ void GUI::createActions()
 	_degreesMinutesAction->setActionGroup(ag);
 	connect(_degreesMinutesAction, SIGNAL(triggered()), this,
 	  SLOT(setDegreesMinutes()));
-	_DMSAction = new QAction(tr("Degrees, minutes, seconds (DMS)"), this);
+	_dmsAction = new QAction(tr("Degrees, minutes, seconds (DMS)"), this);
-	_DMSAction->setMenuRole(QAction::NoRole);
+	_dmsAction->setMenuRole(QAction::NoRole);
-	_DMSAction->setCheckable(true);
+	_dmsAction->setCheckable(true);
-	_DMSAction->setActionGroup(ag);
+	_dmsAction->setActionGroup(ag);
-	connect(_DMSAction, SIGNAL(triggered()), this, SLOT(setDMS()));
+	connect(_dmsAction, SIGNAL(triggered()), this, SLOT(setDMS()));
 	_fullscreenAction = new QAction(QIcon(FULLSCREEN_ICON),
 	  tr("Fullscreen mode"), this);
 	_fullscreenAction->setMenuRole(QAction::NoRole);
@@ -559,7 +559,7 @@ void GUI::createMenus()
 	QMenu *coordinatesMenu = settingsMenu->addMenu(tr("Coordinates format"));
 	coordinatesMenu->addAction(_decimalDegreesAction);
 	coordinatesMenu->addAction(_degreesMinutesAction);
-	coordinatesMenu->addAction(_DMSAction);
+	coordinatesMenu->addAction(_dmsAction);
 	settingsMenu->addSeparator();
 	settingsMenu->addAction(_showToolbarsAction);
 	settingsMenu->addAction(_fullscreenAction);
@@ -949,6 +949,7 @@ void GUI::openOptions()
 	SET_TRACK_OPTION(cadenceFilter, setCadenceFilter);
 	SET_TRACK_OPTION(powerFilter, setPowerFilter);
 	SET_TRACK_OPTION(outlierEliminate, setOutlierElimination);
+	SET_TRACK_OPTION(automaticPause, setAutomaticPause);
 	SET_TRACK_OPTION(pauseSpeed, setPauseSpeed);
 	SET_TRACK_OPTION(pauseInterval, setPauseInterval);
 	SET_TRACK_OPTION(useReportedSpeed, useReportedSpeed);
@@ -1654,7 +1655,7 @@ void GUI::writeSettings()
 	  : _nauticalUnitsAction->isChecked() ? Nautical : Metric;
 	if (units != UNITS_DEFAULT)
 		settings.setValue(UNITS_SETTING, units);
-	CoordinatesFormat format = _DMSAction->isChecked() ? DMS
+	CoordinatesFormat format = _dmsAction->isChecked() ? DMS
 	  : _degreesMinutesAction->isChecked() ? DegreesMinutes : DecimalDegrees;
 	if (format != COORDINATES_DEFAULT)
 		settings.setValue(COORDINATES_SETTING, format);
@@ -1798,6 +1799,8 @@ void GUI::writeSettings()
 		settings.setValue(POWER_FILTER_SETTING, _options.powerFilter);
 	if (_options.outlierEliminate != OUTLIER_ELIMINATE_DEFAULT)
 		settings.setValue(OUTLIER_ELIMINATE_SETTING, _options.outlierEliminate);
+	if (_options.automaticPause != AUTOMATIC_PAUSE_DEFAULT)
+		settings.setValue(AUTOMATIC_PAUSE_SETTING, _options.automaticPause);
 	if (_options.pauseSpeed != PAUSE_SPEED_DEFAULT)
 		settings.setValue(PAUSE_SPEED_SETTING, _options.pauseSpeed);
 	if (_options.pauseInterval != PAUSE_INTERVAL_DEFAULT)
@@ -1876,7 +1879,7 @@ void GUI::readSettings()
 
 	value = settings.value(COORDINATES_SETTING, COORDINATES_DEFAULT).toInt();
 	if (value == DMS)
-		_DMSAction->trigger();
+		_dmsAction->trigger();
 	else if (value == DegreesMinutes)
 		_degreesMinutesAction->trigger();
 	else
@@ -2072,6 +2075,8 @@ void GUI::readSettings()
 	  USE_REPORTED_SPEED_DEFAULT).toBool();
 	_options.dataUseDEM = settings.value(DATA_USE_DEM_SETTING,
 	  DATA_USE_DEM_DEFAULT).toBool();
+	_options.automaticPause = settings.value(AUTOMATIC_PAUSE_SETTING,
+	  AUTOMATIC_PAUSE_DEFAULT).toBool();
 	_options.pauseInterval = settings.value(PAUSE_INTERVAL_SETTING,
 	  PAUSE_INTERVAL_DEFAULT).toInt();
 	_options.poiRadius = settings.value(POI_RADIUS_SETTING, POI_RADIUS_DEFAULT)
@@ -2153,6 +2158,7 @@ void GUI::readSettings()
 	Track::setCadenceFilter(_options.cadenceFilter);
 	Track::setPowerFilter(_options.powerFilter);
 	Track::setOutlierElimination(_options.outlierEliminate);
+	Track::setAutomaticPause(_options.automaticPause);
 	Track::setPauseSpeed(_options.pauseSpeed);
 	Track::setPauseInterval(_options.pauseInterval);
 	Track::useReportedSpeed(_options.useReportedSpeed);

src/GUI/gui.h

@@ -180,7 +180,7 @@ private:
 	QAction *_nauticalUnitsAction;
 	QAction *_decimalDegreesAction;
 	QAction *_degreesMinutesAction;
-	QAction *_DMSAction;
+	QAction *_dmsAction;
 	QAction *_totalTimeAction;
 	QAction *_movingTimeAction;
 	QAction *_nextMapAction;

src/GUI/optionsdialog.cpp

@@ -37,6 +37,12 @@ static QFrame *line()
 #endif // Q_OS_MAC
 
 
+void OptionsDialog::automaticPauseDetectionSet(bool set)
+{
+	_pauseInterval->setEnabled(!set);
+	_pauseSpeed->setEnabled(!set);
+}
+
 QWidget *OptionsDialog::createMapPage()
 {
 	_projection = new LimitedComboBox(200);
@@ -343,10 +349,18 @@ QWidget *OptionsDialog::createDataPage()
 	filterTab->setLayout(filterTabLayout);
 
 
+	_automaticPause = new QRadioButton(tr("Automatic"));
+	_manualPause = new QRadioButton(tr("Custom"));
+	if (_options->automaticPause)
+		_automaticPause->setChecked(true);
+	else
+		_manualPause->setChecked(true);
+
 	_pauseSpeed = new QDoubleSpinBox();
 	_pauseSpeed->setDecimals(1);
 	_pauseSpeed->setSingleStep(0.1);
 	_pauseSpeed->setMinimum(0.1);
+	_pauseSpeed->setEnabled(_manualPause->isChecked());
 	if (_options->units == Imperial) {
 		_pauseSpeed->setValue(_options->pauseSpeed * MS2MIH);
 		_pauseSpeed->setSuffix(UNIT_SPACE + tr("mi/h"));
@@ -361,10 +375,26 @@ QWidget *OptionsDialog::createDataPage()
 	_pauseInterval->setMinimum(1);
 	_pauseInterval->setSuffix(UNIT_SPACE + tr("s"));
 	_pauseInterval->setValue(_options->pauseInterval);
+	_pauseInterval->setEnabled(_manualPause->isChecked());
 
-	QFormLayout *pauseLayout = new QFormLayout();
+	connect(_automaticPause, SIGNAL(toggled(bool)), this,
-	pauseLayout->addRow(tr("Minimal speed:"), _pauseSpeed);
+	  SLOT(automaticPauseDetectionSet(bool)));
-	pauseLayout->addRow(tr("Minimal duration:"), _pauseInterval);
+
+	QHBoxLayout *pauseTypeLayout = new QHBoxLayout();
+#ifdef Q_OS_MAC
+	pauseTypeLayout->addStretch();
+#endif
+	pauseTypeLayout->addWidget(_automaticPause);
+	pauseTypeLayout->addWidget(_manualPause);
+	pauseTypeLayout->addStretch();
+
+	QFormLayout *pauseValuesLayout = new QFormLayout();
+	pauseValuesLayout->addRow(tr("Minimal speed:"), _pauseSpeed);
+	pauseValuesLayout->addRow(tr("Minimal duration:"), _pauseInterval);
+
+	QVBoxLayout *pauseLayout = new QVBoxLayout();
+	pauseLayout->addLayout(pauseTypeLayout);
+	pauseLayout->addLayout(pauseValuesLayout);
 
 	QWidget *pauseTab = new QWidget();
 	pauseTab->setLayout(pauseLayout);
@@ -679,6 +709,7 @@ void OptionsDialog::accept()
 	_options->cadenceFilter = _cadenceFilter->value();
 	_options->powerFilter = _powerFilter->value();
 	_options->outlierEliminate = _outlierEliminate->isChecked();
+	_options->automaticPause = _automaticPause->isChecked();
 	qreal pauseSpeed = (_options->units == Imperial)
 		? _pauseSpeed->value() / MS2MIH : (_options->units == Nautical)
 		? _pauseSpeed->value() / MS2KN : _pauseSpeed->value() / MS2KMH;

src/GUI/optionsdialog.h

@@ -49,6 +49,7 @@ struct Options {
 	int cadenceFilter;
 	int powerFilter;
 	bool outlierEliminate;
+	bool automaticPause;
 	qreal pauseSpeed;
 	int pauseInterval;
 	bool useReportedSpeed;
@@ -86,6 +87,9 @@ public slots:
 public:
 	OptionsDialog(Options *options, QWidget *parent = 0);
 
+private slots:
+	void automaticPauseDetectionSet(bool set);
+
 private:
 	QWidget *createMapPage();
 	QWidget *createAppearancePage();
@@ -129,6 +133,9 @@ private:
 	OddSpinBox *_cadenceFilter;
 	OddSpinBox *_powerFilter;
 	QCheckBox *_outlierEliminate;
+
+	QRadioButton *_automaticPause;
+	QRadioButton *_manualPause;
 	QDoubleSpinBox *_pauseSpeed;
 	QSpinBox *_pauseInterval;
 	QRadioButton *_computedSpeed;

src/GUI/popup.cpp

@@ -163,3 +163,9 @@ void Popup::show(const QPoint &pos, const QString &text, QWidget *w)
 	PopupLabel::_instance->place(pos, w);
 	PopupLabel::_instance->showNormal();
 }
+
+void Popup::clear()
+{
+	if (PopupLabel::_instance)
+		delete PopupLabel::_instance;
+}

src/GUI/popup.h

@@ -9,6 +9,7 @@ class Popup
 {
 public:
 	static void show(const QPoint &pos, const QString &text, QWidget *w);
+	static void clear();
 };
 
 #endif // POPUP_H

src/GUI/settings.h

@@ -135,6 +135,8 @@
 #define POWER_FILTER_DEFAULT              3
 #define OUTLIER_ELIMINATE_SETTING         "outlierEliminate"
 #define OUTLIER_ELIMINATE_DEFAULT         true
+#define AUTOMATIC_PAUSE_SETTING           "automaticPause"
+#define AUTOMATIC_PAUSE_DEFAULT           true
 #define PAUSE_SPEED_SETTING               "pauseSpeed"
 #define PAUSE_SPEED_DEFAULT               0.5 /* m/s */
 #define PAUSE_INTERVAL_SETTING            "pauseInterval"

src/GUI/tooltip.cpp

@@ -1,10 +1,21 @@
-#include <QImageReader>
-#include <QLabel>
 #include "popup.h"
 #include "tooltip.h"
 
+static QSize thumbnailSize(const ImageInfo &img, int limit)
+{
+	int width, height;
+	if (img.size().width() > img.size().height()) {
+		width = qMin(img.size().width(), limit);
+		qreal ratio = img.size().width() / (qreal)img.size().height();
+		height = (int)(width / ratio);
+	} else {
+		height = qMin(img.size().height(), limit);
+		qreal ratio = img.size().height() / (qreal)img.size().width();
+		width = (int)(height / ratio);
+	}
 
-#define THUMBNAIL_MAX_SIZE 240
+	return QSize(width, height);
+}
 
 void ToolTip::insert(const QString &key, const QString &value)
 {
@@ -15,22 +26,17 @@ QString ToolTip::toString() const
 {
 	QString html;
 
-	if (_img.isValid()) {
+	if (_images.size()) {
-		int width, height;
+		html = "<div align=\"center\">";
-		if (_img.size().width() > _img.size().height()) {
+		for (int i = 0; i < _images.size(); i++) {
-			width = qMin(_img.size().width(), THUMBNAIL_MAX_SIZE);
+			const ImageInfo &img = _images.at(i);
-			qreal ratio = _img.size().width() / (qreal)_img.size().height();
+			QSize size(thumbnailSize(img, qMin(960/_images.size(), 240)));
-			height = (int)(width / ratio);
-		} else {
-			height = qMin(_img.size().height(), THUMBNAIL_MAX_SIZE);
-			qreal ratio = _img.size().height() / (qreal)_img.size().width();
-			width = (int)(height / ratio);
-		}
 
-		html += "<div align=\"center\">";
+			html += QString("<a href=\"file:%0\">"
-		html += QString("<a href=\"file:%0\">"
+			  "<img src=\"%0\" width=\"%1\" height=\"%2\"/></a>")
-		  "<img src=\"%0\" width=\"%1\" height=\"%2\"/></a>")
+			  .arg(img.path(), QString::number(size.width()),
-		  .arg(_img.path(), QString::number(width), QString::number(height));
+			  QString::number(size.height()));
+		}
 		html += "</div>";
 	}
 

src/GUI/tooltip.h

@@ -3,6 +3,7 @@
 
 #include <QString>
 #include <QList>
+#include <QVector>
 #include "common/kv.h"
 #include "data/imageinfo.h"
 
@@ -10,12 +11,12 @@ class ToolTip
 {
 public:
 	void insert(const QString &key, const QString &value);
-	void setImage(const ImageInfo &image) {_img = image;}
+	void setImages(const QVector<ImageInfo> &images) {_images = images;}
 	QString toString() const;
 
 private:
 	QList<KV<QString, QString> > _list;
-	ImageInfo _img;
+	QVector<ImageInfo> _images;
 };
 
 #endif // TOOLTIP_H

src/GUI/waypointitem.cpp

@@ -30,6 +30,19 @@ QString WaypointItem::info() const
 	if (!_waypoint.description().isEmpty())
 		tt.insert(qApp->translate("WaypointItem", "Description"),
 		  _waypoint.description());
+	if (_waypoint.address().isValid()) {
+		QString addr("<address>");
+		addr += _waypoint.address().street();
+		addr += "<br/>" + _waypoint.address().city();
+		if (!_waypoint.address().postalCode().isEmpty())
+			addr += "<br/>" + _waypoint.address().postalCode();
+		if (!_waypoint.address().state().isEmpty())
+			addr += "<br/>" + _waypoint.address().state();
+		if (!_waypoint.address().country().isEmpty())
+			addr += "<br/>" + _waypoint.address().country();
+		addr += "</address>";
+		tt.insert(qApp->translate("WaypointItem", "Address"), addr);
+	}
 	if (!_waypoint.links().isEmpty()) {
 		QString links;
 		for (int i = 0; i < _waypoint.links().size(); i++) {
@@ -41,7 +54,7 @@ QString WaypointItem::info() const
 		}
 		tt.insert(qApp->translate("WaypointItem", "Links"), links);
 	}
-	tt.setImage(_waypoint.image());
+	tt.setImages(_waypoint.images());
 
 	return tt.toString();
 }

src/common/coordinates.cpp

@@ -14,7 +14,8 @@ double Coordinates::distanceTo(const Coordinates &c) const
 #ifndef QT_NO_DEBUG
 QDebug operator<<(QDebug dbg, const Coordinates &c)
 {
-	dbg.nospace() << "Coordinates(" << c.lon() << ", " << c.lat() << ")";
+	dbg.nospace() << qSetRealNumberPrecision(10) << "Coordinates(" << c.lat()
+	  << ", " << c.lon() << ")";
 	return dbg.space();
 }
 #endif // QT_NO_DEBUG

src/common/garmin.h

@@ -0,0 +1,16 @@
+#ifndef GARMIN_H
+#define GARMIN_H
+
+#include <QtGlobal>
+
+inline double toWGS32(qint32 v)
+{
+	return (double)(((double)v / (double)(1U<<31)) * (double)180);
+}
+
+inline double toWGS24(qint32 v)
+{
+	return toWGS32(v<<8);
+}
+
+#endif // GARMIN_H

src/common/tifffile.h

@@ -9,6 +9,7 @@
 #define TIFF_SHORT     3
 #define TIFF_LONG      4
 #define TIFF_RATIONAL  5
+#define TIFF_SRATIONAL 10
 #define TIFF_DOUBLE    12
 
 class TIFFFile

src/data/address.h

@@ -0,0 +1,35 @@
+#ifndef ADDRESS_H
+#define ADDRESS_H
+
+#include <QString>
+
+class Address
+{
+public:
+	Address() {}
+	Address(const QString &street, const QString &city)
+	  : _street(street), _city(city) {}
+
+	const QString &street() const {return _street;}
+	const QString &city() const {return _city;}
+	const QString &state() const {return _state;}
+	const QString &country() const {return _country;}
+	const QString &postalCode() const {return _postalCode;}
+
+	void setStreet(const QString &street) {_street = street;}
+	void setCity(const QString &city) {_city = city;}
+	void setState(const QString &state) {_state = state;}
+	void setCountry(const QString &country) {_country = country;}
+	void setPostalCode(const QString &postalCode) {_postalCode = postalCode;}
+
+	bool isValid() const {return !(_street.isEmpty() || _city.isEmpty());}
+
+private:
+	QString _street;
+	QString _city;
+	QString _state;
+	QString _country;
+	QString _postalCode;
+};
+
+#endif // ADDRESS_H

src/data/data.cpp

@@ -19,6 +19,7 @@
 #include "exifparser.h"
 #include "cupparser.h"
 #include "gpiparser.h"
+#include "smlparser.h"
 #include "dem.h"
 #include "data.h"
 
@@ -41,6 +42,7 @@ static GeoJSONParser geojson;
 static EXIFParser exif;
 static CUPParser cup;
 static GPIParser gpi;
+static SMLParser sml;
 
 static QHash<QString, Parser*> parsers()
 {
@@ -66,6 +68,7 @@ static QHash<QString, Parser*> parsers()
 	hash.insert("jpg", &exif);
 	hash.insert("cup", &cup);
 	hash.insert("gpi", &gpi);
+	hash.insert("sml", &sml);
 
 	return hash;
 }
@@ -189,6 +192,7 @@ QString Data::formats()
 	  + qApp->translate("Data", "NMEA files") + " (*.nmea);;"
 	  + qApp->translate("Data", "OziExplorer files") + " (*.plt *.rte *.wpt);;"
 	  + qApp->translate("Data", "SLF files") + " (*.slf);;"
+	  + qApp->translate("Data", "SML files") + " (*.sml);;"
 	  + qApp->translate("Data", "TCX files") + " (*.tcx);;"
 	  + qApp->translate("Data", "All files") + " (*)";
 }

src/data/dem.cpp

@@ -1,4 +1,9 @@
 #include <QtEndian>
+#if QT_VERSION < QT_VERSION_CHECK(5, 0, 0)
+#include <QtCore/qmath.h>
+#else // QT5
+#include <QtMath>
+#endif // QT5
 #include <QDir>
 #include <QFile>
 #include "common/coordinates.h"
@@ -37,10 +42,10 @@ static qreal height(const Coordinates &c, const QByteArray *data)
 	else
 		return NAN;
 
-	int row = (int)((c.lat() - (int)c.lat()) * (samples - 1));
+	int row = (int)((c.lat() - qFloor(c.lat())) * (samples - 1));
-	int col = (int)((c.lon() - (int)c.lon()) * (samples - 1));
+	int col = (int)((c.lon() - qFloor(c.lon())) * (samples - 1));
-	qreal dx = ((c.lon() - (int)c.lon()) * (samples - 1)) - col;
+	qreal dx = ((c.lon() - qFloor(c.lon())) * (samples - 1)) - col;
-	qreal dy = ((c.lat() - (int)c.lat()) * (samples - 1)) - row;
+	qreal dy = ((c.lat() - qFloor(c.lat())) * (samples - 1)) - row;
 
 	qreal p0 = value(col, row, samples, data);
 	qreal p1 = value(col + 1, row, samples, data);
@@ -75,7 +80,7 @@ qreal DEM::elevation(const Coordinates &c)
 	if (_dir.isEmpty())
 		return NAN;
 
-	Key k((int)c.lon(), (int)c.lat());
+	Key k(qFloor(c.lon()), qFloor(c.lat()));
 
 	QByteArray *ba = _data[k];
 	if (!ba) {

src/data/exifparser.cpp

@@ -82,7 +82,10 @@ double EXIFParser::altitude(TIFFFile &file, const IFDEntry &alt,
 
 double EXIFParser::coordinate(TIFFFile &file, const IFDEntry &ll) const
 {
-	if (!(ll.type == TIFF_RATIONAL && ll.count == 3))
+	// Some broken image creators like NOKIA phones use a wrong (SRATIONAL)
+	// data type
+	if (!((ll.type == TIFF_RATIONAL || ll.type == TIFF_SRATIONAL)
+	  && ll.count == 3))
 		return NAN;
 
 	if (!file.seek(ll.offset))
@@ -209,7 +212,7 @@ bool EXIFParser::parseTIFF(QFile *file, QVector<Waypoint> &waypoints)
 
 	Waypoint wp(c);
 	wp.setName(QFileInfo(file->fileName()).baseName());
-	wp.setImage(img);
+	wp.addImage(img);
 	wp.setElevation(altitude(tiff, GPSIFD.value(GPSAltitude),
 	  GPSIFD.value(GPSAltitudeRef)));
 	wp.setTimestamp(QDateTime(QDate::fromString(text(tiff,

src/data/gpiparser.cpp

@@ -1,7 +1,17 @@
+#include <cstring>
 #include <QDataStream>
 #include <QTextCodec>
 #include <QtEndian>
 #include <QUrl>
+#include <QIODevice>
+#include <QApplication>
+#include <QBuffer>
+#include <QImageReader>
+#include <QCryptographicHash>
+#if QT_VERSION >= QT_VERSION_CHECK(5, 0, 0)
+#include <QTemporaryDir>
+#endif // QT_VERSION >= 5
+#include "common/garmin.h"
 #include "gpiparser.h"
 
 
@@ -26,16 +36,105 @@ private:
 	QString _str;
 };
 
-static inline double toWGS(qint32 v)
+class CryptDevice : public QIODevice
 {
-	return (double)(((double)v / (double)(1U<<31)) * (double)180);
+public:
+	CryptDevice(QIODevice *device, quint32 key, quint32 blockSize,
+	  QObject *parent = 0);
+	bool isSequential() const {return true;}
+
+protected:
+	qint64 readData(char *data, qint64 maxSize);
+	qint64 writeData(const char *, qint64) {return -1;}
+
+private:
+	QIODevice *_device;
+	quint32 _key;
+	QByteArray _block;
+	int _available;
+};
+
+static void demangle(quint8 *data, quint32 size, quint32 key)
+{
+	static const unsigned char shuf[] = {
+		0xb, 0xc, 0xa, 0x0,
+		0x8, 0xf, 0x2, 0x1,
+		0x6, 0x4, 0x9, 0x3,
+		0xd, 0x5, 0x7, 0xe
+	};
+
+	int hiCnt = 0, loCnt;
+	quint8 sum = shuf[((key >> 24) + (key >> 16) + (key >> 8) + key) & 0xf];
+
+	for (quint32 i = 0; i < size; i++) {
+		quint8 hiAdd = shuf[key >> (hiCnt << 2) & 0xf] + sum;
+		loCnt = (hiCnt > 6) ? 0 : hiCnt + 1;
+		quint8 loAdd = shuf[key >> (loCnt << 2) & 0xf] + sum;
+		quint8 hi = data[i] - (hiAdd << 4);
+		quint8 lo = data[i] - loAdd;
+		data[i] = (hi & 0xf0) | (lo & 0x0f);
+		hiCnt = (loCnt > 6) ? 0 : loCnt + 1;
+	}
+}
+
+CryptDevice::CryptDevice(QIODevice *device, quint32 key, quint32 blockSize,
+  QObject *parent) : QIODevice(parent), _device(device), _key(key), _available(0)
+{
+	_block.resize(blockSize);
+	setOpenMode(_device->openMode());
+}
+
+qint64 CryptDevice::readData(char *data, qint64 maxSize)
+{
+	qint64 rs, ts = 0;
+	int cs;
+
+	if (_available) {
+		cs = qMin(maxSize, (qint64)_available);
+		memcpy(data, _block.constData() + _block.size() - _available, cs);
+		_available -= cs;
+		maxSize -= cs;
+		ts = cs;
+	}
+
+	while (maxSize) {
+		if ((rs = _device->read(_block.data(), _block.size())) < 0)
+			return -1;
+		else if (!rs)
+			break;
+		_available = rs;
+		demangle((quint8*)_block.data(), _available, _key);
+		cs = qMin(maxSize, (qint64)_available);
+		memcpy(data + ts, _block.constData(), cs);
+		_available -= cs;
+		maxSize -= cs;
+		ts += cs;
+	}
+
+	return ts;
+}
+
+
+static qint32 readInt24(QDataStream &stream)
+{
+	unsigned char data[3];
+	quint32 val;
+
+	stream.readRawData((char*)data, sizeof(data));
+	val = data[0] | ((quint32)data[1]) << 8 | ((quint32)data[2]) << 16;
+	return (val > 0x7FFFFF) ? (val & 0x7FFFFF) - 0x800000 : val;
 }
 
 static quint16 nextHeaderType(QDataStream &stream)
 {
 	quint16 type = 0;
-	stream.device()->peek((char*)&type, sizeof(type));
+
-	return qFromLittleEndian(type);
+	if (stream.device()->peek((char*)&type, sizeof(type))
+	  < (qint64)sizeof(type)) {
+		stream.setStatus(QDataStream::ReadCorruptData);
+		return 0xFFFF;
+	} else
+		return qFromLittleEndian(type);
 }
 
 static quint8 readRecordHeader(QDataStream &stream, RecordHeader &hdr)
@@ -55,18 +154,6 @@ static quint32 skipRecord(QDataStream &stream)
 	return rs + rh.size;
 }
 
-static quint32 readFprsRecord(QDataStream &stream)
-{
-	RecordHeader rh;
-	quint16 s1;
-	quint8 rs, s2, s3, s4;
-
-	rs = readRecordHeader(stream, rh);
-	stream >> s1 >> s2 >> s3 >> s4;
-
-	return rs + 5;
-}
-
 static quint16 readString(QDataStream &stream, QTextCodec *codec, QString &str)
 {
 	quint16 len;
@@ -83,15 +170,16 @@ static quint32 readTranslatedObjects(QDataStream &stream, QTextCodec *codec,
   QList<TranslatedString> &objects)
 {
 	qint32 size = 0, ret;
-	char lang[2];
+	char lang[3];
 
+	memset(lang, 0, sizeof(lang));
 	objects.clear();
 
 	stream >> size;
 	ret = size + 4;
-	while (size > 0) {
+	while (stream.status() == QDataStream::Ok && size > 0) {
 		QString str;
-		stream.readRawData(lang, sizeof(lang));
+		stream.readRawData(lang, sizeof(lang) - 1);
 		size -= readString(stream, codec, str) + 2;
 		objects.append(TranslatedString(lang, str));
 	}
@@ -102,6 +190,67 @@ static quint32 readTranslatedObjects(QDataStream &stream, QTextCodec *codec,
 	return ret;
 }
 
+static quint32 readFprsRecord(QDataStream &stream)
+{
+	RecordHeader rh;
+	quint16 s1;
+	quint8 rs, s2, s3, s4;
+
+	rs = readRecordHeader(stream, rh);
+	stream >> s1 >> s2 >> s3 >> s4;
+
+	return rs + 5;
+}
+
+static quint32 readFileDataRecord(QDataStream &stream, QTextCodec *codec)
+{
+	RecordHeader rh;
+	quint32 ds, s1;
+	quint16 s2, s3;
+	quint8 rs;
+	QList<TranslatedString> obj;
+
+	rs = readRecordHeader(stream, rh);
+	stream >> s1 >> s2 >> s3;
+	ds = 8;
+	ds += readTranslatedObjects(stream, codec, obj);
+	ds += readTranslatedObjects(stream, codec, obj);
+
+	if (s1 & 0x10) {
+		quint8 ss1, ss2;
+		quint16 ss3;
+		stream >> ss1 >> ss2 >> ss3;
+		ds += 4;
+	}
+	if (s1 & 0x100) {
+		quint32 ss1;
+		stream >> ss1;
+		if (ss1)
+			stream.skipRawData(ss1);
+		ds += ss1 + 4;
+	}
+	if (s1 & 0x400) {
+		QString str;
+		ds += readString(stream, codec, str);
+	}
+	if (s1 & 0x400000) {
+		quint16 ss1;
+		stream >> ss1;
+		if (ss1)
+			stream.skipRawData(ss1);
+		ds += ss1 + 2;
+	}
+	// structure of higher fields not known
+
+	if (ds > rh.size)
+		stream.setStatus(QDataStream::ReadCorruptData);
+	else if (ds < rh.size)
+		// skip remaining unknown fields
+		stream.skipRawData(rh.size - ds);
+
+	return rs + rh.size;
+}
+
 static quint32 readDescription(QDataStream &stream, QTextCodec *codec,
   Waypoint &waypoint)
 {
@@ -154,29 +303,29 @@ static quint32 readContact(QDataStream &stream, QTextCodec *codec,
 {
 	RecordHeader rh;
 	quint8 rs;
-	quint16 s1;
+	quint16 flags;
 	quint32 ds = 2;
 	QString str;
 	QList<TranslatedString> obj;
 
 	rs = readRecordHeader(stream, rh);
-	stream >> s1;
+	stream >> flags;
 
-	if (s1 & 0x1) // phone
+	if (flags & 0x1) // phone
 		ds += readString(stream, codec, str);
-	if (s1 & 0x2) // phone2
+	if (flags & 0x2) // phone2
 		ds += readString(stream, codec, str);
-	if (s1 & 0x4) // fax
+	if (flags & 0x4) // fax
 		ds += readString(stream, codec, str);
-	if (s1 & 0x8) // mail
+	if (flags & 0x8) // mail
 		ds += readString(stream, codec, str);
-	if (s1 & 0x10) { // web
+	if (flags & 0x10) { // web
 		ds += readString(stream, codec, str);
 		QUrl url(str);
 		waypoint.addLink(Link(url.scheme().isEmpty()
 		  ? "http://" + str : str, str));
 	}
-	if (s1 & 0x20) // unknown
+	if (flags & 0x20) // unknown
 		ds += readTranslatedObjects(stream, codec, obj);
 
 	if (ds != rh.size)
@@ -185,34 +334,228 @@ static quint32 readContact(QDataStream &stream, QTextCodec *codec,
 	return rs + rh.size;
 }
 
+static quint32 readAddress(QDataStream &stream, QTextCodec *codec,
+  Waypoint &waypoint)
+{
+	RecordHeader rh;
+	quint8 rs;
+	quint16 flags;
+	quint32 ds = 2;
+	QList<TranslatedString> obj;
+	QString str;
+	Address addr;
+
+	rs = readRecordHeader(stream, rh);
+	stream >> flags;
+
+	if (flags & 0x1) {
+		ds += readTranslatedObjects(stream, codec, obj);
+		if (!obj.isEmpty())
+			addr.setCity(obj.first().str());
+	}
+	if (flags & 0x2) {
+		ds += readTranslatedObjects(stream, codec, obj);
+		if (!obj.isEmpty())
+			addr.setCountry(obj.first().str());
+	}
+	if (flags & 0x4) {
+		ds += readTranslatedObjects(stream, codec, obj);
+		if (!obj.isEmpty())
+			addr.setState(obj.first().str());
+	}
+	if (flags & 0x8) {
+		ds += readString(stream, codec, str);
+		addr.setPostalCode(str);
+	}
+	if (flags & 0x10) {
+		ds += readTranslatedObjects(stream, codec, obj);
+		if (!obj.isEmpty())
+			addr.setStreet(obj.first().str());
+	}
+	if (flags & 0x20) // unknown
+		ds += readString(stream, codec, str);
+
+	waypoint.setAddress(addr);
+
+	if (ds != rh.size)
+		stream.setStatus(QDataStream::ReadCorruptData);
+
+	return rs + rh.size;
+}
+
+#if QT_VERSION >= QT_VERSION_CHECK(5, 0, 0)
+static const QTemporaryDir &tempDir()
+{
+	static QTemporaryDir dir;
+	return dir;
+}
+
+static quint32 readImageInfo(QDataStream &stream, Waypoint &waypoint,
+  const QString &fileName, int &imgId)
+{
+	RecordHeader rh;
+	quint8 rs, s1;
+	quint32 size;
+
+	rs = readRecordHeader(stream, rh);
+	stream >> s1 >> size;
+
+	QByteArray ba;
+	ba.resize(size);
+	stream.readRawData(ba.data(), ba.size());
+
+	if (tempDir().isValid()) {
+		QBuffer buf(&ba);
+		QImageReader ir(&buf);
+
+		QByteArray id(fileName.toUtf8() + QByteArray::number(imgId++));
+		QFile imgFile(tempDir().path() + "/" + QString("%0.%1").arg(
+		  QCryptographicHash::hash(id, QCryptographicHash::Sha1).toHex(),
+		  QString(ir.format())));
+		imgFile.open(QIODevice::WriteOnly);
+		imgFile.write(ba);
+		imgFile.close();
+
+		waypoint.addImage(ImageInfo(imgFile.fileName(), ir.size()));
+	}
+
+	if (size + 5 != rh.size)
+		stream.setStatus(QDataStream::ReadCorruptData);
+
+	return rs + rh.size;
+}
+#endif // QT_VERSION >= 5
+
+static int speed(quint8 flags)
+{
+	switch (flags >> 4) {
+		case 0x8:
+			return 40;
+		case 0x9:
+			return 30;
+		case 0xA:
+			return 50;
+		case 0xB:
+			return 70;
+		case 0xC:
+			return 80;
+		case 0xD:
+			return 90;
+		case 0xE:
+			return 100;
+		case 0xF:
+			return 120;
+		default:
+			return 0;
+	}
+}
+
+static quint32 readCamera(QDataStream &stream, QVector<Waypoint> &waypoints,
+  QList<Area> &polygons)
+{
+	RecordHeader rh;
+	quint8 flags, type, s7, rs;
+	qint32 top, right, bottom, left, lat, lon;
+	quint32 ds = 15;
+
+
+	rs = readRecordHeader(stream, rh);
+	top = readInt24(stream);
+	right = readInt24(stream);
+	bottom = readInt24(stream);
+	left = readInt24(stream);
+	stream >> flags >> type >> s7;
+
+	if (s7) {
+		quint32 skip = s7 + 2 + s7/4;
+		stream.skipRawData(skip);
+		lat = readInt24(stream);
+		lon = readInt24(stream);
+		ds += skip + 6;
+	} else {
+		quint8 s8;
+		stream.skipRawData(9);
+		stream >> s8;
+		quint32 skip = 3 + s8 + s8/4;
+		stream.skipRawData(skip);
+		lat = readInt24(stream);
+		lon = readInt24(stream);
+		ds += skip + 16;
+	}
+
+	waypoints.append(Coordinates(toWGS24(lon), toWGS24(lat)));
+
+	Area area;
+	Polygon polygon;
+	QVector<Coordinates> v(4);
+	v[0] = Coordinates(toWGS24(left), toWGS24(top));
+	v[1] = Coordinates(toWGS24(right), toWGS24(top));
+	v[2] = Coordinates(toWGS24(right), toWGS24(bottom));
+	v[3] = Coordinates(toWGS24(left), toWGS24(bottom));
+	polygon.append(v);
+	area.append(polygon);
+
+	switch (type) {
+		case 8:
+			area.setDescription(QString("%1&nbsp;mi/h")
+			  .arg(speed(flags)));
+			break;
+		case 9:
+			area.setDescription(QString("%1&nbsp;km/h")
+			  .arg(speed(flags)));
+			break;
+		case 10:
+		case 11:
+			area.setDescription("Red light camera");
+			break;
+	}
+
+	polygons.append(area);
+
+	if (ds > rh.size)
+		stream.setStatus(QDataStream::ReadCorruptData);
+	else if (ds < rh.size)
+		stream.skipRawData(rh.size - ds);
+
+	return rs + rh.size;
+}
+
 static quint32 readPOI(QDataStream &stream, QTextCodec *codec,
-  QVector<Waypoint> &waypoints)
+  QVector<Waypoint> &waypoints, const QString &fileName, int &imgId)
 {
 	RecordHeader rh;
 	quint8 rs;
 	quint32 ds;
-	qint32 s1, s2;
+	qint32 lat, lon;
 	quint16 s3;
 	QList<TranslatedString> obj;
 
 	rs = readRecordHeader(stream, rh);
-	stream >> s1 >> s2 >> s3;
+	stream >> lat >> lon >> s3;
 	stream.skipRawData(s3);
 	ds = 10 + s3;
 	ds += readTranslatedObjects(stream, codec, obj);
 
-	waypoints.append(Waypoint(Coordinates(toWGS(s2), toWGS(s1))));
+	waypoints.append(Waypoint(Coordinates(toWGS32(lon), toWGS32(lat))));
 	if (!obj.isEmpty())
 		waypoints.last().setName(obj.first().str());
 
-	while (ds < rh.size) {
+	while (stream.status() == QDataStream::Ok && ds < rh.size) {
 		switch(nextHeaderType(stream)) {
 			case 10:
 				ds += readDescription(stream, codec, waypoints.last());
 				break;
+			case 11:
+				ds += readAddress(stream, codec, waypoints.last());
+				break;
 			case 12:
 				ds += readContact(stream, codec, waypoints.last());
 				break;
+#if QT_VERSION >= QT_VERSION_CHECK(5, 0, 0)
+			case 13:
+				ds += readImageInfo(stream, waypoints.last(), fileName, imgId);
+				break;
+#endif // QT_VERSION >= 5
 			case 14:
 				ds += readNotes(stream, codec, waypoints.last());
 				break;
@@ -228,7 +571,8 @@ static quint32 readPOI(QDataStream &stream, QTextCodec *codec,
 }
 
 static quint32 readSpatialIndex(QDataStream &stream, QTextCodec *codec,
-  QVector<Waypoint> &waypoints)
+  QVector<Waypoint> &waypoints, QList<Area> &polygons, const QString &fileName,
+  int &imgId)
 {
 	RecordHeader rh;
 	quint32 ds, s5;
@@ -241,13 +585,17 @@ static quint32 readSpatialIndex(QDataStream &stream, QTextCodec *codec,
 	stream.skipRawData(s6);
 	ds = 22 + s6;
 	if (rh.flags & 0x8) {
-		while (ds < rh.size) {
+		while (stream.status() == QDataStream::Ok && ds < rh.size) {
 			switch(nextHeaderType(stream)) {
 				case 2:
-					ds += readPOI(stream, codec, waypoints);
+					ds += readPOI(stream, codec, waypoints, fileName, imgId);
 					break;
 				case 8:
-					ds += readSpatialIndex(stream, codec, waypoints);
+					ds += readSpatialIndex(stream, codec, waypoints, polygons,
+					  fileName, imgId);
+					break;
+				case 19:
+					ds += readCamera(stream, waypoints, polygons);
 					break;
 				default:
 					ds += skipRecord(stream);
@@ -261,52 +609,93 @@ static quint32 readSpatialIndex(QDataStream &stream, QTextCodec *codec,
 	return rs + rh.size;
 }
 
-static quint32 readFileDataRecord(QDataStream &stream, QTextCodec *codec)
+static void readPOIDatabase(QDataStream &stream, QTextCodec *codec,
+  QVector<Waypoint> &waypoints, QList<Area> &polygons, const QString &fileName,
+  int &imgId)
 {
 	RecordHeader rh;
-	quint32 ds, s1;
-	quint16 s2, s3;
-	quint8 rs;
 	QList<TranslatedString> obj;
+	quint32 ds;
 
-	rs = readRecordHeader(stream, rh);
+	readRecordHeader(stream, rh);
-	stream >> s1 >> s2 >> s3;
+	ds = readTranslatedObjects(stream, codec, obj);
-	ds = 8;
+	ds += readSpatialIndex(stream, codec, waypoints, polygons, fileName, imgId);
-	ds += readTranslatedObjects(stream, codec, obj);
+	if (rh.flags & 0x8) {
-	ds += readTranslatedObjects(stream, codec, obj);
+		while (stream.status() == QDataStream::Ok && ds < rh.size) {
-
+			switch(nextHeaderType(stream)) {
-	if (s1 & 0x10) {
+				case 5: // symbol
-		quint8 ss1, ss2;
+				case 7: // category
-		quint16 ss3;
+				default:
-		stream >> ss1 >> ss2 >> ss3;
+					ds += skipRecord(stream);
-		ds += 4;
+			}
-	}
+		}
-	if (s1 & 0x100) {
-		quint32 ss1;
-		stream >> ss1;
-		if (ss1)
-			stream.skipRawData(ss1);
-		ds += ss1 + 4;
-	}
-	if (s1 & 0x400) {
-		QString str;
-		ds += readString(stream, codec, str);
-	}
-	if (s1 & 0x400000) {
-		quint16 ss1;
-		stream >> ss1;
-		if (ss1)
-			stream.skipRawData(ss1);
-		ds += ss1 + 2;
 	}
 
 	if (ds != rh.size)
 		stream.setStatus(QDataStream::ReadCorruptData);
-
-	return rs + rh.size;
 }
 
-bool GPIParser::readFileHeader(QDataStream &stream)
+bool GPIParser::readData(QDataStream &stream, QTextCodec *codec,
+  QVector<Waypoint> &waypoints, QList<Area> &polygons, const QString &fileName)
+{
+	int imgId = 0;
+
+	while (stream.status() == QDataStream::Ok) {
+		switch (nextHeaderType(stream)) {
+			case 0x09:   // POI database
+				readPOIDatabase(stream, codec, waypoints, polygons, fileName,
+				  imgId);
+				break;
+			case 0xffff: // EOF
+				skipRecord(stream);
+				if (stream.status() == QDataStream::Ok)
+					return true;
+				break;
+			case 0x16:   // route
+			case 0x15:   // info header
+			default:
+				skipRecord(stream);
+		}
+	}
+
+	_errorString = "Invalid/corrupted GPI data";
+
+	return false;
+}
+
+bool GPIParser::readGPIHeader(QDataStream &stream, QTextCodec **codec)
+{
+	RecordHeader rh;
+	char m1[6], m2[2];
+	quint16 codepage = 0;
+	quint8 s2, s3;
+	quint32 ds;
+
+	readRecordHeader(stream, rh);
+	stream.readRawData(m1, sizeof(m1));
+	stream.readRawData(m2, sizeof(m2));
+	stream >> codepage >> s2 >> s3;
+	ds = sizeof(m1) + sizeof(m2) + 4;
+
+	if (codepage == 65001)
+		*codec = QTextCodec::codecForName("UTF-8");
+	else if (codepage == 0)
+		*codec = 0;
+	else
+		*codec = QTextCodec::codecForName(QString("CP%1").arg(codepage)
+		  .toLatin1());
+
+	if (s2 & 0x10)
+		ds += readFileDataRecord(stream, *codec);
+
+	if (stream.status() != QDataStream::Ok || ds != rh.size) {
+		_errorString = "Invalid GPI header";
+		return false;
+	} else
+		return true;
+}
+
+bool GPIParser::readFileHeader(QDataStream &stream, quint32 &ebs)
 {
 	RecordHeader rh;
 	quint32 ds, s7;
@@ -326,10 +715,7 @@ bool GPIParser::readFileHeader(QDataStream &stream)
 	if (rh.flags & 8)
 		ds += readFprsRecord(stream);
 
-	if (s8 & 0x4) {
+	ebs = (s8 & 0x4) ? s9 * 8 + 8 : 0;
-		_errorString = "Encrypted GPI files not supported";
-		return false;
-	}
 
 	if (stream.status() != QDataStream::Ok || ds != rh.size) {
 		_errorString = "Invalid file header";
@@ -338,109 +724,26 @@ bool GPIParser::readFileHeader(QDataStream &stream)
 		return true;
 }
 
-bool GPIParser::readGPIHeader(QDataStream &stream, QTextCodec *codec)
-{
-	RecordHeader rh;
-	char m1[6], m2[2];
-	quint16 codepage = 0;
-	quint8 s2, s3;
-	quint32 ds;
-
-	readRecordHeader(stream, rh);
-	stream.readRawData(m1, sizeof(m1));
-	stream.readRawData(m2, sizeof(m2));
-	stream >> codepage >> s2 >> s3;
-	ds = sizeof(m1) + sizeof(m2) + 4;
-
-	if (codepage == 65001)
-		codec = QTextCodec::codecForName("UTF-8");
-	else if (codepage == 0)
-		codec = 0;
-	else
-		codec = QTextCodec::codecForName(QString("CP%1").arg(codepage)
-		  .toLatin1());
-
-	if (s2 & 0x10)
-		ds += readFileDataRecord(stream, codec);
-
-	if (stream.status() != QDataStream::Ok || ds != rh.size) {
-		_errorString = "Invalid GPI header";
-		return false;
-	} else
-		return true;
-}
-
-void GPIParser::readPOIDatabase(QDataStream &stream, QTextCodec *codec,
-  QVector<Waypoint> &waypoints)
-{
-	RecordHeader rh;
-	QList<TranslatedString> obj;
-	quint32 ds;
-
-	readRecordHeader(stream, rh);
-	ds = readTranslatedObjects(stream, codec, obj);
-	ds += readSpatialIndex(stream, codec, waypoints);
-	if (rh.flags & 0x8) {
-		while (ds < rh.size) {
-			switch(nextHeaderType(stream)) {
-				case 5: // symbol
-				case 7: // category
-				default:
-					ds += skipRecord(stream);
-			}
-		}
-	}
-
-	if (ds != rh.size)
-		stream.setStatus(QDataStream::ReadCorruptData);
-}
-
-bool GPIParser::readEntry(QDataStream &stream, QTextCodec *codec,
-  QVector<Waypoint> &waypoints)
-{
-	switch (nextHeaderType(stream)) {
-		case 0x09:   // POI database
-			readPOIDatabase(stream, codec, waypoints);
-			break;
-		case 0xffff: // EOF
-			skipRecord(stream);
-			return false;
-		case 0x16:   // route
-		case 0x15:   // info header
-		default:
-			skipRecord(stream);
-	}
-
-	return true;
-}
-
-bool GPIParser::readData(QDataStream &stream, QTextCodec *codec,
-  QVector<Waypoint> &waypoints)
-{
-	while (stream.status() == QDataStream::Ok)
-		if (!readEntry(stream, codec, waypoints))
-			return stream.atEnd();
-
-	return false;
-}
-
 bool GPIParser::parse(QFile *file, QList<TrackData> &tracks,
   QList<RouteData> &routes, QList<Area> &polygons, QVector<Waypoint> &waypoints)
 {
 	Q_UNUSED(tracks);
 	Q_UNUSED(routes);
-	Q_UNUSED(polygons);
 	QDataStream stream(file);
 	QTextCodec *codec = 0;
+	quint32 ebs;
 
 	stream.setByteOrder(QDataStream::LittleEndian);
 
-	if (!readFileHeader(stream) || !readGPIHeader(stream, codec))
+	if (!readFileHeader(stream, ebs) || !readGPIHeader(stream, &codec))
 		return false;
 
-	if (!readData(stream, codec, waypoints)) {
+	if (ebs) {
-		_errorString = "Invalid/corrupted GPI data";
+		CryptDevice dev(stream.device(), 0xf870b5, ebs);
-		return false;
+		QDataStream cryptStream(&dev);
+		cryptStream.setByteOrder(QDataStream::LittleEndian);
+		return readData(cryptStream, codec, waypoints, polygons,
+		  file->fileName());
 	} else
-		return true;
+		return readData(stream, codec, waypoints, polygons, file->fileName());
 }

src/data/gpiparser.h

@@ -15,14 +15,11 @@ public:
 	int errorLine() const {return 0;}
 
 private:
-	bool readFileHeader(QDataStream &stream);
+	bool readFileHeader(QDataStream &stream, quint32 &ebs);
-	bool readGPIHeader(QDataStream &stream, QTextCodec *codec);
+	bool readGPIHeader(QDataStream &stream, QTextCodec **codec);
 	bool readData(QDataStream &stream, QTextCodec *codec,
-	  QVector<Waypoint> &waypoints);
+	  QVector<Waypoint> &waypoints, QList<Area> &polygons,
-	bool readEntry(QDataStream &stream, QTextCodec *codec,
+	  const QString &fileName);
-	  QVector<Waypoint> &waypoints);
-	void readPOIDatabase(QDataStream &stream, QTextCodec *codec,
-	  QVector<Waypoint> &waypoints);
 
 	QString _errorString;
 };

src/data/gpxparser.cpp

@@ -69,8 +69,10 @@ Coordinates GPXParser::coordinates()
 void GPXParser::rpExtension(SegmentData *autoRoute)
 {
 	while (_reader.readNextStartElement()) {
-		if (_reader.name() == QLatin1String("rpt"))
+		if (_reader.name() == QLatin1String("rpt")) {
-			autoRoute->append(Trackpoint(coordinates()));
+			if (autoRoute)
+				autoRoute->append(Trackpoint(coordinates()));
+		}
 		_reader.skipCurrentElement();
 	}
 }
@@ -91,11 +93,45 @@ void GPXParser::tpExtension(Trackpoint &trackpoint)
 	}
 }
 
-void GPXParser::rteptExtensions(SegmentData *autoRoute)
+void GPXParser::address(Waypoint &waypoint)
+{
+	Address addr;
+
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("StreetAddress"))
+			addr.setStreet(_reader.readElementText());
+		else if (_reader.name() == QLatin1String("City"))
+			addr.setCity(_reader.readElementText());
+		else if (_reader.name() == QLatin1String("PostalCode"))
+			addr.setPostalCode(_reader.readElementText());
+		else if (_reader.name() == QLatin1String("State"))
+			addr.setState(_reader.readElementText());
+		else if (_reader.name() == QLatin1String("Country"))
+			addr.setCountry(_reader.readElementText());
+		else
+			_reader.skipCurrentElement();
+	}
+
+	waypoint.setAddress(addr);
+}
+
+void GPXParser::wpExtension(Waypoint &waypoint)
+{
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("Address"))
+			address(waypoint);
+		else
+			_reader.skipCurrentElement();
+	}
+}
+
+void GPXParser::waypointExtensions(Waypoint &waypoint, SegmentData *autoRoute)
 {
 	while (_reader.readNextStartElement()) {
 		if (_reader.name() == QLatin1String("RoutePointExtension"))
 			rpExtension(autoRoute);
+		else if (_reader.name() == QLatin1String("WaypointExtension"))
+			wpExtension(waypoint);
 		else
 			_reader.skipCurrentElement();
 	}
@@ -170,8 +206,8 @@ void GPXParser::waypointData(Waypoint &waypoint, SegmentData *autoRoute)
 			link10.setURL(_reader.readElementText());
 		else if (_reader.name() == QLatin1String("urlname"))
 			link10.setText(_reader.readElementText());
-		else if (autoRoute && _reader.name() == QLatin1String("extensions"))
+		else if (_reader.name() == QLatin1String("extensions"))
-			rteptExtensions(autoRoute);
+			waypointExtensions(waypoint, autoRoute);
 		else
 			_reader.skipCurrentElement();
 	}

src/data/gpxparser.h

@@ -21,11 +21,13 @@ private:
 	void rpExtension(SegmentData *autoRoute);
 	void tpExtension(Trackpoint &trackpoint);
 	void trkptExtensions(Trackpoint &trackpoint);
-	void rteptExtensions(SegmentData *autoRoute);
+	void wpExtension(Waypoint &waypoint);
+	void waypointExtensions(Waypoint &waypoint, SegmentData *autoRoute);
 	void area(Area &area);
 	void gpxExtensions(QList<Area> &areas);
 	void trackpointData(Trackpoint &trackpoint);
 	void waypointData(Waypoint &waypoint, SegmentData *autoRoute = 0);
+	void address(Waypoint &waypoint);
 	qreal number();
 	QDateTime time();
 	Coordinates coordinates();

src/data/igcparser.cpp

@@ -96,7 +96,7 @@ static bool readARecord(const char *line, qint64 len)
 	return true;
 }
 
-bool IGCParser::readHRecord(const char *line, int len)
+bool IGCParser::readHRecord(CTX &ctx, const char *line, int len)
 {
 	if (len < 11 || ::strncmp(line, "HFDTE", 5))
 		return true;
@@ -112,9 +112,9 @@ bool IGCParser::readHRecord(const char *line, int len)
 		return false;
 	}
 
-	_date = QDate(y + 2000 <= QDate::currentDate().year() ? 2000 + y : 1900 + y,
+	ctx.date = QDate(y + 2000 <= QDate::currentDate().year()
-	  m, d);
+	  ? 2000 + y : 1900 + y, m, d);
-	if (!_date.isValid()) {
+	if (!ctx.date.isValid()) {
 		_errorString = "Invalid date";
 		return false;
 	}
@@ -122,8 +122,8 @@ bool IGCParser::readHRecord(const char *line, int len)
 	return true;
 }
 
-bool IGCParser::readBRecord(SegmentData &segment, const char *line,
+bool IGCParser::readBRecord(CTX &ctx, const char *line, int len,
-  int len)
+  SegmentData &segment)
 {
 	qreal lat, lon, ele;
 	QTime time;
@@ -152,20 +152,20 @@ bool IGCParser::readBRecord(SegmentData &segment, const char *line,
 		return false;
 	}
 
-	if (time < _time && !segment.isEmpty()
+	if (time < ctx.time && !segment.isEmpty()
-	  && _date == segment.last().timestamp().date())
+	  && ctx.date == segment.last().timestamp().date())
-		_date = _date.addDays(1);
+		ctx.date = ctx.date.addDays(1);
-	_time = time;
+	ctx.time = time;
 
 	Trackpoint t(Coordinates(lon, lat));
-	t.setTimestamp(QDateTime(_date, _time, Qt::UTC));
+	t.setTimestamp(QDateTime(ctx.date, ctx.time, Qt::UTC));
 	t.setElevation(ele);
 	segment.append(t);
 
 	return true;
 }
 
-bool IGCParser::readCRecord(RouteData &route, const char *line, int len)
+bool IGCParser::readCRecord(const char *line, int len, RouteData &route)
 {
 	qreal lat, lon;
 
@@ -202,6 +202,7 @@ bool IGCParser::parse(QFile *file, QList<TrackData> &tracks,
 	qint64 len;
 	char line[76 + 2 + 1 + 1];
 	bool route = false, track = false;
+	CTX ctx;
 
 
 	_errorLine = 1;
@@ -225,28 +226,28 @@ bool IGCParser::parse(QFile *file, QList<TrackData> &tracks,
 			}
 		} else {
 			if (line[0] == 'H') {
-				if (!readHRecord(line, len))
+				if (!readHRecord(ctx, line, len))
 					return false;
 			} else if (line[0] == 'C') {
 				if (route) {
-					if (!readCRecord(routes.last() ,line, len))
+					if (!readCRecord(line, len, routes.last()))
 						return false;
 				} else {
 					route = true;
 					routes.append(RouteData());
 				}
 			} else if (line[0] == 'B') {
-				if (_date.isNull()) {
+				if (ctx.date.isNull()) {
 					_errorString = "Missing date header";
 					return false;
 				}
 				if (!track) {
 					tracks.append(TrackData());
 					tracks.last().append(SegmentData());
-					_time = QTime(0, 0);
+					ctx.time = QTime(0, 0);
 					track = true;
 				}
-				if (!readBRecord(tracks.last().last(), line, len))
+				if (!readBRecord(ctx, line, len, tracks.last().last()))
 					return false;
 			}
 		}

src/data/igcparser.h

@@ -17,15 +17,17 @@ public:
 	int errorLine() const {return _errorLine;}
 
 private:
-	bool readHRecord(const char *line, int len);
+	struct CTX {
-	bool readBRecord(SegmentData &segment, const char *line, int len);
+		QDate date;
-	bool readCRecord(RouteData &route, const char *line, int len);
+		QTime time;
+	};
+
+	bool readHRecord(CTX &ctx, const char *line, int len);
+	bool readBRecord(CTX &ctx, const char *line, int len, SegmentData &segment);
+	bool readCRecord(const char *line, int len, RouteData &route);
 
 	int _errorLine;
 	QString _errorString;
-
-	QDate _date;
-	QTime _time;
 };
 
 #endif // IGCPARSER_H

src/data/link.h

@@ -7,15 +7,15 @@ class Link {
 public:
 	Link() {}
 	Link(const QString &URL, const QString &text = QString())
-		: _URL(URL), _text(text) {}
+		: _url(URL), _text(text) {}
 
-	void setURL(const QString &URL) {_URL = URL;}
+	void setURL(const QString &URL) {_url = URL;}
 	void setText(const QString &text) {_text = text;}
-	const QString &URL() const {return _URL;}
+	const QString &URL() const {return _url;}
 	const QString &text() const {return _text;}
 
 private:
-	QString _URL;
+	QString _url;
 	QString _text;
 };
 

src/data/nmeaparser.cpp

@@ -227,7 +227,8 @@ bool NMEAParser::readEW(const char *data, int len, qreal &lon)
 	return true;
 }
 
-bool NMEAParser::readRMC(SegmentData &segment, const char *line, int len)
+bool NMEAParser::readRMC(CTX &ctx, const char *line, int len,
+  SegmentData &segment)
 {
 	int col = 1;
 	const char *vp = line;
@@ -280,23 +281,24 @@ bool NMEAParser::readRMC(SegmentData &segment, const char *line, int len)
 	}
 
 	if (!date.isNull()) {
-		if (_date.isNull() && !_time.isNull() && !segment.isEmpty())
+		if (ctx.date.isNull() && !ctx.time.isNull() && !segment.isEmpty())
-			segment.last().setTimestamp(QDateTime(date, _time, Qt::UTC));
+			segment.last().setTimestamp(QDateTime(date, ctx.time, Qt::UTC));
-		_date = date;
+		ctx.date = date;
 	}
 
 	Coordinates c(lon, lat);
-	if (valid && !_GGA && c.isValid()) {
+	if (valid && !ctx.GGA && c.isValid()) {
 		Trackpoint t(c);
-		if (!_date.isNull() && !time.isNull())
+		if (!ctx.date.isNull() && !time.isNull())
-			t.setTimestamp(QDateTime(_date, time, Qt::UTC));
+			t.setTimestamp(QDateTime(ctx.date, time, Qt::UTC));
 		segment.append(t);
 	}
 
 	return true;
 }
 
-bool NMEAParser::readGGA(SegmentData &segment, const char *line, int len)
+bool NMEAParser::readGGA(CTX &ctx, const char *line, int len,
+  SegmentData &segment)
 {
 	int col = 1;
 	const char *vp = line;
@@ -306,7 +308,7 @@ bool NMEAParser::readGGA(SegmentData &segment, const char *line, int len)
 		if (*lp == ',' || *lp == '*') {
 			switch (col) {
 				case 1:
-					if (!readTime(vp, lp - vp, _time))
+					if (!readTime(vp, lp - vp, ctx.time))
 						return false;
 					break;
 				case 2:
@@ -360,19 +362,19 @@ bool NMEAParser::readGGA(SegmentData &segment, const char *line, int len)
 	Coordinates c(lon, lat);
 	if (c.isValid()) {
 		Trackpoint t(c);
-		if (!(_time.isNull() || _date.isNull()))
+		if (!(ctx.time.isNull() || ctx.date.isNull()))
-			t.setTimestamp(QDateTime(_date, _time, Qt::UTC));
+			t.setTimestamp(QDateTime(ctx.date, ctx.time, Qt::UTC));
 		if (!std::isnan(ele))
 			t.setElevation(ele - gh);
 		segment.append(t);
 
-		_GGA = true;
+		ctx.GGA = true;
 	}
 
 	return true;
 }
 
-bool NMEAParser::readWPL(QVector<Waypoint> &waypoints, const char *line, int len)
+bool NMEAParser::readWPL(const char *line, int len, QVector<Waypoint> &waypoints)
 {
 	int col = 1;
 	const char *vp = line;
@@ -423,7 +425,7 @@ bool NMEAParser::readWPL(QVector<Waypoint> &waypoints, const char *line, int len
 	return true;
 }
 
-bool NMEAParser::readZDA(const char *line, int len)
+bool NMEAParser::readZDA(CTX &ctx, const char *line, int len)
 {
 	int col = 1;
 	const char *vp = line;
@@ -468,8 +470,8 @@ bool NMEAParser::readZDA(const char *line, int len)
 		return false;
 	}
 
-	_date = QDate(y, m, d);
+	ctx.date = QDate(y, m, d);
-	if (!_date.isValid()) {
+	if (!ctx.date.isValid()) {
 		_errorString = "Invalid date";
 		return false;
 	}
@@ -486,13 +488,11 @@ bool NMEAParser::parse(QFile *file, QList<TrackData> &tracks,
 	qint64 len;
 	char line[80 + 2 + 1 + 1];
 	SegmentData segment;
+	CTX ctx;
 
 
 	_errorLine = 1;
 	_errorString.clear();
-	_date = QDate();
-	_time = QTime();
-	_GGA = false;
 
 	while (!file->atEnd()) {
 		len = file->readLine(line, sizeof(line));
@@ -507,16 +507,16 @@ bool NMEAParser::parse(QFile *file, QList<TrackData> &tracks,
 
 		if (validSentence(line, len)) {
 			if (!memcmp(line + 3, "RMC,", 4)) {
-				if (!readRMC(segment, line + 7, len - 7))
+				if (!readRMC(ctx, line + 7, len - 7, segment))
 					return false;
 			} else if (!memcmp(line + 3, "GGA,", 4)) {
-				if (!readGGA(segment, line + 7, len - 7))
+				if (!readGGA(ctx, line + 7, len - 7, segment))
 					return false;
 			} else if (!memcmp(line + 3, "WPL,", 4)) {
-				if (!readWPL(waypoints, line + 7, len - 7))
+				if (!readWPL(line + 7, len - 7, waypoints))
 					return false;
 			} else if (!memcmp(line + 3, "ZDA,", 4)) {
-				if (!readZDA(line + 7, len - 7))
+				if (!readZDA(ctx, line + 7, len - 7))
 					return false;
 			}
 		}

src/data/nmeaparser.h

@@ -8,7 +8,7 @@
 class NMEAParser : public Parser
 {
 public:
-	NMEAParser() : _errorLine(0), _GGA(false) {}
+	NMEAParser() : _errorLine(0) {}
 
 	bool parse(QFile *file, QList<TrackData> &tracks, QList<RouteData> &routes,
 	  QList<Area> &polygons, QVector<Waypoint> &waypoints);
@@ -16,6 +16,14 @@ public:
 	int errorLine() const {return _errorLine;}
 
 private:
+	struct CTX {
+		CTX() : GGA(false) {}
+
+		QDate date;
+		QTime time;
+		bool GGA;
+	};
+
 	bool readEW(const char *data, int len, qreal &lon);
 	bool readLon(const char *data, int len, qreal &lon);
 	bool readNS(const char *data, int len, qreal &lat);
@@ -25,17 +33,13 @@ private:
 	bool readAltitude(const char *data, int len, qreal &ele);
 	bool readGeoidHeight(const char *data, int len, qreal &gh);
 
-	bool readRMC(SegmentData &segment, const char *line, int len);
+	bool readRMC(CTX &ctx, const char *line, int len, SegmentData &segment);
-	bool readGGA(SegmentData &segment, const char *line, int len);
+	bool readGGA(CTX &ctx, const char *line, int len, SegmentData &segment);
-	bool readWPL(QVector<Waypoint> &waypoints, const char *line, int len);
+	bool readWPL(const char *line, int len, QVector<Waypoint> &waypoints);
-	bool readZDA(const char *line, int len);
+	bool readZDA(CTX &ctx, const char *line, int len);
 
 	int _errorLine;
 	QString _errorString;
-
-	QDate _date;
-	QTime _time;
-	bool _GGA;
 };
 
 #endif // NMEAPARSER_H

src/data/smlparser.cpp

@@ -0,0 +1,163 @@
+#include "smlparser.h"
+
+
+#ifndef QT_NO_DEBUG
+QDebug operator<<(QDebug dbg, const SMLParser::Sensors &sensors)
+{
+	dbg.nospace() << "Sensors(" << sensors.cadence << ", "
+	  << sensors.temperature << ", " << sensors.hr << "," << sensors.power
+	  << ", " << sensors.speed << ")";
+
+	return dbg.space();
+}
+#endif // QT_NO_DEBUG
+
+
+void SMLParser::sample(SegmentData &segment, QMap<QDateTime, Sensors> &map)
+{
+	QDateTime timestamp;
+	Sensors sensors;
+	qreal lat = NAN, lon = NAN, altitude = NAN;
+	bool ok, periodic = false;
+
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("Latitude")) {
+			lat = _reader.readElementText().toDouble(&ok);
+			if (!ok || lat < -90 || lon > 90) {
+				_reader.raiseError("Invalid Latitude");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("Longitude")) {
+			lon = _reader.readElementText().toDouble(&ok);
+			if (!ok || lat < -180 || lon > 180) {
+				_reader.raiseError("Invalid Longitude");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("UTC")) {
+			timestamp = QDateTime::fromString(_reader.readElementText(),
+			  Qt::ISODate);
+			if (!timestamp.isValid()) {
+				_reader.raiseError("Invalid timestamp");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("GPSAltitude")) {
+			altitude = _reader.readElementText().toDouble(&ok);
+			if (!ok) {
+				_reader.raiseError("Invalid GPS altitude");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("SampleType")) {
+			if (_reader.readElementText() == "periodic")
+				periodic = true;
+		} else if (_reader.name() == QLatin1String("Cadence")) {
+			sensors.cadence = _reader.readElementText().toDouble(&ok);
+			if (!ok || sensors.cadence < 0) {
+				_reader.raiseError("Invalid Cadence");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("Temperature")) {
+			sensors.temperature = _reader.readElementText().toDouble(&ok);
+			// Temperature is in Kelvin units
+			if (!ok || sensors.temperature < 0) {
+				_reader.raiseError("Invalid Temperature");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("HR")) {
+			sensors.hr = _reader.readElementText().toDouble(&ok);
+			if (!ok || sensors.hr < 0) {
+				_reader.raiseError("Invalid HR");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("BikePower")) {
+			sensors.power = _reader.readElementText().toDouble(&ok);
+			if (!ok || sensors.power < 0) {
+				_reader.raiseError("Invalid BikePower");
+				return;
+			}
+		} else if (_reader.name() == QLatin1String("Speed")) {
+			sensors.speed = _reader.readElementText().toDouble(&ok);
+			if (!ok || sensors.speed < 0) {
+				_reader.raiseError("Invalid Speed");
+				return;
+			}
+		} else
+			_reader.skipCurrentElement();
+	}
+
+	if (periodic && timestamp.isValid())
+		map.insert(timestamp, sensors);
+	else if (!(std::isnan(lon) || std::isnan(lat))) {
+		Trackpoint t(Coordinates(rad2deg(lon), rad2deg(lat)));
+		t.setTimestamp(timestamp);
+		t.setElevation(altitude);
+
+		segment.append(t);
+	}
+}
+
+void SMLParser::samples(SegmentData &segment)
+{
+	QMap<QDateTime, Sensors> sensors;
+	QMap<QDateTime, Sensors>::const_iterator it;
+
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("Sample")) {
+			sample(segment, sensors);
+		} else
+			_reader.skipCurrentElement();
+	}
+
+	for (int i = 0; i < segment.size(); i++) {
+		Trackpoint &t = segment[i];
+		if ((it = sensors.lowerBound(t.timestamp())) != sensors.constEnd()) {
+			t.setCadence(it->cadence * 60);
+			t.setTemperature(it->temperature - 273.15);
+			t.setHeartRate(it->hr * 60);
+			t.setPower(it->power);
+			t.setSpeed(it->speed);
+		}
+	}
+}
+
+void SMLParser::deviceLog(TrackData &track)
+{
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("Samples")) {
+			track.append(SegmentData());
+			samples(track.last());
+		} else
+			_reader.skipCurrentElement();
+	}
+}
+
+void SMLParser::sml(QList<TrackData> &tracks)
+{
+	while (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("DeviceLog")) {
+			tracks.append(TrackData());
+			deviceLog(tracks.last());
+		} else
+			_reader.skipCurrentElement();
+	}
+}
+
+bool SMLParser::parse(QFile *file, QList<TrackData> &tracks,
+  QList<RouteData> &routes, QList<Area> &polygons,
+  QVector<Waypoint> &waypoints)
+{
+	Q_UNUSED(routes);
+	Q_UNUSED(polygons);
+	Q_UNUSED(waypoints);
+
+	_reader.clear();
+	_reader.setDevice(file);
+
+	if (_reader.readNextStartElement()) {
+		if (_reader.name() == QLatin1String("sml"))
+			sml(tracks);
+		else
+			_reader.raiseError("Not a SML file");
+	}
+
+	return !_reader.error();
+}

src/data/smlparser.h

@@ -0,0 +1,38 @@
+#ifndef SMLPARSER_H
+#define SMLPARSER_H
+
+#include <QXmlStreamReader>
+#include <QMap>
+#include <QDebug>
+#include "parser.h"
+
+class SMLParser : public Parser
+{
+public:
+	bool parse(QFile *file, QList<TrackData> &tracks, QList<RouteData> &routes,
+	  QList<Area> &polygons, QVector<Waypoint> &waypoints);
+	QString errorString() const {return _reader.errorString();}
+	int errorLine() const {return _reader.lineNumber();}
+
+private:
+	struct Sensors
+	{
+		Sensors()
+		  : cadence(NAN), temperature(NAN), hr(NAN), power(NAN), speed(NAN) {}
+
+		qreal cadence, temperature, hr, power, speed;
+	};
+
+	void sml(QList<TrackData> &tracks);
+	void deviceLog(TrackData &track);
+	void samples(SegmentData &segment);
+	void sample(SegmentData &segment, QMap<QDateTime, Sensors> &map);
+
+#ifndef QT_NO_DEBUG
+	friend QDebug operator<<(QDebug dbg, const Sensors &sensors);
+#endif // QT_NO_DEBUG
+
+	QXmlStreamReader _reader;
+};
+
+#endif // SMLPARSER_H

src/data/track.cpp

@@ -7,6 +7,7 @@ int Track::_heartRateWindow = 3;
 int Track::_cadenceWindow = 3;
 int Track::_powerWindow = 3;
 
+bool Track::_automaticPause = true;
 qreal Track::_pauseSpeed = 0.5;
 int Track::_pauseInterval = 10;
 
@@ -14,6 +15,16 @@ bool Track::_outlierEliminate = true;
 bool Track::_useReportedSpeed = false;
 
 
+static qreal avg(const QVector<qreal> &v)
+{
+	qreal sum = 0;
+
+	for (int i = 0; i < v.size(); i++)
+		sum += v.at(i);
+
+	return sum/v.size();
+}
+
 static qreal median(QVector<qreal> &v)
 {
 	qSort(v.begin(), v.end());
@@ -24,8 +35,7 @@ static qreal MAD(QVector<qreal> &v, qreal m)
 {
 	for (int i = 0; i < v.size(); i++)
 		v[i] = qAbs(v.at(i) - m);
-	qSort(v.begin(), v.end());
+	return median(v);
-	return v.at(v.size() / 2);
 }
 
 static QSet<int> eliminate(const QVector<qreal> &v)
@@ -74,17 +84,19 @@ Track::Track(const TrackData &data) : _data(data), _pause(0)
 
 	for (int i = 0; i < _data.size(); i++) {
 		const SegmentData &sd = _data.at(i);
+		_segments.append(Segment());
 		if (sd.isEmpty())
 			continue;
 
 		// precompute distances, times, speeds and acceleration
 		QVector<qreal> acceleration;
 
-		_segments.append(Segment());
 		Segment &seg = _segments.last();
 
-		seg.distance.append(i ? _segments.at(i-1).distance.last() : 0);
+		seg.distance.append(i && !_segments.at(i-1).distance.isEmpty()
-		seg.time.append(i ? _segments.at(i-1).time.last() :
+		  ? _segments.at(i-1).distance.last() : 0);
+		seg.time.append(i && !_segments.at(i-1).time.isEmpty()
+		  ? _segments.at(i-1).time.last() :
 		  sd.first().hasTimestamp() ? 0 : NAN);
 		seg.speed.append(sd.first().hasTimestamp() ? 0 : NAN);
 		acceleration.append(sd.first().hasTimestamp() ? 0 : NAN);
@@ -130,17 +142,39 @@ Track::Track(const TrackData &data) : _data(data), _pause(0)
 			}
 		}
 
+		if (!hasTime)
+			continue;
+
+
 		// get stop-points + pause duration
+		int pauseInterval;
+		qreal pauseSpeed;
+
+		if (_automaticPause) {
+			pauseSpeed = (avg(seg.speed) > 2.8) ? 0.40 : 0.15;
+			pauseInterval = 10;
+		} else {
+			pauseSpeed = _pauseSpeed;
+			pauseInterval = _pauseInterval;
+		}
+
+		int ss = 0, la = 0;
 		for (int j = 1; j < seg.time.size(); j++) {
-			if (seg.time.at(j) > seg.time.at(j-1) + _pauseInterval
+			if (seg.speed.at(j) > pauseSpeed)
-			  && seg.speed.at(j) < _pauseSpeed) {
+				ss = -1;
-				_pause += seg.time.at(j) - seg.time.at(j-1);
+			else if (ss < 0)
-				seg.stop.insert(j-1);
+				ss = j-1;
-				seg.stop.insert(j);
+
+			if (ss >= 0 && seg.time.at(j) > seg.time.at(ss) + pauseInterval) {
+				int l = qMax(ss, la);
+				_pause += seg.time.at(j) - seg.time.at(l);
+				for (int k = l; k <= j; k++)
+					seg.stop.insert(k);
+				la = j;
 			}
 		}
 
-		if (!_outlierEliminate || !hasTime)
+		if (!_outlierEliminate)
 			continue;
 
 

src/data/track.h

@@ -41,6 +41,7 @@ public:
 	static void setHeartRateFilter(int window) {_heartRateWindow = window;}
 	static void setCadenceFilter(int window) {_cadenceWindow = window;}
 	static void setPowerFilter(int window) {_powerWindow = window;}
+	static void setAutomaticPause(bool set) {_automaticPause = set;}
 	static void setPauseSpeed(qreal speed) {_pauseSpeed = speed;}
 	static void setPauseInterval(int interval) {_pauseInterval = interval;}
 	static void setOutlierElimination(bool eliminate)
@@ -68,6 +69,7 @@ private:
 	static int _heartRateWindow;
 	static int _cadenceWindow;
 	static int _powerWindow;
+	static bool _automaticPause;
 	static qreal _pauseSpeed;
 	static int _pauseInterval;
 	static bool _useReportedSpeed;

src/data/waypoint.h

@@ -4,10 +4,12 @@
 #include <QString>
 #include <QDateTime>
 #include <QHash>
+#include <QVector>
 #include <QDebug>
 #include "common/coordinates.h"
 #include "imageinfo.h"
 #include "link.h"
+#include "address.h"
 
 class Waypoint
 {
@@ -19,7 +21,8 @@ public:
 	const Coordinates &coordinates() const {return _coordinates;}
 	const QString &name() const {return _name;}
 	const QString &description() const {return _description;}
-	const ImageInfo &image() const {return _image;}
+	const Address &address() const {return _address;}
+	const QVector<ImageInfo> &images() const {return _images;}
 	const QVector<Link> &links() const {return _links;}
 	const QDateTime &timestamp() const {return _timestamp;}
 	qreal elevation() const {return _elevation;}
@@ -29,9 +32,10 @@ public:
 	void setName(const QString &name) {_name = name;}
 	void setDescription(const QString &description)
 	  {_description = description;}
+	void setAddress(const Address &address) {_address = address;}
 	void setTimestamp(const QDateTime &timestamp) {_timestamp = timestamp;}
 	void setElevation(qreal elevation) {_elevation = elevation;}
-	void setImage(const ImageInfo &image) {_image = image;}
+	void addImage(const ImageInfo &image) {_images.append(image);}
 	void addLink(const Link &link) {_links.append(link);}
 
 	bool hasElevation() const {return !std::isnan(_elevation);}
@@ -44,7 +48,8 @@ private:
 	Coordinates _coordinates;
 	QString _name;
 	QString _description;
-	ImageInfo _image;
+	Address _address;
+	QVector<ImageInfo> _images;
 	QVector<Link> _links;
 	QDateTime _timestamp;
 	qreal _elevation;

src/map/IMG/bitstream.cpp

@@ -0,0 +1,79 @@
+#include "bitstream.h"
+
+
+bool BitStream1::read(int bits, quint32 &val)
+{
+	val = 0;
+
+	for (int pos = 0; pos < bits; ) {
+		if (!_remaining) {
+			if (!_length || !_file.readUInt8(_hdl, _data))
+				return false;
+			_remaining = 8;
+			_length--;
+		}
+
+		quint32 get = bits - pos;
+		if (get >= _remaining) {
+			val |= _data << pos;
+			pos += _remaining;
+			_remaining = 0;
+		} else {
+			quint32 mask = (1<<get) - 1;
+			val |= (_data & mask)<<pos;
+			_data >>= get;
+			_remaining -= get;
+			break;
+		}
+	}
+
+	return true;
+}
+
+bool BitStream1::flush()
+{
+	if (_length && !_file.seek(_hdl, _hdl.pos() + _length))
+		return false;
+
+	_length = 0;
+	_remaining = 0;
+
+	return true;
+}
+
+
+bool BitStream4::read(int bits, quint32 &val)
+{
+	if (bits <= 32 - (int)(_used + _unused)) {
+		val = bits ? (_data << _used) >> (32 - bits) : 0;
+		_used += bits;
+		return true;
+	}
+
+	quint32 old = (_used < 32) ? (_data << _used) >> (32 - bits) : 0;
+	quint32 bytes = qMin(_length, 4U);
+
+	if (!_file.readVUInt32SW(_hdl, bytes, _data))
+		return false;
+
+	_used -= 32 - bits;
+	_length -= bytes;
+	_unused = (4 - bytes) * 8;
+	_data <<= _unused;
+
+	val = _data >> (32 - _used) | old;
+
+	return true;
+}
+
+bool BitStream4::flush()
+{
+	if (_length && !_file.seek(_hdl, _hdl.pos() + _length))
+		return false;
+
+	_length = 0;
+	_used = 32;
+	_unused = 0;
+
+	return true;
+}

src/map/IMG/bitstream.h

@@ -0,0 +1,39 @@
+#ifndef BITSTREAM_H
+#define BITSTREAM_H
+
+#include "subfile.h"
+
+class BitStream1 {
+public:
+	BitStream1(const SubFile &file, SubFile::Handle &hdl, quint32 length)
+	  : _file(file), _hdl(hdl), _length(length), _remaining(0) {}
+
+	bool read(int bits, quint32 &val);
+	bool flush();
+	quint32 bitsAvailable() const {return _length * 8 + _remaining;}
+
+private:
+	const SubFile &_file;
+	SubFile::Handle &_hdl;
+	quint32 _length, _remaining;
+	quint8 _data;
+};
+
+class BitStream4 {
+public:
+	BitStream4(const SubFile &file, SubFile::Handle &hdl, quint32 length)
+	  : _file(file), _hdl(hdl), _length(length), _used(32), _unused(0),
+	  _data(0) {}
+
+	bool read(int bits, quint32 &val);
+	bool flush();
+	quint32 bitsAvailable() const {return _length * 8 + (32 - _used) - _unused;}
+
+private:
+	const SubFile &_file;
+	SubFile::Handle &_hdl;
+	quint32 _length, _used, _unused;
+	quint32 _data;
+};
+
+#endif // BITSTREAM_H

src/map/IMG/deltastream.cpp

@@ -0,0 +1,86 @@
+#include "deltastream.h"
+
+
+static int bitSize(quint8 baseSize, bool variableSign, bool extraBit)
+{
+	int bits = 2;
+	if (baseSize <= 9)
+		bits += baseSize;
+	else
+		bits += 2 * baseSize - 9;
+
+	if (variableSign)
+		bits++;
+	if (extraBit)
+		bits++;
+
+	return bits;
+}
+
+DeltaStream::DeltaStream(const SubFile &file, SubFile::Handle &hdl,
+  quint32 length, quint8 info, bool extraBit, bool extended)
+  : BitStream1(file, hdl, length), _readBits(0xFFFFFFFF)
+{
+	_extraBit = extraBit ? 1 : 0;
+	if (!(sign(_lonSign) && sign(_latSign)))
+		return;
+	if (extended) {
+		quint32 b;
+		if (!read(1, b))
+			return;
+	}
+	_lonBits = bitSize(info & 0x0F, !_lonSign, extraBit);
+	_latBits = bitSize(info >> 4, !_latSign, false);
+	_readBits = _lonBits + _latBits;
+}
+
+bool DeltaStream::readDelta(int bits, int sign, int extraBit,
+  qint32 &delta)
+{
+	quint32 value;
+
+	if (!read(bits, value))
+		return false;
+
+	value >>= extraBit;
+
+	if (!sign) {
+		qint32 signMask = 1 << (bits - extraBit - 1);
+		if (value & signMask) {
+			qint32 comp = value ^ signMask;
+			if (comp)
+				delta = comp - signMask;
+			else {
+				qint32 other;
+				if (!readDelta(bits - extraBit, sign, false, other))
+					return false;
+				if (other < 0)
+					delta = 1 - signMask + other;
+				else
+					delta = signMask - 1 + other;
+			}
+		} else {
+			delta = value;
+		}
+	} else {
+		delta = value * sign;
+	}
+
+	return true;
+}
+
+bool DeltaStream::sign(int &val)
+{
+	quint32 bit;
+	val = 0;
+
+	if (!read(1, bit))
+		return false;
+	if (bit) {
+		if (!read(1, bit))
+			return false;
+		val = bit ? -1 : 1;
+	}
+
+	return true;
+}

src/map/IMG/deltastream.h

@@ -0,0 +1,28 @@
+#ifndef DELTASTREAM_H
+#define DELTASTREAM_H
+
+#include "bitstream.h"
+
+class DeltaStream : public BitStream1 {
+public:
+	DeltaStream(const SubFile &file, SubFile::Handle &hdl, quint32 length,
+	  quint8 info, bool extraBit, bool extended);
+
+	bool readNext(qint32 &lonDelta, qint32 &latDelta)
+	{
+		return hasNext()
+			? (readDelta(_lonBits, _lonSign, _extraBit, lonDelta)
+			  && readDelta(_latBits, _latSign, false, latDelta)) : false;
+	}
+	bool atEnd() const {return (_readBits != 0xFFFFFFFF && !hasNext());}
+
+private:
+	bool hasNext() const {return bitsAvailable() >= _readBits;}
+	bool sign(int &val);
+	bool readDelta(int bits, int sign, int extraBit, qint32 &delta);
+
+	int _lonSign, _latSign, _extraBit;
+	quint32 _lonBits, _latBits, _readBits;
+};
+
+#endif // DELTASTREAM_H

src/map/IMG/gmap.cpp

@@ -0,0 +1,151 @@
+#include <QXmlStreamReader>
+#include <QDir>
+#include "vectortile.h"
+#include "gmap.h"
+
+
+static SubFile::Type tileType(const QString &suffix)
+{
+	if (!suffix.compare("TRE"))
+		return SubFile::TRE;
+	else if (!suffix.compare("RGN"))
+		return SubFile::RGN;
+	else if (!suffix.compare("LBL"))
+		return SubFile::LBL;
+	else if (!suffix.compare("TYP"))
+		return SubFile::TYP;
+	else if (!suffix.compare("GMP"))
+		return SubFile::GMP;
+	else if (!suffix.compare("NET"))
+		return SubFile::NET;
+	else
+		return SubFile::Unknown;
+}
+
+void GMAP::subProduct(QXmlStreamReader &reader, QString &dataDir,
+  QString &baseMap)
+{
+	while (reader.readNextStartElement()) {
+		if (reader.name() == "Directory")
+			dataDir = reader.readElementText();
+		else if (reader.name() == "BaseMap")
+			baseMap = reader.readElementText();
+		else
+			reader.skipCurrentElement();
+	}
+}
+
+void GMAP::mapProduct(QXmlStreamReader &reader, QString &dataDir,
+  QString &typFile, QString &baseMap)
+{
+	while (reader.readNextStartElement()) {
+		if (reader.name() == "Name")
+			_name = reader.readElementText();
+		else if (reader.name() == "TYP")
+			typFile = reader.readElementText();
+		else if (reader.name() == "SubProduct")
+			subProduct(reader, dataDir, baseMap);
+		else
+			reader.skipCurrentElement();
+	}
+}
+
+bool GMAP::readXML(const QString &path, QString &dataDir, QString &typFile,
+  QString &baseMap)
+{
+	QFile file(path);
+
+	if (!file.open(QFile::ReadOnly | QFile::Text))
+		return false;
+
+	QXmlStreamReader reader(&file);
+	if (reader.readNextStartElement()) {
+		if (reader.name() == "MapProduct")
+			mapProduct(reader, dataDir, typFile, baseMap);
+		else
+			reader.raiseError("Not a GMAP XML file");
+	}
+	if (reader.error()) {
+		_errorString = QString("%1: %2").arg(reader.lineNumber())
+		  .arg(reader.errorString());
+		return false;
+	}
+
+	return true;
+}
+
+bool GMAP::loadTile(const QDir &dir, bool baseMap)
+{
+	VectorTile *tile = new VectorTile();
+
+	QFileInfoList ml = dir.entryInfoList(QDir::Files);
+	for (int i = 0; i < ml.size(); i++) {
+		const QFileInfo &fi = ml.at(i);
+		tile->addFile(fi.absoluteFilePath(), tileType(fi.suffix()));
+	}
+
+	if (!tile->init(baseMap)) {
+		qWarning("%s: Invalid map tile", qPrintable(dir.path()));
+		delete tile;
+		return false;
+	}
+
+	double min[2], max[2];
+	min[0] = tile->bounds().left();
+	min[1] = tile->bounds().bottom();
+	max[0] = tile->bounds().right();
+	max[1] = tile->bounds().top();
+	_tileTree.Insert(min, max, tile);
+
+	_bounds |= tile->bounds();
+
+	return true;
+}
+
+GMAP::GMAP(const QString &fileName) : _fileName(fileName)
+{
+	QString dataDirPath, typFilePath, baseMapPath;
+	if (!readXML(fileName, dataDirPath, typFilePath, baseMapPath))
+		return;
+
+	QDir baseDir(QFileInfo(fileName).absoluteDir());
+	if (!baseDir.exists(dataDirPath)) {
+		_errorString = "Missing/invalid map data directory";
+		return;
+	}
+	QDir dataDir(baseDir.filePath(dataDirPath));
+	QFileInfoList ml = dataDir.entryInfoList(QDir::Dirs | QDir::NoDotAndDotDot);
+
+
+	QFileInfo baseMap(dataDir.filePath(baseMapPath));
+	_baseMap = !baseMapPath.isEmpty() && baseMap.exists();
+
+	for (int i = 0; i < ml.size(); i++) {
+		const QFileInfo &fi = ml.at(i);
+		if (fi.isDir())
+			loadTile(QDir(fi.absoluteFilePath()),
+			  fi.absoluteFilePath() == baseMap.absoluteFilePath());
+	}
+
+	if (baseDir.exists(typFilePath))
+		_typ = new SubFile(baseDir.filePath(typFilePath));
+
+	if (!_tileTree.Count())
+		_errorString = "No usable map tile found";
+	else
+		_valid = true;
+}
+
+bool GMAP::isGMAP(const QString &path)
+{
+	QFile file(path);
+
+	if (!file.open(QFile::ReadOnly | QFile::Text))
+		return false;
+
+	QXmlStreamReader reader(&file);
+	if (reader.readNextStartElement() && reader.name() == "MapProduct")
+		return true;
+
+	return false;
+}

src/map/IMG/gmap.h

@@ -0,0 +1,30 @@
+#ifndef GMAP_H
+#define GMAP_H
+
+#include "mapdata.h"
+
+class QXmlStreamReader;
+class QDir;
+
+class GMAP : public MapData
+{
+public:
+	GMAP(const QString &fileName);
+
+	QString fileName() const {return _fileName;}
+
+	static bool isGMAP(const QString &path);
+
+private:
+	bool readXML(const QString &path, QString &dataDir, QString &typFile,
+	  QString &baseMap);
+	void mapProduct(QXmlStreamReader &reader, QString &dataDir,
+	  QString &typFile, QString &baseMap);
+	void subProduct(QXmlStreamReader &reader, QString &dataDir,
+	  QString &baseMap);
+	bool loadTile(const QDir &dir, bool baseMap);
+
+	QString _fileName;
+};
+
+#endif // GMAP_H

src/map/IMG/huffmanstream.cpp

@@ -0,0 +1,74 @@
+#include "huffmanstream.h"
+
+
+HuffmanStream::HuffmanStream(const SubFile &file, SubFile::Handle &hdl,
+  quint32 length, const HuffmanTable &table, bool line)
+  : BitStream4(file, hdl, length), _table(table), _symbolDataSize(0),
+  _symbolData(0)
+{
+	if (line) {
+		if (!(sign(_lonSign) && sign(_latSign)))
+			return;
+	} else {
+		_lonSign = 0;
+		_latSign = 0;
+	}
+
+	quint32 eb;
+	if (!read(1, eb))
+		return;
+	if (eb) {
+		qWarning("Extended polygon/lines not supported");
+		flush();
+	}
+}
+
+bool HuffmanStream::sign(int &val)
+{
+	quint32 bit;
+	val = 0;
+
+	if (!read(1, bit))
+		return false;
+	if (bit) {
+		if (!read(1, bit))
+			return false;
+		val = bit ? -1 : 1;
+	}
+
+	return true;
+}
+
+bool HuffmanStream::readDelta(int sign, qint32 &symbol)
+{
+	quint8 size;
+	quint32 next;
+	quint8 nextSize = qMin((quint32)(32 - _symbolDataSize), bitsAvailable());
+
+	if (!read(nextSize, next))
+		return false;
+
+	_symbolData = (_symbolData << nextSize) | next;
+	_symbolDataSize += nextSize;
+
+	symbol = _table.symbol(_symbolData << (32 - _symbolDataSize), size);
+
+	if (size <= _symbolDataSize)
+		_symbolDataSize -= size;
+	else
+		return false;
+
+	if (symbol && !sign) {
+		if (!_symbolDataSize)
+			return false;
+		else {
+			sign = ((1U << (_symbolDataSize - 1)) & _symbolData) ? -1 : 1;
+			_symbolDataSize--;
+		}
+	}
+	symbol = sign * symbol;
+
+	return true;
+}
+
+

src/map/IMG/huffmanstream.h

@@ -0,0 +1,35 @@
+#ifndef HUFFMANSTREAM_H
+#define HUFFMANSTREAM_H
+
+#include "bitstream.h"
+#include "huffmantable.h"
+
+class HuffmanStream : public BitStream4 {
+public:
+	HuffmanStream(const SubFile &file, SubFile::Handle &hdl, quint32 length,
+	  const HuffmanTable &table, bool line);
+
+	bool readNext(qint32 &lonDelta, qint32 &latDelta)
+	{
+		if (!(readDelta(_lonSign, lonDelta) && readDelta(_latSign, latDelta)))
+			return false;
+
+		return (lonDelta || latDelta);
+	}
+
+	bool readOffset(qint32 &lonDelta, qint32 &latDelta)
+	  {return (readDelta(1, lonDelta) && readDelta(1, latDelta));}
+	bool atEnd() const
+	  {return _symbolDataSize + bitsAvailable() < _table.maxSymbolSize();}
+
+private:
+	bool sign(int &val);
+	bool readDelta(int sign, qint32 &delta);
+
+	const HuffmanTable &_table;
+	quint32 _symbolDataSize;
+	quint32 _symbolData;
+	int _lonSign, _latSign;
+};
+
+#endif // HUFFMANSTREAM_H

src/map/IMG/huffmantable.cpp

@@ -0,0 +1,139 @@
+#include "huffmantable.h"
+
+
+static quint8 vs(const quint8 b0)
+{
+	static const quint8 sizes[] = {4, 1, 2, 1, 3, 1, 2, 1};
+	return sizes[b0 & 0x07];
+}
+
+static inline quint8 bs(const quint8 val)
+{
+	return (val + 7) >> 3;
+}
+
+static inline quint32 readVUint32(const quint8 *buffer, quint32 bytes)
+{
+	quint32 val = 0;
+
+	for (quint32 i = bytes; i; i--)
+		val |= ((quint32)*(buffer + i)) << ((i-1) * 8);
+
+	return val;
+}
+
+bool HuffmanTable::load(const SubFile &file, SubFile::Handle &hdl,
+  quint32 offset, quint32 size, quint32 id)
+{
+	if (!getBuffer(file, hdl, offset, size, id))
+		return false;
+
+	_s0 = (quint8)_buffer.at(0) & 0x0F;
+	_s1e = (quint8)_buffer.at(0) & 0x10 ? 1 : 8;
+	_s2 = (quint8)_buffer.at(1);
+	_s3 = bs(_s2);
+	_s1d = (quint8)_buffer.at(2);
+	_s1f = (quint8)_buffer.at(3);
+	_s20 = bs(_s1f);
+	_s1 = _s20 + 1;
+	_s22 = vs(_buffer.at(4));
+	_s1c = _s3 + 1 + _s22;
+	_s14 = (quint8*)(_buffer.data()) + 4 + _s22;
+	_s10 = _s14 + _s1c * _s1d;
+	_s18 = _s10 + (_s1 << _s0);
+
+	return true;
+}
+
+bool HuffmanTable::getBuffer(const SubFile &file, SubFile::Handle &hdl,
+  quint32 offset, quint32 size, quint8 id)
+{
+	quint32 recordSize, recordOffset = offset;
+
+	for (int i = 0; i <= id; i++) {
+		if (!file.seek(hdl, recordOffset))
+			return false;
+		if (!file.readVUInt32(hdl, recordSize))
+			return false;
+		recordOffset = hdl.pos() + recordSize;
+		if (recordOffset > offset + size)
+			return false;
+	};
+
+	_buffer.resize(recordSize);
+	for (int i = 0; i < _buffer.size(); i++)
+		if (!file.readUInt8(hdl, *((quint8*)(_buffer.data() + i))))
+			return false;
+
+	return true;
+}
+
+quint32 HuffmanTable::symbol(quint32 data, quint8 &size) const
+{
+	quint32 ss, sym;
+	quint8 *tp;
+
+
+	if (_s0 == 0) {
+		sym = _s1d - 1;
+		ss = 0;
+	} else {
+		quint32 offset = _s1 * (data >> (0x20U - _s0));
+		tp = _s10 + offset;
+
+		if ((*tp & 1) != 0) {
+			sym = readVUint32(tp, _s20);
+			size = *tp >> 1;
+			return sym;
+		}
+
+		ss = *tp >> 1;
+		sym = tp[1];
+	}
+
+	tp = ss * _s1c + _s14;
+	data = data >> (0x20U - _s2);
+
+	quint8 *prev = tp;
+	while (ss < sym) {
+		quint32 cnt = (ss + 1 + sym) >> 1;
+		tp = _s14 + (cnt * _s1c);
+		quint32 nd = readVUint32(tp - 1, _s3);
+
+		if (data <= nd) {
+			if (data == nd)
+				ss = cnt;
+			else
+				tp = prev;
+
+			sym = cnt - (data < nd);
+			cnt = ss;
+		}
+		ss = cnt;
+		prev = tp;
+	}
+
+	sym = readVUint32(tp - 1, _s3);
+	tp = tp + _s3;
+	ss = readVUint32(tp, _s22);
+	size = *tp;
+	sym = (data - sym) >> (_s2 - *tp);
+
+	if (_s1e == 8)
+		sym = readVUint32(tp, _s20);
+	else {
+		sym = (sym + ss) * _s1f;
+		ss = sym >> 3;
+		sym = sym & 7;
+		quint32 shift = 8 - sym;
+		sym = *(_s18 + ss) >> sym;
+
+		if (shift < _s1f) {
+			tp = _s18 + ss;
+			ss = readVUint32(tp, ((_s1f + 7) - shift) >> 3);
+			sym = (ss << shift) | sym;
+		}
+	}
+
+	return sym;
+}

src/map/IMG/huffmantable.h

@@ -0,0 +1,27 @@
+#ifndef HUFFMANTABLE_H
+#define HUFFMANTABLE_H
+
+#include "subfile.h"
+
+class HuffmanTable {
+public:
+	HuffmanTable() : _s2(0) {}
+
+	bool load(const SubFile &file, SubFile::Handle &hdl, quint32 offset,
+	  quint32 size, quint32 id);
+	bool isNull() const {return _s2 == 0;}
+	quint8 maxSymbolSize() const {return _s2;}
+	quint32 symbol(quint32 data, quint8 &size) const;
+
+private:
+	bool getBuffer(const SubFile &file, SubFile::Handle &hdl, quint32 offset,
+	  quint32 size, quint8 id);
+
+	QByteArray _buffer;
+	quint8 _s0, _s1, _s2, _s3;
+	quint8 *_s10, *_s14, *_s18;
+	quint8 _s1c, _s1d, _s1e, _s1f, _s20;
+	quint16 _s22;
+};
+
+#endif // HUFFMANTABLE_H

src/map/IMG/img.cpp

@@ -1,35 +1,41 @@
-#include <QSet>
+#include <QMap>
 #include <QtEndian>
-#include "common/programpaths.h"
 #include "vectortile.h"
 #include "img.h"
 
 
-#define CACHE_SIZE 8388608 /* 8MB */
+typedef QMap<QByteArray, VectorTile*> TileMap;
 
+static SubFile::Type tileType(const char str[3])
+{
+	if (!memcmp(str, "TRE", 3))
+		return SubFile::TRE;
+	else if (!memcmp(str, "RGN", 3))
+		return SubFile::RGN;
+	else if (!memcmp(str, "LBL", 3))
+		return SubFile::LBL;
+	else if (!memcmp(str, "TYP", 3))
+		return SubFile::TYP;
+	else if (!memcmp(str, "GMP", 3))
+		return SubFile::GMP;
+	else if (!memcmp(str, "NET", 3))
+		return SubFile::NET;
+	else
+		return SubFile::Unknown;
+}
+
+IMG::IMG(const QString &fileName) : _file(fileName)
+{
 #define CHECK(condition) \
 	if (!(condition)) { \
 		_errorString = "Unsupported or invalid IMG file"; \
+		qDeleteAll(tileMap); \
 		return; \
 	}
 
-struct CTX
+	TileMap tileMap;
-{
+	QByteArray typFile;
-	CTX(const RectC &rect, int bits, QList<IMG::Poly> *polygons,
-	  QList<IMG::Poly> *lines, QList<IMG::Point> *points)
-	  : rect(rect), bits(bits), polygons(polygons), lines(lines),
-	  points(points) {}
 
-	const RectC &rect;
-	int bits;
-	QList<IMG::Poly> *polygons;
-	QList<IMG::Poly> *lines;
-	QList<IMG::Point> *points;
-};
-
-IMG::IMG(const QString &fileName)
-  : _file(fileName), _typ(0), _style(0), _valid(false)
-{
 	if (!_file.open(QFile::ReadOnly)) {
 		_errorString = _file.errorString();
 		return;
@@ -50,10 +56,10 @@ IMG::IMG(const QString &fileName)
 	CHECK(_file.seek(0x49) && read(d1, sizeof(d1)) && _file.seek(0x61)
 	  && readValue(e1) && readValue(e2) && _file.seek(0x65)
 	  && read(d2, sizeof(d2)));
+
 	QByteArray nba(QByteArray(d1, sizeof(d1)) + QByteArray(d2, sizeof(d2)));
-	_name = QString(nba).trimmed();
+	_name = QString::fromLatin1(nba.constData(), nba.size()-1).trimmed();
 	_blockSize = 1 << (e1 + e2);
-	_blockCache.setMaxCost(CACHE_SIZE / _blockSize);
 
 	// Read the FAT table
 	quint8 flag;
@@ -74,22 +80,18 @@ IMG::IMG(const QString &fileName)
 	offset += 512;
 	int cnt = (size - offset) / 512;
 
-
-	QMap<QString, VectorTile*> tileMap;
-	QString typFile;
-
 	// Read FAT blocks describing the IMG sub-files
 	for (int i = 0; i < cnt; i++) {
 		quint16 block;
 		CHECK(_file.seek(offset) && readValue(flag) && read(name, sizeof(name))
 		  && read(type, sizeof(type)) && readValue(size) && readValue(part));
-		SubFile::Type tt = SubFile::type(type);
+		SubFile::Type tt = tileType(type);
 
-		QString fn(QByteArray(name, sizeof(name)));
+		QByteArray fn(name, sizeof(name));
-		if (SubFile::isTileFile(tt)) {
+		if (VectorTile::isTileFile(tt)) {
 			VectorTile *tile;
-			QMap<QString, VectorTile*>::iterator it = tileMap.find(fn);
+			TileMap::const_iterator it = tileMap.find(fn);
-			if (it == tileMap.end()) {
+			if (it == tileMap.constEnd()) {
 				tile = new VectorTile();
 				tileMap.insert(fn, tile);
 			} else
@@ -130,80 +132,31 @@ IMG::IMG(const QString &fileName)
 	}
 
 	// Create tile tree
-	for (QMap<QString, VectorTile*>::iterator it = tileMap.begin();
+	for (TileMap::const_iterator it = tileMap.constBegin();
-	  it != tileMap.end(); ++it) {
+	  it != tileMap.constEnd(); ++it) {
-		CHECK((*it)->init());
+		VectorTile *tile = it.value();
+
+		if (!tile->init(false)) {
+			qWarning("%s: %s: Invalid map tile", qPrintable(_file.fileName()),
+			  qPrintable(it.key()));
+			delete tile;
+			continue;
+		}
 
 		double min[2], max[2];
-		min[0] = (*it)->bounds().left();
+		min[0] = tile->bounds().left();
-		min[1] = (*it)->bounds().bottom();
+		min[1] = tile->bounds().bottom();
-		max[0] = (*it)->bounds().right();
+		max[0] = tile->bounds().right();
-		max[1] = (*it)->bounds().top();
+		max[1] = tile->bounds().top();
-		_tileTree.Insert(min, max, *it);
+		_tileTree.Insert(min, max, tile);
 
-		_bounds |= (*it)->bounds();
+		_bounds |= tile->bounds();
 	}
 
-	_valid = true;
+	if (!_tileTree.Count())
-}
+		_errorString = "No usable map tile found";
-
+	else
-IMG::~IMG()
+		_valid = true;
-{
-	TileTree::Iterator it;
-	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
-		delete _tileTree.GetAt(it);
-
-	delete _typ;
-	delete _style;
-}
-
-void IMG::load()
-{
-	Q_ASSERT(!_style);
-
-	if (_typ)
-		_style = new Style(_typ);
-	else {
-		QFile typFile(ProgramPaths::typFile());
-		if (typFile.exists()) {
-			SubFile typ(&typFile);
-			_style = new Style(&typ);
-		} else
-			_style = new Style();
-	}
-}
-
-void IMG::clear()
-{
-	TileTree::Iterator it;
-	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
-		_tileTree.GetAt(it)->clear();
-
-	delete _style;
-	_style = 0;
-
-	_blockCache.clear();
-}
-
-static bool cb(VectorTile *tile, void *context)
-{
-	CTX *ctx = (CTX*)context;
-	tile->objects(ctx->rect, ctx->bits, ctx->polygons, ctx->lines, ctx->points);
-	return true;
-}
-
-void IMG::objects(const RectC &rect, int bits, QList<Poly> *polygons,
-  QList<Poly> *lines, QList<Point> *points)
-{
-	CTX ctx(rect, bits, polygons, lines, points);
-	double min[2], max[2];
-
-	min[0] = rect.left();
-	min[1] = rect.bottom();
-	max[0] = rect.right();
-	max[1] = rect.top();
-
-	_tileTree.Search(min, max, cb, &ctx);
 }
 
 qint64 IMG::read(char *data, qint64 maxSize)
@@ -227,33 +180,12 @@ template<class T> bool IMG::readValue(T &val)
 	return true;
 }
 
-bool IMG::readBlock(int blockNum, QByteArray &data)
+bool IMG::readBlock(int blockNum, char *data)
 {
-	QByteArray *block = _blockCache[blockNum];
+	if (!_file.seek((qint64)blockNum * (qint64)_blockSize))
-	if (!block) {
+		return false;
-		if (!_file.seek((qint64)blockNum * (qint64)_blockSize))
+	if (read(data, _blockSize) < _blockSize)
-			return false;
+		return false;
-		data.resize(_blockSize);
-		if (read(data.data(), _blockSize) < _blockSize)
-			return false;
-		_blockCache.insert(blockNum, new QByteArray(data));
-	} else
-		data = *block;
 
 	return true;
 }
-
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const IMG::Point &point)
-{
-	dbg.nospace() << "Point(" << hex << point.type << ", " << point.label
-	  << ", " << point.poi << ")";
-	return dbg.space();
-}
-
-QDebug operator<<(QDebug dbg, const IMG::Poly &poly)
-{
-	dbg.nospace() << "Poly(" << hex << poly.type << ", " << poly.label << ")";
-	return dbg.space();
-}
-#endif // QT_NO_DEBUG

src/map/IMG/img.h

@@ -1,96 +1,27 @@
 #ifndef IMG_H
 #define IMG_H
 
-#include <QRect>
 #include <QFile>
-#include <QByteArray>
+#include "mapdata.h"
-#include <QCache>
-#include <QDebug>
-#include "common/rtree.h"
-#include "common/rectc.h"
-#include "common/range.h"
-#include "style.h"
-#include "label.h"
 
-class VectorTile;
+class IMG : public MapData
-class SubFile;
-
-class IMG
 {
 public:
-	struct Poly {
-		/* QPointF insted of Coordinates for performance reasons (no need to
-		   duplicate all the vectors for drawing). Note, that we do not want to
-		   ll2xy() the points in the IMG class as this can not be done in
-		   parallel. */
-		QVector<QPointF> points;
-		Label label;
-		quint32 type;
-
-		bool operator<(const Poly &other) const
-		  {return type > other.type;}
-	};
-
-	struct Point {
-		Point() : id(0) {}
-
-		Coordinates coordinates;
-		Label label;
-		quint32 type;
-		bool poi;
-		quint64 id;
-
-		bool operator<(const Point &other) const
-		  {return id < other.id;}
-	};
-
-
 	IMG(const QString &fileName);
-	~IMG();
-
-	void load();
-	void clear();
 
 	QString fileName() const {return _file.fileName();}
-	const QString &name() const {return _name;}
-	const RectC &bounds() const {return _bounds;}
-
-	void objects(const RectC &rect, int bits, QList<Poly> *polygons,
-	  QList<Poly> *lines, QList<Point> *points);
-	const Style *style() const {return _style;}
-
-	bool isValid() const {return _valid;}
-	const QString &errorString() const {return _errorString;}
 
 private:
 	friend class SubFile;
 
-	typedef RTree<VectorTile*, double, 2> TileTree;
-
 	int blockSize() const {return _blockSize;}
-	bool readBlock(int blockNum, QByteArray &data);
+	bool readBlock(int blockNum, char *data);
 	qint64 read(char *data, qint64 maxSize);
 	template<class T> bool readValue(T &val);
-	bool init();
 
 	QFile _file;
 	quint8 _key;
 	int _blockSize;
-	QCache<int, QByteArray> _blockCache;
-
-	QString _name;
-	RectC _bounds;
-	TileTree _tileTree;
-	SubFile *_typ;
-	Style *_style;
-
-	bool _valid;
-	QString _errorString;
 };
 
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const IMG::Point &point);
-QDebug operator<<(QDebug dbg, const IMG::Poly &poly);
-#endif // QT_NO_DEBUG
-
 #endif // IMG_H

src/map/IMG/lblfile.cpp

@@ -50,17 +50,16 @@ static QString capitalize(const QString &str)
 }
 
 
-bool LBLFile::init()
+bool LBLFile::init(Handle &hdl)
 {
-	Handle hdl;
 	quint16 codepage;
 	quint8 multiplier, poiMultiplier;
 
 	if (!(seek(hdl, _gmpOffset + 0x15) && readUInt32(hdl, _offset)
-	  && readUInt32(hdl, _size) && readByte(hdl, multiplier)
+	  && readUInt32(hdl, _size) && readUInt8(hdl, multiplier)
-	  && readByte(hdl, _encoding) && seek(hdl, _gmpOffset + 0x57)
+	  && readUInt8(hdl, _encoding) && seek(hdl, _gmpOffset + 0x57)
 	  && readUInt32(hdl, _poiOffset) && readUInt32(hdl, _poiSize)
-	  && readByte(hdl, poiMultiplier) && seek(hdl, _gmpOffset + 0xAA)
+	  && readUInt8(hdl, poiMultiplier) && seek(hdl, _gmpOffset + 0xAA)
 	  && readUInt16(hdl, codepage)))
 		return false;
 
@@ -90,7 +89,7 @@ Label LBLFile::label6b(Handle &hdl, quint32 offset) const
 		return Label();
 
 	while (true) {
-		if (!(readByte(hdl, b1) && readByte(hdl, b2) && readByte(hdl, b3)))
+		if (!(readUInt8(hdl, b1) && readUInt8(hdl, b2) && readUInt8(hdl, b3)))
 			return Label();
 
 		int c[]= {b1>>2, (b1&0x3)<<4|b2>>4, (b2&0xF)<<2|b3>>6, b3&0x3F};
@@ -139,7 +138,7 @@ Label LBLFile::label8b(Handle &hdl, quint32 offset) const
 		return Label();
 
 	while (true) {
-		if (!readByte(hdl, c))
+		if (!readUInt8(hdl, c))
 			return Label();
 		if (!c || c == 0x1d)
 			break;
@@ -165,7 +164,7 @@ Label LBLFile::label8b(Handle &hdl, quint32 offset) const
 
 Label LBLFile::label(Handle &hdl, quint32 offset, bool poi)
 {
-	if (!_multiplier && !init())
+	if (!_multiplier && !init(hdl))
 		return QString();
 
 	quint32 labelOffset;

src/map/IMG/lblfile.h

@@ -12,6 +12,9 @@ public:
 	LBLFile(IMG *img)
 	  : SubFile(img), _codec(0), _offset(0), _size(0), _poiOffset(0),
 	  _poiSize(0), _poiMultiplier(0), _multiplier(0), _encoding(0) {}
+	LBLFile(const QString &path)
+	  : SubFile(path), _codec(0), _offset(0), _size(0), _poiOffset(0),
+	  _poiSize(0), _poiMultiplier(0), _multiplier(0), _encoding(0) {}
 	LBLFile(SubFile *gmp, quint32 offset) : SubFile(gmp, offset),
 	  _codec(0), _offset(0), _size(0), _poiOffset(0), _poiSize(0),
 	  _poiMultiplier(0), _multiplier(0), _encoding(0) {}
@@ -19,7 +22,7 @@ public:
 	Label label(Handle &hdl, quint32 offset, bool poi = false);
 
 private:
-	bool init();
+	bool init(Handle &hdl);
 
 	Label label6b(Handle &hdl, quint32 offset) const;
 	Label label8b(Handle &hdl, quint32 offset) const;

src/map/IMG/mapdata.cpp

@@ -0,0 +1,123 @@
+#include "common/programpaths.h"
+#include "vectortile.h"
+#include "style.h"
+#include "mapdata.h"
+
+
+#define CACHED_SUBDIVS_COUNT 2048 // ~32MB for both caches together
+
+struct PolyCTX
+{
+	PolyCTX(const RectC &rect, int bits, bool baseMap,
+	  QList<MapData::Poly> *polygons, QList<MapData::Poly> *lines,
+	  QCache<const SubDiv*, MapData::Polys> *polyCache)
+	  : rect(rect), bits(bits), baseMap(baseMap), polygons(polygons),
+	  lines(lines), polyCache(polyCache) {}
+
+	const RectC &rect;
+	int bits;
+	bool baseMap;
+	QList<MapData::Poly> *polygons;
+	QList<MapData::Poly> *lines;
+	QCache<const SubDiv*, MapData::Polys> *polyCache;
+};
+
+struct PointCTX
+{
+	PointCTX(const RectC &rect, int bits, bool baseMap,
+	  QList<MapData::Point> *points,
+	  QCache<const SubDiv*, QList<MapData::Point> > *pointCache)
+	  : rect(rect), bits(bits), baseMap(baseMap), points(points),
+	  pointCache(pointCache) {}
+
+	const RectC &rect;
+	int bits;
+	bool baseMap;
+	QList<MapData::Point> *points;
+	QCache<const SubDiv*, QList<MapData::Point> > *pointCache;
+};
+
+inline bool polyCb(VectorTile *tile, void *context)
+{
+	PolyCTX *ctx = (PolyCTX*)context;
+	tile->polys(ctx->rect, ctx->bits, ctx->baseMap, ctx->polygons, ctx->lines,
+	  ctx->polyCache);
+	return true;
+}
+
+inline bool pointCb(VectorTile *tile, void *context)
+{
+	PointCTX *ctx = (PointCTX*)context;
+	tile->points(ctx->rect, ctx->bits, ctx->baseMap, ctx->points,
+	  ctx->pointCache);
+	return true;
+}
+
+
+MapData::MapData() : _typ(0), _style(0), _baseMap(false), _valid(false)
+{
+	_polyCache.setMaxCost(CACHED_SUBDIVS_COUNT);
+	_pointCache.setMaxCost(CACHED_SUBDIVS_COUNT);
+}
+
+MapData::~MapData()
+{
+	TileTree::Iterator it;
+	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
+		delete _tileTree.GetAt(it);
+
+	delete _typ;
+	delete _style;
+}
+
+void MapData::polys(const RectC &rect, int bits, QList<Poly> *polygons,
+  QList<Poly> *lines)
+{
+	PolyCTX ctx(rect, bits, _baseMap, polygons, lines, &_polyCache);
+	double min[2], max[2];
+
+	min[0] = rect.left();
+	min[1] = rect.bottom();
+	max[0] = rect.right();
+	max[1] = rect.top();
+
+	_tileTree.Search(min, max, polyCb, &ctx);
+}
+
+void MapData::points(const RectC &rect, int bits, QList<Point> *points)
+{
+	PointCTX ctx(rect, bits, _baseMap, points, &_pointCache);
+	double min[2], max[2];
+
+	min[0] = rect.left();
+	min[1] = rect.bottom();
+	max[0] = rect.right();
+	max[1] = rect.top();
+
+	_tileTree.Search(min, max, pointCb, &ctx);
+}
+
+void MapData::load()
+{
+	Q_ASSERT(!_style);
+
+	if (_typ)
+		_style = new Style(_typ);
+	else {
+		SubFile typ(ProgramPaths::typFile());
+		_style = new Style(&typ);
+	}
+}
+
+void MapData::clear()
+{
+	TileTree::Iterator it;
+	for (_tileTree.GetFirst(it); !_tileTree.IsNull(it); _tileTree.GetNext(it))
+		_tileTree.GetAt(it)->clear();
+
+	delete _style;
+	_style = 0;
+
+	_polyCache.clear();
+	_pointCache.clear();
+}

src/map/IMG/mapdata.h

@@ -0,0 +1,107 @@
+#ifndef MAPDATA_H
+#define MAPDATA_H
+
+#include <QList>
+#include <QPointF>
+#include <QCache>
+#include <QDebug>
+#include "common/rectc.h"
+#include "common/rtree.h"
+#include "label.h"
+
+class Style;
+class SubDiv;
+class SubFile;
+class VectorTile;
+
+class MapData
+{
+public:
+	struct Poly {
+		/* QPointF insted of Coordinates for performance reasons (no need to
+		   duplicate all the vectors for drawing). Note, that we do not want to
+		   ll2xy() the points in the IMG class as this can not be done in
+		   parallel. */
+		QVector<QPointF> points;
+		Label label;
+		quint32 type;
+		RectC boundingRect;
+
+		bool operator<(const Poly &other) const
+		  {return type > other.type;}
+	};
+
+	struct Point {
+		Point() : id(0) {}
+
+		Coordinates coordinates;
+		Label label;
+		quint32 type;
+		bool poi;
+		quint64 id;
+
+		bool operator<(const Point &other) const
+		  {return id < other.id;}
+	};
+
+	struct Polys {
+		Polys() {}
+		Polys(const QList<Poly> &polygons, const QList<Poly> &lines)
+			: polygons(polygons), lines(lines) {}
+
+		QList<Poly> polygons;
+		QList<Poly> lines;
+	};
+
+	MapData();
+	virtual ~MapData();
+
+	const QString &name() const {return _name;}
+	const RectC &bounds() const {return _bounds;}
+	const Style *style() const {return _style;}
+	void polys(const RectC &rect, int bits, QList<Poly> *polygons,
+	  QList<Poly> *lines);
+	void points(const RectC &rect, int bits, QList<Point> *points);
+
+	void load();
+	void clear();
+
+	virtual QString fileName() const = 0;
+
+	bool isValid() const {return _valid;}
+	QString errorString() const {return _errorString;}
+
+protected:
+	typedef RTree<VectorTile*, double, 2> TileTree;
+
+	QString _name;
+	RectC _bounds;
+	SubFile *_typ;
+	Style *_style;
+	TileTree _tileTree;
+	bool _baseMap;
+
+	bool _valid;
+	QString _errorString;
+
+private:
+	QCache<const SubDiv*, Polys> _polyCache;
+	QCache<const SubDiv*, QList<Point> > _pointCache;
+};
+
+#ifndef QT_NO_DEBUG
+inline QDebug operator<<(QDebug dbg, const MapData::Point &point)
+{
+	dbg.nospace() << "Point(" << hex << point.type << ", " << point.label
+	  << ", " << point.poi << ")";
+	return dbg.space();
+}
+
+inline QDebug operator<<(QDebug dbg, const MapData::Poly &poly)
+{
+	dbg.nospace() << "Poly(" << hex << poly.type << ", " << poly.label << ")";
+	return dbg.space();
+}
+#endif // QT_NO_DEBUG
+
+#endif // MAPDATA_H

src/map/IMG/netfile.cpp

@@ -1,12 +1,13 @@
 #include "netfile.h"
 
-bool NETFile::init()
+bool NETFile::init(Handle &hdl)
 {
-	Handle hdl;
 	quint8 multiplier;
+	quint16 hdrLen;
 
-	if (!(seek(hdl, _gmpOffset + 0x15) && readUInt32(hdl, _offset)
+	if (!(seek(hdl, _gmpOffset) && readUInt16(hdl, hdrLen)
-	  && readUInt32(hdl, _size) && readByte(hdl, multiplier)))
+	  && seek(hdl, _gmpOffset + 0x15) && readUInt32(hdl, _offset)
+	  && readUInt32(hdl, _size) && readUInt8(hdl, multiplier)))
 		return false;
 
 	_multiplier = 1<<multiplier;
@@ -16,7 +17,7 @@ bool NETFile::init()
 
 bool NETFile::lblOffset(Handle &hdl, quint32 netOffset, quint32 &lblOffset)
 {
-	if (!_multiplier && !init())
+	if (!_multiplier && !init(hdl))
 		return false;
 
 	if (!(seek(hdl, _offset + netOffset * _multiplier)

src/map/IMG/netfile.h

@@ -6,17 +6,19 @@
 class NETFile : public SubFile
 {
 public:
-	NETFile(IMG *img) : SubFile(img), _offset(0), _size(0), _multiplier(0) {}
+	NETFile(IMG *img)
-	NETFile(SubFile *gmp, quint32 offset) : SubFile(gmp, offset),
+	  : SubFile(img), _offset(0), _size(0), _multiplier(0) {}
-	  _offset(0), _size(0), _multiplier(0) {}
+	NETFile(const QString &path)
+	  : SubFile(path), _offset(0), _size(0), _multiplier(0) {}
+	NETFile(SubFile *gmp, quint32 offset)
+	  : SubFile(gmp, offset), _offset(0), _size(0), _multiplier(0) {}
 
 	bool lblOffset(Handle &hdl, quint32 netOffset, quint32 &lblOffset);
 
 private:
-	bool init();
+	bool init(Handle &hdl);
 
-	quint32 _offset;
+	quint32 _offset, _size;
-	quint32 _size;
 	quint8 _multiplier;
 };
 

src/map/IMG/rgnfile.cpp

@@ -1,127 +1,84 @@
+#include <cstring>
 #include "common/rectc.h"
-#include "units.h"
+#include "common/garmin.h"
+#include "deltastream.h"
+#include "huffmanstream.h"
 #include "lblfile.h"
 #include "netfile.h"
 #include "rgnfile.h"
 
 
-static int bitSize(quint8 baseSize, bool variableSign, bool extraBit)
+bool RGNFile::skipClassFields(Handle &hdl) const
 {
-	int bits = 2;
+	quint8 flags;
-	if (baseSize <= 9)
+	quint32 rs;
-		bits += baseSize;
-	else
-		bits += 2 * baseSize - 9;
 
-	if (variableSign)
+	if (!readUInt8(hdl, flags))
-		bits++;
+		return false;
-	if (extraBit)
-		bits++;
 
-	return bits;
+	switch (flags >> 5) {
-}
+		case 4:
-
+			rs = 1;
-bool RGNFile::BitStream::read(int bits, quint32 &val)
+			break;
-{
+		case 5:
-	val = 0;
+			rs = 2;
-
+			break;
-	for (int pos = 0; pos < bits; ) {
+		case 6:
-		if (!_remaining) {
+			rs = 3;
-			if (!_length || !_file.readByte(_hdl, _data))
+			break;
-				return false;
+		case 7:
-			_remaining = 8;
+			if (!readVUInt32(hdl, rs))
-			_length--;
+				return false;
-		}
+			break;
-
+		default:
-		quint32 get = bits - pos;
+			rs = 0;
-		if (get >= _remaining) {
-			val |= _data << pos;
-			pos += _remaining;
-			_remaining = 0;
-		} else {
-			quint32 mask = (1<<get) - 1;
-			val |= (_data & mask)<<pos;
-			_data >>= get;
-			_remaining -= get;
 			break;
-		}
 	}
 
-	return true;
+	return seek(hdl, hdl.pos() + rs);
 }
 
-RGNFile::DeltaStream::DeltaStream(const SubFile &file, Handle &hdl,
+bool RGNFile::skipLclFields(Handle &hdl, const quint32 flags[3],
-  quint32 length, quint8 info, bool extraBit, bool extended)
+  SegmentType type) const
-  : BitStream(file, hdl, length), _readBits(0xFFFFFFFF)
 {
-	_extraBit = extraBit ? 1 : 0;
+	quint32 bitfield = 0xFFFFFFFF;
-	if (!(sign(_lonSign) && sign(_latSign)))
-		return;
-	if (extended) {
-		quint32 b;
-		if (!read(1, b))
-			return;
-	}
-	_lonBits = bitSize(info & 0x0F, !_lonSign, extraBit);
-	_latBits = bitSize(info >> 4, !_latSign, false);
-	_readBits = _lonBits + _latBits;
-}
 
-bool RGNFile::DeltaStream::readDelta(int bits, int sign, int extraBit,
+	if (flags[0] & 0x20000000)
-  qint32 &delta)
+		if (!readVBitfield32(hdl, bitfield))
-{
-	quint32 value;
-
-	if (!read(bits, value))
-		return false;
-
-	value >>= extraBit;
-
-	if (!sign) {
-		qint32 signMask = 1 << (bits - extraBit - 1);
-		if (value & signMask) {
-			qint32 comp = value ^ signMask;
-			if (comp)
-				delta = comp - signMask;
-			else {
-				qint32 other;
-				if (!readDelta(bits - extraBit, sign, false, other))
-					return false;
-				if (other < 0)
-					delta = 1 - signMask + other;
-				else
-					delta = signMask - 1 + other;
-			}
-		} else {
-			delta = value;
-		}
-	} else {
-		delta = value * sign;
-	}
-
-	return true;
-}
-
-bool RGNFile::DeltaStream::sign(int &val)
-{
-	quint32 bit;
-	val = 0;
-
-	if (!read(1, bit))
-		return false;
-	if (bit) {
-		if (!read(1, bit))
 			return false;
-		val = bit ? -1 : 1;
+
+	for (int i = 0; i < 29; i++) {
+		if ((flags[0] >> i) & 1) {
+			if (bitfield & 1) {
+				quint32 m = flags[(i >> 4) + 1] >> ((i * 2) & 0x1e) & 3;
+				switch (i) {
+					case 5:
+						if (m == 1 && type == Point) {
+							quint16 u16;
+							if (!readUInt16(hdl, u16))
+								return false;
+						}
+						break;
+					default:
+						break;
+				}
+			}
+			bitfield >>= 1;
+		}
 	}
 
 	return true;
 }
 
-
+void RGNFile::clearFlags()
-bool RGNFile::init()
+{
+	memset(_polygonsFlags, 0, sizeof(_polygonsFlags));
+	memset(_linesFlags, 0, sizeof(_linesFlags));
+	memset(_pointsFlags, 0, sizeof(_pointsFlags));
+}
+
+bool RGNFile::init(Handle &hdl)
 {
-	Handle hdl;
 	quint16 hdrLen;
 
 	if (!(seek(hdl, _gmpOffset) && readUInt16(hdl, hdrLen)
@@ -129,25 +86,29 @@ bool RGNFile::init()
 	  && readUInt32(hdl, _size)))
 		return false;
 
-	if (hdrLen >= 0x5D) {
+	if (hdrLen >= 0x68) {
 		if (!(readUInt32(hdl, _polygonsOffset) && readUInt32(hdl, _polygonsSize)
-		  && seek(hdl, _gmpOffset + 0x39) && readUInt32(hdl, _linesOffset)
+		  && seek(hdl, _gmpOffset + 0x2D) && readUInt32(hdl, _polygonsFlags[0])
-		  && readUInt32(hdl, _linesSize) && seek(hdl, _gmpOffset + 0x55)
+		  && readUInt32(hdl, _polygonsFlags[1]) && readUInt32(hdl, _polygonsFlags[2])
-		  && readUInt32(hdl, _pointsOffset) && readUInt32(hdl, _pointsSize)))
+		  && readUInt32(hdl, _linesOffset) && readUInt32(hdl, _linesSize)
+		  && seek(hdl, _gmpOffset + 0x49) && readUInt32(hdl, _linesFlags[0])
+		  && readUInt32(hdl, _linesFlags[1]) && readUInt32(hdl, _linesFlags[2])
+		  && readUInt32(hdl, _pointsOffset) && readUInt32(hdl, _pointsSize)
+		  && seek(hdl, _gmpOffset + 0x65) && readUInt32(hdl, _pointsFlags[0])
+		  && readUInt32(hdl, _pointsFlags[1]) && readUInt32(hdl, _pointsFlags[2])))
 			return false;
 	}
 
 	if (hdrLen >= 0x7D) {
-		quint32 dictOffset, dictSize;
+		quint32 dictOffset, dictSize, info;
 		if (!(seek(hdl, _gmpOffset + 0x71) && readUInt32(hdl, dictOffset)
-		  && readUInt32(hdl, dictSize)))
+		  && readUInt32(hdl, dictSize) && readUInt32(hdl, info)))
 			return false;
 
-		// NT maps
+		if (dictSize && dictOffset && (info & 0x1E))
-		if (dictSize || dictOffset) {
+			if (!_huffmanTable.load(*this, hdl, dictOffset, dictSize,
-			qWarning("NT compression not supported");
+			  ((info >> 1) & 0xF) - 1))
-			return false;
+				return false;
-		}
 	}
 
 	_init = true;
@@ -155,14 +116,16 @@ bool RGNFile::init()
 	return true;
 }
 
-bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
+bool RGNFile::polyObjects(Handle &hdl, const SubDiv *subdiv,
-  const Segment &segment, LBLFile *lbl, Handle &lblHdl, NETFile *net,
+  SegmentType segmentType, LBLFile *lbl, Handle &lblHdl, NETFile *net,
   Handle &netHdl, QList<IMG::Poly> *polys) const
 {
-	if (segment.start() == segment.end())
+	const SubDiv::Segment &segment = (segmentType == Line)
-		return true;
+	 ? subdiv->lines() : subdiv->polygons();
 
-	if (!seek(hdl, segment.start()))
+	if (!segment.isValid())
+		return true;
+	if (!seek(hdl, segment.offset()))
 		return false;
 
 	quint32 labelPtr;
@@ -170,31 +133,31 @@ bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 	qint16 lon, lat;
 	quint16 len;
 
-	while (hdl.pos < (int)segment.end()) {
+	while (hdl.pos() < (int)segment.end()) {
 		IMG::Poly poly;
 
-		if (!(readByte(hdl, type) && readUInt24(hdl, labelPtr)
+		if (!(readUInt8(hdl, type) && readUInt24(hdl, labelPtr)
 		  && readInt16(hdl, lon) && readInt16(hdl, lat)))
 			return false;
 		if (type & 0x80) {
 			if (!readUInt16(hdl, len))
 				return false;
 		} else {
-			if (!readByte(hdl, len8))
+			if (!readUInt8(hdl, len8))
 				return false;
 			len = len8;
 		}
-		if (!readByte(hdl, bitstreamInfo))
+		if (!readUInt8(hdl, bitstreamInfo))
 			return false;
 
-		poly.type = (segment.type() == Segment::Polygon)
+		poly.type = (segmentType == Polygon)
 		  ? ((quint32)(type & 0x7F)) << 8 : ((quint32)(type & 0x3F)) << 8;
 
 
 		QPoint pos(subdiv->lon() + ((qint32)lon<<(24-subdiv->bits())),
 		  subdiv->lat() + ((qint32)lat<<(24-subdiv->bits())));
-		Coordinates c(toWGS84(pos.x()), toWGS84(pos.y()));
+		Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
-		RectC br(c, c);
+		poly.boundingRect = RectC(c, c);
 		poly.points.append(QPointF(c.lon(), c.lat()));
 
 		qint32 lonDelta, latDelta;
@@ -204,16 +167,13 @@ bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 			pos.rx() += lonDelta<<(24-subdiv->bits());
 			pos.ry() += latDelta<<(24-subdiv->bits());
 
-			Coordinates c(toWGS84(pos.x()), toWGS84(pos.y()));
+			Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
 			poly.points.append(QPointF(c.lon(), c.lat()));
-			br = br.united(c);
+			poly.boundingRect = poly.boundingRect.united(c);
 		}
 		if (!(stream.atEnd() && stream.flush()))
 			return false;
 
-		if (!rect.intersects(br))
-			continue;
-
 		if (lbl && (labelPtr & 0x3FFFFF)) {
 			if (labelPtr & 0x800000) {
 				quint32 lblOff;
@@ -230,60 +190,96 @@ bool RGNFile::polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 	return true;
 }
 
-bool RGNFile::extPolyObjects(const RectC &rect, Handle &hdl,
+bool RGNFile::extPolyObjects(Handle &hdl, const SubDiv *subdiv, quint32 shift,
-  const SubDiv *subdiv, const Segment &segment, LBLFile *lbl, Handle &lblHdl,
+  SegmentType segmentType, LBLFile *lbl, Handle &lblHdl,
   QList<IMG::Poly> *polys) const
 {
-	quint32 len, labelPtr = 0;
+	quint32 labelPtr, len;
-	quint8 type, subtype, bitstreamInfo;
+	quint8 type, subtype;
 	qint16 lon, lat;
+	const SubDiv::Segment &segment = (segmentType == Line)
+	 ? subdiv->extLines() : subdiv->extPolygons();
 
 
-	if (!seek(hdl, segment.start()))
+	if (!segment.isValid())
+		return true;
+	if (!seek(hdl, segment.offset()))
 		return false;
 
-	while (hdl.pos < (int)segment.end()) {
+	while (hdl.pos() < (int)segment.end()) {
 		IMG::Poly poly;
+		QPoint pos;
 
-		if (!(readByte(hdl, type) && readByte(hdl, subtype)
+		if (!(readUInt8(hdl, type) && readUInt8(hdl, subtype)
 		  && readInt16(hdl, lon) && readInt16(hdl, lat)
-		  && readVUInt32(hdl, len) && readByte(hdl, bitstreamInfo)))
+		  && readVUInt32(hdl, len)))
 			return false;
 
-		if (subtype & 0x80) {
+		poly.type = 0x10000 | (quint16(type)<<8) | (subtype & 0x1F);
-			qWarning("Polygons/lines with extra bytes not supported");
+		labelPtr = 0;
-			return false;
-		}
 
-		poly.type = 0x10000 + (quint16(type) << 8) + (subtype & 0x1F);
+		if (!_huffmanTable.isNull()) {
+			pos = QPoint((subdiv->lon()<<8) + ((qint32)lon<<(32-subdiv->bits())),
+			  (subdiv->lat()<<8) + ((qint32)lat<<(32-subdiv->bits())));
 
-		QPoint pos(subdiv->lon() + ((qint32)lon<<(24-subdiv->bits())),
+			qint32 lonDelta, latDelta;
-		  subdiv->lat() + ((qint32)lat<<(24-subdiv->bits())));
+			HuffmanStream stream(*this, hdl, len, _huffmanTable,
-		Coordinates c(toWGS84(pos.x()), toWGS84(pos.y()));
+			  segmentType == Line);
-		RectC br(c, c);
-		poly.points.append(QPointF(c.lon(), c.lat()));
 
-		qint32 lonDelta, latDelta;
+			if (shift) {
-		DeltaStream stream(*this, hdl, len - 1, bitstreamInfo, false, true);
+				if (!stream.readOffset(lonDelta, latDelta))
-		while (stream.readNext(lonDelta, latDelta)) {
+					return false;
-			pos.rx() += lonDelta<<(24-subdiv->bits());
+				pos = QPoint(pos.x() | lonDelta<<(32-subdiv->bits()-shift),
-			pos.ry() += latDelta<<(24-subdiv->bits());
+				  pos.y() | latDelta<<(32-subdiv->bits()-shift));
-
+			}
-			Coordinates c(toWGS84(pos.x()), toWGS84(pos.y()));
+			Coordinates c(toWGS32(pos.x()), toWGS32(pos.y()));
+			poly.boundingRect = RectC(c, c);
 			poly.points.append(QPointF(c.lon(), c.lat()));
-			br = br.united(c);
-		}
-		if (!(stream.atEnd() && stream.flush()))
-			return false;
 
-		if ((subtype & 0x20)) {
+			while (stream.readNext(lonDelta, latDelta)) {
-			if (!readUInt24(hdl, labelPtr))
+				pos.rx() += lonDelta<<(32-subdiv->bits()-shift);
+				pos.ry() += latDelta<<(32-subdiv->bits()-shift);
+
+				Coordinates c(toWGS32(pos.x()), toWGS32(pos.y()));
+				poly.points.append(QPointF(c.lon(), c.lat()));
+				poly.boundingRect = poly.boundingRect.united(c);
+			}
+
+			if (!(stream.atEnd() && stream.flush()))
 				return false;
-		} else
+		} else {
-			labelPtr = 0;
+			pos = QPoint(subdiv->lon() + ((qint32)lon<<(24-subdiv->bits())),
+			  subdiv->lat() + ((qint32)lat<<(24-subdiv->bits())));
+			Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
+			poly.boundingRect = RectC(c, c);
+			poly.points.append(QPointF(c.lon(), c.lat()));
 
-		if (!rect.intersects(br))
+			quint8 bitstreamInfo;
-			continue;
+			if (!readUInt8(hdl, bitstreamInfo))
+				return false;
+
+			qint32 lonDelta, latDelta;
+			DeltaStream stream(*this, hdl, len - 1, bitstreamInfo, false, true);
+
+			while (stream.readNext(lonDelta, latDelta)) {
+				pos.rx() += lonDelta<<(24-subdiv->bits());
+				pos.ry() += latDelta<<(24-subdiv->bits());
+
+				Coordinates c(toWGS24(pos.x()), toWGS24(pos.y()));
+				poly.points.append(QPointF(c.lon(), c.lat()));
+				poly.boundingRect = poly.boundingRect.united(c);
+			}
+			if (!(stream.atEnd() && stream.flush()))
+				return false;
+		}
+
+		if (subtype & 0x20 && !readUInt24(hdl, labelPtr))
+			return false;
+		if (subtype & 0x80 && !skipClassFields(hdl))
+			return false;
+		if (subtype & 0x40 && !skipLclFields(hdl, segmentType == Line
+		  ? _linesFlags : _polygonsFlags, segmentType))
+			return false;
 
 		if (lbl && (labelPtr & 0x3FFFFF))
 			poly.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF);
@@ -294,45 +290,47 @@ bool RGNFile::extPolyObjects(const RectC &rect, Handle &hdl,
 	return true;
 }
 
-bool RGNFile::pointObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
+bool RGNFile::pointObjects(Handle &hdl, const SubDiv *subdiv,
-  const Segment &segment, LBLFile *lbl, Handle &lblHdl,
+  SegmentType segmentType, LBLFile *lbl, Handle &lblHdl,
   QList<IMG::Point> *points) const
 {
 	quint8 type, subtype;
 	qint16 lon, lat;
 	quint32 labelPtr;
+	const SubDiv::Segment &segment = (segmentType == IndexedPoint)
+	 ? subdiv->idxPoints() : subdiv->points();
 
-	if (!seek(hdl, segment.start()))
+	if (!segment.isValid())
+		return true;
+	if (!seek(hdl, segment.offset()))
 		return false;
 
-	while (hdl.pos < (int)segment.end()) {
+	while (hdl.pos() < (int)segment.end()) {
 		IMG::Point point;
 
-		if (!(readByte(hdl, type) && readUInt24(hdl, labelPtr)
+		if (!(readUInt8(hdl, type) && readUInt24(hdl, labelPtr)
 		  && readInt16(hdl, lon) && readInt16(hdl, lat)))
 			return false;
 		if (labelPtr & 0x800000) {
-			if (!readByte(hdl, subtype))
+			if (!readUInt8(hdl, subtype))
 				return false;
 		} else
 			subtype = 0;
 
 		point.type = (quint16)type<<8 | subtype;
 
-		qint16 lonOffset = lon<<(24-subdiv->bits());
+		qint32 lonOffset = lon<<(24-subdiv->bits());
-		qint16 latOffset = lat<<(24-subdiv->bits());
+		qint32 latOffset = lat<<(24-subdiv->bits());
-		point.coordinates = Coordinates(toWGS84(subdiv->lon() + lonOffset),
+		point.coordinates = Coordinates(toWGS24(subdiv->lon() + lonOffset),
-		  toWGS84(subdiv->lat() + latOffset));
+		  toWGS24(subdiv->lat() + latOffset));
-
-		if (!rect.contains(point.coordinates))
-			continue;
 
+		uint hash = qHash(QPair<uint,uint>(qHash(QPair<qint32, qint32>
+		  (subdiv->lon() + lonOffset, subdiv->lat() + latOffset)),
+		  labelPtr & 0x3FFFFF));
+		point.id = ((quint64)point.type)<<32 | hash;
 		point.poi = labelPtr & 0x400000;
-		if (lbl && (labelPtr & 0x3FFFFF)) {
+		if (lbl && (labelPtr & 0x3FFFFF))
 			point.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF, point.poi);
-			point.id = ((quint64)point.type)<<40 | ((quint64)lbl->offset())<<24
-			  | (labelPtr & 0x3FFFFF);
-		}
 
 		points->append(point);
 	}
@@ -340,167 +338,134 @@ bool RGNFile::pointObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
 	return true;
 }
 
-bool RGNFile::extPointObjects(const RectC &rect, Handle &hdl,
+bool RGNFile::extPointObjects(Handle &hdl, const SubDiv *subdiv, LBLFile *lbl,
-  const SubDiv *subdiv, const Segment &segment, LBLFile *lbl, Handle &lblHdl,
+  Handle &lblHdl, QList<IMG::Point> *points) const
-  QList<IMG::Point> *points) const
 {
 	quint8 type, subtype;
 	qint16 lon, lat;
 	quint32 labelPtr;
+	const SubDiv::Segment &segment = subdiv->extPoints();
 
-	if (!seek(hdl, segment.start()))
+
+	if (!segment.isValid())
+		return true;
+	if (!seek(hdl, segment.offset()))
 		return false;
 
-	while (hdl.pos < (int)segment.end()) {
+	while (hdl.pos() < (int)segment.end()) {
 		IMG::Point point;
 
-		if (!(readByte(hdl, type) && readByte(hdl, subtype)
+		if (!(readUInt8(hdl, type) && readUInt8(hdl, subtype)
 		  && readInt16(hdl, lon) && readInt16(hdl, lat)))
 			return false;
 
-		if (subtype & 0x80) {
-			qWarning("Points with extra bytes not supported");
-			return false;
-		}
-
 		point.type = 0x10000 | (((quint32)type)<<8) | (subtype & 0x1F);
 
-		qint16 lonOffset = lon<<(24-subdiv->bits());
+		qint32 lonOffset = lon<<(24-subdiv->bits());
-		qint16 latOffset = lat<<(24-subdiv->bits());
+		qint32 latOffset = lat<<(24-subdiv->bits());
-		point.coordinates = Coordinates(toWGS84(subdiv->lon() + lonOffset),
+		point.coordinates = Coordinates(toWGS24(subdiv->lon() + lonOffset),
-		  toWGS84(subdiv->lat() + latOffset));
+		  toWGS24(subdiv->lat() + latOffset));
+		labelPtr = 0;
 
-		if (subtype & 0x20) {
+		if (subtype & 0x20 && !readUInt24(hdl, labelPtr))
-			if (!readUInt24(hdl, labelPtr))
+			return false;
-				return false;
+		if (subtype & 0x80 && !skipClassFields(hdl))
-			point.poi = labelPtr & 0x400000;
+			return false;
-			if (lbl && (labelPtr & 0x3FFFFF)) {
+		if (subtype & 0x40 && !skipLclFields(hdl, _pointsFlags, Point))
-				point.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF, point.poi);
+			return false;
-				point.id = ((quint64)point.type)<<40
-				  | ((quint64)lbl->offset())<<24 | (labelPtr & 0x3FFFFF);
-			}
-		}
 
-		if (rect.contains(point.coordinates))
+		// Discard NT points breaking style draw order logic (and causing huge
-			points->append(point);
+		// performance drawback)
+		if (point.type == 0x11400)
+			continue;
+
+		uint hash = qHash(QPair<uint,uint>(qHash(QPair<qint32, qint32>
+		  (subdiv->lon() + lonOffset, subdiv->lat() + latOffset)),
+		  labelPtr & 0x3FFFFF));
+		point.id = ((quint64)point.type)<<32 | hash;
+		point.poi = labelPtr & 0x400000;
+		if (lbl && (labelPtr & 0x3FFFFF))
+			point.label = lbl->label(lblHdl, labelPtr & 0x3FFFFF, point.poi);
+
+		points->append(point);
 	}
 
 	return true;
 }
 
-
+QMap<RGNFile::SegmentType, SubDiv::Segment> RGNFile::segments(Handle &hdl,
-void RGNFile::objects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
+  SubDiv *subdiv) const
-  NETFile *net, QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
-  QList<IMG::Point> *points)
 {
-	Handle rgnHdl, lblHdl, netHdl;
+	QMap<SegmentType, SubDiv::Segment> ret;
 
-	if (!_init && !init())
+	if (subdiv->offset() == subdiv->end() || !(subdiv->objects() & 0x1F))
-		return;
+		return ret;
-
-	QVector<RGNFile::Segment> seg(segments(rgnHdl, subdiv));
-	for (int i = 0; i < seg.size(); i++) {
-		switch (seg.at(i).type()) {
-			case Segment::Point:
-			case Segment::IndexedPoint:
-				if (points)
-					pointObjects(rect, rgnHdl, subdiv, seg.at(i), lbl, lblHdl,
-					  points);
-				break;
-			case Segment::Line:
-				if (lines)
-					polyObjects(rect, rgnHdl, subdiv, seg.at(i), lbl, lblHdl,
-					  net, netHdl, lines);
-				break;
-			case Segment::Polygon:
-				if (polygons)
-					polyObjects(rect, rgnHdl, subdiv, seg.at(i), lbl, lblHdl,
-					  net, netHdl, polygons);
-				break;
-		}
-	}
-}
-
-void RGNFile::extObjects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
-  QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
-  QList<IMG::Point> *points)
-{
-	Handle rgnHdl, lblHdl;
-
-	if (!_init && !init())
-		return;
-
-	if (polygons && subdiv->polygonsOffset() != subdiv->polygonsEnd()) {
-		quint32 start = _polygonsOffset + subdiv->polygonsOffset();
-		quint32 end = subdiv->polygonsEnd()
-		  ? _polygonsOffset + subdiv->polygonsEnd()
-		  : _polygonsOffset + _polygonsSize;
-		extPolyObjects(rect, rgnHdl, subdiv, Segment(start, end,
-		  Segment::Polygon), lbl, lblHdl, polygons);
-	}
-	if (lines && subdiv->linesOffset() != subdiv->linesEnd()) {
-		quint32 start = _linesOffset + subdiv->linesOffset();
-		quint32 end = subdiv->linesEnd()
-		  ? _linesOffset + subdiv->linesEnd()
-		  : _linesOffset + _linesSize;
-		extPolyObjects(rect, rgnHdl, subdiv, Segment(start, end, Segment::Line),
-		  lbl, lblHdl, lines);
-	}
-	if (points && subdiv->pointsOffset() != subdiv->pointsEnd()) {
-		quint32 start = _pointsOffset + subdiv->pointsOffset();
-		quint32 end = subdiv->pointsEnd()
-		  ? _pointsOffset + subdiv->pointsEnd()
-		  : _pointsOffset + _pointsSize;
-		extPointObjects(rect, rgnHdl, subdiv, Segment(start, end,
-		  Segment::Point), lbl, lblHdl, points);
-	}
-}
-
-QVector<RGNFile::Segment> RGNFile::segments(Handle &hdl, const SubDiv *subdiv)
-  const
-{
-	if (subdiv->offset() == subdiv->end() || !(subdiv->objects() & 0xF0))
-		return QVector<Segment>();
 
 	quint32 offset = _offset + subdiv->offset();
 
 	int no = 0;
-	for (quint8 mask = 0x10; mask; mask <<= 1)
+	for (quint8 mask = 0x1; mask <= 0x10; mask <<= 1)
 		if (subdiv->objects() & mask)
 			no++;
 
 	if (!seek(hdl, offset))
-		return QVector<Segment>();
+		return ret;
 
-	QVector<Segment> ret;
 	quint32 start = offset + 2 * (no - 1);
-	quint16 po;
+	quint32 ls = 0;
-	int cnt = 0;
+	SegmentType lt = (SegmentType)0;
 
-	for (quint8 mask = 0x10; mask; mask <<= 1) {
+	for (quint16 mask = 0x1; mask <= 0x10; mask <<= 1) {
 		if (subdiv->objects() & mask) {
-			if (cnt) {
+			if (ls) {
-				if (!readUInt16(hdl, po))
+				quint16 po;
-					return QVector<Segment>();
+				if (!readUInt16(hdl, po) || !po)
+					return QMap<RGNFile::SegmentType, SubDiv::Segment>();
 				start = offset + po;
+				ret.insert(lt, SubDiv::Segment(ls, start));
 			}
-			if (!ret.isEmpty())
+
-				ret.last().setEnd(start);
+			lt = (SegmentType)mask;
-			ret.append(Segment(start, (Segment::Type)mask));
+			ls = start;
-			cnt++;
 		}
 	}
 
-	ret.last().setEnd(subdiv->end() ? _offset + subdiv->end() : _offset + _size);
+	ret.insert(lt, SubDiv::Segment(ls, subdiv->end()
+	  ? _offset + subdiv->end() : _offset + _size));
 
 	return ret;
 }
 
-#ifndef QT_NO_DEBUG
+bool RGNFile::subdivInit(Handle &hdl, SubDiv *subdiv) const
-QDebug operator<<(QDebug dbg, const RGNFile::Segment &segment)
 {
-	dbg.nospace() << "Segment(" << segment.start() << ", " << segment.end()
+	QMap<RGNFile::SegmentType, SubDiv::Segment> seg(segments(hdl, subdiv));
-	  << ", " << segment.type() << ")";
+	SubDiv::Segment extPoints, extLines, extPolygons;
-	return dbg.space();
+
+	if (subdiv->extPointsOffset() != subdiv->extPointsEnd()) {
+		quint32 start = _pointsOffset + subdiv->extPointsOffset();
+		quint32 end = subdiv->extPointsEnd()
+		  ? _pointsOffset + subdiv->extPointsEnd()
+		  : _pointsOffset + _pointsSize;
+		extPoints = SubDiv::Segment(start, end);
+	}
+	if (subdiv->extPolygonsOffset() != subdiv->extPolygonsEnd()) {
+		quint32 start = _polygonsOffset + subdiv->extPolygonsOffset();
+		quint32 end = subdiv->extPolygonsEnd()
+		  ? _polygonsOffset + subdiv->extPolygonsEnd()
+		  : _polygonsOffset + _polygonsSize;
+		extPolygons = SubDiv::Segment(start, end);
+	}
+	if (subdiv->extLinesOffset() != subdiv->extLinesEnd()) {
+		quint32 start = _linesOffset + subdiv->extLinesOffset();
+		quint32 end = subdiv->extLinesEnd()
+		  ? _linesOffset + subdiv->extLinesEnd()
+		  : _linesOffset + _linesSize;
+		extLines = SubDiv::Segment(start, end);
+	}
+
+	subdiv->init(seg.value(Point), seg.value(IndexedPoint), seg.value(Line),
+	  seg.value(Polygon), seg.value(RoadReference), extPoints, extLines,
+	  extPolygons);
+
+	return true;
 }
-#endif // QT_NO_DEBUG

src/map/IMG/rgnfile.h

@@ -4,6 +4,7 @@
 #include "img.h"
 #include "subfile.h"
 #include "subdiv.h"
+#include "huffmantable.h"
 
 class LBLFile;
 class NETFile;
@@ -11,121 +12,67 @@ class NETFile;
 class RGNFile : public SubFile
 {
 public:
+	enum SegmentType {
+		Point = 0x1,
+		IndexedPoint = 0x2,
+		Line = 0x4,
+		Polygon = 0x8,
+		RoadReference = 0x10
+	};
+
 	RGNFile(IMG *img)
 	  : SubFile(img), _offset(0), _size(0), _polygonsOffset(0),
 	  _polygonsSize(0), _linesOffset(0), _linesSize(0), _pointsOffset(0),
-	  _pointsSize(0), _init(false) {}
+	  _pointsSize(0), _init(false) {clearFlags();}
+	RGNFile(const QString &path)
+	  : SubFile(path), _offset(0), _size(0), _polygonsOffset(0),
+	  _polygonsSize(0), _linesOffset(0), _linesSize(0), _pointsOffset(0),
+	  _pointsSize(0), _init(false) {clearFlags();}
 	RGNFile(SubFile *gmp, quint32 offset) : SubFile(gmp, offset), _offset(0),
 	  _size(0), _polygonsOffset(0), _polygonsSize(0), _linesOffset(0),
-	  _linesSize(0), _pointsOffset(0), _pointsSize(0), _init(false) {}
+	  _linesSize(0), _pointsOffset(0), _pointsSize(0), _init(false)
+	  {clearFlags();}
 
-	void objects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
+	bool initialized() const {return _init;}
-	  NETFile *net, QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
+	bool init(Handle &hdl);
-	  QList<IMG::Point> *points);
+
-	void extObjects(const RectC &rect, const SubDiv *subdiv, LBLFile *lbl,
+	bool polyObjects(Handle &hdl, const SubDiv *subdiv, SegmentType segmentType,
-	  QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
+	  LBLFile *lbl, Handle &lblHdl, NETFile *net, Handle &netHdl,
-	  QList<IMG::Point> *points);
+	  QList<IMG::Poly> *polys) const;
+	bool pointObjects(Handle &hdl, const SubDiv *subdiv, SegmentType segmentType,
+	  LBLFile *lbl, Handle &lblHdl, QList<IMG::Point> *points) const;
+	bool extPolyObjects(Handle &hdl, const SubDiv *subdiv, quint32 shift,
+	  SegmentType segmentType, LBLFile *lbl, Handle &lblHdl,
+	  QList<IMG::Poly> *polys) const;
+	bool extPointObjects(Handle &hdl, const SubDiv *subdiv, LBLFile *lbl,
+	  Handle &lblHdl, QList<IMG::Point> *points) const;
+
+	bool subdivInit(Handle &hdl, SubDiv *subdiv) const;
 
 private:
-	class Segment {
+	QMap<SegmentType, SubDiv::Segment> segments(Handle &hdl, SubDiv *subdiv)
-	public:
+	  const;
-		enum Type {
+	void clearFlags();
-			Point = 0x10,
+	bool skipClassFields(Handle &hdl) const;
-			IndexedPoint = 0x20,
+	bool skipLclFields(Handle &hdl, const quint32 flags[3], SegmentType type)
-			Line = 0x40,
+	  const;
-			Polygon = 0x80
-		};
-
-		Segment() : _start(0), _end(0), _type(Point) {}
-		Segment(quint32 start, Type type)
-		  : _start(start), _end(0), _type(type) {}
-		Segment(quint32 start, quint32 end, Type type)
-		  : _start(start), _end(end), _type(type) {}
-
-		void setEnd(quint32 end) {_end = end;}
-
-		quint32 start() const {return _start;}
-		quint32 end() const {return _end;}
-		Type type() const {return _type;}
-
-	private:
-		quint32 _start;
-		quint32 _end;
-		Type _type;
-	};
-
-	class BitStream {
-	public:
-		BitStream(const SubFile &file, Handle &hdl, quint32 length)
-		  : _file(file), _hdl(hdl), _length(length), _remaining(0) {}
-
-		bool read(int bits, quint32 &val);
-		bool flush() {return _file.seek(_hdl, _hdl.pos + _length);}
-		quint32 bitsAvailable() const {return _length * 8 + _remaining;}
-
-	private:
-		const SubFile &_file;
-		Handle &_hdl;
-		quint32 _length, _remaining;
-		quint8 _data;
-	};
-
-	class DeltaStream : public BitStream {
-	public:
-		DeltaStream(const SubFile &file, Handle &hdl, quint32 length,
-		  quint8 info, bool extraBit, bool extended);
-
-		bool readNext(qint32 &lonDelta, qint32 &latDelta)
-		{
-			return hasNext()
-			  ? (readDelta(_lonBits, _lonSign, _extraBit, lonDelta)
-				  && readDelta(_latBits, _latSign, false, latDelta))
-			  : false;
-		}
-		bool atEnd() const {return (_readBits != 0xFFFFFFFF && !hasNext());}
-
-	private:
-		bool hasNext() const {return bitsAvailable() >= _readBits;}
-		bool sign(int &val);
-		bool readDelta(int bits, int sign, int extraBit, qint32 &delta);
-
-		int _lonSign, _latSign, _extraBit;
-		quint32 _lonBits, _latBits, _readBits;
-	};
-
-	bool init();
-
-	QVector<Segment> segments(Handle &hdl, const SubDiv *subdiv) const;
-	bool polyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-	  const Segment &segment, LBLFile *lbl, Handle &lblHdl, NETFile *net,
-	  Handle &netHdl, QList<IMG::Poly> *polys) const;
-	bool pointObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-	  const Segment &segment, LBLFile *lbl, Handle &lblHdl,
-	  QList<IMG::Point> *points) const;
-	bool extPolyObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-	  const Segment &segment, LBLFile *lbl, Handle &lblHdl,
-	  QList<IMG::Poly> *polys) const;
-	bool extPointObjects(const RectC &rect, Handle &hdl, const SubDiv *subdiv,
-	  const Segment &segment, LBLFile *lbl, Handle &lblHdl,
-	  QList<IMG::Point> *points) const;
-
-	friend QDebug operator<<(QDebug dbg, const RGNFile::Segment &segment);
 
 	quint32 _offset;
 	quint32 _size;
 
 	quint32 _polygonsOffset;
 	quint32 _polygonsSize;
+	quint32 _polygonsFlags[3];
 	quint32 _linesOffset;
 	quint32 _linesSize;
+	quint32 _linesFlags[3];
 	quint32 _pointsOffset;
 	quint32 _pointsSize;
+	quint32 _pointsFlags[3];
+
+	HuffmanTable _huffmanTable;
 
 	bool _init;
 };
 
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const RGNFile::Segment &segment);
-#endif // QT_NO_DEBUG
-
 #endif // RGNFILE_H

src/map/IMG/style.cpp

@@ -1,72 +1,69 @@
 #include <QImage>
 #include "style.h"
 
-#define TYPE(t) ((t)<<8)
 
 void Style::defaultPolygonStyle()
 {
-	_polygons[TYPE(0x01)] = Style::Polygon(QBrush("#dfd3b5"));
+	_polygons[TYPE(0x01)] = Polygon(QBrush("#dfd3b5"));
-	_polygons[TYPE(0x02)] = Style::Polygon(QBrush("#dfd3b5"));
+	_polygons[TYPE(0x02)] = Polygon(QBrush("#dfd3b5"));
-	_polygons[TYPE(0x03)] = Style::Polygon(QBrush("#dfd3b5"));
+	_polygons[TYPE(0x03)] = Polygon(QBrush("#dfd3b5"));
-	_polygons[TYPE(0x04)] = Style::Polygon(QBrush("#ff4040", Qt::BDiagPattern));
+	_polygons[TYPE(0x04)] = Polygon(QBrush("#ff4040", Qt::BDiagPattern));
-	_polygons[TYPE(0x05)] = Style::Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x05)] = Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x06)] = Style::Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x06)] = Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x07)] = Style::Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x07)] = Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x08)] = Style::Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x08)] = Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x09)] = Style::Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x09)] = Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x0a)] = Style::Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x0a)] = Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x0b)] = Style::Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x0b)] = Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x0c)] = Style::Polygon(QBrush("#d6d4ce"));
+	_polygons[TYPE(0x0c)] = Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x0d)] = Style::Polygon(QBrush("#f8e3be"));
+	_polygons[TYPE(0x0d)] = Polygon(QBrush("#f8e3be"));
-	_polygons[TYPE(0x0e)] = Style::Polygon(QBrush("#ffffff"));
+	_polygons[TYPE(0x0e)] = Polygon(QBrush("#ffffff"));
-	_polygons[TYPE(0x0f)] = Style::Polygon(QBrush("#e6e2d9"));
+	_polygons[TYPE(0x0f)] = Polygon(QBrush("#e6e2d9"));
-	_polygons[TYPE(0x10)] = Style::Polygon(QBrush("#e6e2d9"));
+	_polygons[TYPE(0x10)] = Polygon(QBrush("#e6e2d9"));
-	_polygons[TYPE(0x11)] = Style::Polygon(QBrush("#e6e2d9"));
+	_polygons[TYPE(0x11)] = Polygon(QBrush("#e6e2d9"));
-	_polygons[TYPE(0x12)] = Style::Polygon(QBrush("#e6e2d9"));
+	_polygons[TYPE(0x12)] = Polygon(QBrush("#e6e2d9"));
-	_polygons[TYPE(0x13)] = Style::Polygon(QBrush("#dbd0b6"),
+	_polygons[TYPE(0x13)] = Polygon(QBrush("#dbd0b6"),
 	  QPen(QColor("#cdccc4"), 1));
-	_polygons[TYPE(0x14)] = Style::Polygon(QBrush(QColor("#9ac269"),
+	_polygons[TYPE(0x14)] = Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x15)] = Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x16)] = Polygon(QBrush(QColor("#9ac269"),
 	  Qt::BDiagPattern));
-	_polygons[TYPE(0x15)] = Style::Polygon(QBrush(QColor("#9ac269"),
+	_polygons[TYPE(0x17)] = Polygon(QBrush("#d4ebb8"));
-	  Qt::BDiagPattern));
+	_polygons[TYPE(0x18)] = Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x16)] = Style::Polygon(QBrush(QColor("#9ac269"),
+	_polygons[TYPE(0x19)] = Polygon(QBrush("#e3edc6"), QPen("#c9d3a5"));
-	  Qt::BDiagPattern));
+	_polygons[TYPE(0x1a)] = Polygon(QBrush("#000000", Qt::Dense6Pattern),
-	_polygons[TYPE(0x17)] = Style::Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x18)] = Style::Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x19)] = Style::Polygon(QBrush("#d6d4ce"));
-	_polygons[TYPE(0x1a)] = Style::Polygon(QBrush("#000000", Qt::Dense6Pattern),
 	  QPen(QColor("#cdccc4"), 1));
-	_polygons[TYPE(0x1e)] = Style::Polygon(QBrush(QColor("#9ac269"),
+	_polygons[TYPE(0x1e)] = Polygon(QBrush(QColor("#9ac269"),
 	  Qt::BDiagPattern));
-	_polygons[TYPE(0x1f)] = Style::Polygon(QBrush(QColor("#9ac269"),
+	_polygons[TYPE(0x1f)] = Polygon(QBrush(QColor("#9ac269"),
 	  Qt::BDiagPattern));
-	_polygons[TYPE(0x28)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x28)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x29)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x29)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x32)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x32)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3b)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3b)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3c)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3c)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3d)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3d)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3e)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3e)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x3f)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x3f)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x40)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x40)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x41)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x41)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x42)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x42)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x43)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x43)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x44)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x44)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x45)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x45)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x46)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x46)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x47)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x47)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x48)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x48)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x49)] = Style::Polygon(QBrush("#9fc4e1"));
+	_polygons[TYPE(0x49)] = Polygon(QBrush("#9fc4e1"));
-	_polygons[TYPE(0x4b)] = Style::Polygon(QBrush("#f1f0e5"), QPen("#f1f0e5"));
+	_polygons[TYPE(0x4b)] = Polygon(QBrush("#f1f0e5"), QPen("#f1f0e5"));
-	_polygons[TYPE(0x4a)] = Style::Polygon(QBrush("#f1f0e5"), QPen("#f1f0e5"));
+	_polygons[TYPE(0x4a)] = Polygon(QBrush("#f1f0e5"), QPen("#f1f0e5"));
-	_polygons[TYPE(0x4c)] = Style::Polygon(QBrush("#9fc4e1", Qt::Dense6Pattern));
+	_polygons[TYPE(0x4c)] = Polygon(QBrush("#9fc4e1", Qt::Dense6Pattern));
-	_polygons[TYPE(0x4d)] = Style::Polygon(QBrush("#ddf1fd"));
+	_polygons[TYPE(0x4d)] = Polygon(QBrush("#ddf1fd"));
-	_polygons[TYPE(0x4e)] = Style::Polygon(QBrush("#e3edc1"));
+	_polygons[TYPE(0x4e)] = Polygon(QBrush("#e3edc1"));
-	_polygons[TYPE(0x4f)] = Style::Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x4f)] = Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x50)] = Style::Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x50)] = Polygon(QBrush("#d4ebb8"));
-	_polygons[TYPE(0x51)] = Style::Polygon(QBrush("#9fc4e1", Qt::Dense4Pattern));
+	_polygons[TYPE(0x51)] = Polygon(QBrush("#9fc4e1", Qt::Dense4Pattern));
-	_polygons[TYPE(0x52)] = Style::Polygon(QBrush("#d4ebb8"));
+	_polygons[TYPE(0x52)] = Polygon(QBrush("#d4ebb8"));
 
 	_drawOrder << TYPE(0x4b) << TYPE(0x4a) << TYPE(0x01) << TYPE(0x02)
 	  << TYPE(0x03) << TYPE(0x17) << TYPE(0x18) << TYPE(0x19) << TYPE(0x1a)
@@ -89,71 +86,69 @@ void Style::defaultLineStyle()
 	QPen rr(QColor("#717171"), 3, Qt::CustomDashLine);
 	rr.setDashPattern(pattern);
 
-	_lines[TYPE(0x01)] = Style::Line(QPen(QColor("#9bd772"), 2, Qt::SolidLine),
+	_lines[TYPE(0x01)] = Line(QPen(QColor("#9bd772"), 2, Qt::SolidLine),
 	  QPen(QColor("#72a35a"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x02)] = Style::Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
+	_lines[TYPE(0x02)] = Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
 	  QPen(QColor("#e8a541"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x03)] = Style::Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
+	_lines[TYPE(0x03)] = Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
 	  QPen(QColor("#e8a541"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x04)] = Style::Line(QPen(QColor("#faef75"), 3, Qt::SolidLine),
+	_lines[TYPE(0x04)] = Line(QPen(QColor("#faef75"), 3, Qt::SolidLine),
 	  QPen(QColor("#dbd27b"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x05)] = Style::Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
+	_lines[TYPE(0x05)] = Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x06)] = Style::Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
+	_lines[TYPE(0x06)] = Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x07)] = Style::Line(QPen(QColor("#ffffff"), 2, Qt::SolidLine),
+	_lines[TYPE(0x07)] = Line(QPen(QColor("#ffffff"), 2, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 4, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x08)] = Style::Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
+	_lines[TYPE(0x08)] = Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
 	  QPen(QColor("#e8a541"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x09)] = Style::Line(QPen(QColor("#9bd772"), 2, Qt::SolidLine),
+	_lines[TYPE(0x09)] = Line(QPen(QColor("#9bd772"), 2, Qt::SolidLine),
 	  QPen(QColor("#72a35a"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x0a)] = Style::Line(QPen(QColor("#aba083"), 1, Qt::DashLine));
+	_lines[TYPE(0x0a)] = Line(QPen(QColor("#aba083"), 1, Qt::DashLine));
-	_lines[TYPE(0x0b)] = Style::Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
+	_lines[TYPE(0x0b)] = Line(QPen(QColor("#ffcc78"), 2, Qt::SolidLine),
 	  QPen(QColor("#e8a541"), 6, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x0c)] = Style::Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
+	_lines[TYPE(0x0c)] = Line(QPen(QColor("#ffffff"), 3, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x14)] = Style::Line(rr, QPen(Qt::white, 3, Qt::SolidLine,
+	_lines[TYPE(0x14)] = Line(rr, QPen(Qt::white, 3, Qt::SolidLine,
 	  Qt::RoundCap, Qt::RoundJoin));
-	_lines[TYPE(0x16)] = Style::Line(QPen(QColor("#aba083"), 1, Qt::DotLine));
+	_lines[TYPE(0x16)] = Line(QPen(QColor("#aba083"), 1, Qt::DotLine));
-	_lines[TYPE(0x18)] = Style::Line(QPen(QColor("#9fc4e1"), 2, Qt::SolidLine));
+	_lines[TYPE(0x18)] = Line(QPen(QColor("#9fc4e1"), 2, Qt::SolidLine));
 	_lines[TYPE(0x18)].setTextColor(QColor("#9fc4e1"));
-	//_lines[TYPE(0x1a)] = Style::Line(QPen(QColor("#7697b7"), 1, Qt::DashLine));
+	//_lines[TYPE(0x1a)] = Line(QPen(QColor("#7697b7"), 1, Qt::DashLine));
-	_lines[TYPE(0x1b)] = Style::Line(QPen(QColor("#7697b7"), 1, Qt::DashLine));
+	_lines[TYPE(0x1b)] = Line(QPen(QColor("#7697b7"), 1, Qt::DashLine));
-	_lines[TYPE(0x1e)] = Style::Line(QPen(QColor("#505145"), 2, Qt::DashDotLine));
+	_lines[TYPE(0x1e)] = Line(QPen(QColor("#505145"), 2, Qt::DashDotLine));
-	_lines[TYPE(0x1f)] = Style::Line(QPen(QColor("#9fc4e1"), 3, Qt::SolidLine));
+	_lines[TYPE(0x1f)] = Line(QPen(QColor("#9fc4e1"), 3, Qt::SolidLine));
 	_lines[TYPE(0x1f)].setTextColor(QColor("#9fc4e1"));
-	_lines[TYPE(0x20)] = Style::Line(QPen(QColor("#cacfc0"), 1, Qt::SolidLine));
+	_lines[TYPE(0x20)] = Line(QPen(QColor("#cfcfcf"), 1, Qt::SolidLine));
-	_lines[TYPE(0x20)].setTextColor(QColor("#62695a"));
+	_lines[TYPE(0x20)].setTextFontSize(None);
-	_lines[TYPE(0x20)].setTextFontSize(Style::Small);
+	_lines[TYPE(0x21)] = Line(QPen(QColor("#bfbfbf"), 1, Qt::SolidLine));
-	_lines[TYPE(0x21)] = Style::Line(QPen(QColor("#cacfc0"), 1.5, Qt::SolidLine));
+	_lines[TYPE(0x21)].setTextColor(QColor("#666666"));
-	_lines[TYPE(0x21)].setTextColor(QColor("#62695a"));
+	_lines[TYPE(0x21)].setTextFontSize(Small);
-	_lines[TYPE(0x21)].setTextFontSize(Style::Small);
+	_lines[TYPE(0x22)] = Line(QPen(QColor("#afafaf"), 1, Qt::SolidLine));
-	_lines[TYPE(0x22)] = Style::Line(QPen(QColor("#cacfc0"), 2, Qt::SolidLine));
+	_lines[TYPE(0x22)].setTextColor(QColor("#666666"));
-	_lines[TYPE(0x22)].setTextColor(QColor("#62695a"));
+	_lines[TYPE(0x22)].setTextFontSize(Small);
-	_lines[TYPE(0x22)].setTextFontSize(Style::Small);
+	_lines[TYPE(0x23)] = Line(QPen(QColor("#55aaff"), 1, Qt::SolidLine));
-	_lines[TYPE(0x23)] = Style::Line(QPen(QColor("#55aaff"), 1, Qt::SolidLine));
+	_lines[TYPE(0x23)].setTextFontSize(None);
-	_lines[TYPE(0x23)].setTextColor(QColor("#55aaff"));
+	_lines[TYPE(0x24)] = Line(QPen(QColor("#659aef"), 1, Qt::SolidLine));
-	_lines[TYPE(0x23)].setTextFontSize(Style::Small);
+	_lines[TYPE(0x24)].setTextColor(QColor("#558adf"));
-	_lines[TYPE(0x24)] = Style::Line(QPen(QColor("#55aaff"), 1.5, Qt::SolidLine));
+	_lines[TYPE(0x24)].setTextFontSize(Small);
-	_lines[TYPE(0x24)].setTextColor(QColor("#55aaff"));
+	_lines[TYPE(0x25)] = Line(QPen(QColor("#558adf"), 1, Qt::SolidLine));
-	_lines[TYPE(0x24)].setTextFontSize(Style::Small);
+	_lines[TYPE(0x25)].setTextColor(QColor("#558adf"));
-	_lines[TYPE(0x25)] = Style::Line(QPen(QColor("#55aaff"), 2, Qt::SolidLine));
+	_lines[TYPE(0x25)].setTextFontSize(Small);
-	_lines[TYPE(0x25)].setTextColor(QColor("#55aaff"));
+	_lines[TYPE(0x26)] = Line(QPen(QColor("#9fc4e1"), 2, Qt::DotLine));
-	_lines[TYPE(0x25)].setTextFontSize(Style::Small);
+	_lines[TYPE(0x27)] = Line(QPen(QColor("#ffffff"), 4, Qt::SolidLine),
-	_lines[TYPE(0x26)] = Style::Line(QPen(QColor("#9fc4e1"), 2, Qt::DotLine));
-	_lines[TYPE(0x27)] = Style::Line(QPen(QColor("#ffffff"), 4, Qt::SolidLine),
 	  QPen(QColor("#d5cdc0"), 5, Qt::SolidLine, Qt::RoundCap, Qt::RoundJoin));
-	//_lines[TYPE(0x28)] = Style::Line(QPen(QColor("#5a5a5a"), 1, Qt::SolidLine));
+	//_lines[TYPE(0x28)] = Line(QPen(QColor("#5a5a5a"), 1, Qt::SolidLine));
-	_lines[TYPE(0x29)] = Style::Line(QPen(QColor("#5a5a5a"), 1, Qt::SolidLine));
+	_lines[TYPE(0x29)] = Line(QPen(QColor("#5a5a5a"), 1, Qt::SolidLine));
-	_lines[TYPE(0x29)].setTextFontSize(Style::None);
+	_lines[TYPE(0x29)].setTextFontSize(None);
 }
 
 void Style::defaultPointStyle()
 {
 	// Cities
-	_points[TYPE(0x01)].setTextFontSize(Style::Large);
+	_points[TYPE(0x01)].setTextFontSize(Large);
-	_points[TYPE(0x02)].setTextFontSize(Style::Large);
+	_points[TYPE(0x02)].setTextFontSize(Large);
-	_points[TYPE(0x03)].setTextFontSize(Style::Large);
+	_points[TYPE(0x03)].setTextFontSize(Large);
 
 	// POI
 	_points[0x2a00] = Point(QImage(":/restaurant-11.png"));
@@ -294,7 +289,7 @@ static bool readBitmap(SubFile *file, SubFile::Handle &hdl, QImage &img,
 	for (int y = 0; y < img.height(); y++) {
 		for (int x = 0; x < img.width(); x += 8/bpp) {
 			quint8 color;
-			if (!file->readByte(hdl, color))
+			if (!file->readUInt8(hdl, color))
 				return false;
 
 			for (int i = 0; i < 8/bpp && x + i < img.width(); i++) {
@@ -319,8 +314,8 @@ static bool readColor(SubFile *file, SubFile::Handle &hdl, QColor &color)
 {
 	quint8 b, g, r;
 
-	if (!(file->readByte(hdl, b) && file->readByte(hdl, g)
+	if (!(file->readUInt8(hdl, b) && file->readUInt8(hdl, g)
-	  && file->readByte(hdl, r)))
+	  && file->readUInt8(hdl, r)))
 		return false;
 
 	color = qRgb(r, g, b);
@@ -333,20 +328,20 @@ static bool skipLocalization(SubFile *file, SubFile::Handle &hdl)
 	quint8 t8;
 	quint16 len;
 
-	if (!file->readByte(hdl, t8))
+	if (!file->readUInt8(hdl, t8))
 		return false;
 	len = t8;
 
 	if (len & 0x01)
 		len = len >> 1;
 	else {
-		if (!file->readByte(hdl, t8))
+		if (!file->readUInt8(hdl, t8))
 			return false;
 		len = (((quint16)t8) << 8) | len;
 		len = len >> 2;
 	}
 
-	if (!file->seek(hdl, hdl.pos + len))
+	if (!file->seek(hdl, hdl.pos() + len))
 		return false;
 
 	return true;
@@ -361,7 +356,7 @@ bool Style::itemInfo(SubFile *file, SubFile::Handle &hdl,
 
 	if (section.arrayItemSize == 5) {
 		if (!(file->readUInt16(hdl, t16_1) && file->readUInt16(hdl, t16_2)
-		  && file->readByte(hdl, t8)))
+		  && file->readUInt8(hdl, t8)))
 			return false;
 		info.offset = t16_2 | (t8<<16);
 	} else if (section.arrayItemSize == 4) {
@@ -369,7 +364,7 @@ bool Style::itemInfo(SubFile *file, SubFile::Handle &hdl,
 			return false;
 		info.offset = t16_2;
 	} else if (section.arrayItemSize == 3) {
-		if (!(file->readUInt16(hdl, t16_1) && file->readByte(hdl, t8)))
+		if (!(file->readUInt16(hdl, t16_1) && file->readUInt8(hdl, t8)))
 			return false;
 		info.offset = t8;
 	} else
@@ -400,7 +395,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 
 		quint8 t8, flags;
 		if (!(file->seek(hdl, section.offset + info.offset)
-		  && file->readByte(hdl, t8)))
+		  && file->readUInt8(hdl, t8)))
 			return false;
 		flags = t8 & 0x0F;
 
@@ -412,14 +407,14 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!(readColor(file, hdl, c1) && readColor(file, hdl, c2)
 				  && readColor(file, hdl, c3) && readColor(file, hdl, c4)))
 					return false;
-				_polygons[type] = Style::Polygon(QBrush(c1), QPen(c3, 2));
+				_polygons[type] = Polygon(QBrush(c1), QPen(c3, 2));
 				break;
 
 			case 0x06:
 			case 0x07:
 				if (!readColor(file, hdl, c1))
 					return false;
-				_polygons[type] = Style::Polygon(QBrush(c1));
+				_polygons[type] = Polygon(QBrush(c1));
 				break;
 
 			case 0x08:
@@ -432,7 +427,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			case 0x09:
@@ -446,7 +441,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			case 0x0B:
@@ -462,7 +457,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			case 0x0E:
@@ -475,7 +470,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			case 0x0F:
@@ -488,7 +483,7 @@ bool Style::parsePolygons(SubFile *file, SubFile::Handle &hdl,
 				if (!readBitmap(file, hdl, img, 1))
 					return false;
 
-				_polygons[type] = Style::Polygon(QBrush(img));
+				_polygons[type] = Polygon(QBrush(img));
 				break;
 
 			default:
@@ -516,7 +511,7 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 
 		quint8 t8_1, t8_2, flags, rows;
 		if (!(file->seek(hdl, section.offset + info.offset)
-		  && file->readByte(hdl, t8_1) && file->readByte(hdl, t8_2)))
+		  && file->readUInt8(hdl, t8_1) && file->readUInt8(hdl, t8_2)))
 			return false;
 		flags = t8_1 & 0x07;
 		rows = t8_1 >> 3;
@@ -539,16 +534,16 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!(file->readByte(hdl, w1) && file->readByte(hdl, w2)))
+					if (!(file->readUInt8(hdl, w1) && file->readUInt8(hdl, w2)))
 						return false;
 
 					_lines[type] = (w2 > w1)
-					  ? Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  ? Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin), QPen(c2, w2, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin))
-					  : Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  : Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin));
 				}
 				break;
@@ -566,16 +561,16 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!(file->readByte(hdl, w1) && file->readByte(hdl, w2)))
+					if (!(file->readUInt8(hdl, w1) && file->readUInt8(hdl, w2)))
 						return false;
 
 					_lines[type] = (w2 > w1)
-					  ? Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  ? Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin), QPen(c2, w2, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin))
-					  : Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  : Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin));
 				}
 				break;
@@ -593,12 +588,12 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!(file->readByte(hdl, w1) && file->readByte(hdl, w2)))
+					if (!(file->readUInt8(hdl, w1) && file->readUInt8(hdl, w2)))
 						return false;
 
-					_lines[type] = Style::Line(QPen(c1, w1, Qt::SolidLine,
+					_lines[type] = Line(QPen(c1, w1, Qt::SolidLine,
 					  Qt::RoundCap, Qt::RoundJoin));
 				}
 				break;
@@ -616,16 +611,16 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!(file->readByte(hdl, w1) && file->readByte(hdl, w2)))
+					if (!(file->readUInt8(hdl, w1) && file->readUInt8(hdl, w2)))
 						return false;
 
 					_lines[type] = (w2 > w1)
-					  ? Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  ? Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin), QPen(c2, w2, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin))
-					  : Style::Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
+					  : Line(QPen(c1, w1, Qt::SolidLine, Qt::RoundCap,
 						Qt::RoundJoin));
 				}
 				break;
@@ -642,12 +637,12 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!file->readByte(hdl, w1))
+					if (!file->readUInt8(hdl, w1))
 						return false;
 
-					_lines[type] = Style::Line(QPen(c1, w1, Qt::SolidLine,
+					_lines[type] = Line(QPen(c1, w1, Qt::SolidLine,
 					  Qt::RoundCap, Qt::RoundJoin));
 				}
 				break;
@@ -664,12 +659,12 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 					if (!readBitmap(file, hdl, img, 1))
 						return false;
 
-					_lines[type] = Style::Line(img);
+					_lines[type] = Line(img);
 				} else {
-					if (!file->readByte(hdl, w1))
+					if (!file->readUInt8(hdl, w1))
 						return false;
 
-					_lines[type] = Style::Line(QPen(c1, w1, Qt::SolidLine,
+					_lines[type] = Line(QPen(c1, w1, Qt::SolidLine,
 					  Qt::RoundCap, Qt::RoundJoin));
 				}
 				break;
@@ -689,7 +684,7 @@ bool Style::parseLines(SubFile *file, SubFile::Handle &hdl,
 
 		if (textColor) {
 			quint8 labelFlags;
-			if (!file->readByte(hdl, labelFlags))
+			if (!file->readUInt8(hdl, labelFlags))
 				return false;
 			if (labelFlags & 0x08) {
 				if (!readColor(file, hdl, c1))
@@ -751,7 +746,7 @@ static bool readColorTable(SubFile *file, SubFile::Handle &hdl, QImage& img,
 
 		for (int i = 0; i < colors; i++) {
 			while (bits < 28) {
-				if (!file->readByte(hdl, byte))
+				if (!file->readUInt8(hdl, byte))
 					return false;
 
 				mask = 0x000000FF << bits;
@@ -801,9 +796,9 @@ bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
 
 		quint8 t8_1, width, height, numColors, imgType;
 		if (!(file->seek(hdl, section.offset + info.offset)
-		  && file->readByte(hdl, t8_1) && file->readByte(hdl, width)
+		  && file->readUInt8(hdl, t8_1) && file->readUInt8(hdl, width)
-		  && file->readByte(hdl, height) && file->readByte(hdl, numColors)
+		  && file->readUInt8(hdl, height) && file->readUInt8(hdl, numColors)
-		  && file->readByte(hdl, imgType)))
+		  && file->readUInt8(hdl, imgType)))
 			return false;
 
 		bool localization = t8_1 & 0x04;
@@ -820,8 +815,8 @@ bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
 		_points[type] = Point(img);
 
 		if (t8_1 == 0x03) {
-			if (!(file->readByte(hdl, numColors)
+			if (!(file->readUInt8(hdl, numColors)
-			  && file->readByte(hdl, imgType)))
+			  && file->readUInt8(hdl, imgType)))
 				return false;
 			if ((bpp = colors2bpp(numColors, imgType)) < 0)
 				continue;
@@ -830,8 +825,8 @@ bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
 			if (!readBitmap(file, hdl, img, bpp))
 				return false;
 		} else if (t8_1 == 0x02) {
-			if (!(file->readByte(hdl, numColors)
+			if (!(file->readUInt8(hdl, numColors)
-			  && file->readByte(hdl, imgType)))
+			  && file->readUInt8(hdl, imgType)))
 				return false;
 			if ((bpp = colors2bpp(numColors, imgType)) < 0)
 				continue;
@@ -845,7 +840,7 @@ bool Style::parsePoints(SubFile *file, SubFile::Handle &hdl,
 		if (textColor) {
 			quint8 labelFlags;
 			QColor color;
-			if (!file->readByte(hdl, labelFlags))
+			if (!file->readUInt8(hdl, labelFlags))
 				return false;
 			if (labelFlags & 0x08) {
 				if (!readColor(file, hdl, color))
@@ -874,7 +869,7 @@ bool Style::parseDrawOrder(SubFile *file, SubFile::Handle &hdl,
 		quint8 type;
 		quint32 subtype;
 
-		if (!(file->readByte(hdl, type) && file->readUInt32(hdl, subtype)))
+		if (!(file->readUInt8(hdl, type) && file->readUInt32(hdl, subtype)))
 			return false;
 
 		if (!subtype)
@@ -895,7 +890,7 @@ bool Style::parseDrawOrder(SubFile *file, SubFile::Handle &hdl,
 
 bool Style::parseTYPFile(SubFile *file)
 {
-	SubFile::Handle hdl;
+	SubFile::Handle hdl(file);
 	Section points, lines, polygons, order;
 	quint16 tmp16, codepage;
 
@@ -966,31 +961,10 @@ const Style::Point &Style::point(quint32 type) const
 {
 	static Point null;
 
-	QMap<quint16, Point>::const_iterator it = _points.find(type);
+	QMap<quint32, Point>::const_iterator it = _points.find(type);
 	return (it == _points.constEnd()) ? null : *it;
 }
 
-bool Style::isContourLine(quint32 type)
-{
-	return (type == TYPE(0x20) || type == TYPE(0x21) || type == TYPE(0x22)
-	  || type == TYPE(0x23) || type == TYPE(0x24) || type == TYPE(0x25));
-}
-
-bool Style::isSpot(quint32 type)
-{
-	return (type == TYPE(0x62) || type == TYPE(0x63));
-}
-
-bool Style::isSummit(quint32 type)
-{
-	return (type == 0x6616);
-}
-
-bool Style::isMajorRoad(quint32 type)
-{
-	return (type <= TYPE(0x04));
-}
-
 Style::POIClass Style::poiClass(quint32 type)
 {
 	if ((type >= 0x2a00 && type < 0x2b00) || type == 0x2c0a || type == 0x2d02)
@@ -1041,4 +1015,11 @@ QDebug operator<<(QDebug dbg, const Style::Line &line)
 	  << penColor(line.background()) << ", " << !line.img().isNull() << ")";
 	return dbg.space();
 }
+
+QDebug operator<<(QDebug dbg, const Style::Point &point)
+{
+	dbg.nospace() << "Point(" << point.textFontSize() << ", "
+	  << point.textColor() << ", " << !point.img().isNull() << ")";
+	return dbg.space();
+}
 #endif // QT_NO_DEBUG

src/map/IMG/style.h

@@ -6,6 +6,7 @@
 #include <QDebug>
 #include "subfile.h"
 
+#define TYPE(t) ((t)<<8)
 
 class Style
 {
@@ -47,6 +48,7 @@ public:
 	private:
 		QBrush _brush;
 		QPen _pen;
+		QColor _textColor;
 	};
 
 	class Line {
@@ -80,6 +82,8 @@ public:
 	class Point {
 	public:
 		Point() : _textFontSize(NotSet) {}
+		Point(FontSize fontSize, const QColor &textColor = QColor())
+		  : _textColor(textColor), _textFontSize(fontSize) {}
 		Point(const QImage &img) : _textFontSize(NotSet), _img(img) {}
 
 		void setTextColor(const QColor &color) {_textColor = color;}
@@ -103,10 +107,22 @@ public:
 	const Point &point(quint32 type) const;
 	const QList<quint32> &drawOrder() const {return _drawOrder;}
 
-	static bool isContourLine(quint32 type);
+	static bool isContourLine(quint32 type)
-	static bool isSpot(quint32 type);
+	  {return ((type >= TYPE(0x20) && type <= TYPE(0x25))
-	static bool isSummit(quint32 type);
+	  || (type & 0xffff00) == TYPE(0x109));}
-	static bool isMajorRoad(quint32 type);
+	static bool isWaterArea(quint32 type)
+	  {return (type >= TYPE(0x3c) && type <= TYPE(0x44));}
+	static bool isMilitaryArea(quint32 type)
+	  {return (type == TYPE(0x04));}
+	static bool isNatureReserve(quint32 type)
+	  {return (type == TYPE(0x16));}
+	static bool isSpot(quint32 type)
+	  {return (type == TYPE(0x62) || type == TYPE(0x63));}
+	static bool isSummit(quint32 type)
+	  {return (type == 0x6616);}
+	static bool isMajorRoad(quint32 type)
+	  {return (type <= TYPE(0x04));}
+
 	static POIClass poiClass(quint32 type);
 
 private:
@@ -142,13 +158,14 @@ private:
 
 	QMap<quint32, Line> _lines;
 	QMap<quint32, Polygon> _polygons;
-	QMap<quint16, Point> _points;
+	QMap<quint32, Point> _points;
 	QList<quint32> _drawOrder;
 };
 
 #ifndef QT_NO_DEBUG
 QDebug operator<<(QDebug dbg, const Style::Polygon &polygon);
 QDebug operator<<(QDebug dbg, const Style::Line &line);
+QDebug operator<<(QDebug dbg, const Style::Point &point);
 #endif // QT_NO_DEBUG
 
 #endif // STYLE_H

src/map/IMG/subdiv.h

@@ -3,59 +3,151 @@
 
 #include <QtGlobal>
 #include "common/coordinates.h"
-#include "units.h"
+#include "common/garmin.h"
 
 class SubDiv {
 public:
-	SubDiv(quint32 offset, qint32 lon, qint32 lat, int bits, quint8 objects)
+	class Segment {
-	  : _offset(offset), _end(0), _lon(lon), _lat(lat), _bits(bits),
+	public:
-	  _objects(objects), _polygonsOffset(0), _polygonsEnd(0), _linesOffset(0),
+		Segment() : _offset(0), _end(0) {}
-	  _linesEnd(0), _pointsOffset(0), _pointsEnd(0) {}
+		Segment(quint32 ofset, quint32 end) : _offset(ofset), _end(end) {}
-	void setEnd(quint32 end) {_end = end;}
+
+		bool isValid() const {return (_end > _offset);}
+
+		quint32 offset() const {return _offset;}
+		quint32 end() const {return _end;}
+
+	private:
+		quint32 _offset, _end;
+	};
+
+	SubDiv(quint32 offset, qint32 lon, qint32 lat, int bits, quint8 objects)
+	  : _lon(lon), _lat(lat), _bits(bits), _init(false)
+	{
+		_tre.objects = objects;
+		_tre.offset = offset;
+		_tre.end = 0;
+
+		_tre.extPolygonsOffset = 0;
+		_tre.extPolygonsEnd = 0;
+		_tre.extLinesOffset = 0;
+		_tre.extLinesEnd = 0;
+		_tre.extPointsOffset = 0;
+		_tre.extPointsEnd = 0;
+	}
+	void setEnd(quint32 end) {_tre.end = end;}
+	void setExtOffsets(quint32 polygon, quint32 line, quint32 point)
+	{
+		_tre.extPolygonsOffset = polygon;
+		_tre.extLinesOffset = line;
+		_tre.extPointsOffset = point;
+	}
+	void setExtEnds(quint32 polygon, quint32 line, quint32 point)
+	{
+		_tre.extPolygonsEnd = polygon;
+		_tre.extLinesEnd = line;
+		_tre.extPointsEnd = point;
+	}
+
+	void init(const Segment &points, const Segment &idxPoints,
+	  const Segment &lines, const Segment &polygons,
+	  const Segment &roadReferences, const Segment &extPoints,
+	  const Segment &extLines, const Segment &extPolygons)
+	{
+		_rgn.pointsOffset = points.offset();
+		_rgn.pointsEnd = points.end();
+		_rgn.idxPointsOffset = idxPoints.offset();
+		_rgn.idxPointsEnd = idxPoints.end();
+		_rgn.linesOffset = lines.offset();
+		_rgn.linesEnd = lines.end();
+		_rgn.polygonsOffset = polygons.offset();
+		_rgn.polygonsEnd = polygons.end();
+		_rgn.roadReferencesOffset = roadReferences.offset();
+		_rgn.roadReferencesEnd = roadReferences.end();
+		_rgn.extPointsOffset = extPoints.offset();
+		_rgn.extPointsEnd = extPoints.end();
+		_rgn.extLinesOffset = extLines.offset();
+		_rgn.extLinesEnd = extLines.end();
+		_rgn.extPolygonsOffset = extPolygons.offset();
+		_rgn.extPolygonsEnd = extPolygons.end();
+
+		_init = true;
+	}
+	bool initialized() const {return _init;}
 
-	quint32 offset() const {return _offset;}
-	quint32 end() const {return _end;}
 	qint32 lon() const {return _lon;}
 	qint32 lat() const {return _lat;}
 	quint8 bits() const {return _bits;}
-	quint8 objects() const {return _objects;}
 
-	// Extended types objects (TRE7)
+	// Valid only after initialization
-	void setExtOffsets(quint32 polygon, quint32 line, quint32 point)
+	Segment points() const
-	  {_polygonsOffset = polygon; _linesOffset = line; _pointsOffset = point;}
+	  {return Segment(_rgn.pointsOffset, _rgn.pointsEnd);}
-	void setExtEnds(quint32 polygon, quint32 line, quint32 point)
+	Segment idxPoints() const
-	  {_polygonsEnd = polygon; _linesEnd = line; _pointsEnd = point;}
+	  {return Segment(_rgn.idxPointsOffset, _rgn.idxPointsEnd);}
+	Segment lines() const
+	  {return Segment(_rgn.linesOffset, _rgn.linesEnd);}
+	Segment polygons() const
+	  {return Segment(_rgn.polygonsOffset, _rgn.polygonsEnd);}
+	Segment extPoints() const
+	  {return Segment(_rgn.extPointsOffset, _rgn.extPointsEnd);}
+	Segment extLines() const
+	  {return Segment(_rgn.extLinesOffset, _rgn.extLinesEnd);}
+	Segment extPolygons() const
+	  {return Segment(_rgn.extPolygonsOffset, _rgn.extPolygonsEnd);}
 
-	quint32 polygonsOffset() const {return _polygonsOffset;}
+	// Valid only until initialization
-	quint32 polygonsEnd() const {return _polygonsEnd;}
+	quint8 objects() const {return _tre.objects;}
-	quint32 linesOffset() const {return _linesOffset;}
+	quint32 offset() const {return _tre.offset;}
-	quint32 linesEnd() const {return _linesEnd;}
+	quint32 end() const {return _tre.end;}
-	quint32 pointsOffset() const {return _pointsOffset;}
+	quint32 extPolygonsOffset() const {return _tre.extPolygonsOffset;}
-	quint32 pointsEnd() const {return _pointsEnd;}
+	quint32 extPolygonsEnd() const {return _tre.extPolygonsEnd;}
+	quint32 extLinesOffset() const {return _tre.extLinesOffset;}
+	quint32 extLinesEnd() const {return _tre.extLinesEnd;}
+	quint32 extPointsOffset() const {return _tre.extPointsOffset;}
+	quint32 extPointsEnd() const {return _tre.extPointsEnd;}
 
 private:
-	quint32 _offset;
+	struct TRE
-	quint32 _end;
+	{
+		quint8 objects;
+		quint32 offset;
+		quint32 end;
+
+		quint32 extPolygonsOffset;
+		quint32 extPolygonsEnd;
+		quint32 extLinesOffset;
+		quint32 extLinesEnd;
+		quint32 extPointsOffset;
+		quint32 extPointsEnd;
+	};
+
+	struct RGN
+	{
+		quint32 pointsOffset;
+		quint32 pointsEnd;
+		quint32 idxPointsOffset;
+		quint32 idxPointsEnd;
+		quint32 linesOffset;
+		quint32 linesEnd;
+		quint32 polygonsOffset;
+		quint32 polygonsEnd;
+		quint32 roadReferencesOffset;
+		quint32 roadReferencesEnd;
+		quint32 extPointsOffset;
+		quint32 extPointsEnd;
+		quint32 extLinesOffset;
+		quint32 extLinesEnd;
+		quint32 extPolygonsOffset;
+		quint32 extPolygonsEnd;
+	};
+
 	qint32 _lon, _lat;
 	quint8 _bits;
-	quint8 _objects;
+	bool _init;
-
+	union {
-	quint32 _polygonsOffset;
+		TRE _tre;
-	quint32 _polygonsEnd;
+		RGN _rgn;
-	quint32 _linesOffset;
+	};
-	quint32 _linesEnd;
-	quint32 _pointsOffset;
-	quint32 _pointsEnd;
 };
 
-#ifndef QT_NO_DEBUG
-inline QDebug operator<<(QDebug dbg, const SubDiv &subdiv)
-{
-	Coordinates c(toWGS84(subdiv.lon()), toWGS84(subdiv.lat()));
-	dbg.nospace() << "SubDiv(" << c << ", " << subdiv.offset()
-	  << ", " << subdiv.end() << ", " << subdiv.objects() << ")";
-	return dbg.space();
-}
-#endif // QT_NO_DEBUG
-
 #endif // SUBDIV_H

src/map/IMG/subfile.cpp

@@ -2,70 +2,43 @@
 #include "img.h"
 #include "subfile.h"
 
-SubFile::Type SubFile::type(const char str[3])
-{
-	if (!memcmp(str, "TRE", 3))
-		return TRE;
-	else if (!memcmp(str, "RGN", 3))
-		return RGN;
-	else if (!memcmp(str, "LBL", 3))
-		return LBL;
-	else if (!memcmp(str, "TYP", 3))
-		return TYP;
-	else if (!memcmp(str, "GMP", 3))
-		return GMP;
-	else if (!memcmp(str, "NET", 3))
-		return NET;
-	else
-		return Unknown;
-}
-
-SubFile::SubFile(QFile *file) :_gmpOffset(0), _img(0), _file(file), _blocks(0)
-{
-	if (!_file->open(QIODevice::ReadOnly))
-		qWarning("Error opening %s: %s", qPrintable(_file->fileName()),
-		  qPrintable(_file->errorString()));
-}
 
 bool SubFile::seek(Handle &handle, quint32 pos) const
 {
-	Q_ASSERT(_img || _file);
+	if (handle._file) {
+		int blockNum = pos / BLOCK_SIZE;
 
-	if (_file)
+		if (handle._blockNum != blockNum) {
-		return _file->seek(pos);
+			if (!handle._file->seek((qint64)blockNum * BLOCK_SIZE))
-	else {
+				return false;
+			if (handle._file->read(handle._data.data(), BLOCK_SIZE) < 0)
+				return false;
+			handle._blockNum = blockNum;
+		}
+
+		handle._blockPos = pos % BLOCK_SIZE;
+		handle._pos = pos;
+
+		return true;
+	} else {
 		quint32 blockSize = _img->blockSize();
 		int blockNum = pos / blockSize;
 
-		if (handle.blockNum != blockNum) {
+		if (handle._blockNum != blockNum) {
 			if (blockNum >= _blocks->size())
 				return false;
-			if (!_img->readBlock(_blocks->at(blockNum), handle.data))
+			if (!_img->readBlock(_blocks->at(blockNum), handle._data.data()))
 				return false;
-			handle.blockNum = blockNum;
+			handle._blockNum = blockNum;
 		}
 
-		handle.blockPos = pos % blockSize;
+		handle._blockPos = pos % blockSize;
-		handle.pos = pos;
+		handle._pos = pos;
 
 		return true;
 	}
 }
 
-bool SubFile::readByte(Handle &handle, quint8 &val) const
-{
-	Q_ASSERT(_img || _file);
-
-	if (_file)
-		return _file->getChar((char*)&val);
-	else {
-		val = handle.data.at(handle.blockPos++);
-		handle.pos++;
-		return (handle.blockPos >= _img->blockSize())
-		  ? seek(handle, handle.pos) : true;
-	}
-}
-
 bool SubFile::readVUInt32(Handle &hdl, quint32 &val) const
 {
 	quint8 bytes, shift, b;
@@ -97,24 +70,31 @@ bool SubFile::readVUInt32(Handle &hdl, quint32 &val) const
 	return true;
 }
 
-QString SubFile::fileName() const
+bool SubFile::readVBitfield32(Handle &hdl, quint32 &bitfield) const
 {
-	return _file ? _file->fileName() : _img->fileName();
+	quint8 bits;
-}
 
-#ifndef QT_NO_DEBUG
+	if (!readUInt8(hdl, bits))
-QDebug operator<<(QDebug dbg, const SubFile &file)
+		return false;
-{
+
-	bool continuous = true;
+	if (!(bits & 1)) {
-	for (int i = 1; i < file._blocks->size(); i++) {
+		seek(hdl, hdl._pos - 1);
-		if (file._blocks->at(i) != file._blocks->at(i-1) + 1) {
+		if (!((bits>>1) & 1)) {
-			continuous = false;
+			if (!((bits>>2) & 1)) {
-			break;
+				if (!readUInt32(hdl, bitfield))
+					return false;
+			} else {
+				if (!readUInt24(hdl, bitfield))
+					return false;
+			}
+			bitfield >>= 3;
+		} else {
+			if (!readUInt16(hdl, bitfield))
+				return false;
+			bitfield >>= 2;
 		}
-	}
+	} else
+		bitfield = bits>>1;
 
-	dbg.nospace() << "SubFile(" << file._blocks->size() << ", "
+	return true;
-	  << continuous << ")";
-	return dbg.space();
 }
-#endif // QT_NO_DEBUG

src/map/IMG/subfile.h

@@ -3,37 +3,74 @@
 
 #include <QVector>
 #include <QDebug>
+#include <QFile>
+#include "img.h"
 
-class IMG;
+
-class QFile;
+#define BLOCK_SIZE 4096
 
 class SubFile
 {
 public:
 	enum Type {Unknown, TRE, RGN, LBL, NET, TYP, GMP};
 
-	struct Handle
+	class Handle
 	{
-		Handle() : blockNum(-1), blockPos(-1), pos(-1) {}
+	public:
+		Handle(const SubFile *subFile)
+		  : _file(0), _blockNum(-1), _blockPos(-1), _pos(-1)
+		{
+			if (subFile && subFile->_path) {
+				_file = new QFile(*(subFile->_path));
+				_file->open(QIODevice::ReadOnly);
+				_data.resize(BLOCK_SIZE);
+			} else if (subFile)
+				_data.resize(subFile->_img->blockSize());
+		}
+		~Handle() {delete _file;}
 
-		QByteArray data;
+		int pos() const {return _pos;}
-		int blockNum;
+
-		int blockPos;
+	private:
-		int pos;
+		friend class SubFile;
+
+		QFile *_file;
+		QByteArray _data;
+		int _blockNum;
+		int _blockPos;
+		int _pos;
 	};
 
-	SubFile(IMG *img) : _gmpOffset(0), _img(img), _file(0),
+	SubFile(IMG *img)
-	  _blocks(&_blockData) {}
+	  : _gmpOffset(0), _img(img), _blocks(new QVector<quint16>()), _path(0) {}
 	SubFile(SubFile *gmp, quint32 offset) : _gmpOffset(offset), _img(gmp->_img),
-	  _file(0), _blocks(&(gmp->_blockData)) {}
+	  _blocks(gmp->_blocks), _path(gmp->_path) {}
-	SubFile(QFile *file);
+	SubFile(const QString &path)
+	  : _gmpOffset(0), _img(0), _blocks(0), _path(new QString(path)) {}
+	~SubFile()
+	{
+		if (!_gmpOffset) {
+			delete _blocks;
+			delete _path;
+		}
+	}
 
 	void addBlock(quint16 block) {_blocks->append(block);}
 
 	bool seek(Handle &handle, quint32 pos) const;
-	bool readByte(Handle &handle, quint8 &val) const;
 
-	bool readUInt16(Handle &handle, quint16 &val) const
+	template<typename T>
+	bool readUInt8(Handle &handle, T &val) const
+	{
+		quint8 b;
+		if (!readByte(handle, b))
+			return false;
+		val = b;
+		return true;
+	}
+
+	template<typename T>
+	bool readUInt16(Handle &handle, T &val) const
 	{
 		quint8 b0, b1;
 		if (!(readByte(handle, b0) && readByte(handle, b1)))
@@ -81,32 +118,41 @@ public:
 		return true;
 	}
 
-	bool readVUInt32(Handle &hdl, quint32 &val) const;
+	bool readVUInt32SW(Handle &hdl, quint32 bytes, quint32 &val) const
-
-	quint16 offset() const {return _blocks->first();}
-	QString fileName() const;
-
-	static Type type(const char str[3]);
-	static bool isTileFile(Type type)
 	{
-		return (type == TRE || type == LBL || type == RGN || type == NET
+		quint8 b;
-		  || type == GMP);
+
+		val = 0;
+		for (quint32 i = bytes; i; i--) {
+			if (!readByte(hdl, b))
+				return false;
+			val |= ((quint32)b) << ((i-1) * 8);
+		}
+
+		return true;
 	}
 
-	friend QDebug operator<<(QDebug dbg, const SubFile &file);
+	bool readVUInt32(Handle &hdl, quint32 &val) const;
+	bool readVBitfield32(Handle &hdl, quint32 &bitfield) const;
+
+	QString fileName() const {return _path ? *_path : _img->fileName();}
 
 protected:
 	quint32 _gmpOffset;
 
 private:
+	bool readByte(Handle &handle, quint8 &val) const
+	{
+		int blockSize = _img ? _img->blockSize() : BLOCK_SIZE;
+		val = handle._data.at(handle._blockPos++);
+		handle._pos++;
+		return (handle._blockPos >= blockSize)
+		  ? seek(handle, handle._pos) : true;
+	}
+
 	IMG *_img;
-	QFile *_file;
 	QVector<quint16> *_blocks;
-	QVector<quint16> _blockData;
+	QString *_path;
 };
 
-#ifndef QT_NO_DEBUG
-QDebug operator<<(QDebug dbg, const SubFile &file);
-#endif // QT_NO_DEBUG
-
 #endif // SUBFILE_H

src/map/IMG/textpathitem.cpp

@@ -100,6 +100,8 @@ static QPainterPath textPath(const QPolygonF &path, qreal textWidth,
   qreal charWidth, const QRectF &tileRect)
 {
 	QList<QLineF> lines(lineString(path, tileRect));
+	if (lines.isEmpty())
+		return QPainterPath();
 	qreal length = 0;
 	qreal angle = lines.first().angle();
 	int last = 0;

src/map/IMG/trefile.cpp

@@ -1,9 +1,9 @@
+#include "common/garmin.h"
 #include "subdiv.h"
-#include "units.h"
 #include "trefile.h"
 
 
-static void unlock(quint8 *dst, const quint8 *src, quint32 size, quint32 key)
+static void demangle(quint8 *data, quint32 size, quint32 key)
 {
 	static const unsigned char shuf[] = {
 		0xb, 0xc, 0xa, 0x0,
@@ -15,8 +15,8 @@ static void unlock(quint8 *dst, const quint8 *src, quint32 size, quint32 key)
 	int sum = shuf[((key >> 24) + (key >> 16) + (key >> 8) + key) & 0xf];
 
 	for (quint32 i = 0, ringctr = 16; i < size; i++) {
-		quint32 upper = src[i] >> 4;
+		quint32 upper = data[i] >> 4;
-		quint32 lower = src[i];
+		quint32 lower = data[i];
 
 		upper -= sum;
 		upper -= key >> ringctr;
@@ -28,7 +28,7 @@ static void unlock(quint8 *dst, const quint8 *src, quint32 size, quint32 key)
 		lower -= shuf[(key >> ringctr) & 0xf];
 		ringctr = ringctr ? ringctr - 4 : 16;
 
-		dst[i] = ((upper << 4) & 0xf0) | (lower & 0xf);
+		data[i] = ((upper << 4) & 0xf0) | (lower & 0xf);
 	}
 }
 
@@ -37,14 +37,14 @@ TREFile::~TREFile()
 	clear();
 }
 
-bool TREFile::init()
+bool TREFile::init(bool baseMap)
 {
-	Handle hdl;
+	Handle hdl(this);
 	quint8 locked;
 	quint16 hdrLen;
 
 	if (!(seek(hdl, _gmpOffset) && readUInt16(hdl, hdrLen)
-	  && seek(hdl, _gmpOffset + 0x0D) && readByte(hdl, locked)))
+	  && seek(hdl, _gmpOffset + 0x0D) && readUInt8(hdl, locked)))
 		return false;
 
 	// Tile bounds
@@ -52,8 +52,8 @@ bool TREFile::init()
 	if (!(seek(hdl, _gmpOffset + 0x15) && readInt24(hdl, north)
 	  && readInt24(hdl, east) && readInt24(hdl, south) && readInt24(hdl, west)))
 		return false;
-	_bounds = RectC(Coordinates(toWGS84(west), toWGS84(north)),
+	_bounds = RectC(Coordinates(toWGS24(west), toWGS24(north)),
-	  Coordinates(toWGS84(east), toWGS84(south)));
+	  Coordinates(toWGS24(east), toWGS24(south)));
 
 	// Levels & subdivs info
 	quint32 levelsOffset, levelsSize, subdivSize;
@@ -62,12 +62,15 @@ bool TREFile::init()
 	  && readUInt32(hdl, subdivSize)))
 		return false;
 
-	// TRE7 info
 	if (hdrLen > 0x9A) {
+		// TRE7 info
 		if (!(seek(hdl, _gmpOffset + 0x7C) && readUInt32(hdl, _extended.offset)
 		  && readUInt32(hdl, _extended.size)
 		  && readUInt16(hdl, _extended.itemSize)))
 			return false;
+		// flags
+		if (!(seek(hdl, _gmpOffset + 0x86) && readUInt32(hdl, _flags)))
+			return false;
 	}
 
 	// Tile levels
@@ -75,15 +78,13 @@ bool TREFile::init()
 		return false;
 	quint8 levels[64];
 	for (quint32 i = 0; i < levelsSize; i++)
-		if (!readByte(hdl, levels[i]))
+		if (!readUInt8(hdl, levels[i]))
 			return false;
 	if (locked) {
 		quint32 key;
-		quint8 unlocked[64];
 		if (!seek(hdl, _gmpOffset + 0xAA) || !readUInt32(hdl, key))
 			return false;
-		unlock(unlocked, levels, levelsSize, key);
+		demangle(levels, levelsSize, key);
-		memcpy(levels, unlocked, levelsSize);
 	}
 
 	quint32 levelsCount = levelsSize / 4;
@@ -107,12 +108,14 @@ bool TREFile::init()
 		}
 	}
 
+	_isBaseMap = baseMap;
+
 	return (_firstLevel >= 0);
 }
 
 bool TREFile::load(int idx)
 {
-	Handle hdl;
+	Handle hdl(this);
 	QList<SubDiv*> sl;
 	SubDiv *s = 0;
 	SubDivTree *tree = new SubDivTree();
@@ -128,15 +131,16 @@ bool TREFile::load(int idx)
 		return false;
 
 	for (int j = 0; j < _levels.at(idx).subdivs; j++) {
-		quint32 offset;
+		quint32 oo;
 		qint32 lon, lat;
-		quint8 objects;
 		quint16 width, height, nextLevel;
 
-		if (!(readUInt24(hdl, offset) && readByte(hdl, objects)
+		if (!(readUInt32(hdl, oo) && readInt24(hdl, lon) && readInt24(hdl, lat)
-		  && readInt24(hdl, lon) && readInt24(hdl, lat)
 		  && readUInt16(hdl, width) && readUInt16(hdl, height)))
 			goto error;
+		quint32 offset = oo & 0xfffffff;
+		quint8 objects = (((qint16)height < 0) << 4) | (oo >> 0x1c);
+
 		if (idx != _levels.size() - 1)
 			if (!readUInt16(hdl, nextLevel))
 				goto error;
@@ -148,13 +152,14 @@ bool TREFile::load(int idx)
 		width <<= (24 - _levels.at(idx).bits);
 		height <<= (24 - _levels.at(idx).bits);
 
+
 		s = new SubDiv(offset, lon, lat, _levels.at(idx).bits, objects);
 		sl.append(s);
 
 		double min[2], max[2];
-		RectC bounds(Coordinates(toWGS84(lon - width),
+		RectC bounds(Coordinates(toWGS24(lon - width),
-		  toWGS84(lat + height + 1)), Coordinates(toWGS84(lon + width + 1),
+		  toWGS24(lat + height + 1)), Coordinates(toWGS24(lon + width + 1),
-		  toWGS84(lat - height)));
+		  toWGS24(lat - height)));
 
 		min[0] = bounds.left();
 		min[1] = bounds.bottom();
@@ -196,7 +201,7 @@ bool TREFile::load(int idx)
 			if (i)
 				sl.at(i-1)->setExtEnds(polygons, lines, points);
 
-			if (!seek(hdl, hdl.pos + _extended.itemSize - 12))
+			if (!seek(hdl, hdl.pos() + _extended.itemSize - 12))
 				goto error;
 		}
 
@@ -233,10 +238,17 @@ void TREFile::clear()
 	_subdivs.clear();
 }
 
-int TREFile::level(int bits)
+int TREFile::level(int bits, bool baseMap)
 {
 	int idx = _firstLevel;
 
+	if (baseMap) {
+		if (!_isBaseMap && _levels.at(idx).bits > bits)
+			return -1;
+		if (_isBaseMap && bits > _levels.last().bits)
+			return -1;
+	}
+
 	for (int i = idx + 1; i < _levels.size(); i++) {
 		if (_levels.at(i).bits > bits)
 			break;
@@ -256,10 +268,10 @@ static bool cb(SubDiv *subdiv, void *context)
 	return true;
 }
 
-QList<SubDiv*> TREFile::subdivs(const RectC &rect, int bits)
+QList<SubDiv*> TREFile::subdivs(const RectC &rect, int bits, bool baseMap)
 {
 	QList<SubDiv*> list;
-	SubDivTree *tree = _subdivs.value(level(bits));
+	SubDivTree *tree = _subdivs.value(level(bits, baseMap));
 	double min[2], max[2];
 
 	min[0] = rect.left();

src/map/IMG/trefile.h

@@ -14,14 +14,17 @@ class TREFile : public SubFile
 {
 public:
 	TREFile(IMG *img) : SubFile(img) {}
+	TREFile(const QString &path) : SubFile(path) {}
 	TREFile(SubFile *gmp, quint32 offset) : SubFile(gmp, offset) {}
 	~TREFile();
 
-	bool init();
+	bool init(bool baseMap);
 	void clear();
 
 	const RectC &bounds() const {return _bounds;}
-	QList<SubDiv*> subdivs(const RectC &rect, int bits);
+	QList<SubDiv*> subdivs(const RectC &rect, int bits, bool baseMap);
+	quint32 shift(quint8 bits) const
+	  {return (bits == _levels.last().bits) ? (_flags >> 0xb) & 7 : 0;}
 
 private:
 	struct MapLevel {
@@ -39,7 +42,7 @@ private:
 	typedef RTree<SubDiv*, double, 2> SubDivTree;
 
 	bool load(int idx);
-	int level(int bits);
+	int level(int bits, bool baseMap);
 	bool parsePoly(Handle hdl, quint32 pos, const QMap<int, int> &level2bits,
 	  QMap<quint32, int> &map);
 	bool parsePoints(Handle hdl, quint32 pos, const QMap<int, int> &level2bits);
@@ -51,6 +54,8 @@ private:
 	quint32 _subdivOffset;
 	Extended _extended;
 	int _firstLevel;
+	quint32 _flags;
+	bool _isBaseMap;
 
 	QMap<int, SubDivTree*> _subdivs;
 };

src/map/IMG/units.h

@@ -1,11 +0,0 @@
-#ifndef UNITS_H
-#define UNITS_H
-
-inline double toWGS84(qint32 coord)
-{
-	return (coord < 0x800000)
-	  ? (double)coord * 360.0 / (double)(1<<24)
-	  : (double)(coord - 0x1000000) * 360.0 / (double)(1<<24);
-}
-
-#endif // UNITS_H

src/map/IMG/vectortile.cpp

@@ -1,5 +1,23 @@
 #include "vectortile.h"
 
+
+static void copyPolys(const RectC &rect, QList<IMG::Poly> *src,
+  QList<IMG::Poly> *dst)
+{
+	for (int i = 0; i < src->size(); i++)
+		if (rect.intersects(src->at(i).boundingRect))
+			dst->append(src->at(i));
+}
+
+static void copyPoints(const RectC &rect, QList<IMG::Point> *src,
+  QList<IMG::Point> *dst)
+{
+	for (int j = 0; j < src->size(); j++)
+		if (rect.contains(src->at(j).coordinates))
+			dst->append(src->at(j));
+}
+
+
 SubFile *VectorTile::file(SubFile::Type type)
 {
 	switch (type) {
@@ -41,12 +59,35 @@ SubFile *VectorTile::addFile(IMG *img, SubFile::Type type)
 	}
 }
 
-bool VectorTile::init()
+SubFile *VectorTile::addFile(const QString &path, SubFile::Type type)
+{
+	switch (type) {
+		case SubFile::TRE:
+			_tre = new TREFile(path);
+			return _tre;
+		case SubFile::RGN:
+			_rgn = new RGNFile(path);
+			return _rgn;
+		case SubFile::LBL:
+			_lbl = new LBLFile(path);
+			return _lbl;
+		case SubFile::NET:
+			_net = new NETFile(path);
+			return _net;
+		case SubFile::GMP:
+			_gmp = new SubFile(path);
+			return _gmp;
+		default:
+			return 0;
+	}
+}
+
+bool VectorTile::init(bool baseMap)
 {
 	if (_gmp && !initGMP())
 		return false;
 
-	if (!(_tre && _tre->init() && _rgn))
+	if (!(_tre && _tre->init(baseMap) && _rgn))
 		return false;
 
 	return true;
@@ -54,7 +95,7 @@ bool VectorTile::init()
 
 bool VectorTile::initGMP()
 {
-	SubFile::Handle hdl;
+	SubFile::Handle hdl(_gmp);
 	quint32 tre, rgn, lbl, net;
 
 	if (!(_gmp->seek(hdl, 0x19) && _gmp->readUInt32(hdl, tre)
@@ -62,39 +103,91 @@ bool VectorTile::initGMP()
 	  && _gmp->readUInt32(hdl, net)))
 		return false;
 
-	_tre = new TREFile(_gmp, tre);
+	_tre = tre ? new TREFile(_gmp, tre) : 0;
-	_rgn = new RGNFile(_gmp, rgn);
+	_rgn = rgn ? new RGNFile(_gmp, rgn) : 0;
-	_lbl = new LBLFile(_gmp, lbl);
+	_lbl = lbl ? new LBLFile(_gmp, lbl) : 0;
-	_net = new NETFile(_gmp, net);
+	_net = net ? new NETFile(_gmp, net) : 0;
 
 	return true;
 }
 
-void VectorTile::objects(const RectC &rect, int bits,
+void VectorTile::polys(const RectC &rect, int bits, bool baseMap,
   QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
-  QList<IMG::Point> *points) const
+  QCache<const SubDiv *, IMG::Polys> *polyCache) const
 {
-	QList<SubDiv*> subdivs = _tre->subdivs(rect, bits);
+	SubFile::Handle rgnHdl(_rgn), lblHdl(_lbl), netHdl(_net);
+
+	if (!_rgn->initialized() && !_rgn->init(rgnHdl))
+		return;
+
+	QList<SubDiv*> subdivs = _tre->subdivs(rect, bits, baseMap);
 	for (int i = 0; i < subdivs.size(); i++) {
-		_rgn->objects(rect, subdivs.at(i), _lbl, _net, polygons, lines, points);
+		SubDiv *subdiv = subdivs.at(i);
-		_rgn->extObjects(rect, subdivs.at(i), _lbl, polygons, lines,
+
-		  points);
+		IMG::Polys *polys = polyCache->object(subdiv);
+		if (!polys) {
+			quint32 shift = _tre->shift(subdiv->bits());
+			QList<IMG::Poly> p, l;
+
+			if (!subdiv->initialized() && !_rgn->subdivInit(rgnHdl, subdiv))
+				continue;
+
+			_rgn->polyObjects(rgnHdl, subdiv, RGNFile::Polygon, _lbl, lblHdl,
+			  _net, netHdl, &p);
+			_rgn->polyObjects(rgnHdl, subdiv, RGNFile::Line, _lbl, lblHdl,
+			  _net, netHdl, &l);
+			_rgn->extPolyObjects(rgnHdl, subdiv, shift, RGNFile::Polygon, _lbl,
+			  lblHdl, &p);
+			_rgn->extPolyObjects(rgnHdl, subdiv, shift, RGNFile::Line, _lbl,
+			  lblHdl, &l);
+
+			copyPolys(rect, &p, polygons);
+			copyPolys(rect, &l, lines);
+			polyCache->insert(subdiv, new IMG::Polys(p, l));
+		} else {
+			copyPolys(rect, &(polys->polygons), polygons);
+			copyPolys(rect, &(polys->lines), lines);
+		}
+	}
+}
+
+void VectorTile::points(const RectC &rect, int bits, bool baseMap,
+  QList<IMG::Point> *points, QCache<const SubDiv *,
+  QList<IMG::Point> > *pointCache) const
+{
+	SubFile::Handle rgnHdl(_rgn), lblHdl(_lbl);
+
+	if (!_rgn->initialized() && !_rgn->init(rgnHdl))
+		return;
+
+	QList<SubDiv*> subdivs = _tre->subdivs(rect, bits, baseMap);
+	for (int i = 0; i < subdivs.size(); i++) {
+		SubDiv *subdiv = subdivs.at(i);
+
+		QList<IMG::Point> *pl = pointCache->object(subdiv);
+		if (!pl) {
+			QList<IMG::Point> p;
+
+			if (!subdiv->initialized() && !_rgn->subdivInit(rgnHdl, subdiv))
+				continue;
+
+			_rgn->pointObjects(rgnHdl, subdiv, RGNFile::Point, _lbl, lblHdl,
+			  &p);
+			_rgn->pointObjects(rgnHdl, subdiv, RGNFile::IndexedPoint, _lbl,
+			  lblHdl, &p);
+			_rgn->extPointObjects(rgnHdl, subdiv, _lbl, lblHdl, &p);
+
+			copyPoints(rect, &p, points);
+			pointCache->insert(subdiv, new QList<IMG::Point>(p));
+		} else
+			copyPoints(rect, pl, points);
 	}
 }
 
 #ifndef QT_NO_DEBUG
 QDebug operator<<(QDebug dbg, const VectorTile &tile)
 {
-	dbg.nospace() << "VectorTile(";
+	dbg.nospace() << "VectorTile(" << tile.bounds() <<")";
-	if (tile._tre)
-		dbg << "TRE: " << *(tile._tre);
-	if (tile._rgn)
-		dbg << ", RGN: " << *(tile._rgn);
-	if (tile._lbl)
-		dbg << ", LBL: " << *(tile._lbl);
-	if (tile._net)
-		dbg << ", NET: " << *(tile._net);
-	dbg << ")";
 
 	return dbg.space();
 }

src/map/IMG/vectortile.h

@@ -1,7 +1,6 @@
 #ifndef VECTORTILE_H
 #define VECTORTILE_H
 
-#include "img.h"
 #include "trefile.h"
 #include "trefile.h"
 #include "rgnfile.h"
@@ -12,20 +11,32 @@ class VectorTile {
 public:
 	VectorTile() : _tre(0), _rgn(0), _lbl(0), _net(0), _gmp(0) {}
 	~VectorTile()
-	  {delete _tre; delete _rgn; delete _lbl; delete _net; delete _gmp;}
+	{
+		delete _tre; delete _rgn; delete _lbl; delete _net; delete _gmp;
+	}
 
-	bool init();
+	bool init(bool baseMap);
 	void clear() {_tre->clear();}
 
 	const RectC &bounds() const {return _tre->bounds();}
 
 	SubFile *file(SubFile::Type type);
 	SubFile *addFile(IMG *img, SubFile::Type type);
+	SubFile *addFile(const QString &path, SubFile::Type type);
 
-	void objects(const RectC &rect, int bits, QList<IMG::Poly> *polygons,
+	void polys(const RectC &rect, int bits, bool baseMap,
-	  QList<IMG::Poly> *lines, QList<IMG::Point> *points) const;
+	  QList<IMG::Poly> *polygons, QList<IMG::Poly> *lines,
+	  QCache<const SubDiv *, IMG::Polys> *polyCache) const;
+	void points(const RectC &rect, int bits, bool baseMap,
+	  QList<IMG::Point> *points, QCache<const SubDiv*,
+	  QList<IMG::Point> > *pointCache) const;
 
-	friend QDebug operator<<(QDebug dbg, const VectorTile &tile);
+	static bool isTileFile(SubFile::Type type)
+	{
+		return (type == SubFile::TRE || type == SubFile::LBL
+		  || type == SubFile::RGN || type == SubFile::NET
+		  || type == SubFile::GMP);
+	}
 
 private:
 	bool initGMP();

src/map/albersequal.cpp

@@ -104,10 +104,10 @@ AlbersEqual::AlbersEqual(const Ellipsoid *ellipsoid, double standardParallel1,
 	} else
 		_n = sin_lat1;
 
-	_C = sqr_m1 + _n * q1;
+	_c = sqr_m1 + _n * q1;
 	_a_over_n = ellipsoid->radius() / _n;
 	nq0 = _n * q0;
-	_rho0 = (_C < nq0) ? 0 : _a_over_n * sqrt(_C - nq0);
+	_rho0 = (_c < nq0) ? 0 : _a_over_n * sqrt(_c - nq0);
 }
 
 PointD AlbersEqual::ll2xy(const Coordinates &c) const
@@ -131,7 +131,7 @@ PointD AlbersEqual::ll2xy(const Coordinates &c) const
 	e_sin = _e * sin_lat;
 	q = ALBERS_Q(sin_lat, ONE_MINUS_SQR(e_sin), e_sin);
 	nq = _n * q;
-	rho = (_C < nq) ? 0 : _a_over_n * sqrt(_C - nq);
+	rho = (_c < nq) ? 0 : _a_over_n * sqrt(_c - nq);
 	theta = _n * dlam;
 
 	return PointD(rho * sin(theta) + _falseEasting,
@@ -168,7 +168,7 @@ Coordinates AlbersEqual::xy2ll(const PointD &p) const
 	if (rho != 0.0)
 		theta = atan2(dx, rho0_minus_dy);
 	rho_n = rho * _n;
-	q = (_C - (rho_n * rho_n) / _a2) / _n;
+	q = (_c - (rho_n * rho_n) / _a2) / _n;
 	qc = 1 - ((_one_minus_es) / (_two_e)) * log((1.0 - _e) / (1.0 + _e));
 	if (fabs(fabs(qc) - fabs(q)) > 1.0e-6) {
 		q_over_2 = q / 2.0;

src/map/albersequal.h

@@ -25,7 +25,7 @@ private:
 
 	double _a2;
 	double _rho0;
-	double _C;
+	double _c;
 	double _n;
 	double _e;
 	double _es;

src/map/imgmap.cpp

@@ -1,5 +1,6 @@
 #include <QFile>
 #include <QPainter>
+#include <QFont>
 #include <QPixmapCache>
 #if QT_VERSION < QT_VERSION_CHECK(5, 0, 0)
 #include <QtCore>
@@ -8,9 +9,13 @@
 #endif // QT_VERSION < 5
 #include "common/rectc.h"
 #include "common/wgs84.h"
+#include "common/range.h"
 #include "IMG/textpathitem.h"
 #include "IMG/textpointitem.h"
 #include "IMG/bitmapline.h"
+#include "IMG/style.h"
+#include "IMG/img.h"
+#include "IMG/gmap.h"
 #include "pcs.h"
 #include "rectd.h"
 #include "imgmap.h"
@@ -33,18 +38,19 @@ public:
 	const QString &key() const {return _key;}
 	const QPoint &xy() const {return _xy;}
 	QImage &img() {return _img;}
-	QList<IMG::Poly> &polygons() {return _polygons;}
+	QList<MapData::Poly> &polygons() {return _polygons;}
-	QList<IMG::Poly> &lines() {return _lines;}
+	QList<MapData::Poly> &lines() {return _lines;}
-	QList<IMG::Point> &points() {return _points;}
+	QList<MapData::Point> &points() {return _points;}
 
 	void render()
 	{
 		QList<TextItem*> textItems;
 
-		_map->processPolygons(_polygons);
+		QRect tileRect(_xy, QSize(TILE_SIZE, TILE_SIZE));
+
 		_map->processPoints(_points, textItems);
-		_map->processLines(_lines, QRect(_xy, QSize(TILE_SIZE, TILE_SIZE)),
+		_map->processPolygons(_polygons, textItems);
-		  textItems);
+		_map->processLines(_lines, tileRect, textItems);
 
 		_img.fill(Qt::transparent);
 
@@ -67,9 +73,9 @@ private:
 	QPoint _xy;
 	QString _key;
 	QImage _img;
-	QList<IMG::Poly> _polygons;
+	QList<MapData::Poly> _polygons;
-	QList<IMG::Poly> _lines;
+	QList<MapData::Poly> _lines;
-	QList<IMG::Point> _points;
+	QList<MapData::Point> _points;
 };
 
 
@@ -172,7 +178,7 @@ static int minShieldZoom(Label::Shield::Type type)
 	switch (type) {
 		case Label::Shield::USInterstate:
 		case Label::Shield::Hbox:
-			return 18;
+			return 17;
 		case Label::Shield::USShield:
 		case Label::Shield::Box:
 			return 19;
@@ -184,12 +190,56 @@ static int minShieldZoom(Label::Shield::Type type)
 	}
 }
 
+static qreal area(const QVector<QPointF> &polygon)
+{
+	qreal area = 0;
+
+	for (int i = 0; i < polygon.size(); i++) {
+		int j = (i + 1) % polygon.size();
+		area += polygon.at(i).x() * polygon.at(j).y();
+		area -= polygon.at(i).y() * polygon.at(j).x();
+	}
+	area /= 2.0;
+
+   return area;
+}
+
+static QPointF centroid(const QVector<QPointF> &polygon)
+{
+	qreal cx = 0, cy = 0;
+	qreal factor = 1.0 / (6.0 * area(polygon));
+
+	for (int i = 0; i < polygon.size(); i++) {
+		int j = (i + 1) % polygon.size();
+		qreal f = (polygon.at(i).x() * polygon.at(j).y() - polygon.at(j).x()
+		  * polygon.at(i).y());
+		cx += (polygon.at(i).x() + polygon.at(j).x()) * f;
+		cy += (polygon.at(i).y() + polygon.at(j).y()) * f;
+	}
+
+	return QPointF(cx * factor, cy * factor);
+}
+
+static bool rectNearPolygon(const QPolygonF &polygon, const QRectF &rect)
+{
+	return (polygon.boundingRect().contains(rect)
+	  && (polygon.containsPoint(rect.topLeft(), Qt::OddEvenFill)
+	  || polygon.containsPoint(rect.topRight(), Qt::OddEvenFill)
+	  || polygon.containsPoint(rect.bottomLeft(), Qt::OddEvenFill)
+	  || polygon.containsPoint(rect.bottomRight(), Qt::OddEvenFill)));
+}
+
 
 IMGMap::IMGMap(const QString &fileName, QObject *parent)
-  : Map(parent), _img(fileName), _projection(PCS::pcs(3857)), _valid(false)
+  : Map(parent), _projection(PCS::pcs(3857)), _valid(false)
 {
-	if (!_img.isValid()) {
+	if (GMAP::isGMAP(fileName))
-		_errorString = _img.errorString();
+		_data = new GMAP(fileName);
+	else
+		_data = new IMG(fileName);
+
+	if (!_data->isValid()) {
+		_errorString = _data->errorString();
 		return;
 	}
 
@@ -201,17 +251,17 @@ IMGMap::IMGMap(const QString &fileName, QObject *parent)
 
 void IMGMap::load()
 {
-	_img.load();
+	_data->load();
 }
 
 void IMGMap::unload()
 {
-	_img.clear();
+	_data->clear();
 }
 
 QRectF IMGMap::bounds()
 {
-	RectD prect(_img.bounds(), _projection);
+	RectD prect(_data->bounds(), _projection);
 	return QRectF(_transform.proj2img(prect.topLeft()),
 	  _transform.proj2img(prect.bottomRight()));
 }
@@ -261,7 +311,7 @@ Transform IMGMap::transform(int zoom) const
 {
 	double scale = _projection.isGeographic()
 	  ? 360.0 / (1<<zoom) : (2.0 * M_PI * WGS84_RADIUS) / (1<<zoom);
-	PointD topLeft(_projection.ll2xy(_img.bounds().topLeft()));
+	PointD topLeft(_projection.ll2xy(_data->bounds().topLeft()));
 	return Transform(ReferencePoint(PointD(0, 0), topLeft),
 	  PointD(scale, scale));
 }
@@ -281,15 +331,14 @@ Coordinates IMGMap::xy2ll(const QPointF &p)
 	return _projection.xy2ll(_transform.img2proj(p));
 }
 
-
+void IMGMap::drawPolygons(QPainter *painter, const QList<MapData::Poly> &polygons)
-void IMGMap::drawPolygons(QPainter *painter, const QList<IMG::Poly> &polygons)
 {
-	for (int n = 0; n < _img.style()->drawOrder().size(); n++) {
+	for (int n = 0; n < _data->style()->drawOrder().size(); n++) {
 		for (int i = 0; i < polygons.size(); i++) {
-			const IMG::Poly &poly = polygons.at(i);
+			const MapData::Poly &poly = polygons.at(i);
-			if (poly.type != _img.style()->drawOrder().at(n))
+			if (poly.type != _data->style()->drawOrder().at(n))
 				continue;
-			const Style::Polygon &style = _img.style()->polygon(poly.type);
+			const Style::Polygon &style = _data->style()->polygon(poly.type);
 
 			painter->setPen(style.pen());
 			painter->setBrush(style.brush());
@@ -298,13 +347,13 @@ void IMGMap::drawPolygons(QPainter *painter, const QList<IMG::Poly> &polygons)
 	}
 }
 
-void IMGMap::drawLines(QPainter *painter, const QList<IMG::Poly> &lines)
+void IMGMap::drawLines(QPainter *painter, const QList<MapData::Poly> &lines)
 {
 	painter->setBrush(Qt::NoBrush);
 
 	for (int i = 0; i < lines.size(); i++) {
-		const IMG::Poly &poly = lines.at(i);
+		const MapData::Poly &poly = lines.at(i);
-		const Style::Line &style = _img.style()->line(poly.type);
+		const Style::Line &style = _data->style()->line(poly.type);
 
 		if (style.background() == Qt::NoPen)
 			continue;
@@ -314,8 +363,8 @@ void IMGMap::drawLines(QPainter *painter, const QList<IMG::Poly> &lines)
 	}
 
 	for (int i = 0; i < lines.size(); i++) {
-		const IMG::Poly &poly = lines.at(i);
+		const MapData::Poly &poly = lines.at(i);
-		const Style::Line &style = _img.style()->line(poly.type);
+		const Style::Line &style = _data->style()->line(poly.type);
 
 		if (!style.img().isNull())
 			BitmapLine::draw(painter, poly.points, style.img());
@@ -332,25 +381,42 @@ void IMGMap::drawTextItems(QPainter *painter, const QList<TextItem*> &textItems)
 		textItems.at(i)->paint(painter);
 }
 
-
+void IMGMap::processPolygons(QList<MapData::Poly> &polygons,
-void IMGMap::processPolygons(QList<IMG::Poly> &polygons)
+  QList<TextItem*> &textItems)
 {
 	for (int i = 0; i < polygons.size(); i++) {
-		IMG::Poly &poly = polygons[i];
+		MapData::Poly &poly = polygons[i];
 		for (int j = 0; j < poly.points.size(); j++) {
 			QPointF &p = poly.points[j];
 			p = ll2xy(Coordinates(p.x(), p.y()));
 		}
+
+		if (poly.label.text().isEmpty())
+			continue;
+
+		if (_zoom <= 23 && (Style::isWaterArea(poly.type)
+		  || Style::isMilitaryArea(poly.type)
+		  || Style::isNatureReserve(poly.type))) {
+			const Style::Polygon &style = _data->style()->polygon(poly.type);
+			TextPointItem *item = new TextPointItem(
+			  centroid(poly.points).toPoint(), &poly.label.text(),
+			  poiFont(), 0, &style.brush().color());
+			if (item->isValid() && !item->collides(textItems)
+			  && rectNearPolygon(poly.points, item->boundingRect()))
+				textItems.append(item);
+			else
+				delete item;
+		}
 	}
 }
 
-void IMGMap::processLines(QList<IMG::Poly> &lines, const QRect &tileRect,
+void IMGMap::processLines(QList<MapData::Poly> &lines, const QRect &tileRect,
   QList<TextItem*> &textItems)
 {
 	qStableSort(lines);
 
 	for (int i = 0; i < lines.size(); i++) {
-		IMG::Poly &poly = lines[i];
+		MapData::Poly &poly = lines[i];
 		for (int j = 0; j < poly.points.size(); j++) {
 			QPointF &p = poly.points[j];
 			p = ll2xy(Coordinates(p.x(), p.y()));
@@ -362,12 +428,12 @@ void IMGMap::processLines(QList<IMG::Poly> &lines, const QRect &tileRect,
 	processShields(lines, tileRect, textItems);
 }
 
-void IMGMap::processStreetNames(QList<IMG::Poly> &lines, const QRect &tileRect,
+void IMGMap::processStreetNames(QList<MapData::Poly> &lines,
-  QList<TextItem*> &textItems)
+  const QRect &tileRect, QList<TextItem*> &textItems)
 {
 	for (int i = 0; i < lines.size(); i++) {
-		IMG::Poly &poly = lines[i];
+		MapData::Poly &poly = lines[i];
-		const Style::Line &style = _img.style()->line(poly.type);
+		const Style::Line &style = _data->style()->line(poly.type);
 
 		if (style.img().isNull() && style.foreground() == Qt::NoPen)
 			continue;
@@ -391,7 +457,7 @@ void IMGMap::processStreetNames(QList<IMG::Poly> &lines, const QRect &tileRect,
 	}
 }
 
-void IMGMap::processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
+void IMGMap::processShields(QList<MapData::Poly> &lines, const QRect &tileRect,
   QList<TextItem*> &textItems)
 {
 	for (int type = FIRST_SHIELD; type <= LAST_SHIELD; type++) {
@@ -402,7 +468,7 @@ void IMGMap::processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
 		QHash<Label::Shield, const Label::Shield*> sp;
 
 		for (int i = 0; i < lines.size(); i++) {
-			const IMG::Poly &poly = lines.at(i);
+			const MapData::Poly &poly = lines.at(i);
 			const Label::Shield &shield = poly.label.shield();
 			if (!shield.isValid() || shield.type() != type
 			  || !Style::isMajorRoad(poly.type))
@@ -455,14 +521,14 @@ void IMGMap::processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
 	}
 }
 
-void IMGMap::processPoints(QList<IMG::Point> &points,
+void IMGMap::processPoints(QList<MapData::Point> &points,
   QList<TextItem*> &textItems)
 {
 	qSort(points);
 
 	for (int i = 0; i < points.size(); i++) {
-		IMG::Point &point = points[i];
+		MapData::Point &point = points[i];
-		const Style::Point &style = _img.style()->point(point.type);
+		const Style::Point &style = _data->style()->point(point.type);
 
 		if (point.poi && _zoom < minPOIZoom(Style::poiClass(point.type)))
 			continue;
@@ -516,7 +582,7 @@ void IMGMap::draw(QPainter *painter, const QRectF &rect, Flags flags)
 		for (int j = 0; j < height; j++) {
 			QPixmap pm;
 			QPoint ttl(tl.x() + i * TILE_SIZE, tl.y() + j * TILE_SIZE);
-			QString key = _img.fileName() + "-" + QString::number(_zoom) + "_"
+			QString key = _data->fileName() + "-" + QString::number(_zoom) + "_"
 			  + QString::number(ttl.x()) + "_" + QString::number(ttl.y());
 			if (QPixmapCache::find(key, pm))
 				painter->drawPixmap(ttl, pm);
@@ -526,13 +592,14 @@ void IMGMap::draw(QPainter *painter, const QRectF &rect, Flags flags)
 
 				RectD polyRect(_transform.img2proj(ttl), _transform.img2proj(
 				  QPointF(ttl.x() + TILE_SIZE, ttl.y() + TILE_SIZE)));
-				_img.objects(polyRect.toRectC(_projection, 4), _zoom,
+				_data->polys(polyRect.toRectC(_projection, 4), _zoom,
-				  &(tile.polygons()), &(tile.lines()), 0);
+				  &(tile.polygons()), &(tile.lines()));
+
 				RectD pointRect(_transform.img2proj(QPointF(ttl.x() - TEXT_EXTENT,
 				  ttl.y() - TEXT_EXTENT)), _transform.img2proj(QPointF(ttl.x()
 				  + TILE_SIZE + TEXT_EXTENT, ttl.y() + TILE_SIZE + TEXT_EXTENT)));
-				_img.objects(pointRect.toRectC(_projection, 4), _zoom,
+				_data->points(pointRect.toRectC(_projection, 4), _zoom,
-				  0, 0, &(tile.points()));
+				  &(tile.points()));
 			}
 		}
 	}

src/map/imgmap.h

@@ -1,12 +1,10 @@
 #ifndef IMGMAP_H
 #define IMGMAP_H
 
-#include <QFont>
 #include "map.h"
 #include "projection.h"
 #include "transform.h"
-#include "common/range.h"
+#include "IMG/mapdata.h"
-#include "IMG/img.h"
 
 class TextItem;
 
@@ -16,8 +14,9 @@ class IMGMap : public Map
 
 public:
 	IMGMap(const QString &fileName, QObject *parent = 0);
+	~IMGMap() {delete _data;}
 
-	QString name() const {return _img.name();}
+	QString name() const {return _data->name();}
 
 	QRectF bounds();
 
@@ -45,20 +44,21 @@ private:
 
 	Transform transform(int zoom) const;
 	void updateTransform();
-	void drawPolygons(QPainter *painter, const QList<IMG::Poly> &polygons);
+	void drawPolygons(QPainter *painter, const QList<MapData::Poly> &polygons);
-	void drawLines(QPainter *painter, const QList<IMG::Poly> &lines);
+	void drawLines(QPainter *painter, const QList<MapData::Poly> &lines);
 	void drawTextItems(QPainter *painter, const QList<TextItem*> &textItems);
 
-	void processPolygons(QList<IMG::Poly> &polygons);
+	void processPolygons(QList<MapData::Poly> &polygons,
-	void processLines(QList<IMG::Poly> &lines, const QRect &tileRect,
+	  QList<TextItem *> &textItems);
+	void processLines(QList<MapData::Poly> &lines, const QRect &tileRect,
 	  QList<TextItem*> &textItems);
-	void processPoints(QList<IMG::Point> &points, QList<TextItem*> &textItems);
+	void processPoints(QList<MapData::Point> &points, QList<TextItem*> &textItems);
-	void processShields(QList<IMG::Poly> &lines, const QRect &tileRect,
+	void processShields(QList<MapData::Poly> &lines, const QRect &tileRect,
 	  QList<TextItem*> &textItems);
-	void processStreetNames(QList<IMG::Poly> &lines, const QRect &tileRect,
+	void processStreetNames(QList<MapData::Poly> &lines, const QRect &tileRect,
 	  QList<TextItem*> &textItems);
 
-	IMG _img;
+	MapData *_data;
 	int _zoom;
 	Projection _projection;
 	Transform _transform;

src/map/krovak.cpp

@@ -15,16 +15,16 @@ Krovak::Krovak(const Ellipsoid *ellipsoid, double standardParallel,
 
 	_phiP = deg2rad(standardParallel);
 	_e = sqrt(ellipsoid->es());
-	_A = ellipsoid->radius() * sqrt(1.0 - ellipsoid->es())
+	_a = ellipsoid->radius() * sqrt(1.0 - ellipsoid->es())
 	  / (1.0 - ellipsoid->es() * sinPhiC2);
-	_B = sqrt(1.0 + (ellipsoid->es() * cosPhiC4 / (1.0 - ellipsoid->es())));
+	_b = sqrt(1.0 + (ellipsoid->es() * cosPhiC4 / (1.0 - ellipsoid->es())));
-	double gamma0 = asin(sinPhiC / _B);
+	double gamma0 = asin(sinPhiC / _b);
 	_t0 = tan(M_PI_4 + gamma0 / 2.0) * pow((1.0 + _e * sinPhiC) /
-	  (1.0 - _e * sinPhiC), _e*_B / 2.0) / pow(tan(M_PI_4 + phiC/2.0), _B);
+	  (1.0 - _e * sinPhiC), _e*_b / 2.0) / pow(tan(M_PI_4 + phiC/2.0), _b);
 	_n = sin(_phiP);
-	_r0 = scale * _A / tan(_phiP);
+	_r0 = scale * _a / tan(_phiP);
-	_FE = falseEasting;
+	_fe = falseEasting;
-	_FN = falseNorthing;
+	_fn = falseNorthing;
 	_cosAlphaC = cos(alphaC);
 	_sinAlphaC = sin(alphaC);
 	_lambda0 = deg2rad(longitudeOrigin);
@@ -35,23 +35,23 @@ PointD Krovak::ll2xy(const Coordinates &c) const
 	double phi = deg2rad(c.lat());
 	double lambda = deg2rad(c.lon());
 	double eSinPhi = _e * sin(phi);
-	double U = 2.0 * (atan(_t0 * pow(tan(phi/2.0 + M_PI_4), _B)
+	double U = 2.0 * (atan(_t0 * pow(tan(phi/2.0 + M_PI_4), _b)
-	  / pow((1.0 + eSinPhi) / (1.0 - eSinPhi), _e * _B/2.0)) - M_PI_4);
+	  / pow((1.0 + eSinPhi) / (1.0 - eSinPhi), _e * _b/2.0)) - M_PI_4);
 	double cosU = cos(U);
-	double V = _B * (_lambda0 - lambda);
+	double V = _b * (_lambda0 - lambda);
 	double T = asin(_cosAlphaC * sin(U) + _sinAlphaC * cosU * cos(V));
 	double D = asin(cosU * sin(V) / cos(T));
 	double theta = _n * D;
 	double r = _r0 * pow(tan(M_PI_4 + _phiP/2.0), _n)
 	  / pow(tan(T/2.0 + M_PI_4), _n);
 
-	return PointD(r * sin(theta) + _FE, r * cos(theta) + _FN);
+	return PointD(r * sin(theta) + _fe, r * cos(theta) + _fn);
 }
 
 Coordinates Krovak::xy2ll(const PointD &p) const
 {
-	double Xp = p.y() - _FN;
+	double Xp = p.y() - _fn;
-	double Yp = p.x() - _FE;
+	double Yp = p.x() - _fe;
 	double Xp2 = Xp * Xp;
 	double Yp2 = Yp * Yp;
 	double r = sqrt(Xp2 + Yp2);
@@ -63,8 +63,8 @@ Coordinates Krovak::xy2ll(const PointD &p) const
 	double V = asin(cos(T) * sin(D) / cos(U));
 	double phi = U;
 	for (int i = 0; i < 3; i++)
-		phi = 2.0 * (atan(pow(_t0, -1.0/_B) * pow(tan(U/2.0 + M_PI_4), 1.0/_B)
+		phi = 2.0 * (atan(pow(_t0, -1.0/_b) * pow(tan(U/2.0 + M_PI_4), 1.0/_b)
 		  * pow((1.0 + _e * sin(phi))/(1.0 - _e * sin(phi)), _e/2.0)) - M_PI_4);
 
-	return Coordinates(rad2deg(_lambda0 - V/_B), rad2deg(phi));
+	return Coordinates(rad2deg(_lambda0 - V/_b), rad2deg(phi));
 }